Cesium

Cesium, 99.98% (metals basis), Alfa Aesar

CAS: 7440-46-2 Molecular Formula: Cs Molecular Weight (g/mol): 132.905 MDL Number: MFCD00134037 InChI Key: TVFDJXOCXUVLDH-UHFFFAOYSA-N Synonym: atomic spectroscopy standard concentrate 1.00 g 1.00 g/l for 1 l standard solution, plasma standard solution specpure 10000g/ml, plasma standard solution specpure 1000g/ml, aas standard solution specpure 1000g/ml, or caesium un1407 dangerous when wet, ingot trace metals basis, trace metals basis 1g, chloride 1 m solution, acetate PubChem CID: 5354618 ChEBI: CHEBI:30514 IUPAC Name: cesium SMILES: [Cs]

Cesium carbonate, 99% (metals basis), Alfa Aesar™

CAS: 534-17-8 Molecular Formula: CCs2O3 Molecular Weight (g/mol): 325.819 MDL Number: MFCD00010957 InChI Key: FJDQFPXHSGXQBY-UHFFFAOYSA-L Synonym: cesium carbonate vetec tm reagent grade, cesium carbonate trace metals basis 50g, cesium carbonate trace metals basis, cesium carbonate cabot high-purity grade, cesium carbonate purum p.a t, cesium carbonate puriss. p.a, cesium carbonate reagentplus r, carbonic acid cesium salt 1:2 PubChem CID: 10796 IUPAC Name: dicesium;carbonate SMILES: C(=O)([O-])[O-].[Cs+].[Cs+]

Cesium Chloride (White Crystalline Powder/Molecular Biology), Fisher BioReagents Available on GSA/VA Contract for Federal Government customers only.

CAS: 7647-17-8 Molecular Formula: ClCs Molecular Weight (g/mol): 168.355 InChI Key: AIYUHDOJVYHVIT-UHFFFAOYSA-M Synonym: cesium chloride anhydrous free-flowing redi-dri tm reagentplus r, cesium chloride for molecular biology silver nitrate titration, cesium chloride anhydrous beads-10 mesh trace metals basis, cesium chloride bioultra for molecular biology at, cesium chloride optical grade trace metals basis, cesium chloride vetec tm reagent grade, cesium chloride ultrapure grade p.a., cesium chloride trace metals basis 25g, cesium chloride bioxtra titration, cesium chloride trace metals basis PubChem CID: 24293 ChEBI: CHEBI:63039 IUPAC Name: cesium;chloride SMILES: [Cl-].[Cs+]

Cesium Chloride (Crystalline/Certified), Fisher Chemical Available on GSA/VA Contract for Federal Government customers only.

CAS: 7647-17-8 Molecular Formula: ClCs Molecular Weight (g/mol): 168.355 MDL Number: MFCD00010955 InChI Key: AIYUHDOJVYHVIT-UHFFFAOYSA-M Synonym: cesium chloride anhydrous free-flowing redi-dri tm reagentplus r, cesium chloride for molecular biology silver nitrate titration, cesium chloride anhydrous beads-10 mesh trace metals basis, cesium chloride bioultra for molecular biology at, cesium chloride optical grade trace metals basis, cesium chloride vetec tm reagent grade, cesium chloride ultrapure grade p.a., cesium chloride trace metals basis 25g, cesium chloride bioxtra titration, cesium chloride trace metals basis PubChem CID: 24293 ChEBI: CHEBI:63039 IUPAC Name: cesium;chloride SMILES: [Cl-].[Cs+]

Cesium Chloride (Crystalline Powder), Fisher BioReagents

CAS: 7647-17-8 Molecular Formula: ClCs Molecular Weight (g/mol): 168.355 InChI Key: AIYUHDOJVYHVIT-UHFFFAOYSA-M Synonym: cesium chloride anhydrous free-flowing redi-dri tm reagentplus r, cesium chloride for molecular biology silver nitrate titration, cesium chloride anhydrous beads-10 mesh trace metals basis, cesium chloride bioultra for molecular biology at, cesium chloride optical grade trace metals basis, cesium chloride vetec tm reagent grade, cesium chloride ultrapure grade p.a., cesium chloride trace metals basis 25g, cesium chloride bioxtra titration, cesium chloride trace metals basis PubChem CID: 24293 ChEBI: CHEBI:63039 IUPAC Name: cesium;chloride SMILES: [Cl-].[Cs+]

Cesium nitrate, 99.99%, (trace metal basis), for analysis, ACROS Organics™

CAS: 7789-18-6 Molecular Formula: CsNO3 Molecular Weight (g/mol): 194.909 MDL Number: MFCD00010963 InChI Key: NLSCHDZTHVNDCP-UHFFFAOYSA-N Synonym: cesium nitrate or caesium nitrate un1451 oxidizer, cesium nitrate ionization buffer solution specpure, cesium nitrate trace metals basis 50g, cesium nitrate trace metals basis, cesium nitrate cabot high-purity grade, cesium nitrate puriss. p.a, cesium nitrate or caesium nitrate, nitric acid cesium salt 1:1 PubChem CID: 62674 IUPAC Name: cesium;nitrate SMILES: [N+](=O)([O-])[O-].[Cs+]

Cesium chloride, 99.99%, (trace metal basis), for spectroscopy, optical grade, ACROS Organics™

CAS: 7647-17-8 Molecular Formula: ClCs Molecular Weight (g/mol): 168.355 MDL Number: MFCD00010955 InChI Key: AIYUHDOJVYHVIT-UHFFFAOYSA-M Synonym: cesium chloride anhydrous free-flowing redi-dri tm reagentplus r, cesium chloride for molecular biology silver nitrate titration, cesium chloride anhydrous beads-10 mesh trace metals basis, cesium chloride bioultra for molecular biology at, cesium chloride optical grade trace metals basis, cesium chloride vetec tm reagent grade, cesium chloride ultrapure grade p.a., cesium chloride trace metals basis 25g, cesium chloride bioxtra titration, cesium chloride trace metals basis PubChem CID: 24293 ChEBI: CHEBI:63039 IUPAC Name: cesium;chloride SMILES: [Cl-].[Cs+]

Cesium hydroxide monohydrate, 99.95%, Acros Organics™

CAS: 35103-79-8 Molecular Formula: CsH3O2 Molecular Weight (g/mol): 167.927 MDL Number: MFCD00149664 InChI Key: ABSOMGPQFXJESQ-UHFFFAOYSA-M Synonym: cesium hydroxidemonohydrate 9ci, caesium 1+ ion hydrate hydroxide, cesium hydroxide hydrate, cesium hydroxide monohydrate, cesium hydroxide-hydrate, ksc493c5l PubChem CID: 23679066 IUPAC Name: cesium;hydroxide;hydrate SMILES: O.[OH-].[Cs+]

Cesium nitrate, 99.999% (metals basis), Alfa Aesar™

CAS: 7789-18-6 Molecular Formula: CsNO3 Molecular Weight (g/mol): 194.909 MDL Number: MFCD00010963 InChI Key: NLSCHDZTHVNDCP-UHFFFAOYSA-N Synonym: cesium nitrate or caesium nitrate un1451 oxidizer, cesium nitrate ionization buffer solution specpure, cesium nitrate trace metals basis 50g, cesium nitrate trace metals basis, cesium nitrate cabot high-purity grade, cesium nitrate puriss. p.a, cesium nitrate or caesium nitrate, nitric acid cesium salt 1:1 PubChem CID: 62674 IUPAC Name: cesium;nitrate SMILES: [N+](=O)([O-])[O-].[Cs+]

Cesium chloride, 99+%, pure, ACROS Organics™

CAS: 7647-17-8 Molecular Formula: ClCs Molecular Weight (g/mol): 168.355 MDL Number: MFCD00010955 InChI Key: AIYUHDOJVYHVIT-UHFFFAOYSA-M Synonym: cesium chloride anhydrous free-flowing redi-dri tm reagentplus r, cesium chloride for molecular biology silver nitrate titration, cesium chloride anhydrous beads-10 mesh trace metals basis, cesium chloride bioultra for molecular biology at, cesium chloride optical grade trace metals basis, cesium chloride vetec tm reagent grade, cesium chloride ultrapure grade p.a., cesium chloride trace metals basis 25g, cesium chloride bioxtra titration, cesium chloride trace metals basis PubChem CID: 24293 ChEBI: CHEBI:63039 IUPAC Name: cesium;chloride SMILES: [Cl-].[Cs+]

Cesium trifluoroacetate, Alfa Aesar™

CAS: 21907-50-6 Molecular Formula: C2CsF3O2 Molecular Weight (g/mol): 245.921 MDL Number: MFCD00051304 InChI Key: RJYSYRSELCQCSO-UHFFFAOYSA-M Synonym: cesium 222-tris fluoranyl ethanoate, trifluoroacetic acid cesium salt, caesium 1+ ion trifluoroacetate, cesium trifluoroacetate solution, caesio 222-trifluoroacetate, cesium 222-trifluoroacetate, caesium 1+ trifluoroacetate, caesium trifluoroacetate, cesium trifluoroacetate, cstfa PubChem CID: 23689558 IUPAC Name: cesium;2,2,2-trifluoroacetate SMILES: C(=O)(C(F)(F)F)[O-].[Cs+]

Cesium carbonate, 99.99%, Acros Organics™

CAS: 534-17-8 Molecular Formula: CCs2O3 Molecular Weight (g/mol): 325.819 MDL Number: MFCD00010957 InChI Key: FJDQFPXHSGXQBY-UHFFFAOYSA-L Synonym: cesium carbonate vetec tm reagent grade, cesium carbonate trace metals basis 50g, cesium carbonate trace metals basis, cesium carbonate cabot high-purity grade, cesium carbonate purum p.a t, cesium carbonate puriss. p.a, cesium carbonate reagentplus r, carbonic acid cesium salt 1:2 PubChem CID: 10796 IUPAC Name: dicesium;carbonate SMILES: C(=O)([O-])[O-].[Cs+].[Cs+]

Cesium chloride, 99.999% (metals basis), Alfa Aesar™

CAS: 7647-17-8 Molecular Formula: ClCs Molecular Weight (g/mol): 168.355 MDL Number: MFCD00010955 InChI Key: AIYUHDOJVYHVIT-UHFFFAOYSA-M Synonym: cesium chloride anhydrous free-flowing redi-dri tm reagentplus r, cesium chloride for molecular biology silver nitrate titration, cesium chloride anhydrous beads-10 mesh trace metals basis, cesium chloride bioultra for molecular biology at, cesium chloride optical grade trace metals basis, cesium chloride vetec tm reagent grade, cesium chloride ultrapure grade p.a., cesium chloride trace metals basis 25g, cesium chloride bioxtra titration, cesium chloride trace metals basis PubChem CID: 24293 ChEBI: CHEBI:63039 IUPAC Name: cesium;chloride SMILES: [Cl-].[Cs+]

Cesium hydroxide, 99.9%, (trace metal basis), for analysis, 50 wt.% solution in water, ACROS Organics™

CAS: 21351-79-1 Molecular Formula: CsHO Molecular Weight (g/mol): 149.912 MDL Number: MFCD00010964 InChI Key: HUCVOHYBFXVBRW-UHFFFAOYSA-M Synonym: cesium hydroxide solution 50 wt. % in h2o trace metals basis, cesium hydroxide w/w aqueous solution metals basis, cesium hydroxide monohydrate trace metals basis, caesium hydroxide solution un2681 corrosive, cesium hydroxide monohydrate technical grade, cesium hydroxide w/w aqueous solution, caesium hydroxide un2682 corrosive PubChem CID: 62750 ChEBI: CHEBI:33988 IUPAC Name: cesium;hydroxide SMILES: [OH-].[Cs+]

Cesium fluoride, 99%, for analysis, ACROS Organics™

CAS: 13400-13-0 Molecular Formula: CsF Molecular Weight (g/mol): 151.904 InChI Key: XJHCXCQVJFPJIK-UHFFFAOYSA-M Synonym: cesium fluoride trace metals basis 25g, cesium fluoride trace metals basis, cesium fluoride bioultra f, cesium fluoride purum p.a, cesium fluoride puratronic r, cesium fluoride p.a, caesium 1+ ion fluoride, cesium fluoride cs2f2, cesium fluoride PubChem CID: 25953 IUPAC Name: cesium;fluoride SMILES: [F-].[Cs+]

Cesium chloride, 99+%, for analysis, ACROS Organics™

CAS: 7647-17-8 Molecular Formula: ClCs Molecular Weight (g/mol): 168.355 MDL Number: MFCD00010955 InChI Key: AIYUHDOJVYHVIT-UHFFFAOYSA-M Synonym: cesium chloride anhydrous free-flowing redi-dri tm reagentplus r, cesium chloride for molecular biology silver nitrate titration, cesium chloride anhydrous beads-10 mesh trace metals basis, cesium chloride bioultra for molecular biology at, cesium chloride optical grade trace metals basis, cesium chloride vetec tm reagent grade, cesium chloride ultrapure grade p.a., cesium chloride trace metals basis 25g, cesium chloride bioxtra titration, cesium chloride trace metals basis PubChem CID: 24293 ChEBI: CHEBI:63039 IUPAC Name: cesium;chloride SMILES: [Cl-].[Cs+]

Cesium bromide, 99.9%, pure, ACROS Organics™

CAS: 7787-69-1 Molecular Formula: BrCs Molecular Weight (g/mol): 212.809 MDL Number: MFCD00010954 InChI Key: LYQFWZFBNBDLEO-UHFFFAOYSA-M Synonym: cesium bromide trace metals basis 50g, cesium bromide ultra dry, caesium 1+ ion bromide, cesium bromide csbr, cesium bromide, tricesium tribromide, caesium 1+ bromide, caesium i bromide, caesium bromide, unii-06m25edm3f PubChem CID: 24592 IUPAC Name: cesium;bromide SMILES: [Br-].[Cs+]

Cesium methanesulfonate, 98%, ACROS Organics™

CAS: 2550-61-0 Molecular Formula: CH3CsO3S Molecular Weight (g/mol): 227.997 InChI Key: DJKJXRLREATOMF-UHFFFAOYSA-M Synonym: cesium methanesulfonate used in patch clamp techniques, methanesulfonic acid cesium salt, caesium 1+ ion mesylate, cesium methanesulfonate, csmes, csmsf PubChem CID: 5148066 IUPAC Name: cesium;methanesulfonate SMILES: CS(=O)(=O)[O-].[Cs+]

Cesium chloride, 99% (metals basis), Alfa Aesar™

CAS: 7647-17-8 Molecular Formula: ClCs Molecular Weight (g/mol): 168.355 MDL Number: MFCD00010955 InChI Key: AIYUHDOJVYHVIT-UHFFFAOYSA-M Synonym: cesium chloride anhydrous free-flowing redi-dri tm reagentplus r, cesium chloride for molecular biology silver nitrate titration, cesium chloride anhydrous beads-10 mesh trace metals basis, cesium chloride bioultra for molecular biology at, cesium chloride optical grade trace metals basis, cesium chloride vetec tm reagent grade, cesium chloride ultrapure grade p.a., cesium chloride trace metals basis 25g, cesium chloride bioxtra titration, cesium chloride trace metals basis PubChem CID: 24293 ChEBI: CHEBI:63039 IUPAC Name: cesium;chloride SMILES: [Cl-].[Cs+]

Cesium sulfate, 99+%, pure, ACROS Organics™

CAS: 10294-54-9 Molecular Formula: Cs2O4S Molecular Weight (g/mol): 361.867 MDL Number: MFCD00010959 InChI Key: FLJPGEWQYJVDPF-UHFFFAOYSA-L Synonym: cesium sulfate trace metals basis 25g, cesium sulfate vetec tm reagent grade, cesium sulfate trace metals basis, cesium sulfate puriss. p.a t, cesium sulfate ultrapure grade, sulfuric acid cesium salt 1:2, cesium sulfate grade i, sulfuric acid dicesium salt, cesium sulfate puratronic, dicaesium 1+ ion sulfate PubChem CID: 25137 IUPAC Name: dicesium;sulfate SMILES: [O-]S(=O)(=O)[O-].[Cs+].[Cs+]

Cesium carbonate, 99.5%, for analysis, ACROS Organics™

CAS: 534-17-8 Molecular Formula: CCs2O3 Molecular Weight (g/mol): 325.819 MDL Number: MFCD00010957 InChI Key: FJDQFPXHSGXQBY-UHFFFAOYSA-L Synonym: cesium carbonate vetec tm reagent grade, cesium carbonate trace metals basis 50g, cesium carbonate trace metals basis, cesium carbonate cabot high-purity grade, cesium carbonate purum p.a t, cesium carbonate puriss. p.a, cesium carbonate reagentplus r, carbonic acid cesium salt 1:2 PubChem CID: 10796 IUPAC Name: dicesium;carbonate SMILES: C(=O)([O-])[O-].[Cs+].[Cs+]

Cesium carbonate, 99.9% (metals basis), Alfa Aesar

CAS: 534-17-8 Molecular Formula: CCs2O3 Molecular Weight (g/mol): 325.819 InChI Key: FJDQFPXHSGXQBY-UHFFFAOYSA-L Synonym: cesium carbonate vetec tm reagent grade, cesium carbonate trace metals basis 50g, cesium carbonate trace metals basis, cesium carbonate cabot high-purity grade, cesium carbonate purum p.a t, cesium carbonate puriss. p.a, cesium carbonate reagentplus r, carbonic acid cesium salt 1:2 PubChem CID: 10796 IUPAC Name: dicesium;carbonate SMILES: C(=O)([O-])[O-].[Cs+].[Cs+]

Cesium Chloride, For Analysis, EMSURE™, EMD Millipore™ Available on GSA/VA Contract for Federal Government customers only.

CAS: 7647-17-8 Molecular Formula: ClCs Molecular Weight (g/mol): 168.355 InChI Key: AIYUHDOJVYHVIT-UHFFFAOYSA-M Synonym: cesium chloride anhydrous free-flowing redi-dri tm reagentplus r, cesium chloride for molecular biology silver nitrate titration, cesium chloride anhydrous beads-10 mesh trace metals basis, cesium chloride bioultra for molecular biology at, cesium chloride optical grade trace metals basis, cesium chloride vetec tm reagent grade, cesium chloride ultrapure grade p.a., cesium chloride trace metals basis 25g, cesium chloride bioxtra titration, cesium chloride trace metals basis PubChem CID: 24293 ChEBI: CHEBI:63039 IUPAC Name: cesium;chloride SMILES: [Cl-].[Cs+]

Cesium chloride, 99.999%, (trace metal basis), extra pure, ACROS Organics™

CAS: 7647-17-8 Molecular Formula: ClCs Molecular Weight (g/mol): 168.355 InChI Key: AIYUHDOJVYHVIT-UHFFFAOYSA-M Synonym: cesium chloride anhydrous free-flowing redi-dri tm reagentplus r, cesium chloride for molecular biology silver nitrate titration, cesium chloride anhydrous beads-10 mesh trace metals basis, cesium chloride bioultra for molecular biology at, cesium chloride optical grade trace metals basis, cesium chloride vetec tm reagent grade, cesium chloride ultrapure grade p.a., cesium chloride trace metals basis 25g, cesium chloride bioxtra titration, cesium chloride trace metals basis PubChem CID: 24293 ChEBI: CHEBI:63039 IUPAC Name: cesium;chloride SMILES: [Cl-].[Cs+]

Cesium hydroxide hydrate, 99.9% (metals basis), Alfa Aesar™

CAS: 12260-45-6 Molecular Formula: CsH3O2 Molecular Weight (g/mol): 167.927 MDL Number: MFCD00010964 InChI Key: ABSOMGPQFXJESQ-UHFFFAOYSA-M Synonym: cesium hydroxidemonohydrate 9ci, caesium 1+ ion hydrate hydroxide, cesium hydroxide hydrate, cesium hydroxide monohydrate, cesium hydroxide-hydrate, ksc493c5l PubChem CID: 23679066 IUPAC Name: cesium;hydroxide;hydrate SMILES: O.[OH-].[Cs+]

Cesium nitrate, 99.8% (metals basis), Alfa Aesar

CAS: 7789-18-6 Molecular Formula: CsNO3 Molecular Weight (g/mol): 194.909 InChI Key: NLSCHDZTHVNDCP-UHFFFAOYSA-N Synonym: cesium nitrate or caesium nitrate un1451 oxidizer, cesium nitrate ionization buffer solution specpure, cesium nitrate trace metals basis 50g, cesium nitrate trace metals basis, cesium nitrate cabot high-purity grade, cesium nitrate puriss. p.a, cesium nitrate or caesium nitrate, nitric acid cesium salt 1:1 PubChem CID: 62674 IUPAC Name: cesium;nitrate SMILES: [N+](=O)([O-])[O-].[Cs+]

Cesium acetate, 99% (metals basis), Alfa Aesar™

CAS: 3396-11-0 Molecular Formula: C2H3CsO2 Molecular Weight (g/mol): 191.949 MDL Number: MFCD00013056 InChI Key: ZOAIGCHJWKDIPJ-UHFFFAOYSA-M Synonym: cesium acetate vetec tm reagent grade, cesium acetate trace metals basis, cesium acetate trace metals basis 50g, cesium acetate technical grade, acetic acid cesium salt 1:1, acetic acid cesium salt, caesium 1+ ion acetate, acetic acid cesiumsalt PubChem CID: 5152919 IUPAC Name: cesium;acetate SMILES: CC(=O)[O-].[Cs+]

Cesium chloride, 99.9% (metals basis), Alfa Aesar

CAS: 7647-17-8 Molecular Formula: ClCs Molecular Weight (g/mol): 168.355 InChI Key: AIYUHDOJVYHVIT-UHFFFAOYSA-M Synonym: cesium chloride anhydrous free-flowing redi-dri tm reagentplus r, cesium chloride for molecular biology silver nitrate titration, cesium chloride anhydrous beads-10 mesh trace metals basis, cesium chloride bioultra for molecular biology at, cesium chloride optical grade trace metals basis, cesium chloride vetec tm reagent grade, cesium chloride ultrapure grade p.a., cesium chloride trace metals basis 25g, cesium chloride bioxtra titration, cesium chloride trace metals basis PubChem CID: 24293 ChEBI: CHEBI:63039 IUPAC Name: cesium;chloride SMILES: [Cl-].[Cs+]

Cesium iodide, 99.9%, for analysis, ACROS Organics™

CAS: 7789-17-5 Molecular Formula: CsI Molecular Weight (g/mol): 259.81 MDL Number: MFCD00010962 InChI Key: XQPRBTXUXXVTKB-UHFFFAOYSA-M Synonym: cesium iodide trace metals basis 25g, cesium iodide ultra dry, caesium 1+ ion iodide, cesium iodide cs2i2, cesium iodide cs3i3, cesium iodide, tricesium triiodide, caesium 1+ iodide, cesium monoiodide PubChem CID: 24601 IUPAC Name: cesium;iodide SMILES: [I-].[Cs+]

Cesium carbonate, 99.99% (metals basis), Alfa Aesar™

CAS: 534-17-8 Molecular Formula: CCs2O3 Molecular Weight (g/mol): 325.819 MDL Number: MFCD00010957 InChI Key: FJDQFPXHSGXQBY-UHFFFAOYSA-L Synonym: cesium carbonate vetec tm reagent grade, cesium carbonate trace metals basis 50g, cesium carbonate trace metals basis, cesium carbonate cabot high-purity grade, cesium carbonate purum p.a t, cesium carbonate puriss. p.a, cesium carbonate reagentplus r, carbonic acid cesium salt 1:2 PubChem CID: 10796 IUPAC Name: dicesium;carbonate SMILES: C(=O)([O-])[O-].[Cs+].[Cs+]

  spinner