Chemicals
Filtered Search Results
1,1,1,3,3,3-Hexafluoro-2-propanol 99.0+%, TCI America™
CAS: 920-66-1 Molecular Formula: C3H2F6O Molecular Weight (g/mol): 168.038 MDL Number: MFCD00011651 InChI Key: BYEAHWXPCBROCE-UHFFFAOYSA-N Synonym: 1,1,1,3,3,3-hexafluoro-2-propanol,hexafluoroisopropanol,hfip,hexafluoro-2-propanol,hexafluoroisopropyl alcohol,bis trifluoromethyl methanol,1,1,1,3,3,3-hexafluoroisopropanol,2h-hexafluoroisopropanol,2-propanol, 1,1,1,3,3,3-hexafluoro,1,1,1,3,3,3-hexafluoroisopropyl alcohol PubChem CID: 13529 ChEBI: CHEBI:63104 IUPAC Name: 1,1,1,3,3,3-hexafluoropropan-2-ol SMILES: C(C(F)(F)F)(C(F)(F)F)O
| PubChem CID | 13529 |
|---|---|
| CAS | 920-66-1 |
| Molecular Weight (g/mol) | 168.038 |
| ChEBI | CHEBI:63104 |
| MDL Number | MFCD00011651 |
| SMILES | C(C(F)(F)F)(C(F)(F)F)O |
| Synonym | 1,1,1,3,3,3-hexafluoro-2-propanol,hexafluoroisopropanol,hfip,hexafluoro-2-propanol,hexafluoroisopropyl alcohol,bis trifluoromethyl methanol,1,1,1,3,3,3-hexafluoroisopropanol,2h-hexafluoroisopropanol,2-propanol, 1,1,1,3,3,3-hexafluoro,1,1,1,3,3,3-hexafluoroisopropyl alcohol |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-ol |
| InChI Key | BYEAHWXPCBROCE-UHFFFAOYSA-N |
| Molecular Formula | C3H2F6O |
Gibco™ Ethanol (EtOH), 20%
Greener Choice
Offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More
Offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More
Gibco 20% Ethanol (EtOH) is sterile-filtered, packaged in bioprocess containers, and stocked to be available when you need it. Sourcing 20% EtOH can streamline your workload for equipment sanitization and column storage, allowing you to focus on the key steps in your downstream processes.
| Sterilization Method | 0.2 μm Sterile-filtered |
|---|---|
| Formulation | 20% EtOH |
| Color | Clear |
| Physical Form | Liquid |
| DOT Information | DOT Transport Hazard Class 3, Packaging Group III |
| Chemical Name or Material | Ethyl Alcohol |
| Concentration | 20% |
| Certifications/Compliance | GMP - 21 CFR 820, ISO 13485 |
| Shelf Life | 24 Months |
BSTFA-TMCS (99:1) [Derivatizing Reagent for GC], TCI America™
CAS: 25561-30-2 Molecular Formula: C8H18F3NOSi2 Molecular Weight (g/mol): 257.403 MDL Number: MFCD00008269 InChI Key: XCOBLONWWXQEBS-GHXNOFRVSA-N Synonym: bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate PubChem CID: 9601896 IUPAC Name: trimethylsilyl (1Z)-2,2,2-trifluoro-N-trimethylsilylethanimidate SMILES: C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C
| PubChem CID | 9601896 |
|---|---|
| CAS | 25561-30-2 |
| Molecular Weight (g/mol) | 257.403 |
| MDL Number | MFCD00008269 |
| SMILES | C[Si](C)(C)N=C(C(F)(F)F)O[Si](C)(C)C |
| Synonym | bstfa,n,o-bis trimethylsilyl trifluoroacetamide,acetamide, 2,2,2-trifluoro-o,n-bis trimethylsilyl,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl acetimidate,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanimidate,trimethylsilyl 1z-2,2,2-trifluoro-n-z-trimethylsilyl ethanimidoate #,n,o-bis trimethylsilyl trifluoroacetamide bstfa,trimethylsilyl 2,2,2-trifluoro-n-trimethylsilyl ethanecarboximidate |
| IUPAC Name | trimethylsilyl (1Z)-2,2,2-trifluoro-N-trimethylsilylethanimidate |
| InChI Key | XCOBLONWWXQEBS-GHXNOFRVSA-N |
| Molecular Formula | C8H18F3NOSi2 |
Propionic Acid 99.0+%, TCI America™
CAS: 79-09-4 Molecular Formula: C3H6O2 Molecular Weight (g/mol): 74.079 MDL Number: MFCD00002756 InChI Key: XBDQKXXYIPTUBI-UHFFFAOYSA-N Synonym: propionic acid,ethylformic acid,methylacetic acid,carboxyethane,ethanecarboxylic acid,pseudoacetic acid,metacetonic acid,monoprop,luprosil,prozoin PubChem CID: 1032 ChEBI: CHEBI:30768 IUPAC Name: propanoic acid SMILES: CCC(=O)O
| PubChem CID | 1032 |
|---|---|
| CAS | 79-09-4 |
| Molecular Weight (g/mol) | 74.079 |
| ChEBI | CHEBI:30768 |
| MDL Number | MFCD00002756 |
| SMILES | CCC(=O)O |
| Synonym | propionic acid,ethylformic acid,methylacetic acid,carboxyethane,ethanecarboxylic acid,pseudoacetic acid,metacetonic acid,monoprop,luprosil,prozoin |
| IUPAC Name | propanoic acid |
| InChI Key | XBDQKXXYIPTUBI-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2 |
Manganese(II) nitrate tetrahydrate, 98%
CAS: 20694-39-7 Molecular Formula: H8MnN2O10 Molecular Weight (g/mol): 251.006 MDL Number: MFCD00149789 InChI Key: ALIMWUQMDCBYFM-UHFFFAOYSA-N Synonym: manganese ii nitrate tetrahydrate,manganese nitrate tetrahydrate,unii-03m0g68r5f,manganese 2+ ion tetrahydrate dinitrate,manganese dinitrate tetrahydrate,acmc-20akkk,nitric acid, manganese 2+ salt, tetrahydrate,ksc206g2f,mn.2no3.4h2o,manganese 2+ dinitrate tetrahydrate PubChem CID: 182616 IUPAC Name: manganese(2+);dinitrate;tetrahydrate SMILES: [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.O.[Mn+2]
| PubChem CID | 182616 |
|---|---|
| CAS | 20694-39-7 |
| Molecular Weight (g/mol) | 251.006 |
| MDL Number | MFCD00149789 |
| SMILES | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.O.[Mn+2] |
| Synonym | manganese ii nitrate tetrahydrate,manganese nitrate tetrahydrate,unii-03m0g68r5f,manganese 2+ ion tetrahydrate dinitrate,manganese dinitrate tetrahydrate,acmc-20akkk,nitric acid, manganese 2+ salt, tetrahydrate,ksc206g2f,mn.2no3.4h2o,manganese 2+ dinitrate tetrahydrate |
| IUPAC Name | manganese(2+);dinitrate;tetrahydrate |
| InChI Key | ALIMWUQMDCBYFM-UHFFFAOYSA-N |
| Molecular Formula | H8MnN2O10 |
Tannic acid, ACS
CAS: 1401-55-4 Molecular Formula: C76H52O46 Molecular Weight (g/mol): 1701.206 MDL Number: MFCD00066397 InChI Key: LRBQNJMCXXYXIU-JPZKJCTESA-N Synonym: tannins,gallotannic acid,quebracho extract,acide tannique,d'acide tannique,tannic acid usp:jan,unii-28f9e0djy6 PubChem CID: 134129492 SMILES: C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)OCC3C(C(C(C(O3)OC(=O)C4=CC(=C(C(=C4)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)OC(=O)C9=CC(=C(C(=C9)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)OC(=O)C1=CC(=C(
| PubChem CID | 134129492 |
|---|---|
| CAS | 1401-55-4 |
| Molecular Weight (g/mol) | 1701.206 |
| MDL Number | MFCD00066397 |
| SMILES | C1=C(C=C(C(=C1O)O)O)C(=O)OC2=CC(=CC(=C2O)O)C(=O)OCC3C(C(C(C(O3)OC(=O)C4=CC(=C(C(=C4)OC(=O)C5=CC(=C(C(=C5)O)O)O)O)O)OC(=O)C6=CC(=C(C(=C6)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8)OC(=O)C9=CC(=C(C(=C9)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)OC(=O)C1=CC(=C( |
| Synonym | tannins,gallotannic acid,quebracho extract,acide tannique,d'acide tannique,tannic acid usp:jan,unii-28f9e0djy6 |
| InChI Key | LRBQNJMCXXYXIU-JPZKJCTESA-N |
| Molecular Formula | C76H52O46 |
Acetone, For HPLC, MilliporeSigma™
CAS: 67-64-1 Molecular Formula: C3H6O Molecular Weight (g/mol): 58.08 MDL Number: MFCD00008765 InChI Key: CSCPPACGZOOCGX-UHFFFAOYSA-N Synonym: acetone,2-propanone,propanone,dimethyl ketone,methyl ketone,dimethylformaldehyde,pyroacetic ether,beta-ketopropane,dimethylketal,chevron acetone PubChem CID: 180 ChEBI: CHEBI:15347 IUPAC Name: propan-2-one SMILES: CC(C)=O
| PubChem CID | 180 |
|---|---|
| CAS | 67-64-1 |
| Molecular Weight (g/mol) | 58.08 |
| ChEBI | CHEBI:15347 |
| MDL Number | MFCD00008765 |
| SMILES | CC(C)=O |
| Synonym | acetone,2-propanone,propanone,dimethyl ketone,methyl ketone,dimethylformaldehyde,pyroacetic ether,beta-ketopropane,dimethylketal,chevron acetone |
| IUPAC Name | propan-2-one |
| InChI Key | CSCPPACGZOOCGX-UHFFFAOYSA-N |
| Molecular Formula | C3H6O |
Nitric Acid, 10% (v/v), Ricca Chemical
CAS: 7732-18-5 Molecular Formula: HNO3 Molecular Weight (g/mol): 63.01 MDL Number: MFCD00011349 InChI Key: GRYLNZFGIOXLOG-UHFFFAOYSA-N Synonym: hydrogen nitrate,aqua fortis,azotic acid,salpetersaeure,rfna,acidum nitricum,nital,acide nitrique,nitrous fumes,nitryl hydroxide PubChem CID: 944 ChEBI: CHEBI:48107 IUPAC Name: nitric acid SMILES: O[N+]([O-])=O
| PubChem CID | 944 |
|---|---|
| CAS | 7732-18-5 |
| Molecular Weight (g/mol) | 63.01 |
| ChEBI | CHEBI:48107 |
| MDL Number | MFCD00011349 |
| SMILES | O[N+]([O-])=O |
| Synonym | hydrogen nitrate,aqua fortis,azotic acid,salpetersaeure,rfna,acidum nitricum,nital,acide nitrique,nitrous fumes,nitryl hydroxide |
| IUPAC Name | nitric acid |
| InChI Key | GRYLNZFGIOXLOG-UHFFFAOYSA-N |
| Molecular Formula | HNO3 |
Zinc Chloride 98.0+%, TCI America™
CAS: 7646-85-7 Molecular Formula: Cl2Zn Molecular Weight (g/mol): 136.28 MDL Number: MFCD00011295 InChI Key: JIAARYAFYJHUJI-UHFFFAOYSA-L Synonym: zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride PubChem CID: 5727 ChEBI: CHEBI:49976 IUPAC Name: dichlorozinc SMILES: Cl[Zn]Cl
| PubChem CID | 5727 |
|---|---|
| CAS | 7646-85-7 |
| Molecular Weight (g/mol) | 136.28 |
| ChEBI | CHEBI:49976 |
| MDL Number | MFCD00011295 |
| SMILES | Cl[Zn]Cl |
| Synonym | zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride |
| IUPAC Name | dichlorozinc |
| InChI Key | JIAARYAFYJHUJI-UHFFFAOYSA-L |
| Molecular Formula | Cl2Zn |
Diethylene Glycol Dimethyl Ether 99.0+%, TCI America™
CAS: 111-96-6 Molecular Formula: C6H14O3 Molecular Weight (g/mol): 134.175 MDL Number: MFCD00008503 InChI Key: SBZXBUIDTXKZTM-UHFFFAOYSA-N Synonym: diglyme,bis 2-methoxyethyl ether,2-methoxyethyl ether,1-methoxy-2-2-methoxyethoxy ethane,diethylene glycol dimethyl ether,poly-solv,di 2-methoxyethyl ether,dimethyl carbitol,2,5,8-trioxanonane PubChem CID: 8150 ChEBI: CHEBI:46784 IUPAC Name: 1-methoxy-2-(2-methoxyethoxy)ethane SMILES: COCCOCCOC
| PubChem CID | 8150 |
|---|---|
| CAS | 111-96-6 |
| Molecular Weight (g/mol) | 134.175 |
| ChEBI | CHEBI:46784 |
| MDL Number | MFCD00008503 |
| SMILES | COCCOCCOC |
| Synonym | diglyme,bis 2-methoxyethyl ether,2-methoxyethyl ether,1-methoxy-2-2-methoxyethoxy ethane,diethylene glycol dimethyl ether,poly-solv,di 2-methoxyethyl ether,dimethyl carbitol,2,5,8-trioxanonane |
| IUPAC Name | 1-methoxy-2-(2-methoxyethoxy)ethane |
| InChI Key | SBZXBUIDTXKZTM-UHFFFAOYSA-N |
| Molecular Formula | C6H14O3 |
N,N'-Dicyclohexylcarbodiimide 98.0+%, TCI America™
CAS: 538-75-0 Molecular Formula: C13H22N2 Molecular Weight (g/mol): 206.333 MDL Number: MFCD00011659 InChI Key: QOSSAOTZNIDXMA-UHFFFAOYSA-N Synonym: dicyclohexylcarbodiimide,n,n'-dicyclohexylcarbodiimide,dccd,1,3-dicyclohexylcarbodiimide,dcci,carbodicyclohexylimide,bis cyclohexyl carbodiimide,dcc,n,n-dicyclohexylcarbodiimide,carbodiimide, dicyclohexyl PubChem CID: 10868 ChEBI: CHEBI:53090 IUPAC Name: N,N'-dicyclohexylmethanediimine SMILES: C1CCC(CC1)N=C=NC2CCCCC2
| PubChem CID | 10868 |
|---|---|
| CAS | 538-75-0 |
| Molecular Weight (g/mol) | 206.333 |
| ChEBI | CHEBI:53090 |
| MDL Number | MFCD00011659 |
| SMILES | C1CCC(CC1)N=C=NC2CCCCC2 |
| Synonym | dicyclohexylcarbodiimide,n,n'-dicyclohexylcarbodiimide,dccd,1,3-dicyclohexylcarbodiimide,dcci,carbodicyclohexylimide,bis cyclohexyl carbodiimide,dcc,n,n-dicyclohexylcarbodiimide,carbodiimide, dicyclohexyl |
| IUPAC Name | N,N'-dicyclohexylmethanediimine |
| InChI Key | QOSSAOTZNIDXMA-UHFFFAOYSA-N |
| Molecular Formula | C13H22N2 |
Ammonium Chloride 99.5+%, TCI America™
CAS: 12125-02-9 Molecular Formula: ClH4N Molecular Weight (g/mol): 53.49 MDL Number: MFCD00011420 Synonym: ammonium chloride,salmiac,sal ammoniac,ammonium muriate,ammoniumchlorid,ammoneric,darammon,amchlor,ammonium chloride nh4 cl,ammoniumklorid PubChem CID: 25517 ChEBI: CHEBI:31206 IUPAC Name: amine hydrochloride SMILES: N.Cl
| PubChem CID | 25517 |
|---|---|
| CAS | 12125-02-9 |
| Molecular Weight (g/mol) | 53.49 |
| ChEBI | CHEBI:31206 |
| MDL Number | MFCD00011420 |
| SMILES | N.Cl |
| Synonym | ammonium chloride,salmiac,sal ammoniac,ammonium muriate,ammoniumchlorid,ammoneric,darammon,amchlor,ammonium chloride nh4 cl,ammoniumklorid |
| IUPAC Name | amine hydrochloride |
| Molecular Formula | ClH4N |
Furfural 98.0+%, TCI America™
CAS: 98-01-1 Molecular Formula: C5H4O2 Molecular Weight (g/mol): 96.09 MDL Number: MFCD00003229 InChI Key: HYBBIBNJHNGZAN-UHFFFAOYSA-N Synonym: furfural,2-furaldehyde,2-furancarboxaldehyde,furaldehyde,2-formylfuran,furfuraldehyde,fural,2-furanaldehyde,2-furancarbonal,2-furfural PubChem CID: 7362 ChEBI: CHEBI:34768 IUPAC Name: furan-2-carbaldehyde SMILES: O=CC1=CC=CO1
| PubChem CID | 7362 |
|---|---|
| CAS | 98-01-1 |
| Molecular Weight (g/mol) | 96.09 |
| ChEBI | CHEBI:34768 |
| MDL Number | MFCD00003229 |
| SMILES | O=CC1=CC=CO1 |
| Synonym | furfural,2-furaldehyde,2-furancarboxaldehyde,furaldehyde,2-formylfuran,furfuraldehyde,fural,2-furanaldehyde,2-furancarbonal,2-furfural |
| IUPAC Name | furan-2-carbaldehyde |
| InChI Key | HYBBIBNJHNGZAN-UHFFFAOYSA-N |
| Molecular Formula | C5H4O2 |
Chloroform, 99.8% min., ACS, MilliporeSigma™
CAS: 67-66-3 Molecular Formula: CHCl3 Molecular Weight (g/mol): 119.37 MDL Number: MFCD00000826 InChI Key: HEDRZPFGACZZDS-UHFFFAOYSA-N Synonym: trichloromethane,formyl trichloride,methane, trichloro,trichloroform,methane trichloride,methenyl trichloride,methyl trichloride,trichlormethan,chloroforme,cloroformio PubChem CID: 6212 ChEBI: CHEBI:35255 IUPAC Name: trichloromethane SMILES: ClC(Cl)Cl
| PubChem CID | 6212 |
|---|---|
| CAS | 67-66-3 |
| Molecular Weight (g/mol) | 119.37 |
| ChEBI | CHEBI:35255 |
| MDL Number | MFCD00000826 |
| SMILES | ClC(Cl)Cl |
| Synonym | trichloromethane,formyl trichloride,methane, trichloro,trichloroform,methane trichloride,methenyl trichloride,methyl trichloride,trichlormethan,chloroforme,cloroformio |
| IUPAC Name | trichloromethane |
| InChI Key | HEDRZPFGACZZDS-UHFFFAOYSA-N |
| Molecular Formula | CHCl3 |
Hydrochloric Acid, in Isopropanol, Certified, 0.1000N ±0.0010N (0.1M), LabChem™
CAS: 7647-01-0 Molecular Formula: ClH Molecular Weight (g/mol): 36.46 MDL Number: MFCD00011324 MFCD00792839 InChI Key: VEXZGXHMUGYJMC-UHFFFAOYSA-N Synonym: hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof PubChem CID: 313 ChEBI: CHEBI:17883 IUPAC Name: hydrogen chloride SMILES: Cl
| PubChem CID | 313 |
|---|---|
| CAS | 7647-01-0 |
| Molecular Weight (g/mol) | 36.46 |
| ChEBI | CHEBI:17883 |
| MDL Number | MFCD00011324 MFCD00792839 |
| SMILES | Cl |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| IUPAC Name | hydrogen chloride |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Molecular Formula | ClH |