4-alkoxyphenols
Medchemexpress LLC BLI-489 hydrate 1mg | 2580120-08-5 | 1MG
BLI-489 hydrate a penem -lactamase inhibitor is active against class A and class C as well as some class D -lactamases The combination of Piperacillin and BLI-489 hydrate is efficacious against murine infections caused by class A (including extended-spectrum -lactamases) class C (AmpC) and class D -lactamase-expressing pathogens[1 [2
eMolecules 37966-57-7 | 4-Amino-3-methoxyphenol hydrochloride | Combi-Blocks | MFCD14585016 | 175.610 | C7H10ClNO2 | 95.000 | Cl.COc1cc(O)ccc1N | 1g | 232335336
4-Amino-3-methoxyphenol hydrochloride | Combi-Blocks | 37966-57-7 | MFCD14585016 | 175.610 | C7H10ClNO2 | 95.000 | Cl.COc1cc(O)ccc1N | 1g | 232335336
Sigma Aldrich Fine Chemicals Biosciences Butylhydroxyanisole European Pharmacopoeia (EP) Reference Standard | 25013-16-5 | MFCD01779059 |
Butylhydroxyanisole European Pharmacopoeia (EP) Reference Standard | Mol Wt: 180.24 | 25013-16-5 | MFCD01779059 |
Accela Chembio Inc 2-bromo-4-methoxyphenol | 25g | 17332-11-5 | MFCD02113712 | 97+% | Shelf Life: 1260 Days | Light Sensitive/nitrogen Or Argon/+4
2-bromo-4-methoxyphenol | 25g | 17332-11-5 | MFCD02113712 | 97+% | Shelf Life: 1260 Days | Light Sensitive/nitrogen Or Argon/+4
eMolecules 183673-71-4 | 4-amino-1-[(tert-butoxy)carbonyl]piperidine-4-carboxylic acid | Pharmablock | MFCD01318728 | 244.291 | C11H20N2O4 | 97.000 | CC(C)(C)OC(=O)N1CCC(N)(CC1)C(O)=O | 250mg | 551323187
4-amino-1-[(tert-butoxy)carbonyl]piperidine-4-carboxylic acid | Pharmablock | 183673-71-4 | MFCD01318728 | 244.291 | C11H20N2O4 | 97.000 | CC(C)(C)OC(=O)N1CCC(N)(CC1)C(O)=O | 250mg | 551323187
eMolecules 5815-08-7 | 1-(tert-Butoxy)-N,N,N',N'-tetramethylmethanediamine | Apollo Scientific | MFCD00042858 | 174.288 | C9H22N2O | 90.000 | CN(C)C(OC(C)(C)C)N(C)C | 25g | 562437692
1-(tert-Butoxy)-N,N,N',N'-tetramethylmethanediamine | Apollo Scientific | 5815-08-7 | MFCD00042858 | 174.288 | C9H22N2O | 90.000 | CN(C)C(OC(C)(C)C)N(C)C | 25g | 562437692