Tetracarboxylic acids and derivatives
eMolecules 25005-97-4 | Tetra-2-pyridinylpyrazine | Combi-Blocks, Inc. | MFCD00014608 | 388.434 | C24H16N6 | 97.000 | c1ccc(nc1)-c1nc(-c2ccccn2)c(nc1-c1ccccn1)-c1ccccn1 | 5g | 589788930
Tetra-2-pyridinylpyrazine | Combi-Blocks, Inc. | 25005-97-4 | MFCD00014608 | 388.434 | C24H16N6 | 97.000 | c1ccc(nc1)-c1nc(-c2ccccn2)c(nc1-c1ccccn1)-c1ccccn1 | 5g | 589788930
Sigma Aldrich Fine Chemicals Biosciences Ethylenediaminetetraacetic acid calcium disodium salt | 62-33-9 | MFCD00148919 | 500G
Ethylenediaminetetraacetic acid calcium disodium salt | Purity: 97.0-102.0% (titration) | Mol Wt: 374.27 | 62-33-9 | MFCD00148919 | 500G
Chem-Impex International, Inc. 1,1,1-Tris(acetyloxy)-1,1-dihydro-1,2-benziodoxol-3-(1H)-one | 87413-09-0 | MFCD00130127 | 25G
1,1,1-Tris(acetyloxy)-1,1-dihydro-1,2-benziodoxol-3-(1H)-one, 87413-09-0, MFCD00130127, 25G
Chem-Impex International, Inc. 4,4'-(Hexafluoroisopropylidene)diphthalic anhydride | MFCD00039143 | 100G
4,4'-(Hexafluoroisopropylidene)diphthalic anhydride, MFCD00039143, 100G
Bioworld EDTA, Dipotassium Salt Dihydrate, 1 kg
Used to eliminate inhibition of enzyme catalyzed reactions due to the trace presence of heavy metals.A metal chelating agent commonly used in tissue culture media and biological buffers.Specifications:Ultra Pure GradeChloride: <0.005%Iron: <0.001%Heavy metals (as Pb): <0.001%Appearance: LiquidHS Code : 29224985Melting Point: 255-280 °CPH Value: pH (5%, water, 250º°C): 4.0-5.0
Pfaltz & Bauer Pentaerythritol tetraacrylate 100G | 4986-89-4
Pentaerythritol tetraacrylate 100G | 4986-89-4
Boston Bioproducts Inc Triethanolamine Buffer (0.2 M, pH 8.0) - 250ml
The Triethanolamine (TEA) Buffer is bifunctional solution that exhibits properties of both alcohols and amines. It is a zwitterionic buffer and can be used as a protein purification reagent in the pH range of 7-8.5 as well as a stationary phase for liquid chromatography. This buffer functions as neutralizing and emulsifying agent, allowing it to neutralize fatty acids and enhance the solubility of oils and other components that are not fully water-soluble.
Sigma Aldrich Fine Chemicals Biosciences Ethylene glycol-bis(2-aminoethylether)-N,N,N′,N′-tetraacetic acid | 67-42-5 | MFCD00004291 | 25 g
Ethylene glycol-bis(2-aminoethylether)-N,N,N′,N′-tetraacetic acid | Purity: ≥97.0% | Mol Wt: 380.35 | 67-42-5 | MFCD00004291 | 25 g
eMolecules 529493-92-3 | 2,3,4,6-tetra-o-acetyl-alpha-D-glucosylpyranosyl bromide | Broadpharm | MFCD01365753 | 411.201 | C14H19BrO9 | 98.000 | CC(=O)OCC1OC(Br)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O | 1g | 268504907
2,3,4,6-tetra-o-acetyl-alpha-D-glucosylpyranosyl bromide | Broadpharm | 529493-92-3 | MFCD01365753 | 411.201 | C14H19BrO9 | 98.000 | CC(=O)OCC1OC(Br)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O | 1g | 268504907
eMolecules 2095393-15-8 | Medchem Express | ARQ 531 | 5mg | 446260233 | HY-112215 | 478.93 | C25H23ClN4O4
Ambeed | (S)-2-isocyanato-3-phenylpropionicacidmethylester | 100mg | 642081313 | A807096 | 40203-94-9 | MFCD00191535 | 205.213 | C11H11NO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
C(C)(C)C)C(O)=O)C(O)=O | 25g | 517027487](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502184049.JPG-250.jpg)
eMolecules 65259-81-6 | (-)-Dipivaloyl-l-tartaric acid | Combi-Blocks | MFCD00066535 | 318.322 | C14H22O8 | 97.000 | CC(C)(C)C(=O)O[C@H]([C@@H](OC(=O)C(C)(C)C)C(O)=O)C(O)=O | 25g | 517027487
(-)-Dipivaloyl-l-tartaric acid | Combi-Blocks | 65259-81-6 | MFCD00066535 | 318.322 | C14H22O8 | 97.000 | CC(C)(C)C(=O)O[C@H]([C@@H](OC(=O)C(C)(C)C)C(O)=O)C(O)=O | 25g | 517027487
eMolecules 59820-90-5 | 2'-Bromo-4',5'-(ethylenedioxy)acetophenone | Apollo Scientific | MFCD00168681 | 257.083 | C10H9BrO3 | 98.000 | CC(=O)c1cc2OCCOc2cc1Br | 1g | 562430503
2'-Bromo-4',5'-(ethylenedioxy)acetophenone | Apollo Scientific | 59820-90-5 | MFCD00168681 | 257.083 | C10H9BrO3 | 98.000 | CC(=O)c1cc2OCCOc2cc1Br | 1g | 562430503
AG Scientific Inc EDTA Disodium Salt, 250 G
EDTA disodium salt, for molecular biology, is extensively used as a chelator of divalent cations such as Ca2+. EDTA is a chelating agent, a general chemical, and a sequestrant. In molecular biology applications, addition of EDTA minimizes the impact of metal ion contaminants. Also used to facilitate enzymatic reactions that could be inhibited by heavy metal traces and it also inhibits enzymes, such as metalloproteases.CAS Number: 6381-92-6Molecular Weight: 372.2 DaChemical Formula: C10H14N2O8Na2 2H2OSolubility: WaterStorage Temperature: Room TemperatureResearch or further manufacturing use only, not for food or drug use.
![eMolecules 2872-65-3 | 4-METHOXYPHENYL 2,3,4,6-TETRA-O-ACETYL-?-D-GALACTOPYRANOSIDE | AstaTech | MFCD06797123 | 454.428 | C21H26O11 | 95.000 | COc1ccc(O[C@@H]2O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)cc1 | 5g | 718072374](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502482406.JPG-250.jpg)
eMolecules 2872-65-3 | 4-METHOXYPHENYL 2,3,4,6-TETRA-O-ACETYL-?-D-GALACTOPYRANOSIDE | AstaTech | MFCD06797123 | 454.428 | C21H26O11 | 95.000 | COc1ccc(O[C@@H]2O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)cc1 | 5g | 718072374
4-METHOXYPHENYL 2,3,4,6-TETRA-O-ACETYL-?-D-GALACTOPYRANOSIDE | AstaTech | 2872-65-3 | MFCD06797123 | 454.428 | C21H26O11 | 95.000 | COc1ccc(O[C@@H]2O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)cc1 | 5g | 718072374
Sigma Aldrich Fine Chemicals Biosciences Ethylenediaminetetraacetic acid tripotassium salt dihydrate | 65501-24-8 | MFCD00149672 | 100 g
Ethylenediaminetetraacetic acid tripotassium salt dihydrate | Purity: 98% | Mol Wt: 442.54 | 65501-24-8 | MFCD00149672 | 100 g