Chemicals
Filtered Search Results
Boron trifluoride, 12% (1.5M) in methanol
Boron trifluoride, 12% (1.5M) in methanol, Quantity: 500g, Packaging: Glass bottle, Boiling Point: 65.0 deg.C, CAS: 373-57-9, 67-56-1, Amber to Colorless, Melting Point: -98.0 deg.C, Molecular Formula: BF3, Molecular Weight: 67.81, Percent Purity: 10 to 15% (w/v BF3) | CAS: 373-57-9 | BF3 | 67.81 g/mol
| Linear Formula | BF3 |
|---|---|
| Molecular Weight (g/mol) | 67.81 |
| InChI Key | WTEOIRVLGSZEPR-UHFFFAOYSA-N |
| Density | 0.8700g/mL |
| PubChem CID | 11062313 |
| Name Note | 1.5M solution in methanol |
| Percent Purity | 10 to 15% (w/v BF3) |
| RTECS Number | ED2275000 |
| Formula Weight | 67.81 |
| Melting Point | -98.0°C |
| Boiling Point | 65.0°C |
| Color | Amber to Colorless |
| Physical Form | Solution |
| Chemical Name or Material | Boron trifluoride |
| SMILES | FB(F)F |
| Merck Index | 14, 1349 |
| CAS | 67-56-1 |
| Health Hazard 3 | GHS P Statement IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Wear protective gloves/protective |
| MDL Number | MFCD00011316 |
| Health Hazard 2 | GHS H Statement Highly flammable liquid and vapor. Causes severe skin burns and eye damage. Fatal if inhaled. Toxic if swallowed. Reacts violently with water. Toxic in contact with skin. Causes damage to organs |
| Packaging | Glass bottle |
| Solubility Information | Solubility in water: may decompose |
| Flash Point | 4°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | boron trifluoride-methanol solution,boron trifluoride-methanol complex,boron trifluoride methanol,boron trifluoride-methanol solution in methanol,bf3 methanol,.bf3 in methanol,boron fluoride methanol,bf3 meoh,borontrifluoride methanol,boron trifluoride solution |
| TSCA | TSCA |
| Molecular Formula | BF3 |
| EINECS Number | 206-766-4 |
| Specific Gravity | 0.87 |
| Boiling Point | 100.0°C |
|---|---|
| Linear Formula | HCl |
| Molecular Weight (g/mol) | 36.46 |
| ChEBI | CHEBI:17883 |
| Color | Colorless |
| Physical Form | Liquid |
| SMILES | Cl |
| Merck Index | 15, 4818 |
| Concentration | 0.0998 to 0.1002N (20°C) |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Density | 1.0000g/mL |
| PubChem CID | 313 |
| Name Note | 0.1 N Standard Solution |
| Fieser | 04,450; 05,533; 06,283 |
| CAS | 7732-18-5 |
| Health Hazard 3 | Emergency Overview May cause skin, eye, and respiratory tract irritation. The toxicological properties have not been fully investigated. NFPA Health: 2 Flammability: 0 Instability: 0 |
| MDL Number | MFCD00011324 MFCD00792839 |
| Solubility Information | Solubility in water: miscible. Other solubilities: soluble in alcohol and benzene |
| Health Hazard 1 | SIGNAL WORD: CAUTION! |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| Molecular Formula | ClH |
| Formula Weight | 36.46 |
| Specific Gravity | 1 |
Sodium Hypochlorite, Certified ACS Grade, 5.0% to 6.0% (w/v), LabChem™
CAS: 7681-52-9 Molecular Formula: ClNaO Molecular Weight (g/mol): 74.439 InChI Key: SUKJFIGYRHOWBL-UHFFFAOYSA-N Synonym: sodium hypochlorite,antiformin,sodium oxychloride,chlorox,clorox,javex,javelle water,hypochlorous acid, sodium salt,hypochlorite sodium,carrel-dakin solution PubChem CID: 23665760 ChEBI: CHEBI:32146 IUPAC Name: sodium;hypochlorite SMILES: [O-]Cl.[Na+]
| PubChem CID | 23665760 |
|---|---|
| CAS | 7681-52-9 |
| Molecular Weight (g/mol) | 74.439 |
| ChEBI | CHEBI:32146 |
| SMILES | [O-]Cl.[Na+] |
| Synonym | sodium hypochlorite,antiformin,sodium oxychloride,chlorox,clorox,javex,javelle water,hypochlorous acid, sodium salt,hypochlorite sodium,carrel-dakin solution |
| IUPAC Name | sodium;hypochlorite |
| InChI Key | SUKJFIGYRHOWBL-UHFFFAOYSA-N |
| Molecular Formula | ClNaO |
Sodium phosphate, dibasic dodecahydrate, 99%, extra pure
CAS: 10039-32-4 Molecular Formula: HNa2O4P·12H2O Molecular Weight (g/mol): 358.13 InChI Key: DGLRDKLJZLEJCY-UHFFFAOYSA-L Synonym: disodium phosphate dodecahydrate,disodium hydrogen phosphate dodecahydrate,phosphoric acid, disodium salt, dodecahydrate,di-sodium hydrogen phosphate dodecahydrate,sodium hydrogenphosphate dodecahydrate,unii-e1w4n241fo,sodium phosphate dibasic dodecahydrate,sodium phosphate, dibasic, dodecahydrate,disodium orthophosphate, dodecahydrate,sodium monohydrogen phosphate dodecahydrate 2:1:1:12 PubChem CID: 61456 IUPAC Name: disodium;hydrogen phosphate;dodecahydrate SMILES: O.O.O.O.O.O.O.O.O.O.O.O.OP(=O)([O-])[O-].[Na+].[Na+]
| PubChem CID | 61456 |
|---|---|
| CAS | 10039-32-4 |
| Molecular Weight (g/mol) | 358.13 |
| SMILES | O.O.O.O.O.O.O.O.O.O.O.O.OP(=O)([O-])[O-].[Na+].[Na+] |
| Synonym | disodium phosphate dodecahydrate,disodium hydrogen phosphate dodecahydrate,phosphoric acid, disodium salt, dodecahydrate,di-sodium hydrogen phosphate dodecahydrate,sodium hydrogenphosphate dodecahydrate,unii-e1w4n241fo,sodium phosphate dibasic dodecahydrate,sodium phosphate, dibasic, dodecahydrate,disodium orthophosphate, dodecahydrate,sodium monohydrogen phosphate dodecahydrate 2:1:1:12 |
| IUPAC Name | disodium;hydrogen phosphate;dodecahydrate |
| InChI Key | DGLRDKLJZLEJCY-UHFFFAOYSA-L |
| Molecular Formula | HNa2O4P·12H2O |
Ethanolamine, 99%
CAS: 141-43-5 Molecular Formula: C2H7NO Molecular Weight (g/mol): 61.08 MDL Number: MFCD00008183 InChI Key: HZAXFHJVJLSVMW-UHFFFAOYSA-N Synonym: ethanolamine,monoethanolamine,aminoethanol,2-hydroxyethylamine,colamine,glycinol,olamine,2-amino-1-ethanol,ethanol, 2-amino,ethylolamine PubChem CID: 700 ChEBI: CHEBI:16000 SMILES: NCCO
| PubChem CID | 700 |
|---|---|
| CAS | 141-43-5 |
| Molecular Weight (g/mol) | 61.08 |
| ChEBI | CHEBI:16000 |
| MDL Number | MFCD00008183 |
| SMILES | NCCO |
| Synonym | ethanolamine,monoethanolamine,aminoethanol,2-hydroxyethylamine,colamine,glycinol,olamine,2-amino-1-ethanol,ethanol, 2-amino,ethylolamine |
| InChI Key | HZAXFHJVJLSVMW-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO |
Aniline, ACS, 99+%
CAS: 62-53-3 Molecular Formula: C6H7N Molecular Weight (g/mol): 93.13 MDL Number: MFCD00007629 InChI Key: PAYRUJLWNCNPSJ-UHFFFAOYSA-N Synonym: benzenamine,phenylamine,aminobenzene,aminophen,anilin,kyanol,arylamine,cyanol,benzeneamine,benzidam PubChem CID: 6115 ChEBI: CHEBI:17296 IUPAC Name: aniline SMILES: NC1=CC=CC=C1
| PubChem CID | 6115 |
|---|---|
| CAS | 62-53-3 |
| Molecular Weight (g/mol) | 93.13 |
| ChEBI | CHEBI:17296 |
| MDL Number | MFCD00007629 |
| SMILES | NC1=CC=CC=C1 |
| Synonym | benzenamine,phenylamine,aminobenzene,aminophen,anilin,kyanol,arylamine,cyanol,benzeneamine,benzidam |
| IUPAC Name | aniline |
| InChI Key | PAYRUJLWNCNPSJ-UHFFFAOYSA-N |
| Molecular Formula | C6H7N |
Thermo Scientific Chemicals Riboflavin, 98%
CAS: 83-88-5 Molecular Formula: C17H20N4O6 Molecular Weight (g/mol): 376.37 MDL Number: MFCD00005022 InChI Key: AUNGANRZJHBGPY-QTZZOOGMNA-N Synonym: riboflavin,vitamin b2,lactoflavin,riboflavine,vitamin g,lactoflavine,--riboflavin,beflavin,beflavine,flavaxin PubChem CID: 71310809 SMILES: CC1=C(C)C=C2N(C[C@H](O)[C@H](O)[C@H](O)CO)C3=NC(=O)NC(=O)C3=NC2=C1
| PubChem CID | 71310809 |
|---|---|
| CAS | 83-88-5 |
| Molecular Weight (g/mol) | 376.37 |
| MDL Number | MFCD00005022 |
| SMILES | CC1=C(C)C=C2N(C[C@H](O)[C@H](O)[C@H](O)CO)C3=NC(=O)NC(=O)C3=NC2=C1 |
| Synonym | riboflavin,vitamin b2,lactoflavin,riboflavine,vitamin g,lactoflavine,--riboflavin,beflavin,beflavine,flavaxin |
| InChI Key | AUNGANRZJHBGPY-QTZZOOGMNA-N |
| Molecular Formula | C17H20N4O6 |
2,2,4-Trimethylpentane, 99%, for spectroscopy
CAS: 540-84-1 Molecular Formula: C8H18 Molecular Weight (g/mol): 114.232 MDL Number: MFCD00008943 InChI Key: NHTMVDHEPJAVLT-UHFFFAOYSA-N Synonym: isooctane,isobutyltrimethylmethane,pentane, 2,2,4-trimethyl,iso-octane,2,4,4-trimethylpentane,unii-qab8f5669o,ch3 2chch2c ch3 3,2, 2, 4-trimethylpentane,i-octane,isobutyltrimethylethane PubChem CID: 10907 ChEBI: CHEBI:62805 IUPAC Name: 2,2,4-trimethylpentane SMILES: CC(C)CC(C)(C)C
| PubChem CID | 10907 |
|---|---|
| CAS | 540-84-1 |
| Molecular Weight (g/mol) | 114.232 |
| ChEBI | CHEBI:62805 |
| MDL Number | MFCD00008943 |
| SMILES | CC(C)CC(C)(C)C |
| Synonym | isooctane,isobutyltrimethylmethane,pentane, 2,2,4-trimethyl,iso-octane,2,4,4-trimethylpentane,unii-qab8f5669o,ch3 2chch2c ch3 3,2, 2, 4-trimethylpentane,i-octane,isobutyltrimethylethane |
| IUPAC Name | 2,2,4-trimethylpentane |
| InChI Key | NHTMVDHEPJAVLT-UHFFFAOYSA-N |
| Molecular Formula | C8H18 |
Iodine, 0.1N (0.05M) standard solution
CAS: 7553-56-2 Molecular Formula: I2 Molecular Weight (g/mol): 253.81 MDL Number: MFCD00011355 MFCD00164163 InChI Key: PNDPGZBMCMUPRI-UHFFFAOYSA-N Synonym: iodine,diiodine,iodine crystals,iodine sublimed,tincture iodine,vistarin,eranol,iodio,iodine solution,iode PubChem CID: 807 ChEBI: CHEBI:17606 IUPAC Name: diiodine SMILES: II
| PubChem CID | 807 |
|---|---|
| CAS | 7553-56-2 |
| Molecular Weight (g/mol) | 253.81 |
| ChEBI | CHEBI:17606 |
| MDL Number | MFCD00011355 MFCD00164163 |
| SMILES | II |
| Synonym | iodine,diiodine,iodine crystals,iodine sublimed,tincture iodine,vistarin,eranol,iodio,iodine solution,iode |
| IUPAC Name | diiodine |
| InChI Key | PNDPGZBMCMUPRI-UHFFFAOYSA-N |
| Molecular Formula | I2 |
Ammonium molybdate(VI) tetrahydrate, ACS reagent
CAS: 12054-85-2 Molecular Formula: H24Mo7N6O24·4H2O MDL Number: MFCD00167059
| CAS | 12054-85-2 |
|---|---|
| MDL Number | MFCD00167059 |
| Molecular Formula | H24Mo7N6O24·4H2O |
Calcium carbonate, chelometric standard, ACS, 99.95-100.05%
CAS: 471-34-1 Molecular Formula: CCaO3 Molecular Weight (g/mol): 100.09 MDL Number: MFCD00010906 InChI Key: VTYYLEPIZMXCLO-UHFFFAOYSA-L Synonym: calcium carbonate,limestone,chalk,calcite,carbonic acid calcium salt 1:1,marble,calofort u,aragonite,aeromatt,akadama PubChem CID: 10112 ChEBI: CHEBI:3311 SMILES: [Ca++].[O-]C([O-])=O
| PubChem CID | 10112 |
|---|---|
| CAS | 471-34-1 |
| Molecular Weight (g/mol) | 100.09 |
| ChEBI | CHEBI:3311 |
| MDL Number | MFCD00010906 |
| SMILES | [Ca++].[O-]C([O-])=O |
| Synonym | calcium carbonate,limestone,chalk,calcite,carbonic acid calcium salt 1:1,marble,calofort u,aragonite,aeromatt,akadama |
| InChI Key | VTYYLEPIZMXCLO-UHFFFAOYSA-L |
| Molecular Formula | CCaO3 |
Sodium nitrate, 99+%, ACS reagent
CAS: 7631-99-4 Molecular Formula: NNaO3 Molecular Weight (g/mol): 84.99 MDL Number: MFCD00011119 InChI Key: VWDWKYIASSYTQR-UHFFFAOYSA-N Synonym: sodium nitrate,chile saltpeter,nitrate of soda,cubic niter,etabisulfite,nitratine,soda niter,sodium saltpeter,nitric acid, sodium salt,sodium i nitrate 1:1 PubChem CID: 24268 ChEBI: CHEBI:63005 SMILES: [Na+].[O-][N+]([O-])=O
| PubChem CID | 24268 |
|---|---|
| CAS | 7631-99-4 |
| Molecular Weight (g/mol) | 84.99 |
| ChEBI | CHEBI:63005 |
| MDL Number | MFCD00011119 |
| SMILES | [Na+].[O-][N+]([O-])=O |
| Synonym | sodium nitrate,chile saltpeter,nitrate of soda,cubic niter,etabisulfite,nitratine,soda niter,sodium saltpeter,nitric acid, sodium salt,sodium i nitrate 1:1 |
| InChI Key | VWDWKYIASSYTQR-UHFFFAOYSA-N |
| Molecular Formula | NNaO3 |
Calcium chloride dihydrate, 99+%, ACS reagent
CAS: 10035-04-8 Molecular Formula: CaCl2·2H2O Molecular Weight (g/mol): 147.02 MDL Number: MFCD00149613
| CAS | 10035-04-8 |
|---|---|
| Molecular Weight (g/mol) | 147.02 |
| MDL Number | MFCD00149613 |
| Molecular Formula | CaCl2·2H2O |
1,5-Diphenylcarbazide, ACS
CAS: 140-22-7 Molecular Formula: C13H14N4O Molecular Weight (g/mol): 242.282 MDL Number: MFCD00003013 InChI Key: KSPIHGBHKVISFI-UHFFFAOYSA-N Synonym: 1,5-diphenylcarbazide,diphenylcarbazide,1,5-diphenylcarbohydrazide,carbonic dihydrazide, 2,2'-diphenyl,1,5-diphenylcarbonohydrazide,1,5-diphenylcabohydrazide,sym-diphenylcarbazide,n,n'-diphenylcarbazide,2,2'-diphenylcarbazide,carbohydrazide, 1,5-diphenyl PubChem CID: 8789 ChEBI: CHEBI:4641 IUPAC Name: 1,3-dianilinourea SMILES: C1=CC=C(C=C1)NNC(=O)NNC2=CC=CC=C2
| PubChem CID | 8789 |
|---|---|
| CAS | 140-22-7 |
| Molecular Weight (g/mol) | 242.282 |
| ChEBI | CHEBI:4641 |
| MDL Number | MFCD00003013 |
| SMILES | C1=CC=C(C=C1)NNC(=O)NNC2=CC=CC=C2 |
| Synonym | 1,5-diphenylcarbazide,diphenylcarbazide,1,5-diphenylcarbohydrazide,carbonic dihydrazide, 2,2'-diphenyl,1,5-diphenylcarbonohydrazide,1,5-diphenylcabohydrazide,sym-diphenylcarbazide,n,n'-diphenylcarbazide,2,2'-diphenylcarbazide,carbohydrazide, 1,5-diphenyl |
| IUPAC Name | 1,3-dianilinourea |
| InChI Key | KSPIHGBHKVISFI-UHFFFAOYSA-N |
| Molecular Formula | C13H14N4O |
Ethylenediaminetetraacetic acid, (EDTA), 0.5M Solution, Molecular Biology Grade, Ultrapure
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.238 MDL Number: MFCD00150037 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)O)CC(=O)O.O.O.[Na+].[Na+]
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.238 |
| MDL Number | MFCD00150037 |
| SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)O)CC(=O)O.O.O.[Na+].[Na+] |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |