Promotional price valid on web orders only. Your contract pricing may differ. Interested in signing up for a dedicated account number?
Learn More
Learn More
Fisher Science Education™ Safranin Stain Solution, 1%
| Quantity | 500 mL |
|---|
Chemical Identifiers
| 477-73-6, 532-32-1, 7732-18-5 | |
| 350.85 | |
| QRYAEWIQIBAZOJ-UHFFFAOYSA-N | |
| 2723800 | |
| [Cl-].CC1=C(N)C=C2C(=C1)N=C1C(C)=C(N)C=CC1=[N+]2C1=CC=CC=C1 |
| C20H19ClN4 | |
| MFCD00011759 | |
| basic red 2, safranine o, gossypimine, safranin, safranine t, safranin o, safranin t, safranine, tolusafranine, hidaco safranine | |
| 2,7-diamino-1,8-dimethyl-5-phenyl-5λ⁵-phenazin-5-ylium chloride |
Specifications
| 477-73-6, 532-32-1, 7732-18-5 | |
| 1.0, 0.2, 98.8 | |
| MFCD00011759 | |
| basic red 2, safranine o, gossypimine, safranin, safranine t, safranin o, safranin t, safranine, tolusafranine, hidaco safranine | |
| [Cl-].CC1=C(N)C=C2C(=C1)N=C1C(C)=C(N)C=CC1=[N+]2C1=CC=CC=C1 | |
| 350.85 | |
| 1% | |
| Liquid |
| 0.0 | |
| C20H19ClN4 | |
| 1.000 | |
| QRYAEWIQIBAZOJ-UHFFFAOYSA-N | |
| 2,7-diamino-1,8-dimethyl-5-phenyl-5λ⁵-phenazin-5-ylium chloride | |
| 2723800 | |
| 500 mL | |
| Safranin Staining Solution, 1% |
Safety and Handling
Product Content Correction
Your input is important to us. Please complete this form to provide feedback related to the content on this product.
Product Title
Spot an opportunity for improvement?Share a Content Correction