Chemicals
Filtered Search Results
1-Methyl-2-pyrrolidinone, 99.5%, Extra Dry, AcroSeal™
CAS: 872-50-4 Molecular Formula: C5H9NO Molecular Weight (g/mol): 99.133 MDL Number: MFCD00003193 InChI Key: SECXISVLQFMRJM-UHFFFAOYSA-N Synonym: 1-methyl-2-pyrrolidinone,n-methyl-2-pyrrolidone,n-methylpyrrolidone,1-methyl-2-pyrrolidone,methylpyrrolidone,m-pyrol,n-methyl-2-pyrrolidinone,n-methylpyrrolidinone,1-methylpyrrolidinone,2-pyrrolidinone, 1-methyl PubChem CID: 13387 ChEBI: CHEBI:7307 IUPAC Name: 1-methylpyrrolidin-2-one SMILES: CN1CCCC1=O
| PubChem CID | 13387 |
|---|---|
| CAS | 872-50-4 |
| Molecular Weight (g/mol) | 99.133 |
| ChEBI | CHEBI:7307 |
| MDL Number | MFCD00003193 |
| SMILES | CN1CCCC1=O |
| Synonym | 1-methyl-2-pyrrolidinone,n-methyl-2-pyrrolidone,n-methylpyrrolidone,1-methyl-2-pyrrolidone,methylpyrrolidone,m-pyrol,n-methyl-2-pyrrolidinone,n-methylpyrrolidinone,1-methylpyrrolidinone,2-pyrrolidinone, 1-methyl |
| IUPAC Name | 1-methylpyrrolidin-2-one |
| InChI Key | SECXISVLQFMRJM-UHFFFAOYSA-N |
| Molecular Formula | C5H9NO |
Hydrochloric acid, 10% v/v aq. soln.
CAS: 7647-01-0 Molecular Formula: ClH Molecular Weight (g/mol): 36.46 MDL Number: MFCD00011324 MFCD00792839 InChI Key: VEXZGXHMUGYJMC-UHFFFAOYSA-N Synonym: hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof PubChem CID: 313 ChEBI: CHEBI:17883 SMILES: Cl
| PubChem CID | 313 |
|---|---|
| CAS | 7647-01-0 |
| Molecular Weight (g/mol) | 36.46 |
| ChEBI | CHEBI:17883 |
| MDL Number | MFCD00011324 MFCD00792839 |
| SMILES | Cl |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Molecular Formula | ClH |
Ascarite™ II, CO2 absorbent, 20-30 mesh, capacity: 40-50%, product of Arthur H. Thomas Company
Ascarite(II), CO2 absorbent, 20-30 mesh, capacity: 40-50%, CAS Number-81133-20-2, 1310-73-2, 7631-86-9, 100g, Beige to Brown, Danger, GHS H Statement: Causes severe skin burns and eye damage. | CAS: 81133-20-2
| Particle Size | Particle size analysis: 20 to 30 mesh |
|---|---|
| Name Note | 20- to 30-mesh |
| CAS | 7631-86-9 |
| Health Hazard 3 | GHS P Statement: Do not breathe dust/fume/gas/mist/vapors/spray. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Wash face, hands and any exposed skin thoroughly after handling. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| MDL Number | MFCD00132264 |
| Health Hazard 2 | GHS H Statement: Causes severe skin burns and eye damage. |
| Color | Beige to Brown |
| Packaging | Glass Bottle |
| Health Hazard 1 | Danger |
| Physical Form | Granular |
| Chemical Name or Material | Ascarite(II)™, CO2 absorbent, 20-30 mesh, capacity: 40-50% |
Hexanes, 99%, ACS reagent, mixture of isomers
CAS: 92112-69-1 Molecular Formula: C6H14 MDL Number: MFCD00009520 Synonym: Hex
| CAS | 92112-69-1 |
|---|---|
| MDL Number | MFCD00009520 |
| Synonym | Hex |
| Molecular Formula | C6H14 |
Sodium bicarbonate, 99.5%, for analysis
CAS: 144-55-8 Molecular Formula: CHNaO3 Molecular Weight (g/mol): 84.01 MDL Number: MFCD00003528 InChI Key: UIIMBOGNXHQVGW-UHFFFAOYSA-M Synonym: sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut PubChem CID: 516892 ChEBI: CHEBI:32139 SMILES: [Na+].OC([O-])=O
| PubChem CID | 516892 |
|---|---|
| CAS | 144-55-8 |
| Molecular Weight (g/mol) | 84.01 |
| ChEBI | CHEBI:32139 |
| MDL Number | MFCD00003528 |
| SMILES | [Na+].OC([O-])=O |
| Synonym | sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut |
| InChI Key | UIIMBOGNXHQVGW-UHFFFAOYSA-M |
| Molecular Formula | CHNaO3 |
Tannic acid, ACS reagent
CAS: 1401-55-4 Molecular Formula: C76H52O46 Molecular Weight (g/mol): 1701.206 MDL Number: MFCD00066397 InChI Key: LRBQNJMCXXYXIU-JPZKJCTESA-N Synonym: tannins,gallotannic acid,quebracho extract,acide tannique,d'acide tannique,tannic acid usp:jan,unii-28f9e0djy6 PubChem CID: 134129492 SMILES: C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)OCC3C(C(C(C(O3)OC(=O)C4=CC(=C(C(=C4)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)OC(=O)C9=CC(=C(C(=C9)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)OC(=O)C1=CC(=C(
| PubChem CID | 134129492 |
|---|---|
| CAS | 1401-55-4 |
| Molecular Weight (g/mol) | 1701.206 |
| MDL Number | MFCD00066397 |
| SMILES | C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)OCC3C(C(C(C(O3)OC(=O)C4=CC(=C(C(=C4)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)OC(=O)C9=CC(=C(C(=C9)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)OC(=O)C1=CC(=C( |
| Synonym | tannins,gallotannic acid,quebracho extract,acide tannique,d'acide tannique,tannic acid usp:jan,unii-28f9e0djy6 |
| InChI Key | LRBQNJMCXXYXIU-JPZKJCTESA-N |
| Molecular Formula | C76H52O46 |
Borane dimethyl sulfide complex, 94%, AcroSeal™
CAS: 13292-87-0 Molecular Formula: C2H9BS Molecular Weight (g/mol): 75.96 MDL Number: MFCD00013189 InChI Key: RMHDLBZYPISZOI-UHFFFAOYSA-N Synonym: dimethyl sulfide borane,borane-methyl sulfide complex,borane dimethyl sulfide complex,borane-dimethyl sulfide,dimethyl sulfideborane,dimethyl sulfide trihydroboron,borane-dimethyl sulfide complex,borane methylsulfide,borane dimethylsulfide,borane dms PubChem CID: 9833925 IUPAC Name: boron;methylsulfanylmethane SMILES: B.CSC
| PubChem CID | 9833925 |
|---|---|
| CAS | 13292-87-0 |
| Molecular Weight (g/mol) | 75.96 |
| MDL Number | MFCD00013189 |
| SMILES | B.CSC |
| Synonym | dimethyl sulfide borane,borane-methyl sulfide complex,borane dimethyl sulfide complex,borane-dimethyl sulfide,dimethyl sulfideborane,dimethyl sulfide trihydroboron,borane-dimethyl sulfide complex,borane methylsulfide,borane dimethylsulfide,borane dms |
| IUPAC Name | boron;methylsulfanylmethane |
| InChI Key | RMHDLBZYPISZOI-UHFFFAOYSA-N |
| Molecular Formula | C2H9BS |
Sodium metaperiodate, ACS, 99.8-100.3%
CAS: 7790-28-5 Molecular Formula: INaO4 Molecular Weight (g/mol): 213.89 MDL Number: MFCD00003534 InChI Key: JQWHASGSAFIOCM-UHFFFAOYSA-M Synonym: sodium periodate,sodium metaperiodate,sodium m-periodate,sodiumperiodate,sodium meta periodate,periodic acid, sodium salt,sodium meta-periodate,periodic acid hio4 , sodium salt,periodate sodium,sodium penodate PubChem CID: 23667635 ChEBI: CHEBI:75226 IUPAC Name: sodium;periodate SMILES: [Na+].[O-][I](=O)(=O)=O
| PubChem CID | 23667635 |
|---|---|
| CAS | 7790-28-5 |
| Molecular Weight (g/mol) | 213.89 |
| ChEBI | CHEBI:75226 |
| MDL Number | MFCD00003534 |
| SMILES | [Na+].[O-][I](=O)(=O)=O |
| Synonym | sodium periodate,sodium metaperiodate,sodium m-periodate,sodiumperiodate,sodium meta periodate,periodic acid, sodium salt,sodium meta-periodate,periodic acid hio4 , sodium salt,periodate sodium,sodium penodate |
| IUPAC Name | sodium;periodate |
| InChI Key | JQWHASGSAFIOCM-UHFFFAOYSA-M |
| Molecular Formula | INaO4 |
Potassium acetate, ACS, 99% min
CAS: 127-08-2 Molecular Formula: C2H3KO2 Molecular Weight (g/mol): 98.142 MDL Number: MFCD00012458 InChI Key: SCVFZCLFOSHCOH-UHFFFAOYSA-M Synonym: potassium acetate,acetic acid, potassium salt,diuretic salt,potassium ethanoate,koac,octan draselny czech,potassiumacetate,acetic acid potassium salt,acok,fema no. 2920 PubChem CID: 517044 ChEBI: CHEBI:32029 IUPAC Name: potassium;acetate SMILES: CC(=O)[O-].[K+]
| PubChem CID | 517044 |
|---|---|
| CAS | 127-08-2 |
| Molecular Weight (g/mol) | 98.142 |
| ChEBI | CHEBI:32029 |
| MDL Number | MFCD00012458 |
| SMILES | CC(=O)[O-].[K+] |
| Synonym | potassium acetate,acetic acid, potassium salt,diuretic salt,potassium ethanoate,koac,octan draselny czech,potassiumacetate,acetic acid potassium salt,acok,fema no. 2920 |
| IUPAC Name | potassium;acetate |
| InChI Key | SCVFZCLFOSHCOH-UHFFFAOYSA-M |
| Molecular Formula | C2H3KO2 |
Styrene, 99.5%, for analysis, stabilized
CAS: 100-42-5 Molecular Formula: C8H8 Molecular Weight (g/mol): 104.15 MDL Number: MFCD00008612,MFCD00084450 InChI Key: PPBRXRYQALVLMV-UHFFFAOYSA-N Synonym: ethenylbenzene,phenylethylene,vinylbenzene,styrol,benzene, ethenyl,cinnamene,phenylethene,monomer,phenethylene,styrolene PubChem CID: 7501 ChEBI: CHEBI:27452 IUPAC Name: styrene SMILES: C=CC1=CC=CC=C1
| PubChem CID | 7501 |
|---|---|
| CAS | 100-42-5 |
| Molecular Weight (g/mol) | 104.15 |
| ChEBI | CHEBI:27452 |
| MDL Number | MFCD00008612,MFCD00084450 |
| SMILES | C=CC1=CC=CC=C1 |
| Synonym | ethenylbenzene,phenylethylene,vinylbenzene,styrol,benzene, ethenyl,cinnamene,phenylethene,monomer,phenethylene,styrolene |
| IUPAC Name | styrene |
| InChI Key | PPBRXRYQALVLMV-UHFFFAOYSA-N |
| Molecular Formula | C8H8 |
| CAS | 9000-01-5 |
|---|---|
| MDL Number | MFCD00081264 |
| Synonym | Acacia |
Guaiacol, 99+%
CAS: 90-05-1 Molecular Formula: C7H8O2 Molecular Weight (g/mol): 124.14 InChI Key: LHGVFZTZFXWLCP-UHFFFAOYSA-N Synonym: guaiacol,o-methoxyphenol,2-hydroxyanisole,phenol, 2-methoxy,pyrocatechol monomethyl ether,methylcatechol,guaiastil,guaicol,1-hydroxy-2-methoxybenzene,pyroguaiac acid PubChem CID: 460 ChEBI: CHEBI:28591 IUPAC Name: 2-methoxyphenol SMILES: COC1=CC=CC=C1O
| PubChem CID | 460 |
|---|---|
| CAS | 90-05-1 |
| Molecular Weight (g/mol) | 124.14 |
| ChEBI | CHEBI:28591 |
| SMILES | COC1=CC=CC=C1O |
| Synonym | guaiacol,o-methoxyphenol,2-hydroxyanisole,phenol, 2-methoxy,pyrocatechol monomethyl ether,methylcatechol,guaiastil,guaicol,1-hydroxy-2-methoxybenzene,pyroguaiac acid |
| IUPAC Name | 2-methoxyphenol |
| InChI Key | LHGVFZTZFXWLCP-UHFFFAOYSA-N |
| Molecular Formula | C7H8O2 |
Thermo Scientific Chemicals Propidium iodide, 95%
CAS: 25535-16-4 Molecular Formula: C27H34I2N4 Molecular Weight (g/mol): 668.39 InChI Key: XJMOSONTPMZWPB-UHFFFAOYSA-M Synonym: propidium iodide,propidium diiodide,3,8-diamino-5-3-diethyl methyl ammonio propyl-6-phenylphenanthridin-5-ium iodide,unii-tp416o228t,3,8-diamino-5-3-diethylmethylammonio propyl-6-phenylphenanthridinium diiodide,3,8-diamino-5-3-diethylaminopropyl-6-phenylphenanthridinium iodide methiodide,phenanthridinium, 3,8-diamino-5-3-diethylmethylammonio propyl-6-phenyl-, diiodide PubChem CID: 104981 ChEBI: CHEBI:51240 IUPAC Name: 3-(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)propyl-diethyl-methylazanium;diiodide SMILES: CC[N+](C)(CC)CCC[N+]1=C2C=C(C=CC2=C3C=CC(=CC3=C1C4=CC=CC=C4)N)N.[I-].[I-]
| PubChem CID | 104981 |
|---|---|
| CAS | 25535-16-4 |
| Molecular Weight (g/mol) | 668.39 |
| ChEBI | CHEBI:51240 |
| SMILES | CC[N+](C)(CC)CCC[N+]1=C2C=C(C=CC2=C3C=CC(=CC3=C1C4=CC=CC=C4)N)N.[I-].[I-] |
| Synonym | propidium iodide,propidium diiodide,3,8-diamino-5-3-diethyl methyl ammonio propyl-6-phenylphenanthridin-5-ium iodide,unii-tp416o228t,3,8-diamino-5-3-diethylmethylammonio propyl-6-phenylphenanthridinium diiodide,3,8-diamino-5-3-diethylaminopropyl-6-phenylphenanthridinium iodide methiodide,phenanthridinium, 3,8-diamino-5-3-diethylmethylammonio propyl-6-phenyl-, diiodide |
| IUPAC Name | 3-(3,8-diamino-6-phenylphenanthridin-5-ium-5-yl)propyl-diethyl-methylazanium;diiodide |
| InChI Key | XJMOSONTPMZWPB-UHFFFAOYSA-M |
| Molecular Formula | C27H34I2N4 |
Oxalic acid, anhydrous, 98%
CAS: 144-62-7 Molecular Formula: C2H2O4 Molecular Weight (g/mol): 90.034 MDL Number: MFCD00002573 InChI Key: MUBZPKHOEPUJKR-UHFFFAOYSA-N Synonym: ethanedioic acid,aktisal,aquisal,oxiric acid,oxalate,oxalsaeure,oxaalzuur,kyselina stavelova,acide oxalique,acido ossalico PubChem CID: 971 ChEBI: CHEBI:16995 IUPAC Name: oxalic acid SMILES: C(=O)(C(=O)O)O
| PubChem CID | 971 |
|---|---|
| CAS | 144-62-7 |
| Molecular Weight (g/mol) | 90.034 |
| ChEBI | CHEBI:16995 |
| MDL Number | MFCD00002573 |
| SMILES | C(=O)(C(=O)O)O |
| Synonym | ethanedioic acid,aktisal,aquisal,oxiric acid,oxalate,oxalsaeure,oxaalzuur,kyselina stavelova,acide oxalique,acido ossalico |
| IUPAC Name | oxalic acid |
| InChI Key | MUBZPKHOEPUJKR-UHFFFAOYSA-N |
| Molecular Formula | C2H2O4 |
Murexide
CAS: 3051-09-0 Molecular Formula: C8H3N5O6-2 Molecular Weight (g/mol): 265.141 MDL Number: MFCD00012777 InChI Key: MUMMBXDKKJEASE-UHFFFAOYSA-L Synonym: murexide,ammonium purpurate acid,6-oxo-5-2,4,6-trioxo-1,3-diazinan-5-ylidene amino-1h-pyrimidine-2,4-diolate,5-hexahydro-2,4,6-trioxo-5-pyrimidinyl imino-2,4,6 1h,3h,5h-pyrimidinetrione ammonium salt,6-oxidanylidene-5-2,4,6-tris oxidanylidene-1,3-diazinan-5-ylidene amino-1h-pyrimidine-2,4-diolate PubChem CID: 51381221 IUPAC Name: 6-oxo-5-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)amino]-1H-pyrimidine-2,4-diolate SMILES: C1(=C(N=C(NC1=O)[O-])[O-])N=C2C(=O)NC(=O)NC2=O
| PubChem CID | 51381221 |
|---|---|
| CAS | 3051-09-0 |
| Molecular Weight (g/mol) | 265.141 |
| MDL Number | MFCD00012777 |
| SMILES | C1(=C(N=C(NC1=O)[O-])[O-])N=C2C(=O)NC(=O)NC2=O |
| Synonym | murexide,ammonium purpurate acid,6-oxo-5-2,4,6-trioxo-1,3-diazinan-5-ylidene amino-1h-pyrimidine-2,4-diolate,5-hexahydro-2,4,6-trioxo-5-pyrimidinyl imino-2,4,6 1h,3h,5h-pyrimidinetrione ammonium salt,6-oxidanylidene-5-2,4,6-tris oxidanylidene-1,3-diazinan-5-ylidene amino-1h-pyrimidine-2,4-diolate |
| IUPAC Name | 6-oxo-5-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)amino]-1H-pyrimidine-2,4-diolate |
| InChI Key | MUMMBXDKKJEASE-UHFFFAOYSA-L |
| Molecular Formula | C8H3N5O6-2 |