Phenylphosphines and derivatives
Aobchem 3-Bromo-4-(methoxymethyl)pyridine | ≥95% | CAS 1357095-16-9 | C7H8BrNO | 5g
3-Bromo-4-(methoxymethyl)pyridine | ≥95% | CAS 1357095-16-9 | C7H8BrNO | 5g
Aobchem 4-Chloro-1-(methoxymethyl)-2-(trifluoromethyl)benzene | ≥97% | CAS 1824603-79-3 | C9H8ClF3O | 500mg
4-Chloro-1-(methoxymethyl)-2-(trifluoromethyl)benzene | ≥97% | CAS 1824603-79-3 | C9H8ClF3O | 500mg
![Strem, An Ascensus Company CAS# 135139-00-3. 1g. (S)-(-)-2,2'-Bis[di(3,5-xylyl)phosphino]-1,1'-binaphthyl, 98% (S)-(-)-XylBINAP. MFCD01630821](https://assets.fishersci.com/TFS-Assets/CCG/product-images/VN00009818-15-0477.JPG-250.jpg)
Strem, An Ascensus Company CAS# 135139-00-3. 1g. (S)-(-)-2,2'-Bis[di(3,5-xylyl)phosphino]-1,1'-binaphthyl, 98% (S)-(-)-XylBINAP. MFCD01630821
CAS# 135139-00-3. 1g. (S)-(-)-2,2'-Bis[di(3,5-xylyl)phosphino]-1,1'-binaphthyl, 98% (S)-(-)-XylBINAP. MFCD01630821. Molecular Weight: 734.90. Molecular Formula: C52H48P2. Color/form: white to pale yellow xtl. Strem# 15-0477. http://www.strem.com/catalog/v/15-0477/
Aobchem -Cyclopropyl-2-(methoxymethyl)benzenemethanol | 95% | CAS 1467345-00-1 | C12H16O2 | 250mg
-Cyclopropyl-2-(methoxymethyl)benzenemethanol | 95% | CAS 1467345-00-1 | C12H16O2 | 250mg
![eMolecules 298693-03-5 | ChemScene | (4S4S)-22-Cyclopentylidenebis[4-tert-butyl-45-dihydrooxazole] | 100mg | 487935858 | CS-0087865 | 320.477 | C19H32N2O2](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502445167.PNG-250.jpg)
eMolecules 298693-03-5 | ChemScene | (4S4S)-22-Cyclopentylidenebis[4-tert-butyl-45-dihydrooxazole] | 100mg | 487935858 | CS-0087865 | 320.477 | C19H32N2O2
Ambeed | (4-Aminophenyl)dimethylphosphine oxide | 100mg | 660581732 | A538417 | 737751-54-1 | MFCD20696907 | 169.164 | C8H12NOP
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Pfaltz & Bauer Triphenylphosphine Oxide 98% 25G | 791-28-6
Triphenylphosphine Oxide 98% 25G | 791-28-6
eMolecules 791-28-6 | Triphenylphosphine oxide | Oakwood Chemicals | MFCD00002080 | 278.291 | C18H15OP | 98.000 | O=P(c1ccccc1)(c1ccccc1)c1ccccc1 | 5g | 480160124
Triphenylphosphine oxide | Oakwood Chemicals | 791-28-6 | MFCD00002080 | 278.291 | C18H15OP | 98.000 | O=P(c1ccccc1)(c1ccccc1)c1ccccc1 | 5g | 480160124
(C)C | 5g | 410167571](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000189853.jpg-250.jpg)
eMolecules 93102-05-7 | N-(Methoxymethyl)-N-(trimethylsilylmethyl)benzylamine | AA Blocks LLC | MFCD00674005 | 237.418 | C13H23NOSi | 0.000 | COCN(Cc1ccccc1)C[Si](C)(C)C | 5g | 410167571
N-(Methoxymethyl)-N-(trimethylsilylmethyl)benzylamine | AA Blocks LLC | 93102-05-7 | MFCD00674005 | 237.418 | C13H23NOSi | 0.000 | COCN(Cc1ccccc1)C[Si](C)(C)C | 5g | 410167571
eMolecules 14259-47-3 | Medchem Express | Didymin | 5mg | 506404244 | HY-N2068 | MFCD00151177 | 594.566 | C28H34O14
Ambeed | N-(5-((4-(4-((Dimethylamino)methyl)-3-phenyl-1H-pyrazol-1-yl)pyrimidin-2-yl)amino)-4-methoxy-2-morpholinophenyl)acrylamide | 1mg | 552745572 | A589050 | 1903008-80-9 | 554.655 | C30H34N8O3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Strem, An Ascensus Company CAS# 14221-02-4. 5g. Tetrakis(triphenylphosphine)platinum(0), 98%. MFCD00010014
CAS# 14221-02-4. 5g. Tetrakis(triphenylphosphine)platinum(0), 98%. MFCD00010014. Molecular Weight: 1244.21. Molecular Formula: Pt[(C6H5)3P]4. Color/form: yellow xtl. Strem# 78-2030. http://www.strem.com/catalog/v/78-2030/
eMolecules 791-28-6 | Triphenylphosphine oxide | Synthonix | MFCD00002080 | 278.291 | C18H15OP | 95.000 | O=P(c1ccccc1)(c1ccccc1)c1ccccc1 | 100g | 779539741
Triphenylphosphine oxide | Synthonix | 791-28-6 | MFCD00002080 | 278.291 | C18H15OP | 95.000 | O=P(c1ccccc1)(c1ccccc1)c1ccccc1 | 100g | 779539741
eMolecules 791-28-6 | Triphenylphosphine oxide | Oakwood Chemicals | MFCD00002080 | 278.291 | C18H15OP | 98.000 | O=P(c1ccccc1)(c1ccccc1)c1ccccc1 | 500g | 480160129
Triphenylphosphine oxide | Oakwood Chemicals | 791-28-6 | MFCD00002080 | 278.291 | C18H15OP | 98.000 | O=P(c1ccccc1)(c1ccccc1)c1ccccc1 | 500g | 480160129
eMolecules 76189-56-5 | S(-)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthalene | Chem-Impex | MFCD00010805 | 622.688 | C44H32P2 | 99.000 | c1ccc(cc1)P(c1ccccc1)c1ccc2ccccc2c1-c1c(ccc2ccccc12)P(c1ccccc1)c1ccccc1 | 5g | 272386327
S(-)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthalene | Chem-Impex | 76189-56-5 | MFCD00010805 | 622.688 | C44H32P2 | 99.000 | c1ccc(cc1)P(c1ccccc1)c1ccc2ccccc2c1-c1c(ccc2ccccc12)P(c1ccccc1)c1ccccc1 | 5g | 272386327
eMolecules 109936-21-2 | 2-(4-Chlorophenyl)-1,1-diphenylethanol | MFCD00017507 | 1g
ChemScene | 22-Dimethyl-[11-biphenyl]-44-dicarbonitrile | 100mg | 596091044 | CS-0159445 | 117490-51-4 | 232.286 | C16H12N2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 2757082-85-0 | Ambeed | (R)-2-(2-(Diphenylphosphanyl)phenyl)-4-isobutyl-45-dihydrooxazole | 100mg | 633660453 | A1352236 | 387.463 | C25H26NOP
Medchem Express | 5-Aza-7-deazaguanine | 5mg | 552386445 | HY-111627 | 67410-64-4 | MFCD20661701 | 151.129 | C5H5N5O
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>