Gas Detection Tubes
eMolecules 3034-86-4 | Methyl 4-ethynylbenzoate | Ambeed | MFCD00168820 | 160.172 | C10H8O2 | 98.000 | COC(=O)c1ccc(cc1)C#C | 100mg | 521428414
Methyl 4-ethynylbenzoate | Ambeed | 3034-86-4 | MFCD00168820 | 160.172 | C10H8O2 | 98.000 | COC(=O)c1ccc(cc1)C#C | 100mg | 521428414
![eMolecules 110928-44-4 | TRANS-METHYL 4-(HYDROXYMETHYL)CYCLOHEXANECARBOXYLATE | AstaTech | MFCD03840884 | 172.224 | C9H16O3 | 95.000 | COC(=O)[C@H]1CC[C@H](CO)CC1 | 0.25g | 490591068](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502429046.PNG-250.jpg)
eMolecules 110928-44-4 | TRANS-METHYL 4-(HYDROXYMETHYL)CYCLOHEXANECARBOXYLATE | AstaTech | MFCD03840884 | 172.224 | C9H16O3 | 95.000 | COC(=O)[C@H]1CC[C@H](CO)CC1 | 0.25g | 490591068
TRANS-METHYL 4-(HYDROXYMETHYL)CYCLOHEXANECARBOXYLATE | AstaTech | 110928-44-4 | MFCD03840884 | 172.224 | C9H16O3 | 95.000 | COC(=O)[C@H]1CC[C@H](CO)CC1 | 0.25g | 490591068
Beckman Coulter Sealing Foil for Automation, Gas-Permeable, for 48-Well Plates (M2P-F-RS48-10)
Gas-permeable sealing foil designed for automated handling of 48-well microtiter plates. The non-woven material and perforated silicone layer reduce evaporation while allowing uniform aeration; pre-cut slits permit automated sterile sampling and dosing and re-seal after piercing.
- Gas-permeable non-woven material for aeration and reduced condensation.
- Perforated silicone layer with one hole per well and pre-cut slits for automated sampling.
- Pre-cut slits close after piercing to minimize contamination and evaporation.
- Venting holes provide sufficient and uniform aeration across wells.
- Designed for use with automated foil applicators and liquid handling systems.
- Compatible with 48-well, non-microfluidic microtiter plates such as FlowerPlate and round well plate.
eMolecules 5597-50-2 | Methyl 3-(4-hydroxyphenyl)propanoate | Ambeed | MFCD00071577 | 180.203 | C10H12O3 | 98.000 | COC(=O)CCc1ccc(O)cc1 | 1g | 523728567
Methyl 3-(4-hydroxyphenyl)propanoate | Ambeed | 5597-50-2 | MFCD00071577 | 180.203 | C10H12O3 | 98.000 | COC(=O)CCc1ccc(O)cc1 | 1g | 523728567
eMolecules 2150-46-1 | Methyl 2,5-dihydroxybenzoate | Ambeed | MFCD00016464 | 168.148 | C8H8O4 | 98.000 | COC(=O)c1cc(O)ccc1O | 5g | 552588741
Methyl 2,5-dihydroxybenzoate | Ambeed | 2150-46-1 | MFCD00016464 | 168.148 | C8H8O4 | 98.000 | COC(=O)c1cc(O)ccc1O | 5g | 552588741
eMolecules 13148-83-9 | Methyl 3-oxocyclohexanecarboxylate | Ambeed | MFCD09031996 | 156.181 | C8H12O3 | 95.000 | COC(=O)C1CCCC(=O)C1 | 100mg | 490502497
Methyl 3-oxocyclohexanecarboxylate | Ambeed | 13148-83-9 | MFCD09031996 | 156.181 | C8H12O3 | 95.000 | COC(=O)C1CCCC(=O)C1 | 100mg | 490502497
CO | 250mg | 552726617](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502423143.PNG-250.jpg)
eMolecules 80657-57-4 | (S)-Methyl 3-hydroxy-2-methylpropanoate | Ambeed | MFCD00064520 | 118.132 | C5H10O3 | 97.000 | COC(=O)[C@@H](C)CO | 250mg | 552726617
(S)-Methyl 3-hydroxy-2-methylpropanoate | Ambeed | 80657-57-4 | MFCD00064520 | 118.132 | C5H10O3 | 97.000 | COC(=O)[C@@H](C)CO | 250mg | 552726617
eMolecules 374537-95-8 | Ambeed | Methyl 3-(4-(chlorosulfonyl)phenyl)propanoate | 1g | 586029843 | A284253 | MFCD02093942 | 262.7 | C10H11ClO4S
ChemScene | 3-Bromopyrazolo[15-a]pyridine-5-carboxylic acid | 100mg | 632295642 | CS-0155566 | 876379-79-2 | MFCD11518932 | 241.044 | C8H5BrN2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 17289-19-9 | Methyl 1-methyl-1H-imidazole-4-carboxylate | Ambeed | MFCD02179561 | 140.142 | C6H8N2O2 | 98.000 | COC(=O)c1cn(C)cn1 | 1g | 551674738
Methyl 1-methyl-1H-imidazole-4-carboxylate | Ambeed | 17289-19-9 | MFCD02179561 | 140.142 | C6H8N2O2 | 98.000 | COC(=O)c1cn(C)cn1 | 1g | 551674738