Chemicals
Filtered Search Results
1-Bromo-4-ethylbenzene, 99%
CAS: 1585-07-5 Molecular Formula: C8H9Br Molecular Weight (g/mol): 185.064 MDL Number: MFCD00000111 InChI Key: URFPRAHGGBYNPW-UHFFFAOYSA-N Synonym: p-bromoethylbenzene,benzene, 1-bromo-4-ethyl,4-ethylbromobenzene,p-ethylbromobenzene,1-bromo-4-ethyl-benzene,unii-42li8tat6j,1-ethyl-4-bromobenzene,4-bromo-1-ethylbenzene,4-ethyl-1-bromobenzene,42li8tat6j PubChem CID: 15313 IUPAC Name: 1-bromo-4-ethylbenzene SMILES: CCC1=CC=C(C=C1)Br
| PubChem CID | 15313 |
|---|---|
| CAS | 1585-07-5 |
| Molecular Weight (g/mol) | 185.064 |
| MDL Number | MFCD00000111 |
| SMILES | CCC1=CC=C(C=C1)Br |
| Synonym | p-bromoethylbenzene,benzene, 1-bromo-4-ethyl,4-ethylbromobenzene,p-ethylbromobenzene,1-bromo-4-ethyl-benzene,unii-42li8tat6j,1-ethyl-4-bromobenzene,4-bromo-1-ethylbenzene,4-ethyl-1-bromobenzene,42li8tat6j |
| IUPAC Name | 1-bromo-4-ethylbenzene |
| InChI Key | URFPRAHGGBYNPW-UHFFFAOYSA-N |
| Molecular Formula | C8H9Br |
Bromine, 99.6%, for analysis
CAS: 7726-95-6 Molecular Formula: Br Molecular Weight (g/mol): 79.91 MDL Number: MFCD00010896 InChI Key: CPELXLSAUQHCOX-UHFFFAOYSA-M Synonym: bromine,dibromine,brom,bromine solution,brome,bromo,broom,bromine water,bromo italian,bromo spanish PubChem CID: 24408 ChEBI: CHEBI:29224 SMILES: [Br-]
| PubChem CID | 24408 |
|---|---|
| CAS | 7726-95-6 |
| Molecular Weight (g/mol) | 79.91 |
| ChEBI | CHEBI:29224 |
| MDL Number | MFCD00010896 |
| SMILES | [Br-] |
| Synonym | bromine,dibromine,brom,bromine solution,brome,bromo,broom,bromine water,bromo italian,bromo spanish |
| InChI Key | CPELXLSAUQHCOX-UHFFFAOYSA-M |
| Molecular Formula | Br |
3-Ethyl-4-methyl-3-pyrrolin-2-one, 98%
CAS: 766-36-9 Molecular Formula: C7H11NO Molecular Weight (g/mol): 125.17 MDL Number: MFCD00173861 InChI Key: YCTNTSVMJWIYTQ-UHFFFAOYSA-N Synonym: 3-ethyl-4-methyl-3-pyrrolin-2-one,3-ethyl-4-methyl-3-pyrroline-2-one,3-ethyl-4-methyl-2,5-dihydro-1h-pyrrol-2-one,3-ethyl-4-methyl-1h-pyrrol-2 5h-one,1,5-dihydro-3-ethyl-4-methyl-2h-pyrrol-2-one,2h-pyrrol-2-one, 3-ethyl-1,5-dihydro-4-methyl,3-ethyl-4-methyl-2-oxo-3-pyrroline,3-ethyl-4-methyl-1,5-dihydropyrrol-2-one,3-ethyl-1,5-dihydro-4-methyl-2h-pyrrol-2-one,pubchem12392 PubChem CID: 854146 SMILES: CCC1=C(C)CNC1=O
| PubChem CID | 854146 |
|---|---|
| CAS | 766-36-9 |
| Molecular Weight (g/mol) | 125.17 |
| MDL Number | MFCD00173861 |
| SMILES | CCC1=C(C)CNC1=O |
| Synonym | 3-ethyl-4-methyl-3-pyrrolin-2-one,3-ethyl-4-methyl-3-pyrroline-2-one,3-ethyl-4-methyl-2,5-dihydro-1h-pyrrol-2-one,3-ethyl-4-methyl-1h-pyrrol-2 5h-one,1,5-dihydro-3-ethyl-4-methyl-2h-pyrrol-2-one,2h-pyrrol-2-one, 3-ethyl-1,5-dihydro-4-methyl,3-ethyl-4-methyl-2-oxo-3-pyrroline,3-ethyl-4-methyl-1,5-dihydropyrrol-2-one,3-ethyl-1,5-dihydro-4-methyl-2h-pyrrol-2-one,pubchem12392 |
| InChI Key | YCTNTSVMJWIYTQ-UHFFFAOYSA-N |
| Molecular Formula | C7H11NO |
4-Aminoantipyrine, 99%, MP Biomedicals™
Molecular Formula: C11H13N3O InChI Key: RLFWWDJHLFCNIJ-UHFFFAOYSA-N PubChem CID: 2151
| PubChem CID | 2151 |
|---|---|
| InChI Key | RLFWWDJHLFCNIJ-UHFFFAOYSA-N |
| Molecular Formula | C11H13N3O |
2,6-Dimethoxyphenol, 99%
CAS: 91-10-1 Molecular Formula: C8H10O3 Molecular Weight (g/mol): 154.17 MDL Number: MFCD00064434 InChI Key: KLIDCXVFHGNTTM-UHFFFAOYSA-N Synonym: syringol,pyrogallol 1,3-dimethyl ether,1,3-dimethyl pyrogallate,phenol, 2,6-dimethoxy,2-hydroxy-1,3-dimethoxybenzene,1,3-di-o-methylpyrogallol,1,3-dimethoxy-2-hydroxybenzene,2,6-dimethoxy-phenol,pyrogallol dimethylether,2,6-dwumetoksyfenol PubChem CID: 7041 ChEBI: CHEBI:955 IUPAC Name: 2,6-dimethoxyphenol SMILES: COC1=CC=CC(OC)=C1O
| PubChem CID | 7041 |
|---|---|
| CAS | 91-10-1 |
| Molecular Weight (g/mol) | 154.17 |
| ChEBI | CHEBI:955 |
| MDL Number | MFCD00064434 |
| SMILES | COC1=CC=CC(OC)=C1O |
| Synonym | syringol,pyrogallol 1,3-dimethyl ether,1,3-dimethyl pyrogallate,phenol, 2,6-dimethoxy,2-hydroxy-1,3-dimethoxybenzene,1,3-di-o-methylpyrogallol,1,3-dimethoxy-2-hydroxybenzene,2,6-dimethoxy-phenol,pyrogallol dimethylether,2,6-dwumetoksyfenol |
| IUPAC Name | 2,6-dimethoxyphenol |
| InChI Key | KLIDCXVFHGNTTM-UHFFFAOYSA-N |
| Molecular Formula | C8H10O3 |
Ethyl L-lactate, 99%
CAS: 687-47-8 Molecular Formula: C5H10O3 Molecular Weight (g/mol): 118.132 MDL Number: MFCD00065359 InChI Key: LZCLXQDLBQLTDK-BYPYZUCNSA-N Synonym: ethyl l-lactate,ethyl 2s-2-hydroxypropanoate,l-ethyl lactate,l---ethyl lactate,ethyl l--lactate,ethyl s-2-hydroxypropionate,ethyl l---lactate,s-ethyl lactate,propanoic acid, 2-hydroxy-, ethyl ester, 2s PubChem CID: 92831 ChEBI: CHEBI:78322 IUPAC Name: ethyl (2S)-2-hydroxypropanoate SMILES: CCOC(=O)C(C)O
| PubChem CID | 92831 |
|---|---|
| CAS | 687-47-8 |
| Molecular Weight (g/mol) | 118.132 |
| ChEBI | CHEBI:78322 |
| MDL Number | MFCD00065359 |
| SMILES | CCOC(=O)C(C)O |
| Synonym | ethyl l-lactate,ethyl 2s-2-hydroxypropanoate,l-ethyl lactate,l---ethyl lactate,ethyl l--lactate,ethyl s-2-hydroxypropionate,ethyl l---lactate,s-ethyl lactate,propanoic acid, 2-hydroxy-, ethyl ester, 2s |
| IUPAC Name | ethyl (2S)-2-hydroxypropanoate |
| InChI Key | LZCLXQDLBQLTDK-BYPYZUCNSA-N |
| Molecular Formula | C5H10O3 |
3,3'-Diaminodiphenyl sulfone, 98%
CAS: 599-61-1 Molecular Formula: C12H12N2O2S Molecular Weight (g/mol): 248.30 MDL Number: MFCD00007792 InChI Key: LJGHYPLBDBRCRZ-UHFFFAOYSA-N Synonym: 3,3'-sulfonyldianiline,3,3'-diaminodiphenyl sulfone,3-aminophenyl sulfone,benzenamine, 3,3'-sulfonylbis,3,3'-sulphonyldianiline,bis m-aminophenyl sulfone,3-aminophenyl-sulfone,3,3'-diaminophenyl sulfone,3,3'-sulfonylbis aniline,sulfone, bis m-aminophenyl PubChem CID: 11741 IUPAC Name: 3-(3-aminophenyl)sulfonylaniline SMILES: NC1=CC(=CC=C1)S(=O)(=O)C1=CC(N)=CC=C1
| PubChem CID | 11741 |
|---|---|
| CAS | 599-61-1 |
| Molecular Weight (g/mol) | 248.30 |
| MDL Number | MFCD00007792 |
| SMILES | NC1=CC(=CC=C1)S(=O)(=O)C1=CC(N)=CC=C1 |
| Synonym | 3,3'-sulfonyldianiline,3,3'-diaminodiphenyl sulfone,3-aminophenyl sulfone,benzenamine, 3,3'-sulfonylbis,3,3'-sulphonyldianiline,bis m-aminophenyl sulfone,3-aminophenyl-sulfone,3,3'-diaminophenyl sulfone,3,3'-sulfonylbis aniline,sulfone, bis m-aminophenyl |
| IUPAC Name | 3-(3-aminophenyl)sulfonylaniline |
| InChI Key | LJGHYPLBDBRCRZ-UHFFFAOYSA-N |
| Molecular Formula | C12H12N2O2S |
Silver sulfate, ACS reagent
CAS: 10294-26-5 Molecular Formula: Ag2H2O4S Molecular Weight (g/mol): 313.81 InChI Key: YPNVIBVEFVRZPJ-UHFFFAOYSA-N Synonym: silver sulfate,disilver sulfate,disilver 1+ sulfate,unii-8qg6hv4zpo,disilver 1+ sulphate,sulfuric acid, disilver 1+ salt,8qg6hv4zpo,disilver 1+ ion sulfate,sulfuric acid, silver 1+ salt 1:2,sulfuric acid disilver i salt PubChem CID: 159865 IUPAC Name: disilver(1+) sulfuric acid SMILES: [Ag+].[Ag+].OS(O)(=O)=O
| PubChem CID | 159865 |
|---|---|
| CAS | 10294-26-5 |
| Molecular Weight (g/mol) | 313.81 |
| SMILES | [Ag+].[Ag+].OS(O)(=O)=O |
| Synonym | silver sulfate,disilver sulfate,disilver 1+ sulfate,unii-8qg6hv4zpo,disilver 1+ sulphate,sulfuric acid, disilver 1+ salt,8qg6hv4zpo,disilver 1+ ion sulfate,sulfuric acid, silver 1+ salt 1:2,sulfuric acid disilver i salt |
| IUPAC Name | disilver(1+) sulfuric acid |
| InChI Key | YPNVIBVEFVRZPJ-UHFFFAOYSA-N |
| Molecular Formula | Ag2H2O4S |
Potassium tungstate, 99.95%, for trace metal analysis, -100 mesh
CAS: 7790-60-5 Molecular Formula: K2O4W Molecular Weight (g/mol): 326.05 InChI Key: AAQNGTNRWPXMPB-UHFFFAOYSA-N Synonym: potassium tungstate,unii-t6vrm0ou6v,t6vrm0ou6v,dipotassium dioxido dioxo tungsten,dipotassium wolframate,potassium tungstate vi,tungstate wo42-, dipotassium, t-4,2k.wo4,potassium tungstate-w PubChem CID: 3084032 IUPAC Name: dipotassium;dioxido(dioxo)tungsten SMILES: [O-][W](=O)(=O)[O-].[K+].[K+]
| PubChem CID | 3084032 |
|---|---|
| CAS | 7790-60-5 |
| Molecular Weight (g/mol) | 326.05 |
| SMILES | [O-][W](=O)(=O)[O-].[K+].[K+] |
| Synonym | potassium tungstate,unii-t6vrm0ou6v,t6vrm0ou6v,dipotassium dioxido dioxo tungsten,dipotassium wolframate,potassium tungstate vi,tungstate wo42-, dipotassium, t-4,2k.wo4,potassium tungstate-w |
| IUPAC Name | dipotassium;dioxido(dioxo)tungsten |
| InChI Key | AAQNGTNRWPXMPB-UHFFFAOYSA-N |
| Molecular Formula | K2O4W |
| Name Note | 0.51mm (0.02 in.) dia. |
|---|---|
| Form | Wire |
| Health Hazard 3 | P201-P202-P260-P264b-P270-P272-P280g-P281-P302+P352-P308+P313-P333+P313-P363-P501c |
| MDL Number | MFCD00148499 |
| Health Hazard 2 | GHS H Statement H372-H351-H317 Causes damage to organs through prolonged or repeated exposure. Suspected of causing cancer. May cause an allergic skin reaction. |
| Solubility Information | Insoluble in water. |
| Health Hazard 1 | H317-H350-H372 |
| Chemical Name or Material | Stainless Steel wire, Type 304 |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Odor | Odorless |
| Avg. Mol. Wt. or Mol. Wt. Range | Fe:Cr:Ni; 70:19:11 wt% |
1-Bromohexane, 99%
CAS: 111-25-1 Molecular Formula: C6H13Br Molecular Weight (g/mol): 165.07 MDL Number: MFCD00000271 InChI Key: MNDIARAMWBIKFW-UHFFFAOYSA-N Synonym: hexyl bromide,n-hexyl bromide,bromohexane,1-hexyl bromide,hexane, 1-bromo,hexane, bromo,unii-wva0fax7ga,1-bromo-hexane,pentane, bromomethyl,wva0fax7ga PubChem CID: 8101 IUPAC Name: 1-bromohexane SMILES: CCCCCCBr
| PubChem CID | 8101 |
|---|---|
| CAS | 111-25-1 |
| Molecular Weight (g/mol) | 165.07 |
| MDL Number | MFCD00000271 |
| SMILES | CCCCCCBr |
| Synonym | hexyl bromide,n-hexyl bromide,bromohexane,1-hexyl bromide,hexane, 1-bromo,hexane, bromo,unii-wva0fax7ga,1-bromo-hexane,pentane, bromomethyl,wva0fax7ga |
| IUPAC Name | 1-bromohexane |
| InChI Key | MNDIARAMWBIKFW-UHFFFAOYSA-N |
| Molecular Formula | C6H13Br |
Potassium hydrogen phosphate trihydrate, Reagent Grade
CAS: 16788-57-1 Molecular Formula: H7K2O7P Molecular Weight (g/mol): 228.22 MDL Number: MFCD00149926 InChI Key: XQGPKZUNMMFTAL-UHFFFAOYSA-L Synonym: dipotassium hydrogen phosphate trihydrate,dipotassium hydrogen phosphate trihydrate,unii-rjk174x3tz,potassium hydrogenphosphate trihydrate,potassium phosphate dibasic trihydrate,potassium hydrogen phosphate trihydrate,potassium phosphate, dibasic, trihydrate,phosphoric acid, dipotassium salt, trihydrate,rjk174x3tz,dipotassium phosphate trihydrate PubChem CID: 16217523 IUPAC Name: dipotassium;hydrogen phosphate;trihydrate SMILES: O.O.O.[K+].[K+].OP([O-])([O-])=O
| PubChem CID | 16217523 |
|---|---|
| CAS | 16788-57-1 |
| Molecular Weight (g/mol) | 228.22 |
| MDL Number | MFCD00149926 |
| SMILES | O.O.O.[K+].[K+].OP([O-])([O-])=O |
| Synonym | dipotassium hydrogen phosphate trihydrate,dipotassium hydrogen phosphate trihydrate,unii-rjk174x3tz,potassium hydrogenphosphate trihydrate,potassium phosphate dibasic trihydrate,potassium hydrogen phosphate trihydrate,potassium phosphate, dibasic, trihydrate,phosphoric acid, dipotassium salt, trihydrate,rjk174x3tz,dipotassium phosphate trihydrate |
| IUPAC Name | dipotassium;hydrogen phosphate;trihydrate |
| InChI Key | XQGPKZUNMMFTAL-UHFFFAOYSA-L |
| Molecular Formula | H7K2O7P |
Potassium Phosphate Monobasic (ACS), MilliporeSigma™
CAS: 7778-77-0 Molecular Formula: H2KO4P Molecular Weight (g/mol): 136.08 MDL Number: MFCD00011401 MFCD00147253 InChI Key: GNSKLFRGEWLPPA-UHFFFAOYSA-M Synonym: potassium dihydrogen phosphate,monopotassium phosphate,potassium phosphate monobasic,potassium phosphate, monobasic,potassium acid phosphate,phosphoric acid, monopotassium salt,monobasic potassium phosphate,monopotassium monophosphate,monopotassium dihydrogen phosphate,monopotassium orthophosphate PubChem CID: 516951 ChEBI: CHEBI:63036 IUPAC Name: potassium dihydrogen phosphate SMILES: [K+].OP(O)([O-])=O
| PubChem CID | 516951 |
|---|---|
| CAS | 7778-77-0 |
| Molecular Weight (g/mol) | 136.08 |
| ChEBI | CHEBI:63036 |
| MDL Number | MFCD00011401 MFCD00147253 |
| SMILES | [K+].OP(O)([O-])=O |
| Synonym | potassium dihydrogen phosphate,monopotassium phosphate,potassium phosphate monobasic,potassium phosphate, monobasic,potassium acid phosphate,phosphoric acid, monopotassium salt,monobasic potassium phosphate,monopotassium monophosphate,monopotassium dihydrogen phosphate,monopotassium orthophosphate |
| IUPAC Name | potassium dihydrogen phosphate |
| InChI Key | GNSKLFRGEWLPPA-UHFFFAOYSA-M |
| Molecular Formula | H2KO4P |
Sodium cyclamate, 99%
CAS: 139-05-9 Molecular Formula: C6H12NNaO3S Molecular Weight (g/mol): 201.22 MDL Number: MFCD00003827 InChI Key: UDIPTWFVPPPURJ-UHFFFAOYSA-M Synonym: sodium cyclamate,sodium cyclohexylsulfamate,sodium n-cyclohexylsulfamate,cyclamate sodium,cyclamic acid sodium salt,assugrin,ibiosuc,suessette,suestamin,sugarin PubChem CID: 23665706 ChEBI: CHEBI:82431 IUPAC Name: sodium;N-cyclohexylsulfamate SMILES: [Na+].[O-]S(=O)(=O)NC1CCCCC1
| PubChem CID | 23665706 |
|---|---|
| CAS | 139-05-9 |
| Molecular Weight (g/mol) | 201.22 |
| ChEBI | CHEBI:82431 |
| MDL Number | MFCD00003827 |
| SMILES | [Na+].[O-]S(=O)(=O)NC1CCCCC1 |
| Synonym | sodium cyclamate,sodium cyclohexylsulfamate,sodium n-cyclohexylsulfamate,cyclamate sodium,cyclamic acid sodium salt,assugrin,ibiosuc,suessette,suestamin,sugarin |
| IUPAC Name | sodium;N-cyclohexylsulfamate |
| InChI Key | UDIPTWFVPPPURJ-UHFFFAOYSA-M |
| Molecular Formula | C6H12NNaO3S |
Molybdenum powder, -250 mesh, 99.9% (metals basis), Thermo Scientific Chemicals
CAS: 7439-98-7 Molecular Formula: Mo Molecular Weight (g/mol): 95.95 MDL Number: MFCD00003465 InChI Key: ZOKXTWBITQBERF-UHFFFAOYSA-N Synonym: molybdenum, elemental,6+ ion,mchvl,vi ion,molybdenum, metallic,metco 63,atom,molybdenum, ion 6+,tsm1,amperit 106.2 PubChem CID: 23932 ChEBI: CHEBI:28685 IUPAC Name: molybdenum SMILES: [Mo]
| PubChem CID | 23932 |
|---|---|
| CAS | 7439-98-7 |
| Molecular Weight (g/mol) | 95.95 |
| ChEBI | CHEBI:28685 |
| MDL Number | MFCD00003465 |
| SMILES | [Mo] |
| Synonym | molybdenum, elemental,6+ ion,mchvl,vi ion,molybdenum, metallic,metco 63,atom,molybdenum, ion 6+,tsm1,amperit 106.2 |
| IUPAC Name | molybdenum |
| InChI Key | ZOKXTWBITQBERF-UHFFFAOYSA-N |
| Molecular Formula | Mo |