Chemicals
Filtered Search Results
Sodium carbonate, ACS primary standard, 99.95-100.05% (dried basis)
CAS: 497-19-8 Molecular Formula: CNa2O3 Molecular Weight (g/mol): 105.99 MDL Number: MFCD00003494 InChI Key: CDBYLPFSWZWCQE-UHFFFAOYSA-L Synonym: sodium carbonate,disodium carbonate,soda ash,carbonic acid disodium salt,calcined soda,sodium carbonate, anhydrous,carbonic acid, disodium salt,washing soda,sodiumcarbonate,solvay soda PubChem CID: 10340 ChEBI: CHEBI:29377 SMILES: [Na+].[Na+].[O-]C([O-])=O
| PubChem CID | 10340 |
|---|---|
| CAS | 497-19-8 |
| Molecular Weight (g/mol) | 105.99 |
| ChEBI | CHEBI:29377 |
| MDL Number | MFCD00003494 |
| SMILES | [Na+].[Na+].[O-]C([O-])=O |
| Synonym | sodium carbonate,disodium carbonate,soda ash,carbonic acid disodium salt,calcined soda,sodium carbonate, anhydrous,carbonic acid, disodium salt,washing soda,sodiumcarbonate,solvay soda |
| InChI Key | CDBYLPFSWZWCQE-UHFFFAOYSA-L |
| Molecular Formula | CNa2O3 |
D-alpha-Tocopherol 97.0+%, TCI America™
CAS: 59-02-9 Molecular Formula: C29H50O2 Molecular Weight (g/mol): 430.717 InChI Key: GVJHHUAWPYXKBD-IEOSBIPESA-N Synonym: vitamin e,alpha-tocopherol,d-alpha-tocopherol,5,7,8-trimethyltocol,+-alpha-tocopherol,r,r,r-alpha-tocopherol,phytogermine,eprolin,2r,4'r,8'r-alpha-tocopherol,dl-a-tocopherol PubChem CID: 14985 ChEBI: CHEBI:18145 IUPAC Name: (2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol SMILES: CC1=C(C(=C2CCC(OC2=C1C)(C)CCCC(C)CCCC(C)CCCC(C)C)C)O
| PubChem CID | 14985 |
|---|---|
| CAS | 59-02-9 |
| Molecular Weight (g/mol) | 430.717 |
| ChEBI | CHEBI:18145 |
| SMILES | CC1=C(C(=C2CCC(OC2=C1C)(C)CCCC(C)CCCC(C)CCCC(C)C)C)O |
| Synonym | vitamin e,alpha-tocopherol,d-alpha-tocopherol,5,7,8-trimethyltocol,+-alpha-tocopherol,r,r,r-alpha-tocopherol,phytogermine,eprolin,2r,4'r,8'r-alpha-tocopherol,dl-a-tocopherol |
| IUPAC Name | (2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-ol |
| InChI Key | GVJHHUAWPYXKBD-IEOSBIPESA-N |
| Molecular Formula | C29H50O2 |
Isopropyl alcohol, ≥99%, Reagent grade, For ACS analysis, MP Biomedicals™
CAS: 67-63-0 Molecular Formula: C3H8O Molecular Weight (g/mol): 60.096 InChI Key: KFZMGEQAYNKOFK-UHFFFAOYSA-N Synonym: isopropanol,2-propanol,isopropyl alcohol,2-hydroxypropane,alkolave,avantine,hartosol,dimethylcarbinol,sec-propyl alcohol,petrohol PubChem CID: 3776 ChEBI: CHEBI:17824 IUPAC Name: propan-2-ol SMILES: CC(C)O
| PubChem CID | 3776 |
|---|---|
| CAS | 67-63-0 |
| Molecular Weight (g/mol) | 60.096 |
| ChEBI | CHEBI:17824 |
| SMILES | CC(C)O |
| Synonym | isopropanol,2-propanol,isopropyl alcohol,2-hydroxypropane,alkolave,avantine,hartosol,dimethylcarbinol,sec-propyl alcohol,petrohol |
| IUPAC Name | propan-2-ol |
| InChI Key | KFZMGEQAYNKOFK-UHFFFAOYSA-N |
| Molecular Formula | C3H8O |
Acetic acid, glacial, 99+%
CAS: 64-19-7 Molecular Formula: C2H4O2 Molecular Weight (g/mol): 60.05 MDL Number: MFCD00036152 InChI Key: QTBSBXVTEAMEQO-UHFFFAOYSA-N Synonym: ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure PubChem CID: 176 ChEBI: CHEBI:15366 IUPAC Name: acetic acid SMILES: CC(O)=O
| PubChem CID | 176 |
|---|---|
| CAS | 64-19-7 |
| Molecular Weight (g/mol) | 60.05 |
| ChEBI | CHEBI:15366 |
| MDL Number | MFCD00036152 |
| SMILES | CC(O)=O |
| Synonym | ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure |
| IUPAC Name | acetic acid |
| InChI Key | QTBSBXVTEAMEQO-UHFFFAOYSA-N |
| Molecular Formula | C2H4O2 |
Praseodymium(III) nitrate hydrate, 99.9% (REO)
CAS: 15878-77-0 Molecular Formula: H12N3O15Pr Molecular Weight (g/mol): 435.01 MDL Number: MFCD00011175 InChI Key: LXXCECZPOWZKLC-UHFFFAOYSA-N Synonym: praseodymium iii nitrate hexahydrate,praseodymium iii nitrate, hexahydrate 1:3:6,praseodymium nitrate hexahydrate,nitric acid, praseodymium 3+ salt, hexahydrate,praseodymium 3+ hexahydrate trinitrate,ksc529q4r,praseodymium trinitrate hexahydrate,praseodymium nitrate hydrate 1:3:6,praseodymium nitrate,,praseodymium 3+ trinitrate hexahydrate PubChem CID: 204170 SMILES: O.O.O.O.O.O.[Pr+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 204170 |
|---|---|
| CAS | 15878-77-0 |
| Molecular Weight (g/mol) | 435.01 |
| MDL Number | MFCD00011175 |
| SMILES | O.O.O.O.O.O.[Pr+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | praseodymium iii nitrate hexahydrate,praseodymium iii nitrate, hexahydrate 1:3:6,praseodymium nitrate hexahydrate,nitric acid, praseodymium 3+ salt, hexahydrate,praseodymium 3+ hexahydrate trinitrate,ksc529q4r,praseodymium trinitrate hexahydrate,praseodymium nitrate hydrate 1:3:6,praseodymium nitrate,,praseodymium 3+ trinitrate hexahydrate |
| InChI Key | LXXCECZPOWZKLC-UHFFFAOYSA-N |
| Molecular Formula | H12N3O15Pr |
Allyltrimethoxysilane, 97+%
CAS: 2551-83-9 Molecular Formula: C6H14O3Si Molecular Weight (g/mol): 162.26 MDL Number: MFCD00053865 InChI Key: LFRDHGNFBLIJIY-UHFFFAOYSA-N Synonym: allyltrimethoxysilane,silane, trimethoxy-2-propenyl,silane, trimethoxy-2-propen-1-yl,allyl trimethoxy silane,silane, allyltrimethoxy,allytrimethoxysilane,acmc-209gkn,trimethoxy prop-2-enyl silane,silane,trimethoxy-2-propen-1-yl PubChem CID: 75698 IUPAC Name: trimethoxy(prop-2-enyl)silane SMILES: CO[Si](CC=C)(OC)OC
| PubChem CID | 75698 |
|---|---|
| CAS | 2551-83-9 |
| Molecular Weight (g/mol) | 162.26 |
| MDL Number | MFCD00053865 |
| SMILES | CO[Si](CC=C)(OC)OC |
| Synonym | allyltrimethoxysilane,silane, trimethoxy-2-propenyl,silane, trimethoxy-2-propen-1-yl,allyl trimethoxy silane,silane, allyltrimethoxy,allytrimethoxysilane,acmc-209gkn,trimethoxy prop-2-enyl silane,silane,trimethoxy-2-propen-1-yl |
| IUPAC Name | trimethoxy(prop-2-enyl)silane |
| InChI Key | LFRDHGNFBLIJIY-UHFFFAOYSA-N |
| Molecular Formula | C6H14O3Si |
Acetic Acid, 99.8%, for analysis
CAS: 64-19-7 Molecular Formula: C2H4O2 Molecular Weight (g/mol): 60.05 MDL Number: MFCD00036152 InChI Key: QTBSBXVTEAMEQO-UHFFFAOYSA-N Synonym: ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure PubChem CID: 176 ChEBI: CHEBI:15366 IUPAC Name: acetic acid SMILES: CC(O)=O
| PubChem CID | 176 |
|---|---|
| CAS | 64-19-7 |
| Molecular Weight (g/mol) | 60.05 |
| ChEBI | CHEBI:15366 |
| MDL Number | MFCD00036152 |
| SMILES | CC(O)=O |
| Synonym | ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure |
| IUPAC Name | acetic acid |
| InChI Key | QTBSBXVTEAMEQO-UHFFFAOYSA-N |
| Molecular Formula | C2H4O2 |
Polyvinylpyrrolidone, average M.W. 3500, K12
CAS: 9003-39-8 Molecular Formula: (C6H9NO)n Molecular Weight (g/mol): 111.14 MDL Number: MFCD01076626 InChI Key: WHNWPMSKXPGLAX-UHFFFAOYSA-N Synonym: n-vinyl-2-pyrrolidone,n-vinylpyrrolidone,1-vinyl-2-pyrrolidone,1-vinylpyrrolidin-2-one,n-vinyl-2-pyrrolidinone,vinylpyrrolidone,2-pyrrolidinone, 1-ethenyl,1-vinyl-2-pyrrolidinone,n-vinylpyrrolidinone,1-vinylpyrrolidone PubChem CID: 6917 ChEBI: CHEBI:82551 IUPAC Name: 1-ethenylpyrrolidin-2-one SMILES: *-CC(-*)N1CCCC1=O
| PubChem CID | 6917 |
|---|---|
| CAS | 9003-39-8 |
| Molecular Weight (g/mol) | 111.14 |
| ChEBI | CHEBI:82551 |
| MDL Number | MFCD01076626 |
| SMILES | *-CC(-*)N1CCCC1=O |
| Synonym | n-vinyl-2-pyrrolidone,n-vinylpyrrolidone,1-vinyl-2-pyrrolidone,1-vinylpyrrolidin-2-one,n-vinyl-2-pyrrolidinone,vinylpyrrolidone,2-pyrrolidinone, 1-ethenyl,1-vinyl-2-pyrrolidinone,n-vinylpyrrolidinone,1-vinylpyrrolidone |
| IUPAC Name | 1-ethenylpyrrolidin-2-one |
| InChI Key | WHNWPMSKXPGLAX-UHFFFAOYSA-N |
| Molecular Formula | (C6H9NO)n |
| Boiling Point | 69.0°C |
|---|---|
| Water | 0.01% max. |
| Viscosity | 0.31 mPa.s (20°C) |
| Linear Formula | CH3(CH2)4CH3 |
| Physical Form | Liquid |
| Chemical Name or Material | Hexanes |
| Grade | Analytical |
| Acidity | 0.0002 meq/g max. |
| Residue after Evaporation | 0.0005% max. |
| Density | 0.6590g/mL |
| CAS | 110-54-3 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. IF exposed or concerned: Get medical advice/attention. |
| Health Hazard 2 | GHS H Statement Highly flammable liquid and vapor. May be fatal if swallowed and enters airways. Causes skin irritation. May cause drowsiness or dizziness. Suspected of damaging fertility. May cause damage to organs through prolonged or repeated exposure. Toxic to aquatic life with long lasting effects. |
| Solubility Information | Solubility in water: insoluble. Other solubilities: soluble in alcohol, acetone, ether and chloroform |
| Flash Point | −22°C |
| Health Hazard 1 | Danger |
| Refractive Index | 1.3748 to 1.3810 |
| Synonym | Hex |
| Molecular Formula | C6H14 |
| Formula Weight | 86.18 |
| Specific Gravity | 0.659 |
| Melting Point | -95.0°C |
Spermine tetrahydrochloride, 99%
CAS: 306-67-2 Molecular Formula: C10H30Cl4N4 Molecular Weight (g/mol): 348.18 MDL Number: MFCD00012914 InChI Key: XLDKUDAXZWHPFH-UHFFFAOYSA-N Synonym: spermine tetrahydrochloride,n,n'-bis 3-aminopropyl-1,4-butanediamine tetrahydrochloride,gerontine tetrahydrochloride,neuridine tetrahydrochloride,n1,n1'-butane-1,4-diyl bis propane-1,3-diamine tetrahydrochloride,musculamine tetrahydrochloride,geontine tetrahydrochloride,spermine hcl,1,4-butanediamine, n,n'-bis 3-aminopropyl-, tetrahydrochloride,spermine, tetrahydrochloride PubChem CID: 9384 IUPAC Name: N,N'-bis(3-aminopropyl)butane-1,4-diamine;tetrahydrochloride SMILES: [H+].[H+].[H+].[H+].[Cl-].[Cl-].[Cl-].[Cl-].NCCCNCCCCNCCCN
| PubChem CID | 9384 |
|---|---|
| CAS | 306-67-2 |
| Molecular Weight (g/mol) | 348.18 |
| MDL Number | MFCD00012914 |
| SMILES | [H+].[H+].[H+].[H+].[Cl-].[Cl-].[Cl-].[Cl-].NCCCNCCCCNCCCN |
| Synonym | spermine tetrahydrochloride,n,n'-bis 3-aminopropyl-1,4-butanediamine tetrahydrochloride,gerontine tetrahydrochloride,neuridine tetrahydrochloride,n1,n1'-butane-1,4-diyl bis propane-1,3-diamine tetrahydrochloride,musculamine tetrahydrochloride,geontine tetrahydrochloride,spermine hcl,1,4-butanediamine, n,n'-bis 3-aminopropyl-, tetrahydrochloride,spermine, tetrahydrochloride |
| IUPAC Name | N,N'-bis(3-aminopropyl)butane-1,4-diamine;tetrahydrochloride |
| InChI Key | XLDKUDAXZWHPFH-UHFFFAOYSA-N |
| Molecular Formula | C10H30Cl4N4 |
n-Dodecane, 99%, anhydrous, AcroSeal™
CAS: 112-40-3 Molecular Formula: C12H26 Molecular Weight (g/mol): 170.34 InChI Key: SNRUBQQJIBEYMU-UHFFFAOYSA-N Synonym: n-dodecane,dihexyl,bihexyl,adakane 12,n-dodecan,n-dodecan german,duodecane,alkanes, c10-14,undecane, methyl,ccris 661 PubChem CID: 8182 ChEBI: CHEBI:28817 IUPAC Name: dodecane SMILES: CCCCCCCCCCCC
| PubChem CID | 8182 |
|---|---|
| CAS | 112-40-3 |
| Molecular Weight (g/mol) | 170.34 |
| ChEBI | CHEBI:28817 |
| SMILES | CCCCCCCCCCCC |
| Synonym | n-dodecane,dihexyl,bihexyl,adakane 12,n-dodecan,n-dodecan german,duodecane,alkanes, c10-14,undecane, methyl,ccris 661 |
| IUPAC Name | dodecane |
| InChI Key | SNRUBQQJIBEYMU-UHFFFAOYSA-N |
| Molecular Formula | C12H26 |
Chloroform, 99.9%, Extra Dry, stabilized, AcroSeal™, Thermo Scientific Chemicals
CAS: 67-66-3 Molecular Formula: CHCl3 Molecular Weight (g/mol): 119.37 MDL Number: MFCD00000826 InChI Key: HEDRZPFGACZZDS-UHFFFAOYSA-N Synonym: trichloromethane,formyl trichloride,methane, trichloro,trichloroform,methane trichloride,methenyl trichloride,methyl trichloride,trichlormethan,chloroforme,cloroformio PubChem CID: 6212 ChEBI: CHEBI:35255 IUPAC Name: trichloromethane SMILES: ClC(Cl)Cl
| PubChem CID | 6212 |
|---|---|
| CAS | 67-66-3 |
| Molecular Weight (g/mol) | 119.37 |
| ChEBI | CHEBI:35255 |
| MDL Number | MFCD00000826 |
| SMILES | ClC(Cl)Cl |
| Synonym | trichloromethane,formyl trichloride,methane, trichloro,trichloroform,methane trichloride,methenyl trichloride,methyl trichloride,trichlormethan,chloroforme,cloroformio |
| IUPAC Name | trichloromethane |
| InChI Key | HEDRZPFGACZZDS-UHFFFAOYSA-N |
| Molecular Formula | CHCl3 |
Omnisolv Ethyl Acetate, 99.9%, MilliporeSigma™
CAS: 141-78-6 Molecular Formula: C4H8O2 Molecular Weight (g/mol): 88.106 InChI Key: XEKOWRVHYACXOJ-UHFFFAOYSA-N Synonym: ethyl ethanoate,acetoxyethane,acetic acid ethyl ester,acetic ether,ethyl acetic ester,vinegar naphtha,acetic acid, ethyl ester,ethylacetate,acetidin,acetic ester PubChem CID: 8857 ChEBI: CHEBI:27750 IUPAC Name: ethyl acetate SMILES: CCOC(=O)C
| PubChem CID | 8857 |
|---|---|
| CAS | 141-78-6 |
| Molecular Weight (g/mol) | 88.106 |
| ChEBI | CHEBI:27750 |
| SMILES | CCOC(=O)C |
| Synonym | ethyl ethanoate,acetoxyethane,acetic acid ethyl ester,acetic ether,ethyl acetic ester,vinegar naphtha,acetic acid, ethyl ester,ethylacetate,acetidin,acetic ester |
| IUPAC Name | ethyl acetate |
| InChI Key | XEKOWRVHYACXOJ-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2 |
Trioctylphosphine, 90%, technical grade, AcroSeal™
CAS: 4731-53-7 Molecular Formula: C24H51P Molecular Weight (g/mol): 370.64 InChI Key: RMZAYIKUYWXQPB-UHFFFAOYSA-N Synonym: trioctylphosphine,tri-n-octylphosphine,phosphine, trioctyl,tri-n-octyl phosphine,tri-octylphosphine,trioctyl phosphine,tri degrees ctylphosphine,acmc-209k8q PubChem CID: 20851 IUPAC Name: trioctylphosphane SMILES: CCCCCCCCP(CCCCCCCC)CCCCCCCC
| PubChem CID | 20851 |
|---|---|
| CAS | 4731-53-7 |
| Molecular Weight (g/mol) | 370.64 |
| SMILES | CCCCCCCCP(CCCCCCCC)CCCCCCCC |
| Synonym | trioctylphosphine,tri-n-octylphosphine,phosphine, trioctyl,tri-n-octyl phosphine,tri-octylphosphine,trioctyl phosphine,tri degrees ctylphosphine,acmc-209k8q |
| IUPAC Name | trioctylphosphane |
| InChI Key | RMZAYIKUYWXQPB-UHFFFAOYSA-N |
| Molecular Formula | C24H51P |
Lithium metaborate, Puratronic™, 99.997% (metals basis)
CAS: 13453-69-5 Molecular Formula: B4H14Li2O7 Molecular Weight (g/mol): 183.23 MDL Number: MFCD00011089 InChI Key: DPYKRXYVXDYLEY-UHFFFAOYSA-N Synonym: lithium metaborate,boric acid hbo2 , lithium salt,lithium metaborate, anhydrous,lithium oxido oxo borane,bo2.li,boric acid hbo2 , lithium salt 1:1,lithium metaborate,anhydrous,lithium metaborate, puratronic,lithotab boron oxide hydroxide,lithium metaborate, acs PubChem CID: 123308 SMILES: [Li].[Li].[B].[B].[B].[B].O.O.O.O.O.O.O
| PubChem CID | 123308 |
|---|---|
| CAS | 13453-69-5 |
| Molecular Weight (g/mol) | 183.23 |
| MDL Number | MFCD00011089 |
| SMILES | [Li].[Li].[B].[B].[B].[B].O.O.O.O.O.O.O |
| Synonym | lithium metaborate,boric acid hbo2 , lithium salt,lithium metaborate, anhydrous,lithium oxido oxo borane,bo2.li,boric acid hbo2 , lithium salt 1:1,lithium metaborate,anhydrous,lithium metaborate, puratronic,lithotab boron oxide hydroxide,lithium metaborate, acs |
| InChI Key | DPYKRXYVXDYLEY-UHFFFAOYSA-N |
| Molecular Formula | B4H14Li2O7 |