Gas Detection Tubes
![eMolecules 372147-49-4 | Ambeed | Ethyl imidazo[12-a]pyridine-7-carboxylate | 1g | 596568582 | A357610 | MFCD08436046 | 190.202 | C10H10N2O2](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502441758.PNG-250.jpg)
eMolecules 372147-49-4 | Ambeed | Ethyl imidazo[12-a]pyridine-7-carboxylate | 1g | 596568582 | A357610 | MFCD08436046 | 190.202 | C10H10N2O2
AstaTech | 4-BENZYL-2-((PIPERIDIN-1-YL)METHYL) MORPHOLINE | 0.1g | 721754388 | AB1170 | 95.000 | 874881-17-1 | MFCD06658346 | 274.408 | C17H26N2O
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 228728-32-3 | ChemScene | Ethyl 6-(tert-butyl)-4-hydroxyquinoline-3-carboxylate | 250mg | 569145398 | CS-0097037 | MFCD24843129 | 273.332 | C16H19NO3
Ambeed | 4-Methoxy-[11-biphenyl]-4-carbaldehyde | 5g | 506393681 | A455895 | 52988-34-8 | MFCD01862517 | 212.248 | C14H12O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 1814881-70-3 | Medchem Express | LEM-14 | 5mg | 778475708 | HY-114340 | 478.57 | C25H26N4O4S
Ambeed | 4-(4455-Tetramethyl-132-dioxaborolan-2-yl)benzohydrazide | 250mg | 752810659 | A493738 | 276694-16-7 | MFCD07783860 | 262.120 | C13H19BN2O3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
![eMolecules 115932-00-8 | Pharmablock | ethyl pyrazolo[15-a]pyrimidine-3-carboxylate | 25mg | 624170350 | PBN2011497 | MFCD00847745 | 191.19 | C9H9N3O2](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502515397.JPG-250.jpg)
eMolecules 115932-00-8 | Pharmablock | ethyl pyrazolo[15-a]pyrimidine-3-carboxylate | 25mg | 624170350 | PBN2011497 | MFCD00847745 | 191.19 | C9H9N3O2
Medchem Express | Ibuprofen-d3 | 1mg | 705861396 | HY-78131S | 121662-14-4 | MFCD06658737 | 209.303 | C13H18O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 13148-83-9 | Methyl 3-oxocyclohexanecarboxylate | Ambeed | MFCD09031996 | 156.181 | C8H12O3 | 95.000 | COC(=O)C1CCCC(=O)C1 | 100mg | 490502497
Methyl 3-oxocyclohexanecarboxylate | Ambeed | 13148-83-9 | MFCD09031996 | 156.181 | C8H12O3 | 95.000 | COC(=O)C1CCCC(=O)C1 | 100mg | 490502497
eMolecules 89228-42-2 | METHYL 4-HYDROXY-5,6,7,8-TETRAHYDRONAPHTHALENE-2-CARBOXYLATE | AstaTech | MFCD07779371 | 206.241 | C12H14O3 | 95.000 | COC(=O)c1cc(O)c2CCCCc2c1 | 0.25g | 273166999
METHYL 4-HYDROXY-5,6,7,8-TETRAHYDRONAPHTHALENE-2-CARBOXYLATE | AstaTech | 89228-42-2 | MFCD07779371 | 206.241 | C12H14O3 | 95.000 | COC(=O)c1cc(O)c2CCCCc2c1 | 0.25g | 273166999
eMolecules 374537-95-8 | Ambeed | Methyl 3-(4-(chlorosulfonyl)phenyl)propanoate | 1g | 586029843 | A284253 | MFCD02093942 | 262.7 | C10H11ClO4S
ChemScene | 3-Bromopyrazolo[15-a]pyridine-5-carboxylic acid | 100mg | 632295642 | CS-0155566 | 876379-79-2 | MFCD11518932 | 241.044 | C8H5BrN2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 76275-86-0 | ChemScene | Methyl 2-(1-hydroxyethyl)thiazole-4-carboxylate | 100mg | 768994003 | CS-0613831 | 187.21 | C7H9NO3S
ChemScene | Methyl 2-(1-hydroxyethyl)thiazole-4-carboxylate | 100mg | 768994003 | CS-0613831 | 76275-86-0 | 187.210 | C7H9NO3S
eMolecules 18830-44-9 | Methyl 3,3,3-trifluoropropionate | Ambeed | MFCD02262206 | 142.077 | C4H5F3O2 | 97.000 | COC(=O)CC(F)(F)F | 1g | 575774934
Methyl 3,3,3-trifluoropropionate | Ambeed | 18830-44-9 | MFCD02262206 | 142.077 | C4H5F3O2 | 97.000 | COC(=O)CC(F)(F)F | 1g | 575774934
eMolecules Ambeed / Ethyl thiazole-2-carboxylate / 250mg / 525135141 / A222678 / / 14527-42-5 / MFCD06204689 / 157.190 / C6H7NO2S
Ambeed / Ethyl thiazole-2-carboxylate / 250mg / 525135141 / A222678 / / 14527-42-5 / MFCD06204689 / 157.190 / C6H7NO2S
eMolecules 87281-44-5 | 5,6,7,8-Tetrahydro-indolizine-2-carboxylic acid methyl ester | J&W PharmLab LLC | MFCD13178402 | 179.219 | C10H13NO2 | 96.000 | COC(=O)c1cc2CCCCn2c1 | 50mg | 746318791
5,6,7,8-Tetrahydro-indolizine-2-carboxylic acid methyl ester | J&W PharmLab LLC | 87281-44-5 | MFCD13178402 | 179.219 | C10H13NO2 | 96.000 | COC(=O)c1cc2CCCCn2c1 | 50mg | 746318791
eMolecules 617-36-7 | Ethyl 2-amino-2-oxoacetate | Ambeed | MFCD00008005 | 117.104 | C4H7NO3 | 95.000 | CCOC(=O)C(N)=O | 10g | 525114537
Ethyl 2-amino-2-oxoacetate | Ambeed | 617-36-7 | MFCD00008005 | 117.104 | C4H7NO3 | 95.000 | CCOC(=O)C(N)=O | 10g | 525114537
eMolecules 80028-44-0 | Pharmablock | ethyl pyrrolidine-3-carboxylate hydrochloride | 50mg | 551091048 | PB90153-1 | MFCD14585012 | 179.64 | C7H14ClNO2
Pharmablock | ethyl pyrrolidine-3-carboxylate hydrochloride | 50mg | 551091048 | PB90153-1 | 80028-44-0 | MFCD14585012 | 179.640 | C7H14ClNO2
eMolecules 17289-19-9 | Methyl 1-methyl-1H-imidazole-4-carboxylate | Ambeed | MFCD02179561 | 140.142 | C6H8N2O2 | 98.000 | COC(=O)c1cn(C)cn1 | 1g | 551674738
Methyl 1-methyl-1H-imidazole-4-carboxylate | Ambeed | 17289-19-9 | MFCD02179561 | 140.142 | C6H8N2O2 | 98.000 | COC(=O)c1cn(C)cn1 | 1g | 551674738
eMolecules 1149-24-2 | Diethyl 2,6-dimethylpyridine-3,5-dicarboxylate | Ambeed | MFCD00023506 | 251.282 | C13H17NO4 | 97.000 | CCOC(=O)c1cc(C(=O)OCC)c(C)nc1C | 100mg | 525161909
Diethyl 2,6-dimethylpyridine-3,5-dicarboxylate | Ambeed | 1149-24-2 | MFCD00023506 | 251.282 | C13H17NO4 | 97.000 | CCOC(=O)c1cc(C(=O)OCC)c(C)nc1C | 100mg | 525161909