Chemicals
Filtered Search Results
Acetone, MilliporeSigma™
CAS: 67-64-1 Molecular Formula: C3H6O Molecular Weight (g/mol): 58.08 MDL Number: MFCD00008765 InChI Key: CSCPPACGZOOCGX-UHFFFAOYSA-N Synonym: acetone,2-propanone,propanone,dimethyl ketone,methyl ketone,dimethylformaldehyde,pyroacetic ether,beta-ketopropane,dimethylketal,chevron acetone PubChem CID: 180 ChEBI: CHEBI:15347 IUPAC Name: propan-2-one SMILES: CC(C)=O
| PubChem CID | 180 |
|---|---|
| CAS | 67-64-1 |
| Molecular Weight (g/mol) | 58.08 |
| ChEBI | CHEBI:15347 |
| MDL Number | MFCD00008765 |
| SMILES | CC(C)=O |
| Synonym | acetone,2-propanone,propanone,dimethyl ketone,methyl ketone,dimethylformaldehyde,pyroacetic ether,beta-ketopropane,dimethylketal,chevron acetone |
| IUPAC Name | propan-2-one |
| InChI Key | CSCPPACGZOOCGX-UHFFFAOYSA-N |
| Molecular Formula | C3H6O |
Sodium Hydroxide, 10.0 N, from NF/USP material, Ricca Chemical
SureTRACE
Supports traceability with guaranteed access to certificates and proactive change notifications.
Learn More
Supports traceability with guaranteed access to certificates and proactive change notifications.
Learn More
CAS: 1310-73-2 Synonym: sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic PubChem CID: 14798 ChEBI: CHEBI:32145
| PubChem CID | 14798 |
|---|---|
| CAS | 1310-73-2 |
| ChEBI | CHEBI:32145 |
| Synonym | sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic |
4-Dimethylaminopyridine 99.0+%, TCI America™
CAS: 1122-58-3 Molecular Formula: C7H10N2 Molecular Weight (g/mol): 122.171 MDL Number: MFCD00006418 InChI Key: VHYFNPMBLIVWCW-UHFFFAOYSA-N Synonym: 4-dimethylaminopyridine,dmap,4-dimethylamino pyridine,4-pyridinamine, n,n-dimethyl,n,n-dimethyl-4-pyridinamine,p-dimethylaminopyridine,pyridine, 4-dimethylamino,ccris 6176,dimethylpyridin-4-ylamine PubChem CID: 14284 IUPAC Name: N,N-dimethylpyridin-4-amine SMILES: CN(C)C1=CC=NC=C1
| PubChem CID | 14284 |
|---|---|
| CAS | 1122-58-3 |
| Molecular Weight (g/mol) | 122.171 |
| MDL Number | MFCD00006418 |
| SMILES | CN(C)C1=CC=NC=C1 |
| Synonym | 4-dimethylaminopyridine,dmap,4-dimethylamino pyridine,4-pyridinamine, n,n-dimethyl,n,n-dimethyl-4-pyridinamine,p-dimethylaminopyridine,pyridine, 4-dimethylamino,ccris 6176,dimethylpyridin-4-ylamine |
| IUPAC Name | N,N-dimethylpyridin-4-amine |
| InChI Key | VHYFNPMBLIVWCW-UHFFFAOYSA-N |
| Molecular Formula | C7H10N2 |
Benzyl Bromide (stabilized with Propylene Oxide) 98.0+%, TCI America™
CAS: 100-39-0 Molecular Formula: C7H7Br Molecular Weight (g/mol): 171.037 MDL Number: MFCD00000172 InChI Key: AGEZXYOZHKGVCM-UHFFFAOYSA-N Synonym: benzyl bromide,bromomethyl benzene,alpha-bromotoluene,bromophenylmethane,benzene, bromomethyl,phenylmethyl bromide,1-bromotoluene,benzylbromide,cyclite PubChem CID: 7498 ChEBI: CHEBI:59858 IUPAC Name: bromomethylbenzene SMILES: C1=CC=C(C=C1)CBr
| PubChem CID | 7498 |
|---|---|
| CAS | 100-39-0 |
| Molecular Weight (g/mol) | 171.037 |
| ChEBI | CHEBI:59858 |
| MDL Number | MFCD00000172 |
| SMILES | C1=CC=C(C=C1)CBr |
| Synonym | benzyl bromide,bromomethyl benzene,alpha-bromotoluene,bromophenylmethane,benzene, bromomethyl,phenylmethyl bromide,1-bromotoluene,benzylbromide,cyclite |
| IUPAC Name | bromomethylbenzene |
| InChI Key | AGEZXYOZHKGVCM-UHFFFAOYSA-N |
| Molecular Formula | C7H7Br |
N,N,N',N'-Tetramethylethylenediamine 98.0+%, TCI America™
CAS: 110-18-9 Molecular Formula: C6H16N2 Molecular Weight (g/mol): 116.208 MDL Number: MFCD00008335 InChI Key: KWYHDKDOAIKMQN-UHFFFAOYSA-N Synonym: temed,n,n,n',n'-tetramethylethylenediamine,tmeda,1,2-bis dimethylamino ethane,tetramethylethylenediamine,tetramethyldiaminoethane,tetrameen,propamine d,n1,n1,n2,n2-tetramethylethane-1,2-diamine,1,2-ethanediamine, n,n,n',n'-tetramethyl PubChem CID: 8037 ChEBI: CHEBI:32850 IUPAC Name: N,N,N',N'-tetramethylethane-1,2-diamine SMILES: CN(C)CCN(C)C
| PubChem CID | 8037 |
|---|---|
| CAS | 110-18-9 |
| Molecular Weight (g/mol) | 116.208 |
| ChEBI | CHEBI:32850 |
| MDL Number | MFCD00008335 |
| SMILES | CN(C)CCN(C)C |
| Synonym | temed,n,n,n',n'-tetramethylethylenediamine,tmeda,1,2-bis dimethylamino ethane,tetramethylethylenediamine,tetramethyldiaminoethane,tetrameen,propamine d,n1,n1,n2,n2-tetramethylethane-1,2-diamine,1,2-ethanediamine, n,n,n',n'-tetramethyl |
| IUPAC Name | N,N,N',N'-tetramethylethane-1,2-diamine |
| InChI Key | KWYHDKDOAIKMQN-UHFFFAOYSA-N |
| Molecular Formula | C6H16N2 |
Thermo Scientific™ DEPC-treated Water
Optimize applications involving RNA with this deionized, diethylpyrocarbonate (DEPC) treated and 0.22μm membrane-filtered water.
| Treatment(s) | DEPC-Treated |
|---|---|
| pH | 7.9 |
| Grade | Molecular Biology |
Ricca Chemical Company Sodium Hydroxide, 1.00 N, Ricca Chemical
SureTRACE
Supports traceability with guaranteed access to certificates and proactive change notifications.
Learn More
Supports traceability with guaranteed access to certificates and proactive change notifications.
Learn More
CAS: 1310-73-2 Molecular Formula: HNaO Molecular Weight (g/mol): 40 g/mol InChI Key: HEMHJVSKTPXQMS-UHFFFAOYSA-M Synonym: sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic PubChem CID: 14798 ChEBI: CHEBI:32145 IUPAC Name: sodium;hydroxide SMILES: [OH-].[Na+]
| PubChem CID | 14798 |
|---|---|
| CAS | 1310-73-2 |
| Molecular Weight (g/mol) | 40 g/mol |
| ChEBI | CHEBI:32145 |
| SMILES | [OH-].[Na+] |
| Synonym | sodium hydroxide,caustic soda,sodium hydrate,white caustic,soda lye,aetznatron,ascarite,sodium hydroxide na oh,sodium hydroxide solution,soda, caustic |
| IUPAC Name | sodium;hydroxide |
| InChI Key | HEMHJVSKTPXQMS-UHFFFAOYSA-M |
| Molecular Formula | HNaO |
Zinc Chloride 98.0+%, TCI America™
CAS: 7646-85-7 Molecular Formula: Cl2Zn Molecular Weight (g/mol): 136.28 MDL Number: MFCD00011295 InChI Key: JIAARYAFYJHUJI-UHFFFAOYSA-L Synonym: zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride PubChem CID: 5727 ChEBI: CHEBI:49976 IUPAC Name: dichlorozinc SMILES: Cl[Zn]Cl
| PubChem CID | 5727 |
|---|---|
| CAS | 7646-85-7 |
| Molecular Weight (g/mol) | 136.28 |
| ChEBI | CHEBI:49976 |
| MDL Number | MFCD00011295 |
| SMILES | Cl[Zn]Cl |
| Synonym | zinc chloride,zinc dichloride,zinc chloride zncl2,zinc butter,zinc chloride fume,zinc ii chloride,zinkchloride,zintrace,zinc chloride, anhydrous,zine dichloride |
| IUPAC Name | dichlorozinc |
| InChI Key | JIAARYAFYJHUJI-UHFFFAOYSA-L |
| Molecular Formula | Cl2Zn |
p-Toluenesulfonyl Chloride 99.0+%, TCI America™
CAS: 98-59-9 Molecular Formula: C7H7ClO2S Molecular Weight (g/mol): 190.64 MDL Number: MFCD00007450 InChI Key: YYROPELSRYBVMQ-UHFFFAOYSA-N Synonym: tosyl chloride,p-toluenesulfonyl chloride,p-tosyl chloride,4-toluenesulfonyl chloride,p-toluenesulfochloride,4-methylbenzene-1-sulfonyl chloride,p-tolylsulfonyl chloride,p-toluenesulphonyl chloride,tosylchloride,p-toluenesulfonic acid chloride PubChem CID: 7397 IUPAC Name: 4-methylbenzene-1-sulfonyl chloride SMILES: CC1=CC=C(C=C1)S(Cl)(=O)=O
| PubChem CID | 7397 |
|---|---|
| CAS | 98-59-9 |
| Molecular Weight (g/mol) | 190.64 |
| MDL Number | MFCD00007450 |
| SMILES | CC1=CC=C(C=C1)S(Cl)(=O)=O |
| Synonym | tosyl chloride,p-toluenesulfonyl chloride,p-tosyl chloride,4-toluenesulfonyl chloride,p-toluenesulfochloride,4-methylbenzene-1-sulfonyl chloride,p-tolylsulfonyl chloride,p-toluenesulphonyl chloride,tosylchloride,p-toluenesulfonic acid chloride |
| IUPAC Name | 4-methylbenzene-1-sulfonyl chloride |
| InChI Key | YYROPELSRYBVMQ-UHFFFAOYSA-N |
| Molecular Formula | C7H7ClO2S |
Diphenylmethane, 99%
CAS: 101-81-5 Molecular Formula: C13H12 Molecular Weight (g/mol): 168.24 MDL Number: MFCD00004781 InChI Key: CZZYITDELCSZES-UHFFFAOYSA-N Synonym: diphenylmethane,ditan,ditane,benzene, 1,1'-methylenebis,diphenyl methane,benzene, benzyl,methane, diphenyl,1,1'-dimethylenebis benzene,benzene, phenylmethyl,methylenedibenzene PubChem CID: 7580 ChEBI: CHEBI:38884 IUPAC Name: benzylbenzene SMILES: C(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 7580 |
|---|---|
| CAS | 101-81-5 |
| Molecular Weight (g/mol) | 168.24 |
| ChEBI | CHEBI:38884 |
| MDL Number | MFCD00004781 |
| SMILES | C(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | diphenylmethane,ditan,ditane,benzene, 1,1'-methylenebis,diphenyl methane,benzene, benzyl,methane, diphenyl,1,1'-dimethylenebis benzene,benzene, phenylmethyl,methylenedibenzene |
| IUPAC Name | benzylbenzene |
| InChI Key | CZZYITDELCSZES-UHFFFAOYSA-N |
| Molecular Formula | C13H12 |
trans,trans-1,4-Diphenyl-1,3-butadiene, 99%
CAS: 538-81-8 Molecular Formula: C16H14 Molecular Weight (g/mol): 206.29 MDL Number: MFCD00004791 InChI Key: JFLKFZNIIQFQBS-FNCQTZNRSA-N Synonym: bistyryl,1,4-diphenyl-1,3-butadiene,1,4-diphenylbutadiene,trans,trans-1,4-diphenyl-1,3-butadiene,1,4-diphenylerythrene,distyryl,trans,trans-1,4-diphenylbuta-1,3-diene,1,4-diphenylbuta-1,3-diene,1,1'-1e,3e-buta-1,3-diene-1,4-diyldibenzene,1,3-butadiene, 1,4-diphenyl PubChem CID: 641683 ChEBI: CHEBI:35100 IUPAC Name: [(1E,3E)-4-phenylbuta-1,3-dienyl]benzene SMILES: C(\C=C\C1=CC=CC=C1)=C/C1=CC=CC=C1
| PubChem CID | 641683 |
|---|---|
| CAS | 538-81-8 |
| Molecular Weight (g/mol) | 206.29 |
| ChEBI | CHEBI:35100 |
| MDL Number | MFCD00004791 |
| SMILES | C(\C=C\C1=CC=CC=C1)=C/C1=CC=CC=C1 |
| Synonym | bistyryl,1,4-diphenyl-1,3-butadiene,1,4-diphenylbutadiene,trans,trans-1,4-diphenyl-1,3-butadiene,1,4-diphenylerythrene,distyryl,trans,trans-1,4-diphenylbuta-1,3-diene,1,4-diphenylbuta-1,3-diene,1,1'-1e,3e-buta-1,3-diene-1,4-diyldibenzene,1,3-butadiene, 1,4-diphenyl |
| IUPAC Name | [(1E,3E)-4-phenylbuta-1,3-dienyl]benzene |
| InChI Key | JFLKFZNIIQFQBS-FNCQTZNRSA-N |
| Molecular Formula | C16H14 |
Poly(acrylic acid), sec. stand., aver. MW 1,080,000, aver. MN 135,000
CAS: 9003-01-4 Molecular Formula: (C3H4O2)n Molecular Weight (g/mol): 72.06 MDL Number: MFCD00084394 InChI Key: NNMHYFLPFNGQFZ-UHFFFAOYSA-M Synonym: acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer PubChem CID: 6581 ChEBI: CHEBI:18308 SMILES: OC(=O)C(-*)C-*
| PubChem CID | 6581 |
|---|---|
| CAS | 9003-01-4 |
| Molecular Weight (g/mol) | 72.06 |
| ChEBI | CHEBI:18308 |
| MDL Number | MFCD00084394 |
| SMILES | OC(=O)C(-*)C-* |
| Synonym | acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer |
| InChI Key | NNMHYFLPFNGQFZ-UHFFFAOYSA-M |
| Molecular Formula | (C3H4O2)n |
Manganese(II) nitrate tetrahydrate, 98%
CAS: 20694-39-7 Molecular Formula: H8MnN2O10 Molecular Weight (g/mol): 251.006 MDL Number: MFCD00149789 InChI Key: ALIMWUQMDCBYFM-UHFFFAOYSA-N Synonym: manganese ii nitrate tetrahydrate,manganese nitrate tetrahydrate,unii-03m0g68r5f,manganese 2+ ion tetrahydrate dinitrate,manganese dinitrate tetrahydrate,acmc-20akkk,nitric acid, manganese 2+ salt, tetrahydrate,ksc206g2f,mn.2no3.4h2o,manganese 2+ dinitrate tetrahydrate PubChem CID: 182616 IUPAC Name: manganese(2+);dinitrate;tetrahydrate SMILES: [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.O.[Mn+2]
| PubChem CID | 182616 |
|---|---|
| CAS | 20694-39-7 |
| Molecular Weight (g/mol) | 251.006 |
| MDL Number | MFCD00149789 |
| SMILES | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.O.[Mn+2] |
| Synonym | manganese ii nitrate tetrahydrate,manganese nitrate tetrahydrate,unii-03m0g68r5f,manganese 2+ ion tetrahydrate dinitrate,manganese dinitrate tetrahydrate,acmc-20akkk,nitric acid, manganese 2+ salt, tetrahydrate,ksc206g2f,mn.2no3.4h2o,manganese 2+ dinitrate tetrahydrate |
| IUPAC Name | manganese(2+);dinitrate;tetrahydrate |
| InChI Key | ALIMWUQMDCBYFM-UHFFFAOYSA-N |
| Molecular Formula | H8MnN2O10 |
Iodoethane (stabilized with Copper chip) 99.0+%, TCI America™
CAS: 75-03-6 Molecular Formula: C2H5I Molecular Weight (g/mol): 155.966 MDL Number: MFCD00001091 InChI Key: HVTICUPFWKNHNG-UHFFFAOYSA-N Synonym: ethyl iodide,ethane, iodo,monoiodoethane,hydriodic ether,ethyliodide,jodethan czech,ethyljodid,jodethan,iodo-ethane,ethyljodid czech PubChem CID: 6340 ChEBI: CHEBI:42487 IUPAC Name: iodoethane SMILES: CCI
| PubChem CID | 6340 |
|---|---|
| CAS | 75-03-6 |
| Molecular Weight (g/mol) | 155.966 |
| ChEBI | CHEBI:42487 |
| MDL Number | MFCD00001091 |
| SMILES | CCI |
| Synonym | ethyl iodide,ethane, iodo,monoiodoethane,hydriodic ether,ethyliodide,jodethan czech,ethyljodid,jodethan,iodo-ethane,ethyljodid czech |
| IUPAC Name | iodoethane |
| InChI Key | HVTICUPFWKNHNG-UHFFFAOYSA-N |
| Molecular Formula | C2H5I |
Hexanes, 98.5%, OmniSolv™, ACS, MilliporeSigma™
CAS: 110-54-3 Molecular Formula: C6H14 Molecular Weight (g/mol): 86.18 MDL Number: MFCD02179311 InChI Key: VLKZOEOYAKHREP-UHFFFAOYSA-N Synonym: n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes PubChem CID: 8058 ChEBI: CHEBI:29021 IUPAC Name: hexane SMILES: CCCCCC
| PubChem CID | 8058 |
|---|---|
| CAS | 110-54-3 |
| Molecular Weight (g/mol) | 86.18 |
| ChEBI | CHEBI:29021 |
| MDL Number | MFCD02179311 |
| SMILES | CCCCCC |
| Synonym | n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes |
| IUPAC Name | hexane |
| InChI Key | VLKZOEOYAKHREP-UHFFFAOYSA-N |
| Molecular Formula | C6H14 |