Nitrobenzoic acids and derivatives
=O | 1g | 282984044](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502455122.PNG-250.jpg)
eMolecules 54064-39-0 | ETHYL 3-METHYL-2-NITROBENZOATE | AstaTech | MFCD11111006 | 209.201 | C10H11NO4 | 95.000 | CCOC(=O)c1cccc(C)c1[N+]([O-])=O | 1g | 282984044
ETHYL 3-METHYL-2-NITROBENZOATE | AstaTech | 54064-39-0 | MFCD11111006 | 209.201 | C10H11NO4 | 95.000 | CCOC(=O)c1cccc(C)c1[N+]([O-])=O | 1g | 282984044
=O | 1g | 596058455](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502182526.JPG-250.jpg)
eMolecules 889124-99-6 | TERT-BUTYL 4-(2-NITROBENZOYL)TETRAHYDRO-1(2H)-PYRAZINECARBOXYLATE | AstaTech | MFCD09149298 | 335.360 | C16H21N3O5 | 95.000 | CC(C)(C)OC(=O)N1CCN(CC1)C(=O)c1ccccc1[N+]([O-])=O | 1g | 596058455
TERT-BUTYL 4-(2-NITROBENZOYL)TETRAHYDRO-1(2H)-PYRAZINECARBOXYLATE | AstaTech | 889124-99-6 | MFCD09149298 | 335.360 | C16H21N3O5 | 95.000 | CC(C)(C)OC(=O)N1CCN(CC1)C(=O)c1ccccc1[N+]([O-])=O | 1g | 596058455
Chem-Impex International, Inc. 4-Nitrobenzoic acid | 62-23-7 | MFCD00007352 | 100G
4-Nitrobenzoic acid, 62-23-7, MFCD00007352, 100G
Accela Chembio Inc MF: C8H7NO5 | MW: 197.14 | >97% | BP: 388.2? at 760 mmHg.
MF: C8H7NO5 | MW: 197.14 | >97% | BP: 388.2? at 760 mmHg.
Chem-Impex International, Inc. 4-Bromomethyl-3-nitrobenzoic acid | MFCD00216575 | 25G
4-Bromomethyl-3-nitrobenzoic acid, MFCD00216575, 25G
eMolecules 3898-66-6 | Ambeed | 2-(Carboxymethyl)-5-nitrobenzoic acid | 1g | 525095318 | A178226 | MFCD04035583 | 225.156 | C9H7NO6
Ambeed | 2-Amino-9-((2R4S5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-3H-purine-68(7H9H)-dione | 100mg | 491610728 | A116167 | 88847-89-6 | MFCD28101734 | 283.244 | C10H13N5O5
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Medchemexpress LLC 3-nitrobenzoic acid | 121-92-6 | MFCD00007251 | 99.2% | 167.12 g/mol | C7H5NO4 | 500g
3-Nitrobenzoic acid (m-Carboxynitrobenzene m-Nitrobenzenecarboxylic acid m-Nitrobenzoic acid) is an antioxidant and antibacterial agent that can kill bacteria and fungi 3-Nitrobenzoic acid can be degraded or reduced by certain bacteria (such as Pseudomonas) and fungi (such as white rot fungi) into aldehydes and alcohols[1][2]
eMolecules 4315-09-7 | Ambeed | 4-Nitroisophthalic acid | 5g | 552520601 | A104572 | 211.129 | C8H5NO6
Ambeed | 7-Bromochroman | 100mg | 490541143 | A238227 | 941710-30-1 | MFCD22536189 | 213.074 | C9H9BrO
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Aobchem N-(4-methoxybenzyl)-4-nitrobenzenesulfonamide | 95% | CAS 171414-17-8 | C14H14N2O5S | 5g
N-(4-methoxybenzyl)-4-nitrobenzenesulfonamide | 95% | CAS 171414-17-8 | C14H14N2O5S | 5g
Aobchem N-(4-methoxybenzyl)-4-nitrobenzenesulfonamide | 95% | CAS 171414-17-8 | C14H14N2O5S | 1g
N-(4-methoxybenzyl)-4-nitrobenzenesulfonamide | 95% | CAS 171414-17-8 | C14H14N2O5S | 1g
Enzo Life Sciences Ellmans Reagent (5g). CAS: 69-78-3
A sensitive sulfhydryl reagent. Alternative name: 5,5-Dithio-bis(2-nitrobenzoic acid), DTNB. Purity: ≥98% (Titration). Solubility: Soluble in 100% ethanol or dioxane. Long Term Storage: +4°C.
=O | 1g | 528672778](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502191237.JPG-250.jpg)
eMolecules 69642-00-8 | 1-(1-Bromoethyl)-2-nitrobenzene | Combi-Blocks | MFCD11103117 | 230.061 | C8H8BrNO2 | 95.000 | CC(Br)c1ccccc1[N+]([O-])=O | 1g | 528672778
1-(1-Bromoethyl)-2-nitrobenzene | Combi-Blocks | 69642-00-8 | MFCD11103117 | 230.061 | C8H8BrNO2 | 95.000 | CC(Br)c1ccccc1[N+]([O-])=O | 1g | 528672778
Aobchem N-(4-methoxybenzyl)-4-nitrobenzenesulfonamide | 95% | CAS 171414-17-8 | C14H14N2O5S | 500mg
N-(4-methoxybenzyl)-4-nitrobenzenesulfonamide | 95% | CAS 171414-17-8 | C14H14N2O5S | 500mg
Accela Chembio Inc 2-nitroisophthalic Acid | 25g | 21161-11-5 | MFCD00017007 | 97+% | Shelf Life: 1440 Days | Regular
2-nitroisophthalic Acid | 25g | 21161-11-5 | MFCD00017007 | 97+% | Shelf Life: 1440 Days | Regular