CAS RN 133730-34-4
CAS RN 133730-34-4
Thermo Scientific Chemicals 2,4-Dimethoxybenzeneboronic acid, 98%
CAS: 133730-34-4 Molecular Formula: C8H11BO4 Molecular Weight (g/mol): 181.982 MDL Number: MFCD01074590 InChI Key: SQTUYFKNCCBFRR-UHFFFAOYSA-N Synonym: 2,4-dimethoxybenzeneboronic acid,2,4-dimethoxyphenyl boronic acid,2,4-dimethoxyphenyl boranediol,boronic acid, 2,4-dimethoxyphenyl,2,4-dimethoxybenzene boronic acid,boronic acid, b-2,4-dimethoxyphenyl,pubchem1823,acmc-209btd,ksc174i6j,2,4-dimethoxyphenylboronicacid PubChem CID: 2734341 IUPAC Name: (2,4-dimethoxyphenyl)boronic acid SMILES: B(C1=C(C=C(C=C1)OC)OC)(O)O
2,4-Dimethoxyphenylboronic Acid (contains varying amounts of Anhydride), TCI America™
CAS: 133730-34-4 Molecular Formula: C8H11BO4 MDL Number: MFCD01074590 InChI Key: SQTUYFKNCCBFRR-UHFFFAOYSA-N PubChem CID: 2734341 IUPAC Name: (2,4-dimethoxyphenyl)boronic acid