Gas Detection Tubes
eMolecules 4707-47-5 | Atraric acid | Ambeed | MFCD00157202 | 196.202 | C10H12O4 | 98.000 | COC(=O)c1c(C)cc(O)c(C)c1O | 1mg | 761204790
Atraric acid | Ambeed | 4707-47-5 | MFCD00157202 | 196.202 | C10H12O4 | 98.000 | COC(=O)c1c(C)cc(O)c(C)c1O | 1mg | 761204790
eMolecules 67853-03-6 | ChemScene | Methyl 3-(hydroxymethyl)benzoate | 100mg | 654744543 | CS-0096392 | MFCD06202752 | 166.176 | C9H10O3
ChemScene | Methyl 3-(hydroxymethyl)benzoate | 100mg | 654744543 | CS-0096392 | 67853-03-6 | MFCD06202752 | 166.176 | C9H10O3
eMolecules 88770-18-7 | ChemScene | Methyl 5-methylthiophene-3-carboxylate | 100mg | 582636563 | CS-0138581 | MFCD02245126 | 156.2 | C7H8O2S
ChemScene | Methyl 5-methylthiophene-3-carboxylate | 100mg | 582636563 | CS-0138581 | 88770-18-7 | MFCD02245126 | 156.200 | C7H8O2S
eMolecules 76029-62-4 | ChemScene | Ethyl 2-amino-2-iminoacetate hydrochloride | 100mg | 632287522 | CS-0151910 | MFCD10697937 | 152.58 | C4H9ClN2O2
ChemScene | Ethyl 2-amino-2-iminoacetate hydrochloride | 100mg | 632287522 | CS-0151910 | 76029-62-4 | MFCD10697937 | 152.580 | C4H9ClN2O2
![eMolecules 869067-01-6 | ethyl 4-oxo-3H,4H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylate | Pharmablock | MFCD11977144 | 207.189 | C9H9N3O3 | 97.000 | CCOC(=O)c1cc2n(c1)nc[nH]c2=O | 25mg | 551137042](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502437652.JPG-250.jpg)
eMolecules 869067-01-6 | ethyl 4-oxo-3H,4H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylate | Pharmablock | MFCD11977144 | 207.189 | C9H9N3O3 | 97.000 | CCOC(=O)c1cc2n(c1)nc[nH]c2=O | 25mg | 551137042
ethyl 4-oxo-3H,4H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylate | Pharmablock | 869067-01-6 | MFCD11977144 | 207.189 | C9H9N3O3 | 97.000 | CCOC(=O)c1cc2n(c1)nc[nH]c2=O | 25mg | 551137042
eMolecules 121129-31-5 | ChemScene | Methyl 2-hydroxy-33-dimethylbutanoate | 100mg | 680096813 | CS-0311804 | MFCD16693888 | 146.186 | C7H14O3
Medchem Express | RO8994 | 5mg | 446268093 | HY-16999 | 1309684-94-3 | MFCD29472243 | 613.510 | C31H31Cl2FN4O4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
![eMolecules 1373253-19-0 | ethyl rel-(1R,5S,6r)-3-azabicyclo[3.1.0]hexane-6-carboxylate hydrochloride | Pharmablock | MFCD22194310 | 191.660 | C8H14ClNO2 | 97.000 | Cl.CCOC(=O)[C@@H]1[C@H]2CNC[C@@H]12 | 25mg | 551147099](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502434672.JPG-250.jpg)
eMolecules 1373253-19-0 | ethyl rel-(1R,5S,6r)-3-azabicyclo[3.1.0]hexane-6-carboxylate hydrochloride | Pharmablock | MFCD22194310 | 191.660 | C8H14ClNO2 | 97.000 | Cl.CCOC(=O)[C@@H]1[C@H]2CNC[C@@H]12 | 25mg | 551147099
ethyl rel-(1R,5S,6r)-3-azabicyclo[3.1.0]hexane-6-carboxylate hydrochloride | Pharmablock | 1373253-19-0 | MFCD22194310 | 191.660 | C8H14ClNO2 | 97.000 | Cl.CCOC(=O)[C@@H]1[C@H]2CNC[C@@H]12 | 25mg | 551147099
eMolecules 5338-44-3 | Ethyl 4-acetamidobenzoate | Ambeed | MFCD00157645 | 207.229 | C11H13NO3 | 98.000 | CCOC(=O)c1ccc(NC(C)=O)cc1 | 250mg | 600839678
Ethyl 4-acetamidobenzoate | Ambeed | 5338-44-3 | MFCD00157645 | 207.229 | C11H13NO3 | 98.000 | CCOC(=O)c1ccc(NC(C)=O)cc1 | 250mg | 600839678
![eMolecules 330680-46-1 | Ambeed | Trimethyl [2262-terpyridine]-444-tricarboxylate | 100mg | 490555599 | A339026 | MFCD11042545 | 407.382 | C21H17N3O6](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502441847.PNG-250.jpg)
eMolecules 330680-46-1 | Ambeed | Trimethyl [2262-terpyridine]-444-tricarboxylate | 100mg | 490555599 | A339026 | MFCD11042545 | 407.382 | C21H17N3O6
Pharmablock | NN-bis[(24-dimethoxyphenyl)methyl]-1-phenyl-methanesulfonamide | 25mg | 761744517 | PBJZ394 | 803727-83-5 | 471.570 | C25H29NO6S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 27151-65-1 | MONOMETHYL 3-METHYLGLUTARATE | AstaTech | MFCD01631203 | 160.169 | C7H12O4 | 98.000 | COC(=O)CC(C)CC(O)=O | 1g | 222803946
MONOMETHYL 3-METHYLGLUTARATE | AstaTech | 27151-65-1 | MFCD01631203 | 160.169 | C7H12O4 | 98.000 | COC(=O)CC(C)CC(O)=O | 1g | 222803946
Draeger Safety Inc Draeger MicroTubes, Sulfur Dioxide, 0.05 to 5 ppm
MicroTubes are an innovative analysis system component for precise, on-site measurement of gases, reducing the need for lab analyses. Each set offers 10 individual tests using substance-specific reactive and pre-layers to filter out interfering substances, ensuring accurate target gas indication and minimizing cross-sensitivities. An integrated RFID tag provides one year of valid calibration data, removing manual calibration needs and lowering ownership costs. This specific MicroTube detects Sulfur Dioxide, 0.05 to 5 ppm.
- Precise gas measurement.
- Immediate, on-site results.
- 10 tests per set.
- Substance-specific selective testing.
- Filters interfering substances.
- RFID tag with one-year calibration data.
- Eliminates manual calibration; reduces costs.
- Laboratory-quality results with portability.
eMolecules 23580-75-8 | dimethyl piperidine-2,3-dicarboxylate | Pharmablock | MFCD12026413 | 201.222 | C9H15NO4 | 97.000 | COC(=O)C1CCCNC1C(=O)OC | 25mg | 795394300
dimethyl piperidine-2,3-dicarboxylate | Pharmablock | 23580-75-8 | MFCD12026413 | 201.222 | C9H15NO4 | 97.000 | COC(=O)C1CCCNC1C(=O)OC | 25mg | 795394300
eMolecules 83536-13-4 | Ambeed | Diethyl 44-(ethyne-12-diyl)dibenzoate | 250mg | 633660148 | A1271739 | 322.36 | C20H18O4
Ambeed | Diethyl 44-(ethyne-12-diyl)dibenzoate | 250mg | 633660148 | A1271739 | 83536-13-4 | 322.360 | C20H18O4
eMolecules 20291-40-1 | Ambeed | 7-Methoxy-7-oxoheptanoic acid | 1g | 571782571 | A105938 | MFCD00040445 | 174.196 | C8H14O4
Medchem Express | Kinesore | 5mg | 446276285 | HY-112777 | 363571-83-9 | MFCD02636553 | 536.180 | C20H16Br2N4O4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>