Nitrobenzoic acids and derivatives
Medchemexpress LLC 2-nitrobenzoic acid | 552-16-9 | MFCD00007137 | 99.96% | 167.12 | C7H5NO4 | 1000g
2-Nitrobenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research
=O | 25g | 439372238](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502187101.JPG-250.jpg)
eMolecules 42564-41-0 | 4-(Methylamino)-3-nitrobenzaldehyde | Combi-Blocks | MFCD03964545 | 180.163 | C8H8N2O3 | 98.000 | CNc1ccc(C=O)cc1[N+]([O-])=O | 25g | 439372238
4-(Methylamino)-3-nitrobenzaldehyde | Combi-Blocks | 42564-41-0 | MFCD03964545 | 180.163 | C8H8N2O3 | 98.000 | CNc1ccc(C=O)cc1[N+]([O-])=O | 25g | 439372238
=O)C#N | 1g | 205393249](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502192205.JPG-250.jpg)
eMolecules 320406-01-7 | 4-(t-Butylamino)-3-nitrobenzonitrile | Combi-Blocks | MFCD03551828 | 219.244 | C11H13N3O2 | 98.000 | CC(C)(C)Nc1ccc(cc1[N+]([O-])=O)C#N | 1g | 205393249
4-(t-Butylamino)-3-nitrobenzonitrile | Combi-Blocks | 320406-01-7 | MFCD03551828 | 219.244 | C11H13N3O2 | 98.000 | CC(C)(C)Nc1ccc(cc1[N+]([O-])=O)C#N | 1g | 205393249
Aobchem 1-Isopropoxy-3-methyl-2-nitrobenzene | 97% | CAS 187471-35-8 | C10H13NO3 | 500mg
1-Isopropoxy-3-methyl-2-nitrobenzene | 97% | CAS 187471-35-8 | C10H13NO3 | 500mg
Chemscene ChemScene | Methyl 2-bromo-5-nitrobenzoate | 500G | CS-W012516 | 0.98 | 6942-36-5| MFCD00010867 | 260.043
ChemScene | Methyl 2-bromo-5-nitrobenzoate | 500G | CS-W012516 | 0.98 | 6942-36-5| MFCD00010867 | 260.043
Accela Chembio Inc Methyl 5-methyl-2-nitrobenzoate | 25g | 20587-30-8 | MFCD00157275 | 97+% | Shelf Life: 1260 Days | Regular
Methyl 5-methyl-2-nitrobenzoate | 25g | 20587-30-8 | MFCD00157275 | 97+% | Shelf Life: 1260 Days | Regular
Accela Chembio Inc 2-methyl-6-nitrobenzoic Acid | 100g | 13506-76-8 | MFCD00007267 | 97+% | Shelf Life: 1260 Days | Regular
2-methyl-6-nitrobenzoic Acid | 100g | 13506-76-8 | MFCD00007267 | 97+% | Shelf Life: 1260 Days | Regular
Chemscene ChemScene | 4-Iodo-3-nitrobenzoic acid | 10G | CS-W002638 | 0.98 | 35674-27-2| MFCD00502399 | 293.016
ChemScene | 4-Iodo-3-nitrobenzoic acid | 10G | CS-W002638 | 0.98 | 35674-27-2| MFCD00502399 | 293.016
AdipoGen DTNB, 69-78-3, MFCD00007140, 1 g
MF: C14H8N2O8S2, MW: 396.35, ≥98%, Appearance: Yellow powder. A sensitive reagent for measuring the free sulfhydryl content in proteins, peptides, and tissues. Used to characterize reactive thiol groups and photometric determination of thiols and for measuring low-molecular mass thiols such as glutathione in both pure solutions and biological samples, such as blood. It can also measure the number of thiol groups on proteins.
eMolecules 773109-32-3 | 2-AMINO-3-CHLORO-5-NITROBENZOIC ACID | MFCD06208323 | 1g
WuXi ChemSupply | 2-AMINO-3-CHLORO-5-NITROBENZOIC ACID | 1g | 599170767 | LN03282369 | 95.000 | 773109-32-3 | MFCD06208323 | 216.580 | C7H5ClN2O4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool