Chemicals
Filtered Search Results
Lithium metaborate, Puratronic™, 99.997% (metals basis)
CAS: 13453-69-5 Molecular Formula: B4H14Li2O7 Molecular Weight (g/mol): 183.23 MDL Number: MFCD00011089 InChI Key: DPYKRXYVXDYLEY-UHFFFAOYSA-N Synonym: lithium metaborate,boric acid hbo2 , lithium salt,lithium metaborate, anhydrous,lithium oxido oxo borane,bo2.li,boric acid hbo2 , lithium salt 1:1,lithium metaborate,anhydrous,lithium metaborate, puratronic,lithotab boron oxide hydroxide,lithium metaborate, acs PubChem CID: 123308 SMILES: [Li].[Li].[B].[B].[B].[B].O.O.O.O.O.O.O
| PubChem CID | 123308 |
|---|---|
| CAS | 13453-69-5 |
| Molecular Weight (g/mol) | 183.23 |
| MDL Number | MFCD00011089 |
| SMILES | [Li].[Li].[B].[B].[B].[B].O.O.O.O.O.O.O |
| Synonym | lithium metaborate,boric acid hbo2 , lithium salt,lithium metaborate, anhydrous,lithium oxido oxo borane,bo2.li,boric acid hbo2 , lithium salt 1:1,lithium metaborate,anhydrous,lithium metaborate, puratronic,lithotab boron oxide hydroxide,lithium metaborate, acs |
| InChI Key | DPYKRXYVXDYLEY-UHFFFAOYSA-N |
| Molecular Formula | B4H14Li2O7 |
Uracil 98.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 66-22-8 Molecular Formula: C4H4N2O2 Molecular Weight (g/mol): 112.09 MDL Number: MFCD00006016 InChI Key: ISAKRJDGNUQOIC-UHFFFAOYSA-N Synonym: uracil,2,4-dihydroxypyrimidine,2,4 1h,3h-pyrimidinedione,2,4-pyrimidinediol,2,4-dioxopyrimidine,pyrimidine-2,4 1h,3h-dione,pirod,2,4-pyrimidinedione,pyrod,hybar x PubChem CID: 1174 ChEBI: CHEBI:17568 IUPAC Name: 1,2,3,4-tetrahydropyrimidine-2,4-dione SMILES: O=C1NC=CC(=O)N1
| PubChem CID | 1174 |
|---|---|
| CAS | 66-22-8 |
| Molecular Weight (g/mol) | 112.09 |
| ChEBI | CHEBI:17568 |
| MDL Number | MFCD00006016 |
| SMILES | O=C1NC=CC(=O)N1 |
| Synonym | uracil,2,4-dihydroxypyrimidine,2,4 1h,3h-pyrimidinedione,2,4-pyrimidinediol,2,4-dioxopyrimidine,pyrimidine-2,4 1h,3h-dione,pirod,2,4-pyrimidinedione,pyrod,hybar x |
| IUPAC Name | 1,2,3,4-tetrahydropyrimidine-2,4-dione |
| InChI Key | ISAKRJDGNUQOIC-UHFFFAOYSA-N |
| Molecular Formula | C4H4N2O2 |
Sulfuric acid, ACS, 95.0-98.0%
CAS: 7664-93-9 Molecular Formula: H2O4S Molecular Weight (g/mol): 98.07 MDL Number: MFCD00064589 InChI Key: QAOWNCQODCNURD-UHFFFAOYSA-N Synonym: oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil PubChem CID: 1118 ChEBI: CHEBI:26836 IUPAC Name: sulfuric acid SMILES: OS(O)(=O)=O
| PubChem CID | 1118 |
|---|---|
| CAS | 7664-93-9 |
| Molecular Weight (g/mol) | 98.07 |
| ChEBI | CHEBI:26836 |
| MDL Number | MFCD00064589 |
| SMILES | OS(O)(=O)=O |
| Synonym | oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil |
| IUPAC Name | sulfuric acid |
| InChI Key | QAOWNCQODCNURD-UHFFFAOYSA-N |
| Molecular Formula | H2O4S |
Heptafluorobutyric anhydride, 98%
CAS: 336-59-4 Molecular Formula: C8F14O3 Molecular Weight (g/mol): 410.06 MDL Number: MFCD00000432 InChI Key: UFFSXJKVKBQEHC-UHFFFAOYSA-N Synonym: heptafluorobutyric anhydride,perfluorobutyric anhydride,hfba,heptafluorobutanoic anhydride,2,2,3,3,4,4,4-heptafluorobutanoic anhydride,butanoic acid, heptafluoro-, anhydride,heptafluoro-n-butyric anhydride,heptafluorobutyric acid anhydride,butanoic acid, 2,2,3,3,4,4,4-heptafluoro-, 1,1'-anhydride,heptafluorobutyric anhydride, for gc derivatization PubChem CID: 67643 ChEBI: CHEBI:39424 IUPAC Name: 2,2,3,3,4,4,4-heptafluorobutanoyl 2,2,3,3,4,4,4-heptafluorobutanoate SMILES: FC(F)(F)C(F)(F)C(F)(F)C(=O)OC(=O)C(F)(F)C(F)(F)C(F)(F)F
| PubChem CID | 67643 |
|---|---|
| CAS | 336-59-4 |
| Molecular Weight (g/mol) | 410.06 |
| ChEBI | CHEBI:39424 |
| MDL Number | MFCD00000432 |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(=O)OC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| Synonym | heptafluorobutyric anhydride,perfluorobutyric anhydride,hfba,heptafluorobutanoic anhydride,2,2,3,3,4,4,4-heptafluorobutanoic anhydride,butanoic acid, heptafluoro-, anhydride,heptafluoro-n-butyric anhydride,heptafluorobutyric acid anhydride,butanoic acid, 2,2,3,3,4,4,4-heptafluoro-, 1,1'-anhydride,heptafluorobutyric anhydride, for gc derivatization |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutanoyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| InChI Key | UFFSXJKVKBQEHC-UHFFFAOYSA-N |
| Molecular Formula | C8F14O3 |
Caffeine, citrated
CAS: 69-22-7 Molecular Formula: C14H18N4O9 Molecular Weight (g/mol): 386.32 MDL Number: MFCD00044986 InChI Key: RCQXSQPPHJPGOF-UHFFFAOYSA-N Synonym: caffeine citrate,caffeine, citrated,caffeina citrate,citrated caffein,caffeine citrate 1:1,caffeine citrated,unii-u26eo4675q,citric acid, compd. with caffeine 1:1,1,2,3-propanetricarboxylic acid, 2-hydroxy-, mixt. with 3,7-dihydro-1,3,7-trimethyl-1h-purine-2,6-dione,dsstox_cid_26938 PubChem CID: 6241 IUPAC Name: 2-hydroxypropane-1,2,3-tricarboxylic acid;1,3,7-trimethylpurine-2,6-dione SMILES: OC(=O)CC(O)(CC(O)=O)C(O)=O.CN1C=NC2=C1C(=O)N(C)C(=O)N2C
| PubChem CID | 6241 |
|---|---|
| CAS | 69-22-7 |
| Molecular Weight (g/mol) | 386.32 |
| MDL Number | MFCD00044986 |
| SMILES | OC(=O)CC(O)(CC(O)=O)C(O)=O.CN1C=NC2=C1C(=O)N(C)C(=O)N2C |
| Synonym | caffeine citrate,caffeine, citrated,caffeina citrate,citrated caffein,caffeine citrate 1:1,caffeine citrated,unii-u26eo4675q,citric acid, compd. with caffeine 1:1,1,2,3-propanetricarboxylic acid, 2-hydroxy-, mixt. with 3,7-dihydro-1,3,7-trimethyl-1h-purine-2,6-dione,dsstox_cid_26938 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;1,3,7-trimethylpurine-2,6-dione |
| InChI Key | RCQXSQPPHJPGOF-UHFFFAOYSA-N |
| Molecular Formula | C14H18N4O9 |
Cyclohexane, for residue analysis
CAS: 110-82-7 Molecular Formula: C6H12 Molecular Weight (g/mol): 84.16 MDL Number: MFCD00003814 InChI Key: XDTMQSROBMDMFD-UHFFFAOYSA-N Synonym: hexamethylene,hexahydrobenzene,hexanaphthene,cyclohexan,cykloheksan,cicloesano,cyclohexaan,benzene, hexahydro,benzenehexahydride,polycyclohexane PubChem CID: 8078 ChEBI: CHEBI:29005 IUPAC Name: cyclohexane SMILES: C1CCCCC1
| PubChem CID | 8078 |
|---|---|
| CAS | 110-82-7 |
| Molecular Weight (g/mol) | 84.16 |
| ChEBI | CHEBI:29005 |
| MDL Number | MFCD00003814 |
| SMILES | C1CCCCC1 |
| Synonym | hexamethylene,hexahydrobenzene,hexanaphthene,cyclohexan,cykloheksan,cicloesano,cyclohexaan,benzene, hexahydro,benzenehexahydride,polycyclohexane |
| IUPAC Name | cyclohexane |
| InChI Key | XDTMQSROBMDMFD-UHFFFAOYSA-N |
| Molecular Formula | C6H12 |
Zinc wire, 0.25mm (0.01in) dia, 99.99+% (metals basis)
CAS: 7440-66-6 Molecular Formula: Zn Molecular Weight (g/mol): 65.38 MDL Number: MFCD00011291 InChI Key: HCHKCACWOHOZIP-UHFFFAOYSA-N Synonym: dust,cinc,powder,merrillite,rheinzink,jasad,blue powder,granular,zinc, elemental,emanay dust PubChem CID: 23994 ChEBI: CHEBI:30185 IUPAC Name: zinc SMILES: [Zn]
| PubChem CID | 23994 |
|---|---|
| CAS | 7440-66-6 |
| Molecular Weight (g/mol) | 65.38 |
| ChEBI | CHEBI:30185 |
| MDL Number | MFCD00011291 |
| SMILES | [Zn] |
| Synonym | dust,cinc,powder,merrillite,rheinzink,jasad,blue powder,granular,zinc, elemental,emanay dust |
| IUPAC Name | zinc |
| InChI Key | HCHKCACWOHOZIP-UHFFFAOYSA-N |
| Molecular Formula | Zn |
Tetraethylenepentamine, technical
CAS: 112-57-2 Molecular Formula: C8H23N5 Molecular Weight (g/mol): 189.31 MDL Number: MFCD00008168 InChI Key: FAGUFWYHJQFNRV-UHFFFAOYSA-N Synonym: tetraethylenepentamine,tetren,1,4,7,10,13-pentaazatridecane,tetraethylene pentamine,tetraethylpentylamine,1,11-diamino-3,6,9-triazaundecane,3,6,9-triazaundecamethylenediamine,3,6,9-triazaundecane-1,11-diamine,deh 26,unii-yzd1c9kq28 PubChem CID: 8197 ChEBI: CHEBI:49798 IUPAC Name: N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine SMILES: NCCNCCNCCNCCN
| PubChem CID | 8197 |
|---|---|
| CAS | 112-57-2 |
| Molecular Weight (g/mol) | 189.31 |
| ChEBI | CHEBI:49798 |
| MDL Number | MFCD00008168 |
| SMILES | NCCNCCNCCNCCN |
| Synonym | tetraethylenepentamine,tetren,1,4,7,10,13-pentaazatridecane,tetraethylene pentamine,tetraethylpentylamine,1,11-diamino-3,6,9-triazaundecane,3,6,9-triazaundecamethylenediamine,3,6,9-triazaundecane-1,11-diamine,deh 26,unii-yzd1c9kq28 |
| IUPAC Name | N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine |
| InChI Key | FAGUFWYHJQFNRV-UHFFFAOYSA-N |
| Molecular Formula | C8H23N5 |
Thermo Scientific Chemicals Tartrazine, 89%, pure
CAS: 1934-21-0 Molecular Formula: C16H9N4Na3O9S2 Molecular Weight (g/mol): 534.35 MDL Number: MFCD00148908 InChI Key: UJMBCXLDXJUMFB-UHFFFAOYSA-K Synonym: tartrazine,yellow 5,aizen tartrazine,trisodium salt,food yellow 4,tartrazine FD&C yellow #5,c.i. acid yellow 23,atul tartrazine,erio tartrazine,kako tartrazine PubChem CID: 164825 IUPAC Name: trisodium;5-oxo-1-(4-sulfonatophenyl)-4-[(4-sulfonatophenyl)diazenyl]-4H-pyrazole-3-carboxylate SMILES: C1=CC(=CC=C1N=NC2C(=NN(C2=O)C3=CC=C(C=C3)S(=O)(=O)[O-])C(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+].[Na+]
| PubChem CID | 164825 |
|---|---|
| CAS | 1934-21-0 |
| Molecular Weight (g/mol) | 534.35 |
| MDL Number | MFCD00148908 |
| SMILES | C1=CC(=CC=C1N=NC2C(=NN(C2=O)C3=CC=C(C=C3)S(=O)(=O)[O-])C(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+].[Na+] |
| Synonym | tartrazine,yellow 5,aizen tartrazine,trisodium salt,food yellow 4,tartrazine FD&C yellow #5,c.i. acid yellow 23,atul tartrazine,erio tartrazine,kako tartrazine |
| IUPAC Name | trisodium;5-oxo-1-(4-sulfonatophenyl)-4-[(4-sulfonatophenyl)diazenyl]-4H-pyrazole-3-carboxylate |
| InChI Key | UJMBCXLDXJUMFB-UHFFFAOYSA-K |
| Molecular Formula | C16H9N4Na3O9S2 |
2,3-Dihydrofuran, 98+%
CAS: 1191-99-7 Molecular Formula: C4H6O Molecular Weight (g/mol): 70.09 MDL Number: MFCD00003205 InChI Key: JKTCBAGSMQIFNL-UHFFFAOYSA-N PubChem CID: 70934 ChEBI: CHEBI:51662 IUPAC Name: 2,3-dihydrofuran SMILES: C1CC=CO1
| PubChem CID | 70934 |
|---|---|
| CAS | 1191-99-7 |
| Molecular Weight (g/mol) | 70.09 |
| ChEBI | CHEBI:51662 |
| MDL Number | MFCD00003205 |
| SMILES | C1CC=CO1 |
| IUPAC Name | 2,3-dihydrofuran |
| InChI Key | JKTCBAGSMQIFNL-UHFFFAOYSA-N |
| Molecular Formula | C4H6O |
Ethanolamine, 98+%
CAS: 141-43-5 Molecular Formula: C2H7NO Molecular Weight (g/mol): 61.08 MDL Number: MFCD00008183 InChI Key: HZAXFHJVJLSVMW-UHFFFAOYSA-N Synonym: ethanolamine,monoethanolamine,aminoethanol,2-hydroxyethylamine,colamine,glycinol,olamine,2-amino-1-ethanol,ethanol, 2-amino,ethylolamine PubChem CID: 700 ChEBI: CHEBI:16000 SMILES: NCCO
| PubChem CID | 700 |
|---|---|
| CAS | 141-43-5 |
| Molecular Weight (g/mol) | 61.08 |
| ChEBI | CHEBI:16000 |
| MDL Number | MFCD00008183 |
| SMILES | NCCO |
| Synonym | ethanolamine,monoethanolamine,aminoethanol,2-hydroxyethylamine,colamine,glycinol,olamine,2-amino-1-ethanol,ethanol, 2-amino,ethylolamine |
| InChI Key | HZAXFHJVJLSVMW-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO |
Triphenylbismuth, 98+%, Thermo Scientific Chemicals
CAS: 603-33-8 Molecular Formula: C18H15Bi Molecular Weight (g/mol): 440.298 MDL Number: MFCD00014064 InChI Key: ZHXAZZQXWJJBHA-UHFFFAOYSA-N Synonym: triphenylbismuth,triphenylbismuthine,bismuthine, triphenyl,aerotex,bismuth triphenyl,triphenyl bismuth,bismuth, triphenyl,trifenylbismutin,caswell no. 896,trifenylbismutin czech PubChem CID: 11774 IUPAC Name: triphenylbismuthane SMILES: C1=CC=C(C=C1)[Bi](C2=CC=CC=C2)C3=CC=CC=C3
| PubChem CID | 11774 |
|---|---|
| CAS | 603-33-8 |
| Molecular Weight (g/mol) | 440.298 |
| MDL Number | MFCD00014064 |
| SMILES | C1=CC=C(C=C1)[Bi](C2=CC=CC=C2)C3=CC=CC=C3 |
| Synonym | triphenylbismuth,triphenylbismuthine,bismuthine, triphenyl,aerotex,bismuth triphenyl,triphenyl bismuth,bismuth, triphenyl,trifenylbismutin,caswell no. 896,trifenylbismutin czech |
| IUPAC Name | triphenylbismuthane |
| InChI Key | ZHXAZZQXWJJBHA-UHFFFAOYSA-N |
| Molecular Formula | C18H15Bi |
| Linear Formula | (CH3)3N |
|---|---|
| Molecular Weight (g/mol) | 59.11 |
| ChEBI | CHEBI:18139 |
| InChI Key | GETQZCLCWQTVFV-UHFFFAOYSA-N |
| Density | 0.7500g/mL |
| PubChem CID | 1146 |
| Percent Purity | 32 to 34% |
| RTECS Number | PA0350000 |
| Formula Weight | 59.11 |
| Boiling Point | 50.0°C |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Trimethylamine |
| Grade | Pure |
| SMILES | CN(C)C |
| Merck Index | 15,988 |
| CAS | 64-17-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. Immediately call a POISON CENTER or doctor/physician. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if pre |
| MDL Number | MFCD00008327 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Harmful if inhaled. Harmful if swallowed. May cause respiratory irritation. Highly flammable liquid and vapor. |
| Solubility Information | Solubility in water: soluble. Other solubilities: soluble in alcohol,ether,benzene,toluene,,xylene,ethylbenzene and chloroform |
| Flash Point | −20°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Refractive Index | 1.3630 to 1.3660 |
| Synonym | trimethylamine,methanamine, n,n-dimethyl,dimethylmethaneamine,n-trimethylamine,trimethylamine solution,ch3 3n,trimethyl amine,trimethylamin,trimethyl-amine,fema number 3241 |
| TSCA | TSCA |
| Beilstein | 04,43 |
| Molecular Formula | C3H9N |
| EINECS Number | 200-875-0 |
| Specific Gravity | 0.75 |
Acrylic Acid (stabilized with MEHQ) 99.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 79-10-7 Molecular Formula: C3H4O2 Molecular Weight (g/mol): 72.063 MDL Number: MFCD00004367 InChI Key: NIXOWILDQLNWCW-UHFFFAOYSA-N Synonym: acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer PubChem CID: 6581 ChEBI: CHEBI:18308 IUPAC Name: prop-2-enoic acid SMILES: C=CC(=O)O
| PubChem CID | 6581 |
|---|---|
| CAS | 79-10-7 |
| Molecular Weight (g/mol) | 72.063 |
| ChEBI | CHEBI:18308 |
| MDL Number | MFCD00004367 |
| SMILES | C=CC(=O)O |
| Synonym | acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer |
| IUPAC Name | prop-2-enoic acid |
| InChI Key | NIXOWILDQLNWCW-UHFFFAOYSA-N |
| Molecular Formula | C3H4O2 |
Triphenylmethanol, 97%
CAS: 76-84-6 Molecular Formula: C19H16O Molecular Weight (g/mol): 260.34 MDL Number: MFCD00004445,MFCD10565638 InChI Key: LZTRCELOJRDYMQ-UHFFFAOYSA-N Synonym: triphenylcarbinol,trityl alcohol,tritanol,triphenylmethyl alcohol,triphenyl methanol,triphenyl carbinol,methanol, triphenyl,unii-u97q0ou9kb,triphenyl-methanol,benzenemethanol, .alpha.,.alpha.-diphenyl PubChem CID: 6457 IUPAC Name: triphenylmethanol SMILES: OC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 6457 |
|---|---|
| CAS | 76-84-6 |
| Molecular Weight (g/mol) | 260.34 |
| MDL Number | MFCD00004445,MFCD10565638 |
| SMILES | OC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenylcarbinol,trityl alcohol,tritanol,triphenylmethyl alcohol,triphenyl methanol,triphenyl carbinol,methanol, triphenyl,unii-u97q0ou9kb,triphenyl-methanol,benzenemethanol, .alpha.,.alpha.-diphenyl |
| IUPAC Name | triphenylmethanol |
| InChI Key | LZTRCELOJRDYMQ-UHFFFAOYSA-N |
| Molecular Formula | C19H16O |