Gas Detection Tubes
eMolecules 24589-98-8 | ChemScene | Methyl 4-formyl-3-hydroxybenzoate | 100mg | 632274049 | CS-0044168 | MFCD17015455 | 180.159 | C9H8O4
Ambeed | H-D-Ala-OtBu.HCl | 10g | 552553057 | A124410 | 59531-86-1 | MFCD00077087 | 181.660 | C7H16ClNO2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
![eMolecules 932041-12-8 | METHYL 5-(TRIFLUOROMETHOXY)-1H-INDAZOLE-3-CARBOXYLATE | AstaTech | MFCD12498703 | 260.172 | C10H7F3N2O3 | 95.000 | COC(=O)c1n[nH]c2ccc(OC(F)(F)F)cc12 | 0.25g | 437209948](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502481348.JPG-250.jpg)
eMolecules 932041-12-8 | METHYL 5-(TRIFLUOROMETHOXY)-1H-INDAZOLE-3-CARBOXYLATE | AstaTech | MFCD12498703 | 260.172 | C10H7F3N2O3 | 95.000 | COC(=O)c1n[nH]c2ccc(OC(F)(F)F)cc12 | 0.25g | 437209948
METHYL 5-(TRIFLUOROMETHOXY)-1H-INDAZOLE-3-CARBOXYLATE | AstaTech | 932041-12-8 | MFCD12498703 | 260.172 | C10H7F3N2O3 | 95.000 | COC(=O)c1n[nH]c2ccc(OC(F)(F)F)cc12 | 0.25g | 437209948
eMolecules 1245648-71-8 | ChemScene | Methyl 5-cyano-1H-indole-2-carboxylate | 250mg | 714292904 | CS-0443163 | MFCD12964183 | 200.197 | C11H8N2O2
Ambeed | 5-Chloro-1-methyl-1H-pyrazolo[43-d]pyrimidine | 100mg | 534086456 | A800642 | 1393181-01-5 | MFCD23703367 | 168.580 | C6H5ClN4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 17649-58-0 | Ambeed | Dimethyl 5-methylisophthalate | 1g | 600851530 | A520382 | MFCD00082721 | 208.213 | C11H12O4
6-Bromo-3-methoxy-pyrazine-2-carboxylic acid methyl ester | Chemcia | 259794-06-4 | MFCD10697763 | 247.048 | C7H7BrN2O3 | 95.000 | COC(=O)c1nc(Br)cnc1OC | 1g | 297086582
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 52159-64-5 | Ambeed | Methyl 2-hydroxy-3-isopropylbenzoate | 100mg | 627733497 | A290157 | MFCD24714020 | 194.23 | C11H14O3
Ambeed | Methyl 2-hydroxy-3-isopropylbenzoate | 100mg | 627733497 | A290157 | 52159-64-5 | MFCD24714020 | 194.230 | C11H14O3
eMolecules 127168-90-5 | Ambeed | Methyl isoindoline-4-carboxylate hydrochloride | 50mg | 521407842 | A147530 | MFCD10700133 | 213.66 | C10H12ClNO2
Ambeed | (S)-2-((tert-Butoxycarbonyl)amino)-3-(1H-pyrrolo[23-b]pyridin-3-yl)propanoic acid | 250mg | 600851324 | A346896 | 146610-21-1 | MFCD08273059 | 305.334 | C15H19N3O4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
![eMolecules 25137-01-3 | Ethyl (R)-(-)-3-Piperidinecarboxylate | Ambeed | MFCD03093637 | 157.213 | C8H15NO2 | 98.000 | CCOC(=O)[C@@H]1CCCNC1 | 1g | 552603738](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502419538.JPG-250.jpg)
eMolecules 25137-01-3 | Ethyl (R)-(-)-3-Piperidinecarboxylate | Ambeed | MFCD03093637 | 157.213 | C8H15NO2 | 98.000 | CCOC(=O)[C@@H]1CCCNC1 | 1g | 552603738
Ethyl (R)-(-)-3-Piperidinecarboxylate | Ambeed | 25137-01-3 | MFCD03093637 | 157.213 | C8H15NO2 | 98.000 | CCOC(=O)[C@@H]1CCCNC1 | 1g | 552603738
eMolecules 18289-89-9 | Ambeed | (R)-Methyl 23-dihydroxypropanoate | 250mg | 552661203 | A227282 | MFCD06204263 | 120.104 | C4H8O4
Ambeed | 2-(2-Fluoro-3-isobutoxyphenyl)-4455-tetramethyl-132-dioxaborolane | 100mg | 714084213 | A1541057 | 2828440-13-5 | 294.170 | C16H24BFO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool