Gas Detection Tubes
![eMolecules 330680-46-1 | Ambeed | Trimethyl [2262-terpyridine]-444-tricarboxylate | 100mg | 490555599 | A339026 | MFCD11042545 | 407.382 | C21H17N3O6](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502441847.PNG-250.jpg)
eMolecules 330680-46-1 | Ambeed | Trimethyl [2262-terpyridine]-444-tricarboxylate | 100mg | 490555599 | A339026 | MFCD11042545 | 407.382 | C21H17N3O6
Pharmablock | NN-bis[(24-dimethoxyphenyl)methyl]-1-phenyl-methanesulfonamide | 25mg | 761744517 | PBJZ394 | 803727-83-5 | 471.570 | C25H29NO6S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 27151-65-1 | MONOMETHYL 3-METHYLGLUTARATE | AstaTech | MFCD01631203 | 160.169 | C7H12O4 | 98.000 | COC(=O)CC(C)CC(O)=O | 1g | 222803946
MONOMETHYL 3-METHYLGLUTARATE | AstaTech | 27151-65-1 | MFCD01631203 | 160.169 | C7H12O4 | 98.000 | COC(=O)CC(C)CC(O)=O | 1g | 222803946
eMolecules 50388-51-7 | Ambeed | Methyl 55-dimethyl-2-oxocyclohexanecarboxylate | 100mg | 650570086 | A181831 | MFCD09869052 | 184.235 | C10H16O3
Ambeed | Methyl 55-dimethyl-2-oxocyclohexanecarboxylate | 100mg | 650570086 | A181831 | 50388-51-7 | MFCD09869052 | 184.235 | C10H16O3
eMolecules 1486409-21-5 | Pharmablock | dimethyl 3-oxocyclobutane-11-dicarboxylate | 25mg | 713708229 | PB06128 | MFCD21122007 | 186.163 | C8H10O5
Medchem Express | NSC 601980 | 5mg | 446273996 | HY-B1714A | 2070018-27-6 | MFCD30187525 | 248.289 | C15H12N4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 14186-60-8 | Dimethyl 2-methylterephthalate | ChemScene | MFCD11502730 | 208.213 | C11H12O4 | 98.000 | COC(=O)c1ccc(C(=O)OC)c(C)c1 | 100mg | 626491865
Dimethyl 2-methylterephthalate | ChemScene | 14186-60-8 | MFCD11502730 | 208.213 | C11H12O4 | 98.000 | COC(=O)c1ccc(C(=O)OC)c(C)c1 | 100mg | 626491865
eMolecules 5571-03-9 | methyl 2-methylpyrimidine-5-carboxylate | Pharmablock | MFCD11111634 | 152.153 | C7H8N2O2 | 97.000 | COC(=O)c1cnc(C)nc1 | 25mg | 586137339
methyl 2-methylpyrimidine-5-carboxylate | Pharmablock | 5571-03-9 | MFCD11111634 | 152.153 | C7H8N2O2 | 97.000 | COC(=O)c1cnc(C)nc1 | 25mg | 586137339
eMolecules 23580-75-8 | dimethyl piperidine-2,3-dicarboxylate | Pharmablock | MFCD12026413 | 201.222 | C9H15NO4 | 97.000 | COC(=O)C1CCCNC1C(=O)OC | 25mg | 795394300
dimethyl piperidine-2,3-dicarboxylate | Pharmablock | 23580-75-8 | MFCD12026413 | 201.222 | C9H15NO4 | 97.000 | COC(=O)C1CCCNC1C(=O)OC | 25mg | 795394300
eMolecules 80028-44-0 | Pharmablock | ethyl pyrrolidine-3-carboxylate hydrochloride | 50mg | 551091048 | PB90153-1 | MFCD14585012 | 179.64 | C7H14ClNO2
Pharmablock | ethyl pyrrolidine-3-carboxylate hydrochloride | 50mg | 551091048 | PB90153-1 | 80028-44-0 | MFCD14585012 | 179.640 | C7H14ClNO2
eMolecules 54322-41-7 | Ambeed | (S)-Methyl 2-acetamido-3-hydroxypropanoate | 100mg | 714087093 | A572861 | MFCD00038508 | 161.157 | C6H11NO4
Ambeed | (S)-Methyl 2-acetamido-3-hydroxypropanoate | 100mg | 714087093 | A572861 | 54322-41-7 | MFCD00038508 | 161.157 | C6H11NO4
eMolecules 79247-98-6 | Pharmablock | methyl 5-methylthiazole-2-carboxylate | 25mg | 731744092 | PBT0880 | MFCD01924773 | 157.19 | C6H7NO2S
Pharmablock | methyl 5-methylthiazole-2-carboxylate | 25mg | 731744092 | PBT0880 | 79247-98-6 | MFCD01924773 | 157.190 | C6H7NO2S
![eMolecules 394223-02-0 | Pharmablock | methyl 1H-pyrrolo[23-b]pyridine-2-carboxylate | 50mg | 551057189 | PB00510 | MFCD08752938 | 176.175 | C9H8N2O2](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502518019.JPG-250.jpg)
eMolecules 394223-02-0 | Pharmablock | methyl 1H-pyrrolo[23-b]pyridine-2-carboxylate | 50mg | 551057189 | PB00510 | MFCD08752938 | 176.175 | C9H8N2O2
Medchem Express | PRL-3 Inhibitor I | 5mg | 600899837 | HY-112476 | 893449-38-2 | MFCD11045303 | 485.210 | C17H11Br2NO2S2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
![eMolecules 115932-00-8 | Pharmablock | ethyl pyrazolo[15-a]pyrimidine-3-carboxylate | 25mg | 624170350 | PBN2011497 | MFCD00847745 | 191.19 | C9H9N3O2](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502515397.JPG-250.jpg)
eMolecules 115932-00-8 | Pharmablock | ethyl pyrazolo[15-a]pyrimidine-3-carboxylate | 25mg | 624170350 | PBN2011497 | MFCD00847745 | 191.19 | C9H9N3O2
Medchem Express | Ibuprofen-d3 | 1mg | 705861396 | HY-78131S | 121662-14-4 | MFCD06658737 | 209.303 | C13H18O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
