Chemicals
Filtered Search Results
| Form | Foil |
|---|---|
| Health Hazard 3 | P201-P202-P260-P264b-P270-P272-P280g-P281-P302+P352-P308+P313-P333+P313-P363-P501c |
| MDL Number | MFCD00148499 |
| Color | Silver |
| Solubility Information | It is insoluble in water. |
| Health Hazard 1 | H317-H350-H372 |
| Chemical Name or Material | Stainless Steel |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Molecular Formula | Fe:Cr:Ni; 70:19:11 wt% |
| Odor | Odorless |
| Appearance | Silver -colored foil |
Lithium, 99+%, granular, dry
CAS: 7439-93-2 Molecular Formula: Li Molecular Weight (g/mol): 6.94 MDL Number: MFCD00134051 InChI Key: WHXSMMKQMYFTQS-UHFFFAOYSA-N Synonym: litio,litium,lithium, metallic,lithium, elemental,monohydride,unii-9fn79x2m3f,hsdb 647,hydride lih,hydrure de french,hsdb 549 PubChem CID: 3028194 ChEBI: CHEBI:30145 IUPAC Name: lithium SMILES: [Li]
| PubChem CID | 3028194 |
|---|---|
| CAS | 7439-93-2 |
| Molecular Weight (g/mol) | 6.94 |
| ChEBI | CHEBI:30145 |
| MDL Number | MFCD00134051 |
| SMILES | [Li] |
| Synonym | litio,litium,lithium, metallic,lithium, elemental,monohydride,unii-9fn79x2m3f,hsdb 647,hydride lih,hydrure de french,hsdb 549 |
| IUPAC Name | lithium |
| InChI Key | WHXSMMKQMYFTQS-UHFFFAOYSA-N |
| Molecular Formula | Li |
Diethyl oxalate, 99%
CAS: 95-92-1 Molecular Formula: C6H10O4 Molecular Weight (g/mol): 146.142 MDL Number: MFCD00009119 InChI Key: WYACBZDAHNBPPB-UHFFFAOYSA-N Synonym: ethyl oxalate,diethyl ethanedioate,ethanedioic acid, diethyl ester,oxalic acid, diethyl ester,oxalic ether,diethyloxalate,ethyl oxalate van,oxalic acid diethyl ester,unii-860m3zwf6j,diethylester kyseliny stavelove PubChem CID: 7268 IUPAC Name: diethyl oxalate SMILES: CCOC(=O)C(=O)OCC
| PubChem CID | 7268 |
|---|---|
| CAS | 95-92-1 |
| Molecular Weight (g/mol) | 146.142 |
| MDL Number | MFCD00009119 |
| SMILES | CCOC(=O)C(=O)OCC |
| Synonym | ethyl oxalate,diethyl ethanedioate,ethanedioic acid, diethyl ester,oxalic acid, diethyl ester,oxalic ether,diethyloxalate,ethyl oxalate van,oxalic acid diethyl ester,unii-860m3zwf6j,diethylester kyseliny stavelove |
| IUPAC Name | diethyl oxalate |
| InChI Key | WYACBZDAHNBPPB-UHFFFAOYSA-N |
| Molecular Formula | C6H10O4 |
2-Bromoanisole, 98%
CAS: 578-57-4 Molecular Formula: C7H7BrO Molecular Weight (g/mol): 187.036 MDL Number: MFCD00000064 InChI Key: HTDQSWDEWGSAMN-UHFFFAOYSA-N Synonym: 2-bromoanisole,o-bromoanisole,benzene, 1-bromo-2-methoxy,2-methoxybromobenzene,o-anisyl bromide,anisole, o-bromo,o-methoxybromobenzene,2-bromoanisol,o-methoxyphenyl bromide,2-methoxyphenyl bromide PubChem CID: 11358 IUPAC Name: 1-bromo-2-methoxybenzene SMILES: COC1=CC=CC=C1Br
| PubChem CID | 11358 |
|---|---|
| CAS | 578-57-4 |
| Molecular Weight (g/mol) | 187.036 |
| MDL Number | MFCD00000064 |
| SMILES | COC1=CC=CC=C1Br |
| Synonym | 2-bromoanisole,o-bromoanisole,benzene, 1-bromo-2-methoxy,2-methoxybromobenzene,o-anisyl bromide,anisole, o-bromo,o-methoxybromobenzene,2-bromoanisol,o-methoxyphenyl bromide,2-methoxyphenyl bromide |
| IUPAC Name | 1-bromo-2-methoxybenzene |
| InChI Key | HTDQSWDEWGSAMN-UHFFFAOYSA-N |
| Molecular Formula | C7H7BrO |
Allyl methyl carbonate, 98%
CAS: 35466-83-2 Molecular Formula: C5H8O3 Molecular Weight (g/mol): 116.12 MDL Number: MFCD00134545 InChI Key: YHLVIDQQTOMBGN-UHFFFAOYSA-N Synonym: allyl methyl carbonate,methyl prop-2-en-1-yl carbonate,carbonic acid allyl methyl ester,isobutylene carbonate,methyl allyl carbonate,acmc-1agon,allyl methyl carbonate #,prop-2-enyl methoxyformate,yhlvidqqtombgn-uhfffaoysa PubChem CID: 534788 IUPAC Name: methyl prop-2-enyl carbonate SMILES: COC(=O)OCC=C
| PubChem CID | 534788 |
|---|---|
| CAS | 35466-83-2 |
| Molecular Weight (g/mol) | 116.12 |
| MDL Number | MFCD00134545 |
| SMILES | COC(=O)OCC=C |
| Synonym | allyl methyl carbonate,methyl prop-2-en-1-yl carbonate,carbonic acid allyl methyl ester,isobutylene carbonate,methyl allyl carbonate,acmc-1agon,allyl methyl carbonate #,prop-2-enyl methoxyformate,yhlvidqqtombgn-uhfffaoysa |
| IUPAC Name | methyl prop-2-enyl carbonate |
| InChI Key | YHLVIDQQTOMBGN-UHFFFAOYSA-N |
| Molecular Formula | C5H8O3 |
tert-Butyldimethylsilyl trifluoromethanesulfonate, 98%
CAS: 69739-34-0 Molecular Formula: C7H15F3O3SSi Molecular Weight (g/mol): 264.33 MDL Number: MFCD00000405 InChI Key: WLLIXJBWWFGEHT-UHFFFAOYSA-N Synonym: tert-butyldimethylsilyl trifluoromethanesulfonate,trifluoromethanesulfonic acid tert-butyldimethylsilyl ester,tbdms triflate,t-butyldimethylsilyl triflate,tert-butyldimethylsilyl trifluoromethanesulphonate,tbdms-otf,tert-butyldimethylsilyl triflate,silane tbm2 triflate,t-butyldimethylsilyltrifluoromethanesulfonate,t-butylmethylsilyl triflate PubChem CID: 123564 IUPAC Name: [tert-butyl(dimethyl)silyl] trifluoromethanesulfonate SMILES: CC(C)(C)[Si](C)(C)OS(=O)(=O)C(F)(F)F
| PubChem CID | 123564 |
|---|---|
| CAS | 69739-34-0 |
| Molecular Weight (g/mol) | 264.33 |
| MDL Number | MFCD00000405 |
| SMILES | CC(C)(C)[Si](C)(C)OS(=O)(=O)C(F)(F)F |
| Synonym | tert-butyldimethylsilyl trifluoromethanesulfonate,trifluoromethanesulfonic acid tert-butyldimethylsilyl ester,tbdms triflate,t-butyldimethylsilyl triflate,tert-butyldimethylsilyl trifluoromethanesulphonate,tbdms-otf,tert-butyldimethylsilyl triflate,silane tbm2 triflate,t-butyldimethylsilyltrifluoromethanesulfonate,t-butylmethylsilyl triflate |
| IUPAC Name | [tert-butyl(dimethyl)silyl] trifluoromethanesulfonate |
| InChI Key | WLLIXJBWWFGEHT-UHFFFAOYSA-N |
| Molecular Formula | C7H15F3O3SSi |
Dimethoxydimethylsilane 98.0+%, TCI America™
CAS: 1112-39-6 Molecular Formula: C4H12O2Si Molecular Weight (g/mol): 120.22 MDL Number: MFCD00025691 InChI Key: JJQZDUKDJDQPMQ-UHFFFAOYSA-N Synonym: dimethyldimethoxysilane,silane, dimethoxydimethyl,kbm 22,unii-a3qdb1rs1c,dimethyl dimethoxysilane,dimethoxy dimethyl silane,a3qdb1rs1c,dimethoxy-dimethylsilane,dimethyl dimethoxy silane,dimethyl dimethoxy silicane PubChem CID: 66187 IUPAC Name: dimethoxydimethylsilane SMILES: CO[Si](C)(C)OC
| PubChem CID | 66187 |
|---|---|
| CAS | 1112-39-6 |
| Molecular Weight (g/mol) | 120.22 |
| MDL Number | MFCD00025691 |
| SMILES | CO[Si](C)(C)OC |
| Synonym | dimethyldimethoxysilane,silane, dimethoxydimethyl,kbm 22,unii-a3qdb1rs1c,dimethyl dimethoxysilane,dimethoxy dimethyl silane,a3qdb1rs1c,dimethoxy-dimethylsilane,dimethyl dimethoxy silane,dimethyl dimethoxy silicane |
| IUPAC Name | dimethoxydimethylsilane |
| InChI Key | JJQZDUKDJDQPMQ-UHFFFAOYSA-N |
| Molecular Formula | C4H12O2Si |
(3-Mercaptopropyl)trimethoxysilane, 95%
CAS: 4420-74-0 Molecular Formula: C6H16O3SSi Molecular Weight (g/mol): 196.336 MDL Number: MFCD00004901 InChI Key: UUEWCQRISZBELL-UHFFFAOYSA-N Synonym: trimethoxysilylpropanethiol,3-mercaptopropyltrimethoxysilane,3-mercaptopropyl trimethoxysilane,1-propanethiol, 3-trimethoxysilyl,silquest a 189,3-trimethoxysilyl propanethiol,prosil 196,silane a 189,union carbide a-189,sila-ace s 810 PubChem CID: 20473 IUPAC Name: 3-trimethoxysilylpropane-1-thiol SMILES: CO[Si](CCCS)(OC)OC
| PubChem CID | 20473 |
|---|---|
| CAS | 4420-74-0 |
| Molecular Weight (g/mol) | 196.336 |
| MDL Number | MFCD00004901 |
| SMILES | CO[Si](CCCS)(OC)OC |
| Synonym | trimethoxysilylpropanethiol,3-mercaptopropyltrimethoxysilane,3-mercaptopropyl trimethoxysilane,1-propanethiol, 3-trimethoxysilyl,silquest a 189,3-trimethoxysilyl propanethiol,prosil 196,silane a 189,union carbide a-189,sila-ace s 810 |
| IUPAC Name | 3-trimethoxysilylpropane-1-thiol |
| InChI Key | UUEWCQRISZBELL-UHFFFAOYSA-N |
| Molecular Formula | C6H16O3SSi |
Divinyl sulfone, 97%, stab. with 0.05% hydroquinone
CAS: 77-77-0 Molecular Formula: C4H6O2S Molecular Weight (g/mol): 118.15 MDL Number: MFCD00008623 InChI Key: AFOSIXZFDONLBT-UHFFFAOYSA-N Synonym: divinyl sulfone,vinyl sulfone,divinyl sulphone,bis ethenyl sulfone,vinyl sulphone,sulfone, divinyl,ethenesulfonyl-ethene,ethene, 1,1'-sulfonylbis,1,1'-sulphonylbisethene,ethenesulfonyl ethene PubChem CID: 6496 ChEBI: CHEBI:53729 IUPAC Name: 1-ethenylsulfonylethene SMILES: C=CS(=O)(=O)C=C
| PubChem CID | 6496 |
|---|---|
| CAS | 77-77-0 |
| Molecular Weight (g/mol) | 118.15 |
| ChEBI | CHEBI:53729 |
| MDL Number | MFCD00008623 |
| SMILES | C=CS(=O)(=O)C=C |
| Synonym | divinyl sulfone,vinyl sulfone,divinyl sulphone,bis ethenyl sulfone,vinyl sulphone,sulfone, divinyl,ethenesulfonyl-ethene,ethene, 1,1'-sulfonylbis,1,1'-sulphonylbisethene,ethenesulfonyl ethene |
| IUPAC Name | 1-ethenylsulfonylethene |
| InChI Key | AFOSIXZFDONLBT-UHFFFAOYSA-N |
| Molecular Formula | C4H6O2S |
Lidocaine Hydrochloride, MP Biomedicals
CAS: 6108-05-0 Molecular Formula: C14H25ClN2O2 Molecular Weight (g/mol): 288.82 MDL Number: MFCD00150329 InChI Key: YECIFGHRMFEPJK-UHFFFAOYSA-N Synonym: lidocaine hydrochloride monohydrate,2-diethylamino-n-2,6-dimethylphenyl acetamide hydrochloride hydrate,dolicaine,linocaine hydrochloride,lidocaine hydrochloride hydrate,xylocaine hydrochloride monohydrate,lignocaine hydrochloride monohydrate,2-diethylamino-n-2,6-dimethylphenyl acetamide hydrochloride monohydrate,zingo tm,lidocaine hcl hydrate PubChem CID: 16219577 ChEBI: CHEBI:60791 SMILES: O.[Cl-].CC[NH+](CC)CC(=O)NC1=C(C)C=CC=C1C
| PubChem CID | 16219577 |
|---|---|
| CAS | 6108-05-0 |
| Molecular Weight (g/mol) | 288.82 |
| ChEBI | CHEBI:60791 |
| MDL Number | MFCD00150329 |
| SMILES | O.[Cl-].CC[NH+](CC)CC(=O)NC1=C(C)C=CC=C1C |
| Synonym | lidocaine hydrochloride monohydrate,2-diethylamino-n-2,6-dimethylphenyl acetamide hydrochloride hydrate,dolicaine,linocaine hydrochloride,lidocaine hydrochloride hydrate,xylocaine hydrochloride monohydrate,lignocaine hydrochloride monohydrate,2-diethylamino-n-2,6-dimethylphenyl acetamide hydrochloride monohydrate,zingo tm,lidocaine hcl hydrate |
| InChI Key | YECIFGHRMFEPJK-UHFFFAOYSA-N |
| Molecular Formula | C14H25ClN2O2 |
Nickel rod, 5mm (0.2in) dia, Puratronic™, 99.999% (metals basis)
CAS: 7440-02-0 Molecular Formula: Ni Molecular Weight (g/mol): 58.69 MDL Number: MFCD00011137 MFCD06798735 InChI Key: PXHVJJICTQNCMI-UHFFFAOYSA-N Synonym: raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum PubChem CID: 935 ChEBI: CHEBI:28112 IUPAC Name: nickel SMILES: [Ni]
| PubChem CID | 935 |
|---|---|
| CAS | 7440-02-0 |
| Molecular Weight (g/mol) | 58.69 |
| ChEBI | CHEBI:28112 |
| MDL Number | MFCD00011137 MFCD06798735 |
| SMILES | [Ni] |
| Synonym | raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum |
| IUPAC Name | nickel |
| InChI Key | PXHVJJICTQNCMI-UHFFFAOYSA-N |
| Molecular Formula | Ni |
Nickel Chloride Hexahydrate, (Crystalline),MP Biomedicals
CAS: 7791-20-0 Molecular Formula: NiCl2 · 6H2O
| CAS | 7791-20-0 |
|---|---|
| Molecular Formula | NiCl2 · 6H2O |
Benzalkonium chloride, alkyl distribution from C8H17 to C16H33
CAS: 8001-54-5 Molecular Formula: C9H13ClN Molecular Weight (g/mol): 170.66 MDL Number: MFCD00145757 Synonym: Alkyl-benzyl-dimethylammonium chloride
| CAS | 8001-54-5 |
|---|---|
| Molecular Weight (g/mol) | 170.66 |
| MDL Number | MFCD00145757 |
| Synonym | Alkyl-benzyl-dimethylammonium chloride |
| Molecular Formula | C9H13ClN |
Ammonium carbamate, 98%
CAS: 1111-78-0 Molecular Formula: CH6N2O2 Molecular Weight (g/mol): 78.071 MDL Number: MFCD00013010 InChI Key: BVCZEBOGSOYJJT-UHFFFAOYSA-N Synonym: ammonium carbamate,ammonium aminoformate,carbamic acid, monoammonium salt,carbamic acid ammonium salt,carbamic acid ammoniate,unii-i2w9615swp,carbamic acid, ammonium salt 1:1,ammoniumcarbamate,anhydride of ammonium carbonate,azanium carbamate PubChem CID: 517232 IUPAC Name: azanium;carbamate SMILES: C(=O)(N)[O-].[NH4+]
| PubChem CID | 517232 |
|---|---|
| CAS | 1111-78-0 |
| Molecular Weight (g/mol) | 78.071 |
| MDL Number | MFCD00013010 |
| SMILES | C(=O)(N)[O-].[NH4+] |
| Synonym | ammonium carbamate,ammonium aminoformate,carbamic acid, monoammonium salt,carbamic acid ammonium salt,carbamic acid ammoniate,unii-i2w9615swp,carbamic acid, ammonium salt 1:1,ammoniumcarbamate,anhydride of ammonium carbonate,azanium carbamate |
| IUPAC Name | azanium;carbamate |
| InChI Key | BVCZEBOGSOYJJT-UHFFFAOYSA-N |
| Molecular Formula | CH6N2O2 |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, Cell Culture Reagent
CAS: 60-00-4 Molecular Formula: C10H16N2O8 Molecular Weight (g/mol): 292.24 MDL Number: MFCD00003541 InChI Key: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 SMILES: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| PubChem CID | 6049 |
|---|---|
| CAS | 60-00-4 |
| Molecular Weight (g/mol) | 292.24 |
| ChEBI | CHEBI:42191 |
| MDL Number | MFCD00003541 |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O8 |