Chemicals
Filtered Search Results
3,3-Dimethyl-1-butyne, 98%
CAS: 917-92-0 Molecular Formula: C6H10 Molecular Weight (g/mol): 82.13 MDL Number: MFCD00008852 InChI Key: PPWNCLVNXGCGAF-UHFFFAOYSA-N Synonym: 3,3-dimethyl-1-butyne,tert-butylacetylene,t-butylacetylene,3,3-dimethylbutyne,1-butyne, 3,3-dimethyl,t-butyl acetylene,3,3,3-trimethylpropyne,1-butyne,3,3-dimethyl,tertbutylacetylene,tert-butylacetyiene PubChem CID: 13512 IUPAC Name: 3,3-dimethylbut-1-yne SMILES: CC(C)(C)C#C
| PubChem CID | 13512 |
|---|---|
| CAS | 917-92-0 |
| Molecular Weight (g/mol) | 82.13 |
| MDL Number | MFCD00008852 |
| SMILES | CC(C)(C)C#C |
| Synonym | 3,3-dimethyl-1-butyne,tert-butylacetylene,t-butylacetylene,3,3-dimethylbutyne,1-butyne, 3,3-dimethyl,t-butyl acetylene,3,3,3-trimethylpropyne,1-butyne,3,3-dimethyl,tertbutylacetylene,tert-butylacetyiene |
| IUPAC Name | 3,3-dimethylbut-1-yne |
| InChI Key | PPWNCLVNXGCGAF-UHFFFAOYSA-N |
| Molecular Formula | C6H10 |
Aluminum nitrate nonahydrate, 99+%, for analysis
CAS: 7784-27-2 InChI Key: SWCIQHXIXUMHKA-UHFFFAOYSA-N Synonym: aluminum nitrate nonahydrate,aluminum trinitrate nonahydrate,unii-8mc6621v1h,aluminum iii nitrate, nonahydrate 1:3:9,nitric acid aluminum salt,nitric acid, aluminum salt, nonahydrate 8ci,9ci,aluminum nitrate, acs,aluminum 3+ nonahydrate trinitronate,aluminum nitrate nonahydrate, low mercury, puratronic PubChem CID: 24567 IUPAC Name: aluminum;trinitrate;nonahydrate SMILES: [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.O.O.O.O.O.O.[Al+3]
| PubChem CID | 24567 |
|---|---|
| CAS | 7784-27-2 |
| SMILES | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.O.O.O.O.O.O.[Al+3] |
| Synonym | aluminum nitrate nonahydrate,aluminum trinitrate nonahydrate,unii-8mc6621v1h,aluminum iii nitrate, nonahydrate 1:3:9,nitric acid aluminum salt,nitric acid, aluminum salt, nonahydrate 8ci,9ci,aluminum nitrate, acs,aluminum 3+ nonahydrate trinitronate,aluminum nitrate nonahydrate, low mercury, puratronic |
| IUPAC Name | aluminum;trinitrate;nonahydrate |
| InChI Key | SWCIQHXIXUMHKA-UHFFFAOYSA-N |
1,3-Diphenyl-1-butanone, 95%, Thermo Scientific Chemicals
CAS: 1533-20-6 Molecular Formula: C16H16O Molecular Weight (g/mol): 224.303 MDL Number: MFCD00026345 InChI Key: GIVFXLVPKFXTCU-UHFFFAOYSA-N Synonym: 1,3-diphenyl-1-butanone,3-phenylbutyrophenone,b-phenylbutyrophenone,acmc-20ap3x,1,3-diphenyl-butan-1-one,phenyl 2-phenylpropyl ketone,1-butanone, 1,3-diphenyl,2-alpha-methylbenzyl acetophenone PubChem CID: 137065 IUPAC Name: 1,3-diphenylbutan-1-one SMILES: CC(CC(=O)C1=CC=CC=C1)C2=CC=CC=C2
| PubChem CID | 137065 |
|---|---|
| CAS | 1533-20-6 |
| Molecular Weight (g/mol) | 224.303 |
| MDL Number | MFCD00026345 |
| SMILES | CC(CC(=O)C1=CC=CC=C1)C2=CC=CC=C2 |
| Synonym | 1,3-diphenyl-1-butanone,3-phenylbutyrophenone,b-phenylbutyrophenone,acmc-20ap3x,1,3-diphenyl-butan-1-one,phenyl 2-phenylpropyl ketone,1-butanone, 1,3-diphenyl,2-alpha-methylbenzyl acetophenone |
| IUPAC Name | 1,3-diphenylbutan-1-one |
| InChI Key | GIVFXLVPKFXTCU-UHFFFAOYSA-N |
| Molecular Formula | C16H16O |
Salicylhydroxamic acid, 99%
CAS: 89-73-6 Molecular Formula: C7H7NO3 Molecular Weight (g/mol): 153.137 MDL Number: MFCD00002110 InChI Key: HBROZNQEVUILML-UHFFFAOYSA-N Synonym: salicylhydroxamic acid,2-hydroxybenzohydroxamic acid,salicylohydroxamic acid,sham,salicylohydroximic acid,benzamide, n,2-dihydroxy,2-hydroxybenzhydroxamic acid,o-hydroxybenzohydroxamic acid,sha,2,n-dihydroxy-benzamide PubChem CID: 66644 ChEBI: CHEBI:45615 IUPAC Name: N,2-dihydroxybenzamide SMILES: C1=CC=C(C(=C1)C(=O)NO)O
| PubChem CID | 66644 |
|---|---|
| CAS | 89-73-6 |
| Molecular Weight (g/mol) | 153.137 |
| ChEBI | CHEBI:45615 |
| MDL Number | MFCD00002110 |
| SMILES | C1=CC=C(C(=C1)C(=O)NO)O |
| Synonym | salicylhydroxamic acid,2-hydroxybenzohydroxamic acid,salicylohydroxamic acid,sham,salicylohydroximic acid,benzamide, n,2-dihydroxy,2-hydroxybenzhydroxamic acid,o-hydroxybenzohydroxamic acid,sha,2,n-dihydroxy-benzamide |
| IUPAC Name | N,2-dihydroxybenzamide |
| InChI Key | HBROZNQEVUILML-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO3 |
2-Phenylethyl acetate, 98%
CAS: 103-45-7 Molecular Formula: C10H12O2 Molecular Weight (g/mol): 164.20 MDL Number: MFCD00008720 InChI Key: MDHYEMXUFSJLGV-UHFFFAOYSA-N Synonym: phenethyl acetate,2-phenethyl acetate,acetic acid, 2-phenylethyl ester,benzylcarbinyl acetate,beta-phenylethyl acetate,acetic acid, phenethyl ester,phenethyl alcohol, acetate,phenylethyl acetate,acetic acid phenethyl ester,ethanol, 2-phenyl-, acetate PubChem CID: 7654 ChEBI: CHEBI:31988 IUPAC Name: 2-phenylethyl acetate SMILES: CC(=O)OCCC1=CC=CC=C1
| PubChem CID | 7654 |
|---|---|
| CAS | 103-45-7 |
| Molecular Weight (g/mol) | 164.20 |
| ChEBI | CHEBI:31988 |
| MDL Number | MFCD00008720 |
| SMILES | CC(=O)OCCC1=CC=CC=C1 |
| Synonym | phenethyl acetate,2-phenethyl acetate,acetic acid, 2-phenylethyl ester,benzylcarbinyl acetate,beta-phenylethyl acetate,acetic acid, phenethyl ester,phenethyl alcohol, acetate,phenylethyl acetate,acetic acid phenethyl ester,ethanol, 2-phenyl-, acetate |
| IUPAC Name | 2-phenylethyl acetate |
| InChI Key | MDHYEMXUFSJLGV-UHFFFAOYSA-N |
| Molecular Formula | C10H12O2 |
Isobutyl Acrylate (stabilized with MEHQ) 99.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 106-63-8 Molecular Formula: C7H12O2 Molecular Weight (g/mol): 128.17 MDL Number: MFCD00042865 InChI Key: CFVWNXQPGQOHRJ-UHFFFAOYSA-N Synonym: isobutyl acrylate,isobutyl propenoate,isobutyl 2-propenoate,2-propenoic acid, 2-methylpropyl ester,acrylic acid, isobutyl ester,2-methylpropyl acrylate,isobutylester kyseliny akrylove,propenoic acid, isobutyl ester,ccris 4828,hsdb 610 PubChem CID: 7819 IUPAC Name: 2-methylpropyl prop-2-enoate SMILES: CC(C)COC(=O)C=C
| PubChem CID | 7819 |
|---|---|
| CAS | 106-63-8 |
| Molecular Weight (g/mol) | 128.17 |
| MDL Number | MFCD00042865 |
| SMILES | CC(C)COC(=O)C=C |
| Synonym | isobutyl acrylate,isobutyl propenoate,isobutyl 2-propenoate,2-propenoic acid, 2-methylpropyl ester,acrylic acid, isobutyl ester,2-methylpropyl acrylate,isobutylester kyseliny akrylove,propenoic acid, isobutyl ester,ccris 4828,hsdb 610 |
| IUPAC Name | 2-methylpropyl prop-2-enoate |
| InChI Key | CFVWNXQPGQOHRJ-UHFFFAOYSA-N |
| Molecular Formula | C7H12O2 |
Diphenyliodonium hexafluorophosphate, 98%
CAS: 58109-40-3 Molecular Formula: C12H10I Molecular Weight (g/mol): 281.12 MDL Number: MFCD00061398 InChI Key: OZLBDYMWFAHSOQ-UHFFFAOYSA-N Synonym: diphenyliodonium hexafluorophosphate,diphenyliodanium hexafluorophosphate,diphenyliodonium hexafluorophosphate v,iodonium, diphenyl-, hexafluorophosphate 1-,iodonium, diphenyl-, hexafluorophosphate 1-1:1,diphenyliodonium pf6,dpihfp,acmc-209m2o,phi + pf6-,diphenyliodanium; hexafluoro-$l^ 5-phosphanuide PubChem CID: 2737136 IUPAC Name: diphenyliodanium SMILES: [I+](C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 2737136 |
|---|---|
| CAS | 58109-40-3 |
| Molecular Weight (g/mol) | 281.12 |
| MDL Number | MFCD00061398 |
| SMILES | [I+](C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | diphenyliodonium hexafluorophosphate,diphenyliodanium hexafluorophosphate,diphenyliodonium hexafluorophosphate v,iodonium, diphenyl-, hexafluorophosphate 1-,iodonium, diphenyl-, hexafluorophosphate 1-1:1,diphenyliodonium pf6,dpihfp,acmc-209m2o,phi + pf6-,diphenyliodanium; hexafluoro-$l^ 5-phosphanuide |
| IUPAC Name | diphenyliodanium |
| InChI Key | OZLBDYMWFAHSOQ-UHFFFAOYSA-N |
| Molecular Formula | C12H10I |
Chloro(methyl)diphenylsilane, 97%
CAS: 144-79-6 Molecular Formula: C13H13ClSi Molecular Weight (g/mol): 232.78 MDL Number: MFCD00000498 InChI Key: OJZNZOXALZKPEA-UHFFFAOYSA-N Synonym: chloro methyl diphenylsilane,methyldiphenylchlorosilane,chloromethyldiphenylsilane,silane, chloromethyldiphenyl,chlorodiphenylmethylsilane,diphenylmethylchlorosilane,methyldiphenylsilyl chloride,dpmscl,chloro-methyl-diphenyl-silane,benzene, 1,1'-chloromethylsilylene bis PubChem CID: 67349 IUPAC Name: chloro-methyl-diphenylsilane SMILES: C[Si](Cl)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 67349 |
|---|---|
| CAS | 144-79-6 |
| Molecular Weight (g/mol) | 232.78 |
| MDL Number | MFCD00000498 |
| SMILES | C[Si](Cl)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | chloro methyl diphenylsilane,methyldiphenylchlorosilane,chloromethyldiphenylsilane,silane, chloromethyldiphenyl,chlorodiphenylmethylsilane,diphenylmethylchlorosilane,methyldiphenylsilyl chloride,dpmscl,chloro-methyl-diphenyl-silane,benzene, 1,1'-chloromethylsilylene bis |
| IUPAC Name | chloro-methyl-diphenylsilane |
| InChI Key | OJZNZOXALZKPEA-UHFFFAOYSA-N |
| Molecular Formula | C13H13ClSi |
Sulfur trioxide-pyridine complex, 98%, active SO3 ca 48-50%
CAS: 26412-87-3 Molecular Formula: C5H5NO3S Molecular Weight (g/mol): 159.16 MDL Number: MFCD00012437 InChI Key: UDYFLDICVHJSOY-UHFFFAOYSA-N Synonym: pyridine sulfur trioxide,sulfur trioxide pyridine complex,pyridine; sulfur trioxide,pyridine sulfotrioxide,pyridine compound with sulfur trioxide 1:1,sulfur trioxide, compd. with pyridine,pyridine-sulfur trioxide complex,active sulfure trioxide,sulfur trioxide-pyridine,pyridine-sulfur trioxide PubChem CID: 168533 SMILES: O=S(=O)=O.C1=CC=NC=C1
| PubChem CID | 168533 |
|---|---|
| CAS | 26412-87-3 |
| Molecular Weight (g/mol) | 159.16 |
| MDL Number | MFCD00012437 |
| SMILES | O=S(=O)=O.C1=CC=NC=C1 |
| Synonym | pyridine sulfur trioxide,sulfur trioxide pyridine complex,pyridine; sulfur trioxide,pyridine sulfotrioxide,pyridine compound with sulfur trioxide 1:1,sulfur trioxide, compd. with pyridine,pyridine-sulfur trioxide complex,active sulfure trioxide,sulfur trioxide-pyridine,pyridine-sulfur trioxide |
| InChI Key | UDYFLDICVHJSOY-UHFFFAOYSA-N |
| Molecular Formula | C5H5NO3S |
2'-Hydroxyacetophenone, 98%
CAS: 118-93-4 Molecular Formula: C8H8O2 Molecular Weight (g/mol): 136.15 MDL Number: MFCD00002219 InChI Key: JECYUBVRTQDVAT-UHFFFAOYSA-N Synonym: 2'-hydroxyacetophenone,2-acetylphenol,1-2-hydroxyphenyl ethanone,o-hydroxyacetophenone,o-acetylphenol,o-hydroxyphenyl methyl ketone,ethanone, 1-2-hydroxyphenyl,1-2-hydroxyphenyl ethan-1-one,acetophenone, 2'-hydroxy,2-hydroxyphenyl methyl ketone PubChem CID: 8375 IUPAC Name: 1-(2-hydroxyphenyl)ethanone SMILES: CC(=O)C1=CC=CC=C1O
| PubChem CID | 8375 |
|---|---|
| CAS | 118-93-4 |
| Molecular Weight (g/mol) | 136.15 |
| MDL Number | MFCD00002219 |
| SMILES | CC(=O)C1=CC=CC=C1O |
| Synonym | 2'-hydroxyacetophenone,2-acetylphenol,1-2-hydroxyphenyl ethanone,o-hydroxyacetophenone,o-acetylphenol,o-hydroxyphenyl methyl ketone,ethanone, 1-2-hydroxyphenyl,1-2-hydroxyphenyl ethan-1-one,acetophenone, 2'-hydroxy,2-hydroxyphenyl methyl ketone |
| IUPAC Name | 1-(2-hydroxyphenyl)ethanone |
| InChI Key | JECYUBVRTQDVAT-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2 |
4-tert-Butylbenzaldehyde, 95%
CAS: 939-97-9 Molecular Formula: C11H14O Molecular Weight (g/mol): 162.23 MDL Number: MFCD00035742 InChI Key: OTXINXDGSUFPNU-UHFFFAOYSA-N Synonym: 4-tert-butyl benzaldehyde,p-t-butylbenzaldehyde,p-tertbutyl benzaldehyde,benzaldehyde, 4-1,1-dimethylethyl,p-tert-butylbenzaldehyde,4-t-butylbenzaldehyde,4-tert-butyl-benzaldehyde,unii-qxf0qy8503,4-t-butyl benzaldehyde,benzaldehyde, p-tert-butyl PubChem CID: 70324 IUPAC Name: 4-tert-butylbenzaldehyde SMILES: CC(C)(C)C1=CC=C(C=O)C=C1
| PubChem CID | 70324 |
|---|---|
| CAS | 939-97-9 |
| Molecular Weight (g/mol) | 162.23 |
| MDL Number | MFCD00035742 |
| SMILES | CC(C)(C)C1=CC=C(C=O)C=C1 |
| Synonym | 4-tert-butyl benzaldehyde,p-t-butylbenzaldehyde,p-tertbutyl benzaldehyde,benzaldehyde, 4-1,1-dimethylethyl,p-tert-butylbenzaldehyde,4-t-butylbenzaldehyde,4-tert-butyl-benzaldehyde,unii-qxf0qy8503,4-t-butyl benzaldehyde,benzaldehyde, p-tert-butyl |
| IUPAC Name | 4-tert-butylbenzaldehyde |
| InChI Key | OTXINXDGSUFPNU-UHFFFAOYSA-N |
| Molecular Formula | C11H14O |
N-Methyl-N-(trimethylsilyl)trifluoroacetamide, 97%
CAS: 24589-78-4 Molecular Formula: C6H12F3NOSi Molecular Weight (g/mol): 199.25 MDL Number: MFCD00000411 InChI Key: MSPCIZMDDUQPGJ-UHFFFAOYSA-N Synonym: mstfa,n-methyl-n-trimethylsilyl trifluoroacetamide,2,2,2-trifluoro-n-methyl-n-trimethylsilyl acetamide,n-methyl-n-trimethylsilyltrifluoroacetamide,acetamide, 2,2,2-trifluoro-n-methyl-n-trimethylsilyl,n-methyl-n-trimethylsilyl-trifluoroacetamide,acmc-209tfm PubChem CID: 32510 ChEBI: CHEBI:85064 IUPAC Name: 2,2,2-trifluoro-N-methyl-N-trimethylsilylacetamide SMILES: CN(C(=O)C(F)(F)F)[Si](C)(C)C
| PubChem CID | 32510 |
|---|---|
| CAS | 24589-78-4 |
| Molecular Weight (g/mol) | 199.25 |
| ChEBI | CHEBI:85064 |
| MDL Number | MFCD00000411 |
| SMILES | CN(C(=O)C(F)(F)F)[Si](C)(C)C |
| Synonym | mstfa,n-methyl-n-trimethylsilyl trifluoroacetamide,2,2,2-trifluoro-n-methyl-n-trimethylsilyl acetamide,n-methyl-n-trimethylsilyltrifluoroacetamide,acetamide, 2,2,2-trifluoro-n-methyl-n-trimethylsilyl,n-methyl-n-trimethylsilyl-trifluoroacetamide,acmc-209tfm |
| IUPAC Name | 2,2,2-trifluoro-N-methyl-N-trimethylsilylacetamide |
| InChI Key | MSPCIZMDDUQPGJ-UHFFFAOYSA-N |
| Molecular Formula | C6H12F3NOSi |
Sodium carbonate, 99.999%, (trace metal basis)
CAS: 497-19-8 Molecular Formula: CNa2O3 Molecular Weight (g/mol): 105.99 MDL Number: MFCD00003494 InChI Key: CDBYLPFSWZWCQE-UHFFFAOYSA-L Synonym: sodium carbonate,disodium carbonate,soda ash,carbonic acid disodium salt,calcined soda,sodium carbonate, anhydrous,carbonic acid, disodium salt,washing soda,sodiumcarbonate,solvay soda PubChem CID: 10340 ChEBI: CHEBI:29377 SMILES: [Na+].[Na+].[O-]C([O-])=O
| PubChem CID | 10340 |
|---|---|
| CAS | 497-19-8 |
| Molecular Weight (g/mol) | 105.99 |
| ChEBI | CHEBI:29377 |
| MDL Number | MFCD00003494 |
| SMILES | [Na+].[Na+].[O-]C([O-])=O |
| Synonym | sodium carbonate,disodium carbonate,soda ash,carbonic acid disodium salt,calcined soda,sodium carbonate, anhydrous,carbonic acid, disodium salt,washing soda,sodiumcarbonate,solvay soda |
| InChI Key | CDBYLPFSWZWCQE-UHFFFAOYSA-L |
| Molecular Formula | CNa2O3 |
1,10-Phenanthroline monohydrate, ACS reagent
CAS: 5144-89-8 Molecular Formula: C12H10N2O Molecular Weight (g/mol): 198.23 MDL Number: MFCD00149973 InChI Key: PPQJCISYYXZCAE-UHFFFAOYSA-N PubChem CID: 21226 SMILES: O.C1=CN=C2C(C=CC3=CC=CN=C23)=C1
| PubChem CID | 21226 |
|---|---|
| CAS | 5144-89-8 |
| Molecular Weight (g/mol) | 198.23 |
| MDL Number | MFCD00149973 |
| SMILES | O.C1=CN=C2C(C=CC3=CC=CN=C23)=C1 |
| InChI Key | PPQJCISYYXZCAE-UHFFFAOYSA-N |
| Molecular Formula | C12H10N2O |
Thermo Scientific Chemicals Inositol, 98+%
CAS: 87-89-8 Molecular Formula: C6H12O6 Molecular Weight (g/mol): 180.16 MDL Number: MFCD00077932 InChI Key: CDAISMWEOUEBRE-UHFFFAOYSA-N Synonym: scyllo-inositol,myo-inositol,inositol,muco-inositol,epi-inositol,i-inositol,meso-inositol,allo-inositol,1d-chiro-inositol,myoinositol PubChem CID: 892 ChEBI: CHEBI:24848 IUPAC Name: cyclohexane-1,2,3,4,5,6-hexol SMILES: C1(C(C(C(C(C1O)O)O)O)O)O
| PubChem CID | 892 |
|---|---|
| CAS | 87-89-8 |
| Molecular Weight (g/mol) | 180.16 |
| ChEBI | CHEBI:24848 |
| MDL Number | MFCD00077932 |
| SMILES | C1(C(C(C(C(C1O)O)O)O)O)O |
| Synonym | scyllo-inositol,myo-inositol,inositol,muco-inositol,epi-inositol,i-inositol,meso-inositol,allo-inositol,1d-chiro-inositol,myoinositol |
| IUPAC Name | cyclohexane-1,2,3,4,5,6-hexol |
| InChI Key | CDAISMWEOUEBRE-UHFFFAOYSA-N |
| Molecular Formula | C6H12O6 |