Acids
Organic and inorganic acids suitable for a wide variety of laboratory applications. Products are available in solid and liquid forms and in various pH values, quantities, reagent grades, and purities.
Acids are defined as substances that have a sour taste, a low pH (<7), and cause litmus paper to turn red. They also react with bases (yielding water and ionic compounds called salts) and produce hydrogen gas when used to dissolve metals such as zinc and iron.
Chemically, an acid is a molecule or ion that acts as a proton or hydrogen ion donor (Brønsted-Lowry acid) in a non-aqueous solution. In water, acids form hydronium ions (H3O+).
An acid is alternatively defined as a molecule or ion that accepts an electron pair (Lewis acid). One example is trifluoroborane, which has a boron atom capable of accepting an electron pair from ammonia (NH3) to form NH3-BF3.
Common inorganic acids include hydrochloric, sulfuric, nitric, and phosphoric acids. Common organic acids include acetic, benzoic, citric, and lactic acids.
In the laboratory, acids are used as reagents or catalysts in many types of chemical reactions.
Strong acids, such as sulfuric and hydrochloric acid, are highly corrosive and have extensive commercial applications.
- Sulfuric acid is used to process petroleum and minerals and to make other chemicals like nitric acid
- Hydrochloric acid is used to pickle steel and other metals
- Some acids are used as neutralizers to produce salts; for example, ammonium nitrate is produced by the reaction of nitric acid with ammonia
- Many acids are also used in the food and beverage industry
Do you need bulk and custom chemical solutions? Ask our Fisher Scientific Chemical Specialists.
Filtered Search Results
Sulfuric acid, 0.2N Standardized Solution
CAS: 7664-93-9 Molecular Formula: H2O4S Molecular Weight (g/mol): 98.07 MDL Number: MFCD00064589 InChI Key: QAOWNCQODCNURD-UHFFFAOYSA-N IUPAC Name: sulfuric acid SMILES: OS(O)(=O)=O
| CAS | 7664-93-9 |
|---|---|
| Molecular Weight (g/mol) | 98.07 |
| MDL Number | MFCD00064589 |
| SMILES | OS(O)(=O)=O |
| IUPAC Name | sulfuric acid |
| InChI Key | QAOWNCQODCNURD-UHFFFAOYSA-N |
| Molecular Formula | H2O4S |
| Linear Formula | HCl |
|---|---|
| Molecular Weight (g/mol) | 36.46 |
| ChEBI | CHEBI:17883 |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Density | 0.7400g/mL |
| PubChem CID | 313 |
| Name Note | 2N solution in diethyl ether |
| Fieser | 04,450; 05,533; 06,283 |
| Formula Weight | 36.45 |
| Color | Colorless |
| Physical Form | Liquid |
| Chemical Name or Material | Hydrochloric acid |
| Grade | Pure |
| SMILES | Cl |
| Merck Index | 10, 4701 |
| Concentration | 1.90 to 2.20N |
| CAS | 60-29-7 |
| Health Hazard 3 | GHS P Statement: Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Wear protective gloves/protective clothing/eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/physician. Do not breathe dust/fume/gas/mist/vapors/spray. Wash face, hands and any exposed skin thoroughly after handling. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| MDL Number | MFCD00011324 MFCD00792839 |
| Health Hazard 2 | GHS H Statement: Harmful if swallowed. Harmful if inhaled. Causes severe skin burns and eye damage. May cause drowsiness or dizziness. Extremely flammable liquid and vapor. May form explosive peroxides. Repeated exposure may cause skin dryness or cracking. |
| Solubility Information | Solubility in water: soluble. Other solubilities: soluble in most organic solvents |
| Flash Point | −40°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| Molecular Formula | ClH |
| Specific Gravity | 0.74 |
L(+)-Tartaric acid, EMSURE™ MilliporeSigma™
CAS: 87-69-4 Molecular Formula: C4H6O6 Molecular Weight (g/mol): 150.09 MDL Number: MFCD00064207 InChI Key: FEWJPZIEWOKRBE-UHFFFAOYNA-N Synonym: l-tartaric acid,l-+-tartaric acid,l +-tartaric acid,2r,3r-2,3-dihydroxysuccinic acid,tartaric acid,2r,3r-2,3-dihydroxybutanedioic acid,r,r-tartaric acid,+-l-tartaric acid,dextrotartaric acid,l-threaric acid PubChem CID: 444305 ChEBI: CHEBI:15671 IUPAC Name: 2,3-dihydroxybutanedioic acid SMILES: OC(C(O)C(O)=O)C(O)=O
| PubChem CID | 444305 |
|---|---|
| CAS | 87-69-4 |
| Molecular Weight (g/mol) | 150.09 |
| ChEBI | CHEBI:15671 |
| MDL Number | MFCD00064207 |
| SMILES | OC(C(O)C(O)=O)C(O)=O |
| Synonym | l-tartaric acid,l-+-tartaric acid,l +-tartaric acid,2r,3r-2,3-dihydroxysuccinic acid,tartaric acid,2r,3r-2,3-dihydroxybutanedioic acid,r,r-tartaric acid,+-l-tartaric acid,dextrotartaric acid,l-threaric acid |
| IUPAC Name | 2,3-dihydroxybutanedioic acid |
| InChI Key | FEWJPZIEWOKRBE-UHFFFAOYNA-N |
| Molecular Formula | C4H6O6 |
Hydrochloric Acid, 0.500 N in Methanol, Ricca Chemical
CAS: 67-56-1 Molecular Formula: ClH Molecular Weight (g/mol): 36.46 MDL Number: MFCD00011324 MFCD00792839 InChI Key: VEXZGXHMUGYJMC-UHFFFAOYSA-N Synonym: hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof IUPAC Name: hydrogen chloride SMILES: Cl
| CAS | 67-56-1 |
|---|---|
| Molecular Weight (g/mol) | 36.46 |
| MDL Number | MFCD00011324 MFCD00792839 |
| SMILES | Cl |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| IUPAC Name | hydrogen chloride |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Molecular Formula | ClH |
Citric acid, for molecular biology, anhydrous, Rnase and Protease free
CAS: 77-92-9 Molecular Formula: C6H8O7 Molecular Weight (g/mol): 192.12 MDL Number: MFCD00011669 InChI Key: KRKNYBCHXYNGOX-UHFFFAOYSA-N Synonym: citric acid,citric acid, anhydrous,citro,anhydrous citric acid,citrate,aciletten,citretten,chemfill,hydrocerol a,1,2,3-propanetricarboxylic acid, 2-hydroxy PubChem CID: 311 ChEBI: CHEBI:30769 IUPAC Name: 2-hydroxypropane-1,2,3-tricarboxylic acid SMILES: OC(=O)CC(O)(CC(O)=O)C(O)=O
| PubChem CID | 311 |
|---|---|
| CAS | 77-92-9 |
| Molecular Weight (g/mol) | 192.12 |
| ChEBI | CHEBI:30769 |
| MDL Number | MFCD00011669 |
| SMILES | OC(=O)CC(O)(CC(O)=O)C(O)=O |
| Synonym | citric acid,citric acid, anhydrous,citro,anhydrous citric acid,citrate,aciletten,citretten,chemfill,hydrocerol a,1,2,3-propanetricarboxylic acid, 2-hydroxy |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChI Key | KRKNYBCHXYNGOX-UHFFFAOYSA-N |
| Molecular Formula | C6H8O7 |
D-Gluconic acid, 50% aq. soln.
CAS: 526-95-4 Molecular Formula: C6H12O7 Molecular Weight (g/mol): 196.155 MDL Number: MFCD00004240 InChI Key: RGHNJXZEOKUKBD-SQOUGZDYSA-N Synonym: gluconic acid,d-gluconic acid,dextronic acid,maltonic acid,glycogenic acid,glosanto,gluconate,pentahydroxycaproic acid,gluconic acid, d,d-gluconate PubChem CID: 10690 ChEBI: CHEBI:33198 IUPAC Name: (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid SMILES: C(C(C(C(C(C(=O)O)O)O)O)O)O
| PubChem CID | 10690 |
|---|---|
| CAS | 526-95-4 |
| Molecular Weight (g/mol) | 196.155 |
| ChEBI | CHEBI:33198 |
| MDL Number | MFCD00004240 |
| SMILES | C(C(C(C(C(C(=O)O)O)O)O)O)O |
| Synonym | gluconic acid,d-gluconic acid,dextronic acid,maltonic acid,glycogenic acid,glosanto,gluconate,pentahydroxycaproic acid,gluconic acid, d,d-gluconate |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid |
| InChI Key | RGHNJXZEOKUKBD-SQOUGZDYSA-N |
| Molecular Formula | C6H12O7 |
Nitric Acid, Certified, 50% (v/v) ±1%, LabChem™
CAS: 7697-37-2 Molecular Formula: HNO3 Molecular Weight (g/mol): 63.01 MDL Number: MFCD00011349 InChI Key: GRYLNZFGIOXLOG-UHFFFAOYSA-N Synonym: hydrogen nitrate,aqua fortis,azotic acid,salpetersaeure,rfna,acidum nitricum,nital,acide nitrique,nitrous fumes,nitryl hydroxide PubChem CID: 944 ChEBI: CHEBI:48107 IUPAC Name: nitric acid SMILES: O[N+]([O-])=O
| PubChem CID | 944 |
|---|---|
| CAS | 7697-37-2 |
| Molecular Weight (g/mol) | 63.01 |
| ChEBI | CHEBI:48107 |
| MDL Number | MFCD00011349 |
| SMILES | O[N+]([O-])=O |
| Synonym | hydrogen nitrate,aqua fortis,azotic acid,salpetersaeure,rfna,acidum nitricum,nital,acide nitrique,nitrous fumes,nitryl hydroxide |
| IUPAC Name | nitric acid |
| InChI Key | GRYLNZFGIOXLOG-UHFFFAOYSA-N |
| Molecular Formula | HNO3 |
Sulfuric Acid, Certified, 0.200N ±0.002N (0.1M), LabChem™
CAS: 7664-93-9 Molecular Formula: H2O4S Molecular Weight (g/mol): 98.07 MDL Number: MFCD00064589 InChI Key: QAOWNCQODCNURD-UHFFFAOYSA-N Synonym: oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil PubChem CID: 1118 ChEBI: CHEBI:26836 IUPAC Name: sulfuric acid SMILES: OS(O)(=O)=O
| PubChem CID | 1118 |
|---|---|
| CAS | 7664-93-9 |
| Molecular Weight (g/mol) | 98.07 |
| ChEBI | CHEBI:26836 |
| MDL Number | MFCD00064589 |
| SMILES | OS(O)(=O)=O |
| Synonym | oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil |
| IUPAC Name | sulfuric acid |
| InChI Key | QAOWNCQODCNURD-UHFFFAOYSA-N |
| Molecular Formula | H2O4S |
Amidosulfonic acid, ACS, 99.3-100.3% (Assay dried basis)
CAS: 5329-14-6 Molecular Formula: H3NO3S Molecular Weight (g/mol): 97.088 MDL Number: MFCD00011603 InChI Key: IIACRCGMVDHOTQ-UHFFFAOYSA-N Synonym: amidosulfonic acid,amidosulfuric acid,aminosulfonic acid,imidosulfonic acid,sulfamidic acid,sulfaminic acid,sulphamic acid,jumbo,aminosulfuric acid,sulphamidic acid PubChem CID: 5987 ChEBI: CHEBI:9330 IUPAC Name: sulfamic acid SMILES: NS(=O)(=O)O
| PubChem CID | 5987 |
|---|---|
| CAS | 5329-14-6 |
| Molecular Weight (g/mol) | 97.088 |
| ChEBI | CHEBI:9330 |
| MDL Number | MFCD00011603 |
| SMILES | NS(=O)(=O)O |
| Synonym | amidosulfonic acid,amidosulfuric acid,aminosulfonic acid,imidosulfonic acid,sulfamidic acid,sulfaminic acid,sulphamic acid,jumbo,aminosulfuric acid,sulphamidic acid |
| IUPAC Name | sulfamic acid |
| InChI Key | IIACRCGMVDHOTQ-UHFFFAOYSA-N |
| Molecular Formula | H3NO3S |
L-(-)-Malic acid, 97%
CAS: 97-67-6 Molecular Formula: C4H6O5 Molecular Weight (g/mol): 134.087 MDL Number: MFCD00064213 InChI Key: BJEPYKJPYRNKOW-REOHCLBHSA-N Synonym: l-malic acid,l---malic acid,s-2-hydroxysuccinic acid,2s-2-hydroxybutanedioic acid,l--malic acid,apple acid,--malic acid,l-apple acid,s-malic acid,s-2-hydroxybutanedioic acid PubChem CID: 222656 ChEBI: CHEBI:30797 IUPAC Name: (2S)-2-hydroxybutanedioic acid SMILES: C(C(C(=O)O)O)C(=O)O
| PubChem CID | 222656 |
|---|---|
| CAS | 97-67-6 |
| Molecular Weight (g/mol) | 134.087 |
| ChEBI | CHEBI:30797 |
| MDL Number | MFCD00064213 |
| SMILES | C(C(C(=O)O)O)C(=O)O |
| Synonym | l-malic acid,l---malic acid,s-2-hydroxysuccinic acid,2s-2-hydroxybutanedioic acid,l--malic acid,apple acid,--malic acid,l-apple acid,s-malic acid,s-2-hydroxybutanedioic acid |
| IUPAC Name | (2S)-2-hydroxybutanedioic acid |
| InChI Key | BJEPYKJPYRNKOW-REOHCLBHSA-N |
| Molecular Formula | C4H6O5 |
Selenious acid, 99.999%, (trace metal basis)
CAS: 7783-00-8 Molecular Formula: H2O3Se Molecular Weight (g/mol): 128.98 MDL Number: MFCD00011331 InChI Key: MCAHWIHFGHIESP-UHFFFAOYSA-N Synonym: selenious acid,selenious acid h2seo3,monohydrated selenium dioxide,unii-f6a27p4q4r,selenium dioxide, monohydrated,ccris 5530,selenious acid usp,selenious acid,selenous acid,monohydrated selenium dioxide,selenium, reference standard solution PubChem CID: 1091 ChEBI: CHEBI:26642 IUPAC Name: selenous acid SMILES: O[Se](O)=O
| PubChem CID | 1091 |
|---|---|
| CAS | 7783-00-8 |
| Molecular Weight (g/mol) | 128.98 |
| ChEBI | CHEBI:26642 |
| MDL Number | MFCD00011331 |
| SMILES | O[Se](O)=O |
| Synonym | selenious acid,selenious acid h2seo3,monohydrated selenium dioxide,unii-f6a27p4q4r,selenium dioxide, monohydrated,ccris 5530,selenious acid usp,selenious acid,selenous acid,monohydrated selenium dioxide,selenium, reference standard solution |
| IUPAC Name | selenous acid |
| InChI Key | MCAHWIHFGHIESP-UHFFFAOYSA-N |
| Molecular Formula | H2O3Se |
Cyanuric acid, 98%
CAS: 108-80-5 Molecular Formula: C3H3N3O3 Molecular Weight (g/mol): 129.08 MDL Number: MFCD00082990 InChI Key: ZFSLODLOARCGLH-UHFFFAOYSA-N Synonym: cyanuric acid,isocyanuric acid,1,3,5-triazine-2,4,6-triol,trihydroxycyanidine,tricyanic acid,sym-triazinetriol,s-triazinetriol,1,3,5-triazine-2,4,6 1h,3h,5h-trione,pseudocyanuric acid,isocyanurate acid PubChem CID: 7956 ChEBI: CHEBI:38028 IUPAC Name: 1,3,5-triazinane-2,4,6-trione SMILES: O=C1NC(=O)NC(=O)N1
| PubChem CID | 7956 |
|---|---|
| CAS | 108-80-5 |
| Molecular Weight (g/mol) | 129.08 |
| ChEBI | CHEBI:38028 |
| MDL Number | MFCD00082990 |
| SMILES | O=C1NC(=O)NC(=O)N1 |
| Synonym | cyanuric acid,isocyanuric acid,1,3,5-triazine-2,4,6-triol,trihydroxycyanidine,tricyanic acid,sym-triazinetriol,s-triazinetriol,1,3,5-triazine-2,4,6 1h,3h,5h-trione,pseudocyanuric acid,isocyanurate acid |
| IUPAC Name | 1,3,5-triazinane-2,4,6-trione |
| InChI Key | ZFSLODLOARCGLH-UHFFFAOYSA-N |
| Molecular Formula | C3H3N3O3 |
Citric Acid, 10% (w/v) from USP grade material, Ricca Chemical
CAS: 7732-18-5 Molecular Formula: C6H8O7 Molecular Weight (g/mol): Mixture MDL Number: MFCD00011669 InChI Key: KRKNYBCHXYNGOX-UHFFFAOYSA-N Synonym: citric acid,citric acid, anhydrous,citro,anhydrous citric acid,citrate,aciletten,citretten,chemfill,hydrocerol a,1,2,3-propanetricarboxylic acid, 2-hydroxy PubChem CID: 311 ChEBI: CHEBI:30769 IUPAC Name: 2-hydroxypropane-1,2,3-tricarboxylic acid SMILES: OC(=O)CC(O)(CC(O)=O)C(O)=O
| PubChem CID | 311 |
|---|---|
| CAS | 7732-18-5 |
| Molecular Weight (g/mol) | Mixture |
| ChEBI | CHEBI:30769 |
| MDL Number | MFCD00011669 |
| SMILES | OC(=O)CC(O)(CC(O)=O)C(O)=O |
| Synonym | citric acid,citric acid, anhydrous,citro,anhydrous citric acid,citrate,aciletten,citretten,chemfill,hydrocerol a,1,2,3-propanetricarboxylic acid, 2-hydroxy |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChI Key | KRKNYBCHXYNGOX-UHFFFAOYSA-N |
| Molecular Formula | C6H8O7 |
Nitric Acid, 67-70%, OmniTrace Ultra, MilliporeSigma™
CAS: 7697-37-2 Molecular Formula: HNO3 Molecular Weight (g/mol): 63.01 MDL Number: MFCD00011349 InChI Key: GRYLNZFGIOXLOG-UHFFFAOYSA-N Synonym: hydrogen nitrate,aqua fortis,azotic acid,salpetersaeure,rfna,acidum nitricum,nital,acide nitrique,nitrous fumes,nitryl hydroxide PubChem CID: 944 ChEBI: CHEBI:48107 IUPAC Name: nitric acid SMILES: O[N+]([O-])=O
| PubChem CID | 944 |
|---|---|
| CAS | 7697-37-2 |
| Molecular Weight (g/mol) | 63.01 |
| ChEBI | CHEBI:48107 |
| MDL Number | MFCD00011349 |
| SMILES | O[N+]([O-])=O |
| Synonym | hydrogen nitrate,aqua fortis,azotic acid,salpetersaeure,rfna,acidum nitricum,nital,acide nitrique,nitrous fumes,nitryl hydroxide |
| IUPAC Name | nitric acid |
| InChI Key | GRYLNZFGIOXLOG-UHFFFAOYSA-N |
| Molecular Formula | HNO3 |
Acetic Acid, 50% (v/v), Ricca Chemical
CAS: 7732-18-5 Molecular Formula: C2H4O2 Molecular Weight (g/mol): Mixture MDL Number: MFCD00036152 InChI Key: QTBSBXVTEAMEQO-UHFFFAOYSA-N Synonym: ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure PubChem CID: 176 ChEBI: CHEBI:15366 IUPAC Name: acetic acid SMILES: CC(O)=O
| PubChem CID | 176 |
|---|---|
| CAS | 7732-18-5 |
| Molecular Weight (g/mol) | Mixture |
| ChEBI | CHEBI:15366 |
| MDL Number | MFCD00036152 |
| SMILES | CC(O)=O |
| Synonym | ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure |
| IUPAC Name | acetic acid |
| InChI Key | QTBSBXVTEAMEQO-UHFFFAOYSA-N |
| Molecular Formula | C2H4O2 |