Chemicals
Filtered Search Results
N-Methyldiethanolamine, 99+%, Thermo Scientific Chemicals
CAS: 105-59-9 Molecular Formula: C5H13NO2 Molecular Weight (g/mol): 119.16 MDL Number: MFCD00002848 InChI Key: CRVGTESFCCXCTH-UHFFFAOYSA-N Synonym: n-methyldiethanolamine,methyldiethanolamine,2,2'-methylimino diethanol,ethanol, 2,2'-methylimino bis,methyl diethanolamine,n-methyliminodiethanol,n-methyl-2,2'-iminodiethanol,n-methylaminodiglycol,2,2'-methyliminodiethanol,n-methyldiethanolimine PubChem CID: 7767 SMILES: CN(CCO)CCO
| PubChem CID | 7767 |
|---|---|
| CAS | 105-59-9 |
| Molecular Weight (g/mol) | 119.16 |
| MDL Number | MFCD00002848 |
| SMILES | CN(CCO)CCO |
| Synonym | n-methyldiethanolamine,methyldiethanolamine,2,2'-methylimino diethanol,ethanol, 2,2'-methylimino bis,methyl diethanolamine,n-methyliminodiethanol,n-methyl-2,2'-iminodiethanol,n-methylaminodiglycol,2,2'-methyliminodiethanol,n-methyldiethanolimine |
| InChI Key | CRVGTESFCCXCTH-UHFFFAOYSA-N |
| Molecular Formula | C5H13NO2 |
Chloroform Molecular Biology MP Biomedicals
CAS: 67-66-3 Molecular Formula: CHCl3 Molecular Weight (g/mol): 119.37 MDL Number: MFCD00000826 InChI Key: HEDRZPFGACZZDS-UHFFFAOYSA-N Synonym: trichloromethane,formyl trichloride,methane, trichloro,trichloroform,methane trichloride,methenyl trichloride,methyl trichloride,trichlormethan,chloroforme,cloroformio PubChem CID: 6212 ChEBI: CHEBI:35255 SMILES: ClC(Cl)Cl
| PubChem CID | 6212 |
|---|---|
| CAS | 67-66-3 |
| Molecular Weight (g/mol) | 119.37 |
| ChEBI | CHEBI:35255 |
| MDL Number | MFCD00000826 |
| SMILES | ClC(Cl)Cl |
| Synonym | trichloromethane,formyl trichloride,methane, trichloro,trichloroform,methane trichloride,methenyl trichloride,methyl trichloride,trichlormethan,chloroforme,cloroformio |
| InChI Key | HEDRZPFGACZZDS-UHFFFAOYSA-N |
| Molecular Formula | CHCl3 |
Activated charcoal, NORIT™ SA 2, decolorizing
CAS: 7440-44-0 Molecular Formula: C Molecular Weight (g/mol): 12 MDL Number: MFCD00133992 InChI Key: OKTJSMMVPCPJKN-UHFFFAOYSA-N Synonym: graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve PubChem CID: 5462310 ChEBI: CHEBI:27594 IUPAC Name: carbon SMILES: [C]
| PubChem CID | 5462310 |
|---|---|
| CAS | 7440-44-0 |
| Molecular Weight (g/mol) | 12 |
| ChEBI | CHEBI:27594 |
| MDL Number | MFCD00133992 |
| SMILES | [C] |
| Synonym | graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve |
| IUPAC Name | carbon |
| InChI Key | OKTJSMMVPCPJKN-UHFFFAOYSA-N |
| Molecular Formula | C |
Deuterium oxide, for NMR, packaged in 0.75 ml ampoules, 100.0 atom % D
CAS: 7789-20-0 Molecular Formula: H2O Molecular Weight (g/mol): 20.03 MDL Number: MFCD00044636 InChI Key: XLYOFNOQVPJJNP-ZSJDYOACSA-N Synonym: deuterium oxide,water-d2,heavy water,deuterated water,dideuterium oxide,heavy water-d2,heavy water d2o,water sup 2-h2,deuterium oxide usan,water, heavy d2-o PubChem CID: 24602 ChEBI: CHEBI:41981 IUPAC Name: [(²H)oxy](²H) SMILES: [2H]O[2H]
| PubChem CID | 24602 |
|---|---|
| CAS | 7789-20-0 |
| Molecular Weight (g/mol) | 20.03 |
| ChEBI | CHEBI:41981 |
| MDL Number | MFCD00044636 |
| SMILES | [2H]O[2H] |
| Synonym | deuterium oxide,water-d2,heavy water,deuterated water,dideuterium oxide,heavy water-d2,heavy water d2o,water sup 2-h2,deuterium oxide usan,water, heavy d2-o |
| IUPAC Name | [(²H)oxy](²H) |
| InChI Key | XLYOFNOQVPJJNP-ZSJDYOACSA-N |
| Molecular Formula | H2O |
Ferric Chloride, Anhydrous, MP Biomedicals
CAS: 7705-08-0 Molecular Formula: Cl3Fe Molecular Weight (g/mol): 162.20 MDL Number: MFCD00011005 InChI Key: RBTARNINKXHZNM-UHFFFAOYSA-K IUPAC Name: iron(3+) trichloride SMILES: [Cl-].[Cl-].[Cl-].[Fe+3]
| CAS | 7705-08-0 |
|---|---|
| Molecular Weight (g/mol) | 162.20 |
| MDL Number | MFCD00011005 |
| SMILES | [Cl-].[Cl-].[Cl-].[Fe+3] |
| IUPAC Name | iron(3+) trichloride |
| InChI Key | RBTARNINKXHZNM-UHFFFAOYSA-K |
| Molecular Formula | Cl3Fe |
Sodium polyanetholesulfonate
CAS: 55963-78-5 Molecular Formula: (C10H11NaO4S)n Molecular Weight (g/mol): NaN MDL Number: MFCD00148427 InChI Key: JKJBFNAERWARKW-CZEFNJPISA-L Synonym: sodium anethole sulfite,polyanetholesulfonate,polyanethol sulfonate,benzene, 1-methoxy-4-1-propenyl-, e-, homopolymer, sulfonated, sodium salt,sodium 1-methoxy-4-e-prop-1-enyl benzene sulfite PubChem CID: 6434512 SMILES: CS(=O)(=O)O[Na].COC1=CC=C(C=C1)C(-*)C(C)-*
| PubChem CID | 6434512 |
|---|---|
| CAS | 55963-78-5 |
| Molecular Weight (g/mol) | NaN |
| MDL Number | MFCD00148427 |
| SMILES | CS(=O)(=O)O[Na].COC1=CC=C(C=C1)C(-*)C(C)-* |
| Synonym | sodium anethole sulfite,polyanetholesulfonate,polyanethol sulfonate,benzene, 1-methoxy-4-1-propenyl-, e-, homopolymer, sulfonated, sodium salt,sodium 1-methoxy-4-e-prop-1-enyl benzene sulfite |
| InChI Key | JKJBFNAERWARKW-CZEFNJPISA-L |
| Molecular Formula | (C10H11NaO4S)n |
Humic acid sodium salt, tech. 50-60% (as humic acid)
CAS: 68131-04-4 Molecular Formula: C9H8Na2O4 Molecular Weight (g/mol): 226.139 MDL Number: MFCD00135560 InChI Key: HMGUIQPKFUZDPV-UHFFFAOYSA-L Synonym: humic acid sodium salt,sodium bicyclo 2.2.1 hept-5-ene-2,3-dicarboxylate,sodium humate,disodium bicyclo 2.2.1 hept-5-en-2,3-dicarboxylate,disodium bicyclo 2.2.1 hept-5-ene-2,3-dicarboxylate,bicyclo 2.2.1 hepta-5-ene-2,3-dicarboxylic acid disodium salt PubChem CID: 21908873 IUPAC Name: disodium;bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate SMILES: C1C2C=CC1C(C2C(=O)[O-])C(=O)[O-].[Na+].[Na+]
| PubChem CID | 21908873 |
|---|---|
| CAS | 68131-04-4 |
| Molecular Weight (g/mol) | 226.139 |
| MDL Number | MFCD00135560 |
| SMILES | C1C2C=CC1C(C2C(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| Synonym | humic acid sodium salt,sodium bicyclo 2.2.1 hept-5-ene-2,3-dicarboxylate,sodium humate,disodium bicyclo 2.2.1 hept-5-en-2,3-dicarboxylate,disodium bicyclo 2.2.1 hept-5-ene-2,3-dicarboxylate,bicyclo 2.2.1 hepta-5-ene-2,3-dicarboxylic acid disodium salt |
| IUPAC Name | disodium;bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| InChI Key | HMGUIQPKFUZDPV-UHFFFAOYSA-L |
| Molecular Formula | C9H8Na2O4 |
2-Hexanone, 98%
CAS: 591-78-6 Molecular Formula: C6H12O Molecular Weight (g/mol): 100.16 MDL Number: MFCD00009482 InChI Key: QQZOPKMRPOGIEB-UHFFFAOYSA-N Synonym: 2-hexanone,hexanone,2-oxohexane,propylacetone,n-butyl methyl ketone,butyl methyl ketone,methyl butyl ketone,methyl n-butyl ketone,hexanone-2,ketone, butyl methyl PubChem CID: 11583 IUPAC Name: hexan-2-one SMILES: CCCCC(C)=O
| PubChem CID | 11583 |
|---|---|
| CAS | 591-78-6 |
| Molecular Weight (g/mol) | 100.16 |
| MDL Number | MFCD00009482 |
| SMILES | CCCCC(C)=O |
| Synonym | 2-hexanone,hexanone,2-oxohexane,propylacetone,n-butyl methyl ketone,butyl methyl ketone,methyl butyl ketone,methyl n-butyl ketone,hexanone-2,ketone, butyl methyl |
| IUPAC Name | hexan-2-one |
| InChI Key | QQZOPKMRPOGIEB-UHFFFAOYSA-N |
| Molecular Formula | C6H12O |
Lithium borohydride, 4M (10 wt.%) solution in THF, AcroSeal™
CAS: 16949-15-8 | BH4Li | 21.78 g/mol
| Linear Formula | LiBH4 |
|---|---|
| Molecular Weight (g/mol) | 21.78 |
| SMILES | [Li+].[BH4-] |
| Merck Index | 15,5581 |
| InChI Key | UUKMSDRCXNLYOO-UHFFFAOYSA-N |
| Density | 0.8900g/mL |
| PubChem CID | 20722760 |
| CAS | 109-99-9 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Handle under inert gas. Protect from moisture |
| MDL Number | MFCD00011088 |
| Health Hazard 2 | GHS H Statement Highly flammable liquid and vapor. In contact with water releases flammable gases which may ignite spontaneously. Harmful if swallowed. Causes severe skin burns and eye damage. May cause respiratory irritati |
| Solubility Information | Solubility in water: decomposes |
| Flash Point | −21°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | borate 1-, tetrahydro-, lithium,unii-8l87x4s4kp,boryllithium,lithium, boryl,lithium hydroborate,lithotab borohydride,bh4li,lithium 1+ ion boranuide,lithium borohydride 2.0 m in thf,borate 1-, tetrahydro-, lithium 1:1 |
| IUPAC Name | lithium;boron(1-) |
| Molecular Formula | BH4Li |
| EINECS Number | 241-021-7 |
| Formula Weight | 21.77 |
| Specific Gravity | 0.89 |
L(+)-Tartaric acid, 99+%
CAS: 87-69-4 Molecular Formula: C4H6O6 Molecular Weight (g/mol): 150.09 MDL Number: MFCD00064207 InChI Key: FEWJPZIEWOKRBE-UHFFFAOYNA-N Synonym: l-tartaric acid,l-+-tartaric acid,l +-tartaric acid,2r,3r-2,3-dihydroxysuccinic acid,tartaric acid,2r,3r-2,3-dihydroxybutanedioic acid,r,r-tartaric acid,+-l-tartaric acid,dextrotartaric acid,l-threaric acid PubChem CID: 444305 ChEBI: CHEBI:15671 SMILES: OC(C(O)C(O)=O)C(O)=O
| PubChem CID | 444305 |
|---|---|
| CAS | 87-69-4 |
| Molecular Weight (g/mol) | 150.09 |
| ChEBI | CHEBI:15671 |
| MDL Number | MFCD00064207 |
| SMILES | OC(C(O)C(O)=O)C(O)=O |
| Synonym | l-tartaric acid,l-+-tartaric acid,l +-tartaric acid,2r,3r-2,3-dihydroxysuccinic acid,tartaric acid,2r,3r-2,3-dihydroxybutanedioic acid,r,r-tartaric acid,+-l-tartaric acid,dextrotartaric acid,l-threaric acid |
| InChI Key | FEWJPZIEWOKRBE-UHFFFAOYNA-N |
| Molecular Formula | C4H6O6 |
Triphenylmethyl chloride, 98%
CAS: 76-83-5 Molecular Formula: C19H15Cl Molecular Weight (g/mol): 278.78 MDL Number: MFCD00000813,MFCD00284810 InChI Key: JBWKIWSBJXDJDT-UHFFFAOYSA-N Synonym: trityl chloride,triphenylmethyl chloride,triphenylchloromethane,chlorotriphenylmethane,chloromethanetriyl tribenzene,triphenylmethylchloride,methane, chlorotriphenyl,triphenyl chloromethane,chlorodiphenylmethyl benzene,benzene, 1,1',1-chloromethylidyne tris PubChem CID: 6456 SMILES: ClC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 6456 |
|---|---|
| CAS | 76-83-5 |
| Molecular Weight (g/mol) | 278.78 |
| MDL Number | MFCD00000813,MFCD00284810 |
| SMILES | ClC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | trityl chloride,triphenylmethyl chloride,triphenylchloromethane,chlorotriphenylmethane,chloromethanetriyl tribenzene,triphenylmethylchloride,methane, chlorotriphenyl,triphenyl chloromethane,chlorodiphenylmethyl benzene,benzene, 1,1',1-chloromethylidyne tris |
| InChI Key | JBWKIWSBJXDJDT-UHFFFAOYSA-N |
| Molecular Formula | C19H15Cl |
Aminoguanidine hydrochloride, 98%
CAS: 1937-19-5 Molecular Formula: CH6N4·HCl Molecular Weight (g/mol): 110.55 MDL Number: MFCD00039074 InChI Key: UBDZFAGVPPMTIT-UHFFFAOYSA-N Synonym: aminoguanidine hydrochloride,pimagedine hcl,guanylhydrazine hydrochloride,hydrazinecarboximidamide hydrochloride,aminoguanidinehydrochloride,aminoguanidine hcl,pimagedine hydrochloride,aminoguanidine monohydrochloride,hydrazinecarboximidamide, hydrochloride PubChem CID: 2734687 IUPAC Name: 2-aminoguanidine;hydrochloride SMILES: C(=NN)(N)N.Cl
| PubChem CID | 2734687 |
|---|---|
| CAS | 1937-19-5 |
| Molecular Weight (g/mol) | 110.55 |
| MDL Number | MFCD00039074 |
| SMILES | C(=NN)(N)N.Cl |
| Synonym | aminoguanidine hydrochloride,pimagedine hcl,guanylhydrazine hydrochloride,hydrazinecarboximidamide hydrochloride,aminoguanidinehydrochloride,aminoguanidine hcl,pimagedine hydrochloride,aminoguanidine monohydrochloride,hydrazinecarboximidamide, hydrochloride |
| IUPAC Name | 2-aminoguanidine;hydrochloride |
| InChI Key | UBDZFAGVPPMTIT-UHFFFAOYSA-N |
| Molecular Formula | CH6N4·HCl |
Tetrahydrofuran-D8, for NMR, 99.5 atom % D
CAS: 1693-74-9 Molecular Formula: C4H8O Molecular Weight (g/mol): 80.16 MDL Number: MFCD00044238 InChI Key: WYURNTSHIVDZCO-SVYQBANQSA-N Synonym: tetrahydrofuran-d8,deuterated thf,octadeuterotetrahydrofuran,deuterated tetrahydrofuran,tetrahydrofuran-d8 thf-d8,tetrahydrofuran-d8, ≥99.5 atom % d,2h4 tetrahydro 2h4 furan,thf-d8,2h8 tetrahydrofuran,furan-d4-, tetrahydro-d4 PubChem CID: 80290 SMILES: [2H]C1([2H])OC([2H])([2H])C([2H])([2H])C1([2H])[2H]
| PubChem CID | 80290 |
|---|---|
| CAS | 1693-74-9 |
| Molecular Weight (g/mol) | 80.16 |
| MDL Number | MFCD00044238 |
| SMILES | [2H]C1([2H])OC([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| Synonym | tetrahydrofuran-d8,deuterated thf,octadeuterotetrahydrofuran,deuterated tetrahydrofuran,tetrahydrofuran-d8 thf-d8,tetrahydrofuran-d8, ≥99.5 atom % d,2h4 tetrahydro 2h4 furan,thf-d8,2h8 tetrahydrofuran,furan-d4-, tetrahydro-d4 |
| InChI Key | WYURNTSHIVDZCO-SVYQBANQSA-N |
| Molecular Formula | C4H8O |
Tetrahydrofuran, 99.85%, Extra Dry, stabilized, AcroSeal™, package of 4x25ML bottles
CAS: 109-99-9 Molecular Formula: C4H8O Molecular Weight (g/mol): 72.11 MDL Number: MFCD00005356 InChI Key: WYURNTSHIVDZCO-UHFFFAOYSA-N Synonym: tetrahydrofuran,furan, tetrahydro,butylene oxide,furanidine,hydrofuran,tetramethylene oxide,oxacyclopentane,1,4-epoxybutane,tetrahydrofuranne,tetraidrofurano PubChem CID: 8028 ChEBI: CHEBI:26911 IUPAC Name: oxolane SMILES: C1CCOC1
| PubChem CID | 8028 |
|---|---|
| CAS | 109-99-9 |
| Molecular Weight (g/mol) | 72.11 |
| ChEBI | CHEBI:26911 |
| MDL Number | MFCD00005356 |
| SMILES | C1CCOC1 |
| Synonym | tetrahydrofuran,furan, tetrahydro,butylene oxide,furanidine,hydrofuran,tetramethylene oxide,oxacyclopentane,1,4-epoxybutane,tetrahydrofuranne,tetraidrofurano |
| IUPAC Name | oxolane |
| InChI Key | WYURNTSHIVDZCO-UHFFFAOYSA-N |
| Molecular Formula | C4H8O |
Butyric Acid 99.0+%, TCI America™
CAS: 107-92-6 Molecular Formula: C4H8O2 Molecular Weight (g/mol): 88.11 MDL Number: MFCD00002814 InChI Key: FERIUCNNQQJTOY-UHFFFAOYSA-N Synonym: butyric acid,n-butyric acid,n-butanoic acid,propylformic acid,ethylacetic acid,butanic acid,1-propanecarboxylic acid,butyrate,1-butyric acid,buttersaeure PubChem CID: 264 ChEBI: CHEBI:30772 IUPAC Name: butanoic acid SMILES: CCCC(O)=O
| PubChem CID | 264 |
|---|---|
| CAS | 107-92-6 |
| Molecular Weight (g/mol) | 88.11 |
| ChEBI | CHEBI:30772 |
| MDL Number | MFCD00002814 |
| SMILES | CCCC(O)=O |
| Synonym | butyric acid,n-butyric acid,n-butanoic acid,propylformic acid,ethylacetic acid,butanic acid,1-propanecarboxylic acid,butyrate,1-butyric acid,buttersaeure |
| IUPAC Name | butanoic acid |
| InChI Key | FERIUCNNQQJTOY-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2 |