Dicarbonyl Compounds
eMolecules 1906-95-2 | (5-Bromopentyl)malonic acid diethyl ester | Combi-Blocks | MFCD00048565 | 309.200 | C12H21BrO4 | 95.000 | CCOC(=O)C(CCCCCBr)C(=O)OCC | 1g | 267197793
(5-Bromopentyl)malonic acid diethyl ester | Combi-Blocks | 1906-95-2 | MFCD00048565 | 309.200 | C12H21BrO4 | 95.000 | CCOC(=O)C(CCCCCBr)C(=O)OCC | 1g | 267197793
eMolecules 108-13-4 | Malonamide | Oakwood Chemicals | MFCD00008034 | 102.093 | C3H6N2O2 | 97.000 | NC(=O)CC(N)=O | 5g | 480145882
Malonamide | Oakwood Chemicals | 108-13-4 | MFCD00008034 | 102.093 | C3H6N2O2 | 97.000 | NC(=O)CC(N)=O | 5g | 480145882
eMolecules 40637-56-7 | Dimethyl 2-allylmalonate | Ambeed | MFCD00014959 | 172.180 | C8H12O4 | 98.000 | COC(=O)C(CC=C)C(=O)OC | 5g | 552604694
Dimethyl 2-allylmalonate | Ambeed | 40637-56-7 | MFCD00014959 | 172.180 | C8H12O4 | 98.000 | COC(=O)C(CC=C)C(=O)OC | 5g | 552604694
eMolecules 108-59-8 | Dimethyl malonate | ChemScene | MFCD00008460 | 132.115 | C5H8O4 | 98.000 | COC(=O)CC(=O)OC | 500g | 844794456
Dimethyl malonate | ChemScene | 108-59-8 | MFCD00008460 | 132.115 | C5H8O4 | 98.000 | COC(=O)CC(=O)OC | 500g | 844794456
Apexbio Technology LLC Dimethyl malonate 108-59-8 500mg
Dimethyl malonate (CAS 108-59-8) is a competitive inhibitor of succinate dehydrogenase (SDH) an essential enzyme in the mitochondrial tricarboxylic acid (TCA) cycle This compound effectively crosses the blood-brain barrier and is hydrolyzed within brain tissue to yield malonic acid which modulates SDH activity and impairs mitochondrial respiration By altering TCA cycle metabolism dimethyl malonate has been shown to reduce neuronal apoptosis It is frequently employed in studies investigating mitochondrial dysfunction mechanisms of neuronal cell death and the pathophysiology of neurodegenerative diseases serving as a useful tool for establishing disease models and exploring potential therapeutic interventions
eMolecules 105-53-3 | Diethyl malonate | Chem-Impex | MFCD00009195 | 160.169 | C7H12O4 | 99.000 | CCOC(=O)CC(=O)OCC | 5kg | 490849109
Diethyl malonate | Chem-Impex | 105-53-3 | MFCD00009195 | 160.169 | C7H12O4 | 99.000 | CCOC(=O)CC(=O)OCC | 5kg | 490849109
eMolecules 32864-38-3 | TERT-BUTYL ETHYL MALONATE | AstaTech | MFCD00009193 | 188.223 | C9H16O4 | 95.000 | CCOC(=O)CC(=O)OC(C)(C)C | 25g | 323606828
TERT-BUTYL ETHYL MALONATE | AstaTech | 32864-38-3 | MFCD00009193 | 188.223 | C9H16O4 | 95.000 | CCOC(=O)CC(=O)OC(C)(C)C | 25g | 323606828
Selleck Chemical LLC Diethyl malonate
Diethyl malonate naturally occuring in grapes and strawberries is used in the synthesis of chemicals
Chem-Impex International, Inc. Malonic acid anhydrous | 141-82-2 | MFCD00002707 | 1KG
Malonic acid anhydrous, 141-82-2, MFCD00002707, 1KG
Apexbio Technology LLC Malonic acid 141-82-2 100mg
Malonic acid is a small-molecule dicarboxylic acid It is commonly used to facilitate the cross-linking of polysaccharide molecules such as corn starch and potato starch by forming covalent linkages via its two carboxyl groups Malonic acid acts primarily through condensation or esterification reactions to increase intermolecular connectivity and modulate the mechanical properties of biopolymer matrices Based on these properties malonic acid holds research potential in pharmaceutical excipient formulation drug delivery system development and biomaterial engineering studies