CAS RN 74472-48-3
CAS RN 74472-48-3
IUPAC Name:
2,2',3,4,4',6,6'-heptachloro-1,1'-biphenyl
Synonyms:
2,2',3,4,4',6,6'-heptachloro-1,1'-biphenyl
Molecular Weight (g/mol):
395.31
Molecular Formula:
C12H3Cl7
InChi Key:
OBIUJJSQKPGKME-UHFFFAOYSA-N
SMILES:
ClC1=CC(Cl)=C(C(Cl)=C1)C1=C(Cl)C=C(Cl)C(Cl)=C1Cl