Triazoles
eMolecules 22819-05-2 | ChemScene | 3-Ethyl-1H-124-triazol-5-amine | 250mg | 686072244 | CS-0369482 | MFCD01114776 | 112.136 | C4H8N4
Ambeed | (-)-12-Bis((2R5R)-25-diphenylphospholano)ethane(15-cyclooctadiene)rhodium(I) tetrafluoroborate | 100mg | 633661756 | A238175 | 528565-84-6 | MFCD07369037 | 804.500 | C42H48BF4P2Rh
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 1003-35-6 | Ambeed | 5-Amino-1H-124-triazol-3(2H)-one | 250mg | 490549600 | A285259 | MFCD23140949 | 100.081 | C2H4N4O
Medchem Express | Z433927330 | 5mg | 482204282 | HY-126074 | 1005883-72-6 | 364.405 | C20H20N4O3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
![eMolecules 7343-33-1 | 3-Bromo-1H-1,2,4-triazole | Oakwood Chemical | MFCD01421960 | 147.963 | C2H2BrN3 | 95.000 | Brc1nc[nH]n1 | 5g | 537699967](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000224802.jpg-250.jpg)
eMolecules 7343-33-1 | 3-Bromo-1H-1,2,4-triazole | Oakwood Chemical | MFCD01421960 | 147.963 | C2H2BrN3 | 95.000 | Brc1nc[nH]n1 | 5g | 537699967
3-Bromo-1H-1,2,4-triazole | Oakwood Chemical | 7343-33-1 | MFCD01421960 | 147.963 | C2H2BrN3 | 95.000 | Brc1nc[nH]n1 | 5g | 537699967
![eMolecules 124337-64-0 | 1-[1H-1,2,3-Benzotriazol-1-yl(1H-pyrrol-1-yl)methyl]cyclohexan-1-ol | Oakwood Chemical296.374 | C17H20N4O | 98.000 | OC1(CCCCC1)C(n1cccc1)n1nnc2ccccc12 | 1mg | 537713370](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502150437.JPG-250.jpg)
eMolecules 124337-64-0 | 1-[1H-1,2,3-Benzotriazol-1-yl(1H-pyrrol-1-yl)methyl]cyclohexan-1-ol | Oakwood Chemical296.374 | C17H20N4O | 98.000 | OC1(CCCCC1)C(n1cccc1)n1nnc2ccccc12 | 1mg | 537713370
1-[1H-1,2,3-Benzotriazol-1-yl(1H-pyrrol-1-yl)methyl]cyclohexan-1-ol | Oakwood Chemical | 124337-64-0296.374 | C17H20N4O | 98.000 | OC1(CCCCC1)C(n1cccc1)n1nnc2ccccc12 | 1mg | 537713370
eMolecules 200711-22-4 | 5-Methyl-6-(trifluoromethyl)indoline | MFCD13192389 | 100mg
Ambeed | 3-Phenylpropanehydrazide | 1g | 601096077 | A642135 | 3538-68-9 | MFCD00157933 | 164.208 | C9H12N2O
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Cayman Chemical (S)-SLV 319, Purity: ≥98%, CAS: 464213-10-3, 10 mg
A potent and selective CB1 receptor antagonist (Kis = 7.8 and 7,943 nM for CB1 and CB2, respectively); less lipophilic (log P = 5.1) and therefore more water soluble than other known CB1 receptor ligands
Cayman Chemical (R)-SLV 319, Purity: ≥98%, CAS: 656827-86-0, 5 mg
(R)-SLV 319 is the inactive enantiomer of SLV 319 with 100-fold less affinity for the CB1 receptor than (S)-SLV 319