Chemicals
Filtered Search Results
Thiamine Hydrochloride, Powder, MP Biomedicals
CAS: 67-03-8 Molecular Formula: C12H17ClN4OS·HCl Molecular Weight (g/mol): 337.263 MDL Number: MFCD00012780 Synonym: Aneurine hydrochloride,Vitamin B1 hydrochloride,Vitamin B1 HCl,vitamin b1 mononitrate,aneurine mononitrate,aneurine nitrate,betabion mononitrate,thiamine nitrate salt,vitamin b sub 1 nitrate,thiamine mononitrate usp
| CAS | 67-03-8 |
|---|---|
| Molecular Weight (g/mol) | 337.263 |
| MDL Number | MFCD00012780 |
| Synonym | Aneurine hydrochloride,Vitamin B1 hydrochloride,Vitamin B1 HCl,vitamin b1 mononitrate,aneurine mononitrate,aneurine nitrate,betabion mononitrate,thiamine nitrate salt,vitamin b sub 1 nitrate,thiamine mononitrate usp |
| Molecular Formula | C12H17ClN4OS·HCl |
n-Pentane, capillary GC grade, 98+%
CAS: 109-66-0 Molecular Formula: C5H12 Molecular Weight (g/mol): 72.15 MDL Number: MFCD00009498 InChI Key: OFBQJSOFQDEBGM-UHFFFAOYSA-N Synonym: n-pentane,pentan,skellysolve a,pentanen,pentani,amyl hydride,tetrafume,tetrakil,tetraspot,pentan polish PubChem CID: 8003 ChEBI: CHEBI:37830 IUPAC Name: pentane SMILES: CCCCC
| PubChem CID | 8003 |
|---|---|
| CAS | 109-66-0 |
| Molecular Weight (g/mol) | 72.15 |
| ChEBI | CHEBI:37830 |
| MDL Number | MFCD00009498 |
| SMILES | CCCCC |
| Synonym | n-pentane,pentan,skellysolve a,pentanen,pentani,amyl hydride,tetrafume,tetrakil,tetraspot,pentan polish |
| IUPAC Name | pentane |
| InChI Key | OFBQJSOFQDEBGM-UHFFFAOYSA-N |
| Molecular Formula | C5H12 |
Potassium nitrate, 99+%, for analysis
CAS: 7757-79-1 Molecular Formula: KNO3 Molecular Weight (g/mol): 101.10 MDL Number: MFCD00011409 InChI Key: FGIUAXJPYTZDNR-UHFFFAOYSA-N Synonym: potassium nitrate,saltpeter,nitre,nitrate of potash,vicknite,nitric acid potassium salt,nitric acid, potassium salt,saltpetre,kaliumnitrat,kalii nitras PubChem CID: 24434 ChEBI: CHEBI:63043 SMILES: [K+].[O-][N+]([O-])=O
| PubChem CID | 24434 |
|---|---|
| CAS | 7757-79-1 |
| Molecular Weight (g/mol) | 101.10 |
| ChEBI | CHEBI:63043 |
| MDL Number | MFCD00011409 |
| SMILES | [K+].[O-][N+]([O-])=O |
| Synonym | potassium nitrate,saltpeter,nitre,nitrate of potash,vicknite,nitric acid potassium salt,nitric acid, potassium salt,saltpetre,kaliumnitrat,kalii nitras |
| InChI Key | FGIUAXJPYTZDNR-UHFFFAOYSA-N |
| Molecular Formula | KNO3 |
Tellurium(IV) chloride, 99.9% (metals basis)
CAS: 10026-07-0 Molecular Formula: Cl4Te Molecular Weight (g/mol): 269.4 MDL Number: MFCD00011262 InChI Key: SWLJJEFSPJCUBD-UHFFFAOYSA-N Synonym: tellurium tetrachloride,telluric chloride,tellurium chloride,tetrachlorotellurium,tellurium iv chloride,tellurium chloride tecl4 , t-4,unii-dny2r5498h,tellurium chloride, t-4,telluricchloride,tecl4 PubChem CID: 61443 SMILES: Cl[Te](Cl)(Cl)Cl
| PubChem CID | 61443 |
|---|---|
| CAS | 10026-07-0 |
| Molecular Weight (g/mol) | 269.4 |
| MDL Number | MFCD00011262 |
| SMILES | Cl[Te](Cl)(Cl)Cl |
| Synonym | tellurium tetrachloride,telluric chloride,tellurium chloride,tetrachlorotellurium,tellurium iv chloride,tellurium chloride tecl4 , t-4,unii-dny2r5498h,tellurium chloride, t-4,telluricchloride,tecl4 |
| InChI Key | SWLJJEFSPJCUBD-UHFFFAOYSA-N |
| Molecular Formula | Cl4Te |
Sodium tetraphenylborate, 99%
CAS: 143-66-8 Molecular Formula: C24H20BNa Molecular Weight (g/mol): 342.22 MDL Number: MFCD00011494 InChI Key: HFSRCEJMTLMDLI-UHFFFAOYSA-N Synonym: sodium tetraphenylborate,tetraphenylboron sodium,sodium tetraphenylboron,kalignost,sodium tetraphenylborate 1-,kalibor,dotite kalibor,kariporu k,borate 1-, tetraphenyl-, sodium,sodium tetraphenylboride PubChem CID: 2723787 SMILES: [Na+].C1=CC=C(C=C1)[B-](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 2723787 |
|---|---|
| CAS | 143-66-8 |
| Molecular Weight (g/mol) | 342.22 |
| MDL Number | MFCD00011494 |
| SMILES | [Na+].C1=CC=C(C=C1)[B-](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | sodium tetraphenylborate,tetraphenylboron sodium,sodium tetraphenylboron,kalignost,sodium tetraphenylborate 1-,kalibor,dotite kalibor,kariporu k,borate 1-, tetraphenyl-, sodium,sodium tetraphenylboride |
| InChI Key | HFSRCEJMTLMDLI-UHFFFAOYSA-N |
| Molecular Formula | C24H20BNa |
Poly(vinyl alcohol), 98% hydrolyzed, approx. M.W. 13,000
CAS: 9002-89-5 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 44.05 MDL Number: MFCD00081922 InChI Key: IMROMDMJAWUWLK-UHFFFAOYSA-N Synonym: vinyl alcohol,polyvinyl alcohol,hydroxyethene,hydroxyethylene,ethenol, homopolymer,gohsenol,polyviol,elvanol,mowiol,poval PubChem CID: 11199 IUPAC Name: ethenol SMILES: OC(-*)C-*
| PubChem CID | 11199 |
|---|---|
| CAS | 9002-89-5 |
| Molecular Weight (g/mol) | 44.05 |
| MDL Number | MFCD00081922 |
| SMILES | OC(-*)C-* |
| Synonym | vinyl alcohol,polyvinyl alcohol,hydroxyethene,hydroxyethylene,ethenol, homopolymer,gohsenol,polyviol,elvanol,mowiol,poval |
| IUPAC Name | ethenol |
| InChI Key | IMROMDMJAWUWLK-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Diiodomethane, 99%, stab.
CAS: 75-11-6 Molecular Formula: CH2I2 Molecular Weight (g/mol): 267.84 MDL Number: MFCD00001079 InChI Key: NZZFYRREKKOMAT-UHFFFAOYSA-N Synonym: methylene iodide,methane, diiodo,methylene diiodide,mi-gee,dijodmethan,methylenjodid,dijodmethan czech,methylenjodid czech,di-iodomethane,diiodo-methane PubChem CID: 6346 IUPAC Name: diiodomethane SMILES: ICI
| PubChem CID | 6346 |
|---|---|
| CAS | 75-11-6 |
| Molecular Weight (g/mol) | 267.84 |
| MDL Number | MFCD00001079 |
| SMILES | ICI |
| Synonym | methylene iodide,methane, diiodo,methylene diiodide,mi-gee,dijodmethan,methylenjodid,dijodmethan czech,methylenjodid czech,di-iodomethane,diiodo-methane |
| IUPAC Name | diiodomethane |
| InChI Key | NZZFYRREKKOMAT-UHFFFAOYSA-N |
| Molecular Formula | CH2I2 |
4-Hydroxybenzamide, 98+%
CAS: 619-57-8 Molecular Formula: C7H7NO2 Molecular Weight (g/mol): 137.14 MDL Number: MFCD00007997 InChI Key: QXSAKPUBHTZHKW-UHFFFAOYSA-N Synonym: benzamide, 4-hydroxy,4-hydroxy-benzamide,p-hydroxybenzamide,unii-9ou5yd093j,4-hydroxy benzamide,1,3,4,9-tetrahydro-2-hydroxybenzoyl-9-4-hydroxyphenyl methyl-6-methoxy-2h-pyrido 3,4-b indole,4-oxidanylbenzamide,acmc-1apvc,para-hydroxybenzoic amide PubChem CID: 65052 IUPAC Name: 4-hydroxybenzamide SMILES: NC(=O)C1=CC=C(O)C=C1
| PubChem CID | 65052 |
|---|---|
| CAS | 619-57-8 |
| Molecular Weight (g/mol) | 137.14 |
| MDL Number | MFCD00007997 |
| SMILES | NC(=O)C1=CC=C(O)C=C1 |
| Synonym | benzamide, 4-hydroxy,4-hydroxy-benzamide,p-hydroxybenzamide,unii-9ou5yd093j,4-hydroxy benzamide,1,3,4,9-tetrahydro-2-hydroxybenzoyl-9-4-hydroxyphenyl methyl-6-methoxy-2h-pyrido 3,4-b indole,4-oxidanylbenzamide,acmc-1apvc,para-hydroxybenzoic amide |
| IUPAC Name | 4-hydroxybenzamide |
| InChI Key | QXSAKPUBHTZHKW-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO2 |
Butyl benzoate, 98+%
CAS: 136-60-7 Molecular Formula: C11H14O2 Molecular Weight (g/mol): 178.23 MDL Number: MFCD00009439 InChI Key: XSIFPSYPOVKYCO-UHFFFAOYSA-N Synonym: n-butyl benzoate,benzoic acid, butyl ester,anthrapole az,benzoic acid butyl ester,dai cari xbn,benzoic acid n-butyl ester,butylester kyseliny benzoove,butylbenzoate,unii-1tgz0d0o8i,butylester kyseliny benzoove czech PubChem CID: 8698 IUPAC Name: butyl benzoate SMILES: CCCCOC(=O)C1=CC=CC=C1
| PubChem CID | 8698 |
|---|---|
| CAS | 136-60-7 |
| Molecular Weight (g/mol) | 178.23 |
| MDL Number | MFCD00009439 |
| SMILES | CCCCOC(=O)C1=CC=CC=C1 |
| Synonym | n-butyl benzoate,benzoic acid, butyl ester,anthrapole az,benzoic acid butyl ester,dai cari xbn,benzoic acid n-butyl ester,butylester kyseliny benzoove,butylbenzoate,unii-1tgz0d0o8i,butylester kyseliny benzoove czech |
| IUPAC Name | butyl benzoate |
| InChI Key | XSIFPSYPOVKYCO-UHFFFAOYSA-N |
| Molecular Formula | C11H14O2 |
N,N-Dimethyl-p-toluidine, 99%
CAS: 99-97-8 Molecular Formula: C9H13N Molecular Weight (g/mol): 135.21 MDL Number: MFCD00008316 InChI Key: GYVGXEWAOAAJEU-UHFFFAOYSA-N Synonym: n,n-dimethyl-p-toluidine,dimethyl-p-toluidine,benzenamine, n,n,4-trimethyl,n,n-dimethyl-4-methylaniline,n,n-dimethyl-para-toluidine,4,n,n-trimethylaniline,dimethyl-4-toluidine,p-dimethylamino toluene,n,n-dimethyl-p-tolylamine,n,n,4-trimethylbenzenamine PubChem CID: 7471 IUPAC Name: N,N,4-trimethylaniline SMILES: CN(C)C1=CC=C(C)C=C1
| PubChem CID | 7471 |
|---|---|
| CAS | 99-97-8 |
| Molecular Weight (g/mol) | 135.21 |
| MDL Number | MFCD00008316 |
| SMILES | CN(C)C1=CC=C(C)C=C1 |
| Synonym | n,n-dimethyl-p-toluidine,dimethyl-p-toluidine,benzenamine, n,n,4-trimethyl,n,n-dimethyl-4-methylaniline,n,n-dimethyl-para-toluidine,4,n,n-trimethylaniline,dimethyl-4-toluidine,p-dimethylamino toluene,n,n-dimethyl-p-tolylamine,n,n,4-trimethylbenzenamine |
| IUPAC Name | N,N,4-trimethylaniline |
| InChI Key | GYVGXEWAOAAJEU-UHFFFAOYSA-N |
| Molecular Formula | C9H13N |
L-(-)-Bornyl acetate, 95%
CAS: 5655-61-8 Molecular Formula: C12H20O2 Molecular Weight (g/mol): 196.29 MDL Number: MFCD00867808,MFCD00135942,MFCD00135942 InChI Key: KGEKLUUHTZCSIP-HOSYDEDBSA-N Synonym: bornyl acetate,-bornyl acetate PubChem CID: 44630108 SMILES: CC(=O)O[C@@H]1C[C@@H]2CC[C@@]1(C)C2(C)C
| PubChem CID | 44630108 |
|---|---|
| CAS | 5655-61-8 |
| Molecular Weight (g/mol) | 196.29 |
| MDL Number | MFCD00867808,MFCD00135942,MFCD00135942 |
| SMILES | CC(=O)O[C@@H]1C[C@@H]2CC[C@@]1(C)C2(C)C |
| Synonym | bornyl acetate,-bornyl acetate |
| InChI Key | KGEKLUUHTZCSIP-HOSYDEDBSA-N |
| Molecular Formula | C12H20O2 |
Starch indicator solution 1%, Acculute Standard Volumetric Solution, Final Volume 1L
For Iodometric Titrations | CAS: 9005-84-9
| Concentration or Composition (by Analyte or Components) | Starch: 20%; Water: 80% |
|---|---|
| CAS | 7732-18-5 |
| MDL Number | MFCD00082026 |
| Solubility Information | Miscible with water. |
| Physical Form | Liquid,For iodometric titrations |
| Chemical Name or Material | Starch indicator solution |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Vapor Pressure | 17mm Hg at 20°C |
| Assay Percent Range | 100% |
Sodium cyanide, 98+%, extra pure, Thermo Scientific Chemicals
CAS: 143-33-9 Molecular Formula: CNNa Molecular Weight (g/mol): 49.01 MDL Number: MFCD00003523 InChI Key: MNWBNISUBARLIT-UHFFFAOYSA-N Synonym: sodium cyanide,cyanogran,cymag,cyanide of sodium,sodium cyanide na cn,nacn,cyanobrik,cyanide salts,kyanid sodny,cyanasalt h PubChem CID: 8929 SMILES: [Na+].[C-]#N
| PubChem CID | 8929 |
|---|---|
| CAS | 143-33-9 |
| Molecular Weight (g/mol) | 49.01 |
| MDL Number | MFCD00003523 |
| SMILES | [Na+].[C-]#N |
| Synonym | sodium cyanide,cyanogran,cymag,cyanide of sodium,sodium cyanide na cn,nacn,cyanobrik,cyanide salts,kyanid sodny,cyanasalt h |
| InChI Key | MNWBNISUBARLIT-UHFFFAOYSA-N |
| Molecular Formula | CNNa |
Copper(I) cyanide
CAS: 544-92-3 Molecular Formula: CCuN Molecular Weight (g/mol): 89.564 MDL Number: MFCD00010975 InChI Key: DOBRDRYODQBAMW-UHFFFAOYSA-N Synonym: copper i cyanide,cupricin,copper +1 cyanide,copper cyanide cu cn,cyanocopper,rcra waste number p029,cucn,rcra waste no. p029,cyano copper PubChem CID: 11009 IUPAC Name: copper(1+);cyanide SMILES: [C-]#N.[Cu+]
| PubChem CID | 11009 |
|---|---|
| CAS | 544-92-3 |
| Molecular Weight (g/mol) | 89.564 |
| MDL Number | MFCD00010975 |
| SMILES | [C-]#N.[Cu+] |
| Synonym | copper i cyanide,cupricin,copper +1 cyanide,copper cyanide cu cn,cyanocopper,rcra waste number p029,cucn,rcra waste no. p029,cyano copper |
| IUPAC Name | copper(1+);cyanide |
| InChI Key | DOBRDRYODQBAMW-UHFFFAOYSA-N |
| Molecular Formula | CCuN |
Adiponitrile, 99+%, packaged under Argon in resealable ChemSeal™ bottles
CAS: 111-69-3 Molecular Formula: C6H8N2 Molecular Weight (g/mol): 108.144 MDL Number: MFCD00001975 InChI Key: BTGRAWJCKBQKAO-UHFFFAOYSA-N Synonym: adiponitrile,1,4-dicyanobutane,adipodinitrile,adipyldinitrile,adipic acid dinitrile,tetramethylene dicyanide,nitrile adipico,tetramethylene cyanide,adipic acid nitrile,adipinsaeuredinitril PubChem CID: 8128 IUPAC Name: hexanedinitrile SMILES: C(CCC#N)CC#N
| PubChem CID | 8128 |
|---|---|
| CAS | 111-69-3 |
| Molecular Weight (g/mol) | 108.144 |
| MDL Number | MFCD00001975 |
| SMILES | C(CCC#N)CC#N |
| Synonym | adiponitrile,1,4-dicyanobutane,adipodinitrile,adipyldinitrile,adipic acid dinitrile,tetramethylene dicyanide,nitrile adipico,tetramethylene cyanide,adipic acid nitrile,adipinsaeuredinitril |
| IUPAC Name | hexanedinitrile |
| InChI Key | BTGRAWJCKBQKAO-UHFFFAOYSA-N |
| Molecular Formula | C6H8N2 |