Chemicals
Filtered Search Results
Rubidium chloride, 99.8+%, (trace metal basis)
CAS: 11-9-7791 Molecular Formula: ClRb Molecular Weight (g/mol): 120.92 MDL Number: MFCD00011187 InChI Key: FGDZQCVHDSGLHJ-UHFFFAOYSA-M Synonym: rubidium chloride,rubidium chloride rbcl,rubidium monochloride,rbcl,rubidium 1+ chloride,rubidium 1+ ion chloride,unii-n3shc5273s,rubidiumchloride,rubidium-chlorid,rubidium-chloride PubChem CID: 62683 ChEBI: CHEBI:78672 SMILES: [Cl-].[Rb+]
| PubChem CID | 62683 |
|---|---|
| CAS | 11-9-7791 |
| Molecular Weight (g/mol) | 120.92 |
| ChEBI | CHEBI:78672 |
| MDL Number | MFCD00011187 |
| SMILES | [Cl-].[Rb+] |
| Synonym | rubidium chloride,rubidium chloride rbcl,rubidium monochloride,rbcl,rubidium 1+ chloride,rubidium 1+ ion chloride,unii-n3shc5273s,rubidiumchloride,rubidium-chlorid,rubidium-chloride |
| InChI Key | FGDZQCVHDSGLHJ-UHFFFAOYSA-M |
| Molecular Formula | ClRb |
Dodecane, mixture of isomers
CAS: 13475-82-6 Molecular Formula: C12H26 Molecular Weight (g/mol): 170.34 MDL Number: MFCD00008969 InChI Key: VKPSKYDESGTTFR-UHFFFAOYSA-N PubChem CID: 26058 ChEBI: CHEBI:77509 IUPAC Name: 2,2,4,6,6-pentamethylheptane SMILES: CC(CC(C)(C)C)CC(C)(C)C
| PubChem CID | 26058 |
|---|---|
| CAS | 13475-82-6 |
| Molecular Weight (g/mol) | 170.34 |
| ChEBI | CHEBI:77509 |
| MDL Number | MFCD00008969 |
| SMILES | CC(CC(C)(C)C)CC(C)(C)C |
| IUPAC Name | 2,2,4,6,6-pentamethylheptane |
| InChI Key | VKPSKYDESGTTFR-UHFFFAOYSA-N |
| Molecular Formula | C12H26 |
Thiamine hydrochloride, 99% (dry wt.), may cont. up to 5% water
CAS: 67-03-8 Molecular Formula: C12H18Cl2N4OS Molecular Weight (g/mol): 337.263 MDL Number: MFCD00012780 InChI Key: DPJRMOMPQZCRJU-UHFFFAOYSA-M Synonym: thiamine hydrochloride,vitamin b1 hydrochloride,thiamine hcl,aneurine hydrochloride,berin,thiamine chloride hydrochloride,trophite,thiamin chloride,thiamine dichloride,thiaminium chloride PubChem CID: 6202 ChEBI: CHEBI:49105 IUPAC Name: 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;chloride;hydrochloride SMILES: CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCO.Cl.[Cl-]
| PubChem CID | 6202 |
|---|---|
| CAS | 67-03-8 |
| Molecular Weight (g/mol) | 337.263 |
| ChEBI | CHEBI:49105 |
| MDL Number | MFCD00012780 |
| SMILES | CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCO.Cl.[Cl-] |
| Synonym | thiamine hydrochloride,vitamin b1 hydrochloride,thiamine hcl,aneurine hydrochloride,berin,thiamine chloride hydrochloride,trophite,thiamin chloride,thiamine dichloride,thiaminium chloride |
| IUPAC Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;chloride;hydrochloride |
| InChI Key | DPJRMOMPQZCRJU-UHFFFAOYSA-M |
| Molecular Formula | C12H18Cl2N4OS |
Diphenylamine, 99%, pure
CAS: 122-39-4 Molecular Formula: C12H11N Molecular Weight (g/mol): 169.23 InChI Key: DMBHHRLKUKUOEG-UHFFFAOYSA-N Synonym: diphenylamine,n-phenylbenzenamine,anilinobenzene,benzenamine, n-phenyl,n,n-diphenylamine,phenylaniline,scaldip,n-phenylbenzeneamine,big dipper,no-scald PubChem CID: 11487 ChEBI: CHEBI:4640 IUPAC Name: N-phenylaniline SMILES: C1=CC=C(C=C1)NC2=CC=CC=C2
| PubChem CID | 11487 |
|---|---|
| CAS | 122-39-4 |
| Molecular Weight (g/mol) | 169.23 |
| ChEBI | CHEBI:4640 |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2 |
| Synonym | diphenylamine,n-phenylbenzenamine,anilinobenzene,benzenamine, n-phenyl,n,n-diphenylamine,phenylaniline,scaldip,n-phenylbenzeneamine,big dipper,no-scald |
| IUPAC Name | N-phenylaniline |
| InChI Key | DMBHHRLKUKUOEG-UHFFFAOYSA-N |
| Molecular Formula | C12H11N |
Hydroxyurea, 98%
CAS: 127-07-1 Molecular Formula: CH4N2O2 Molecular Weight (g/mol): 76.055 MDL Number: MFCD00007943 InChI Key: VSNHCAURESNICA-UHFFFAOYSA-N Synonym: hydroxycarbamide,n-hydroxyurea,hydrea,1-hydroxyurea,oxyurea,carbamoyl oxime,biosupressin,hydroxycarbamine,onco-carbide,carbamohydroxamic acid PubChem CID: 3657 ChEBI: CHEBI:44423 IUPAC Name: hydroxyurea SMILES: C(=O)(N)NO
| PubChem CID | 3657 |
|---|---|
| CAS | 127-07-1 |
| Molecular Weight (g/mol) | 76.055 |
| ChEBI | CHEBI:44423 |
| MDL Number | MFCD00007943 |
| SMILES | C(=O)(N)NO |
| Synonym | hydroxycarbamide,n-hydroxyurea,hydrea,1-hydroxyurea,oxyurea,carbamoyl oxime,biosupressin,hydroxycarbamine,onco-carbide,carbamohydroxamic acid |
| IUPAC Name | hydroxyurea |
| InChI Key | VSNHCAURESNICA-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O2 |
Sodium hydroxide, for analysis, 50 wt% solution in water
CAS: 1310-73-2 Molecular Formula: HNaO Molecular Weight (g/mol): 39.997 MDL Number: MFCD00003548 InChI Key: HEMHJVSKTPXQMS-UHFFFAOYSA-M Synonym: sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic PubChem CID: 14798 ChEBI: CHEBI:32145 IUPAC Name: sodium;hydroxide SMILES: [OH-].[Na+]
| PubChem CID | 14798 |
|---|---|
| CAS | 1310-73-2 |
| Molecular Weight (g/mol) | 39.997 |
| ChEBI | CHEBI:32145 |
| MDL Number | MFCD00003548 |
| SMILES | [OH-].[Na+] |
| Synonym | sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic |
| IUPAC Name | sodium;hydroxide |
| InChI Key | HEMHJVSKTPXQMS-UHFFFAOYSA-M |
| Molecular Formula | HNaO |
Omnisolv Ethyl Acetate, 99.9%, MilliporeSigma™
CAS: 141-78-6 Molecular Formula: C4H8O2 Molecular Weight (g/mol): 88.106 InChI Key: XEKOWRVHYACXOJ-UHFFFAOYSA-N Synonym: ethyl ethanoate,acetoxyethane,acetic acid ethyl ester,acetic ether,ethyl acetic ester,vinegar naphtha,acetic acid, ethyl ester,ethylacetate,acetidin,acetic ester PubChem CID: 8857 ChEBI: CHEBI:27750 IUPAC Name: ethyl acetate SMILES: CCOC(=O)C
| PubChem CID | 8857 |
|---|---|
| CAS | 141-78-6 |
| Molecular Weight (g/mol) | 88.106 |
| ChEBI | CHEBI:27750 |
| SMILES | CCOC(=O)C |
| Synonym | ethyl ethanoate,acetoxyethane,acetic acid ethyl ester,acetic ether,ethyl acetic ester,vinegar naphtha,acetic acid, ethyl ester,ethylacetate,acetidin,acetic ester |
| IUPAC Name | ethyl acetate |
| InChI Key | XEKOWRVHYACXOJ-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2 |
Chlorine in Heavy Mineral Oil standard solution, Specpure™ 1000μg/g (0.10%)
MDL Number: MFCD02264398
| MDL Number | MFCD02264398 |
|---|
Tris(2-carboxyethyl)phosphine hydrochloride, 98%
CAS: 51805-45-9 Molecular Formula: C9H12O6P Molecular Weight (g/mol): 247.16 MDL Number: MFCD00145469 InChI Key: PZBFGYYEXUXCOF-UHFFFAOYSA-K Synonym: tris 2-carboxyethyl phosphine hydrochloride,tcep hcl,tcep hydrochloride,3,3',3-phosphinetriyltripropanoic acid hydrochloride,tcep,unii-h49aam893k,tris carboxyethyl phosphine hydrochloride,tris-2-carboxyethyl phosphine hydrochloride,tris 2-carboxyethyl phosphine hcl,3,3',3-phosphinetriyltripropanoicacidhydrochloride PubChem CID: 2734570 IUPAC Name: 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrochloride SMILES: [O-]C(=O)CCP(CCC([O-])=O)CCC([O-])=O
| PubChem CID | 2734570 |
|---|---|
| CAS | 51805-45-9 |
| Molecular Weight (g/mol) | 247.16 |
| MDL Number | MFCD00145469 |
| SMILES | [O-]C(=O)CCP(CCC([O-])=O)CCC([O-])=O |
| Synonym | tris 2-carboxyethyl phosphine hydrochloride,tcep hcl,tcep hydrochloride,3,3',3-phosphinetriyltripropanoic acid hydrochloride,tcep,unii-h49aam893k,tris carboxyethyl phosphine hydrochloride,tris-2-carboxyethyl phosphine hydrochloride,tris 2-carboxyethyl phosphine hcl,3,3',3-phosphinetriyltripropanoicacidhydrochloride |
| IUPAC Name | 3-[bis(2-carboxyethyl)phosphanyl]propanoic acid;hydrochloride |
| InChI Key | PZBFGYYEXUXCOF-UHFFFAOYSA-K |
| Molecular Formula | C9H12O6P |
Ethyl acrylate, 99%, stab. with ca 20ppm 4-methoxyphenol
CAS: 140-88-5 Molecular Formula: C5H8O2 Molecular Weight (g/mol): 100.12 MDL Number: MFCD00009188 InChI Key: JIGUQPWFLRLWPJ-UHFFFAOYSA-N Synonym: ethyl acrylate,acrylic acid ethyl ester,ethyl propenoate,2-propenoic acid, ethyl ester,ethyl 2-propenoate,ethylacrylaat,ethylakrylat,etil acrilato,acrylic acid, ethyl ester,aethylacrylat PubChem CID: 8821 ChEBI: CHEBI:82327 IUPAC Name: ethyl prop-2-enoate SMILES: CCOC(=O)C=C
| PubChem CID | 8821 |
|---|---|
| CAS | 140-88-5 |
| Molecular Weight (g/mol) | 100.12 |
| ChEBI | CHEBI:82327 |
| MDL Number | MFCD00009188 |
| SMILES | CCOC(=O)C=C |
| Synonym | ethyl acrylate,acrylic acid ethyl ester,ethyl propenoate,2-propenoic acid, ethyl ester,ethyl 2-propenoate,ethylacrylaat,ethylakrylat,etil acrilato,acrylic acid, ethyl ester,aethylacrylat |
| IUPAC Name | ethyl prop-2-enoate |
| InChI Key | JIGUQPWFLRLWPJ-UHFFFAOYSA-N |
| Molecular Formula | C5H8O2 |
Sodium phosphate, dibasic, 98+%, extra pure, anhydrous
CAS: 7558-79-4 Molecular Formula: HNa2O4P Molecular Weight (g/mol): 141.96 MDL Number: MFCD00003496 InChI Key: BNIILDVGGAEEIG-UHFFFAOYSA-L Synonym: disodium hydrogen phosphate,disodium phosphate,disodium hydrogenorthophosphate,sodium phosphate dibasic,dibasic sodium phosphate,acetest,soda phosphate,disodium orthophosphate,sodium hydrogen phosphate,phosphoric acid, disodium salt PubChem CID: 24203 ChEBI: CHEBI:34683 SMILES: [Na+].[Na+].OP([O-])([O-])=O
| PubChem CID | 24203 |
|---|---|
| CAS | 7558-79-4 |
| Molecular Weight (g/mol) | 141.96 |
| ChEBI | CHEBI:34683 |
| MDL Number | MFCD00003496 |
| SMILES | [Na+].[Na+].OP([O-])([O-])=O |
| Synonym | disodium hydrogen phosphate,disodium phosphate,disodium hydrogenorthophosphate,sodium phosphate dibasic,dibasic sodium phosphate,acetest,soda phosphate,disodium orthophosphate,sodium hydrogen phosphate,phosphoric acid, disodium salt |
| InChI Key | BNIILDVGGAEEIG-UHFFFAOYSA-L |
| Molecular Formula | HNa2O4P |
n-Pentane, 99+%, extra pure, anhydrous
CAS: 109-66-0 Molecular Formula: C5H12 Molecular Weight (g/mol): 72.15 MDL Number: MFCD00009498 InChI Key: OFBQJSOFQDEBGM-UHFFFAOYSA-N Synonym: n-pentane,pentan,skellysolve a,pentanen,pentani,amyl hydride,tetrafume,tetrakil,tetraspot,pentan polish PubChem CID: 8003 ChEBI: CHEBI:37830 IUPAC Name: pentane SMILES: CCCCC
| PubChem CID | 8003 |
|---|---|
| CAS | 109-66-0 |
| Molecular Weight (g/mol) | 72.15 |
| ChEBI | CHEBI:37830 |
| MDL Number | MFCD00009498 |
| SMILES | CCCCC |
| Synonym | n-pentane,pentan,skellysolve a,pentanen,pentani,amyl hydride,tetrafume,tetrakil,tetraspot,pentan polish |
| IUPAC Name | pentane |
| InChI Key | OFBQJSOFQDEBGM-UHFFFAOYSA-N |
| Molecular Formula | C5H12 |
Phloroglucinol, 99+%, anhydrous
CAS: 108-73-6 Molecular Formula: C6H6O3 Molecular Weight (g/mol): 126.1 InChI Key: QCDYQQDYXPDABM-UHFFFAOYSA-N Synonym: phloroglucinol,1,3,5-benzenetriol,1,3,5-trihydroxybenzene,phloroglucin,phloroglucine,spasfon-lyoc,s-trihydroxybenzene,benzene-s-triol,5-hydroxyresorcinol,benzene, trihydroxy PubChem CID: 359 ChEBI: CHEBI:16204 IUPAC Name: benzene-1,3,5-triol SMILES: C1=C(C=C(C=C1O)O)O
| PubChem CID | 359 |
|---|---|
| CAS | 108-73-6 |
| Molecular Weight (g/mol) | 126.1 |
| ChEBI | CHEBI:16204 |
| SMILES | C1=C(C=C(C=C1O)O)O |
| Synonym | phloroglucinol,1,3,5-benzenetriol,1,3,5-trihydroxybenzene,phloroglucin,phloroglucine,spasfon-lyoc,s-trihydroxybenzene,benzene-s-triol,5-hydroxyresorcinol,benzene, trihydroxy |
| IUPAC Name | benzene-1,3,5-triol |
| InChI Key | QCDYQQDYXPDABM-UHFFFAOYSA-N |
| Molecular Formula | C6H6O3 |
2-Aminoterephthalic acid, 99%
CAS: 10312-55-7 Molecular Formula: C8H5NO4 Molecular Weight (g/mol): 179.13 MDL Number: MFCD00134536 InChI Key: GPNNOCMCNFXRAO-UHFFFAOYSA-L Synonym: aminoterephthalic acid,2-aminobenzene-1,4-dicarboxylic acid,2-amino-1,4-benzenedicarboxylic acid,4-carboxyanthranilic acid,1,4-benzenedicarboxylic acid, 2-amino,2-aminoterephthalic,aminoterephthalicacid,2,5-dicarboxyaniline,2-aminoterephtalic acid,timtec-bb sbb006751 PubChem CID: 2724822 IUPAC Name: 2-aminoterephthalic acid SMILES: NC1=CC(=CC=C1C([O-])=O)C([O-])=O
| PubChem CID | 2724822 |
|---|---|
| CAS | 10312-55-7 |
| Molecular Weight (g/mol) | 179.13 |
| MDL Number | MFCD00134536 |
| SMILES | NC1=CC(=CC=C1C([O-])=O)C([O-])=O |
| Synonym | aminoterephthalic acid,2-aminobenzene-1,4-dicarboxylic acid,2-amino-1,4-benzenedicarboxylic acid,4-carboxyanthranilic acid,1,4-benzenedicarboxylic acid, 2-amino,2-aminoterephthalic,aminoterephthalicacid,2,5-dicarboxyaniline,2-aminoterephtalic acid,timtec-bb sbb006751 |
| IUPAC Name | 2-aminoterephthalic acid |
| InChI Key | GPNNOCMCNFXRAO-UHFFFAOYSA-L |
| Molecular Formula | C8H5NO4 |
Ammonium iron(III) sulfate dodecahydrate, 98+%
CAS: 7783-83-7 Molecular Formula: FeH28NO20S2 Molecular Weight (g/mol): 482.176 MDL Number: MFCD00150004 InChI Key: LCPUDZUWZDSKMX-UHFFFAOYSA-K Synonym: ammonium ferric sulfate,ferric ammonium sulfate dodecahydrate,iron ammonium sulfate dodecahydrate,sulfuric acid, ammonium iron 3+ salt 2:1:1 , dodecahydrate,ferric ammonium sulfate, acs,azanium iron 3+ disulfate dodecahydrate,ferric iron ammonium dodecahydrate disulfate,azanium iron +3 cation disulfate dodecahydrate,ammonium iron iii sulfate dodecahydrate, acs 100g PubChem CID: 197097 IUPAC Name: azanium;iron(3+);disulfate;dodecahydrate SMILES: [NH4+].O.O.O.O.O.O.O.O.O.O.O.O.[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Fe+3]
| PubChem CID | 197097 |
|---|---|
| CAS | 7783-83-7 |
| Molecular Weight (g/mol) | 482.176 |
| MDL Number | MFCD00150004 |
| SMILES | [NH4+].O.O.O.O.O.O.O.O.O.O.O.O.[O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Fe+3] |
| Synonym | ammonium ferric sulfate,ferric ammonium sulfate dodecahydrate,iron ammonium sulfate dodecahydrate,sulfuric acid, ammonium iron 3+ salt 2:1:1 , dodecahydrate,ferric ammonium sulfate, acs,azanium iron 3+ disulfate dodecahydrate,ferric iron ammonium dodecahydrate disulfate,azanium iron +3 cation disulfate dodecahydrate,ammonium iron iii sulfate dodecahydrate, acs 100g |
| IUPAC Name | azanium;iron(3+);disulfate;dodecahydrate |
| InChI Key | LCPUDZUWZDSKMX-UHFFFAOYSA-K |
| Molecular Formula | FeH28NO20S2 |