Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Lithium acetylide ethylenediamine complex, tech. 85%, Thermo Scientific Chemicals
CAS: 6867-30-7 Molecular Formula: C4H9LiN2 Molecular Weight (g/mol): 92.07 MDL Number: MFCD00013183 InChI Key: QJQWXTYPTBEPGS-UHFFFAOYSA-N Synonym: lithium acetylide ethylenediamine complex,lithium acetylide, ethylenediamine complex,lithium; ethane-1,2-diamine; ethyne,1,2-ethanediamine compd. with lithium acetylide li c2h,lithium, 1,2-ethanediamine-kn1,kn2 ethynyl,1,2-ethanediamine, compd. with lithium acetylide li c2h 1:?,c2h8n2.c2hli,lithium acetylide, compd. with 1,2-ethanediamine,lithium acetylide, ethylene diamine complex 1:1,lithium acetylide, compound with ethane-1,2-diamine PubChem CID: 2724010 IUPAC Name: lithium;ethane-1,2-diamine;ethyne SMILES: [Li]C#C.NCCN
| PubChem CID | 2724010 |
|---|---|
| CAS | 6867-30-7 |
| Molecular Weight (g/mol) | 92.07 |
| MDL Number | MFCD00013183 |
| SMILES | [Li]C#C.NCCN |
| Synonym | lithium acetylide ethylenediamine complex,lithium acetylide, ethylenediamine complex,lithium; ethane-1,2-diamine; ethyne,1,2-ethanediamine compd. with lithium acetylide li c2h,lithium, 1,2-ethanediamine-kn1,kn2 ethynyl,1,2-ethanediamine, compd. with lithium acetylide li c2h 1:?,c2h8n2.c2hli,lithium acetylide, compd. with 1,2-ethanediamine,lithium acetylide, ethylene diamine complex 1:1,lithium acetylide, compound with ethane-1,2-diamine |
| IUPAC Name | lithium;ethane-1,2-diamine;ethyne |
| InChI Key | QJQWXTYPTBEPGS-UHFFFAOYSA-N |
| Molecular Formula | C4H9LiN2 |
Iodoacetic acid, 97+%
CAS: 64-69-7 Molecular Formula: C2H3IO2 Molecular Weight (g/mol): 185.948 MDL Number: MFCD00002685 InChI Key: JDNTWHVOXJZDSN-UHFFFAOYSA-N Synonym: iodoacetic acid,acetic acid, iodo,iodoacetate,monoiodoacetic acid,monoiodoacetate,monoiodine acetate,iodoaceticacid,iodoethanoic acid,acetic acid, 2-iodo,kyselina jodoctova PubChem CID: 5240 ChEBI: CHEBI:74571 IUPAC Name: 2-iodoacetic acid SMILES: C(C(=O)O)I
| PubChem CID | 5240 |
|---|---|
| CAS | 64-69-7 |
| Molecular Weight (g/mol) | 185.948 |
| ChEBI | CHEBI:74571 |
| MDL Number | MFCD00002685 |
| SMILES | C(C(=O)O)I |
| Synonym | iodoacetic acid,acetic acid, iodo,iodoacetate,monoiodoacetic acid,monoiodoacetate,monoiodine acetate,iodoaceticacid,iodoethanoic acid,acetic acid, 2-iodo,kyselina jodoctova |
| IUPAC Name | 2-iodoacetic acid |
| InChI Key | JDNTWHVOXJZDSN-UHFFFAOYSA-N |
| Molecular Formula | C2H3IO2 |
5,5-Diphenylhydantoin, 99%
CAS: 57-41-0 Molecular Formula: C15H12N2O2 Molecular Weight (g/mol): 252.273 MDL Number: MFCD00005264 InChI Key: CXOFVDLJLONNDW-UHFFFAOYSA-N Synonym: phenytoin,5,5-diphenylhydantoin,diphenylhydantoin,dilantin,phenytoine,dihydantoin,aleviatin,dilabid,diphantoin,diphenylan PubChem CID: 1775 ChEBI: CHEBI:8107 IUPAC Name: 5,5-diphenylimidazolidine-2,4-dione SMILES: C1=CC=C(C=C1)C2(C(=O)NC(=O)N2)C3=CC=CC=C3
| PubChem CID | 1775 |
|---|---|
| CAS | 57-41-0 |
| Molecular Weight (g/mol) | 252.273 |
| ChEBI | CHEBI:8107 |
| MDL Number | MFCD00005264 |
| SMILES | C1=CC=C(C=C1)C2(C(=O)NC(=O)N2)C3=CC=CC=C3 |
| Synonym | phenytoin,5,5-diphenylhydantoin,diphenylhydantoin,dilantin,phenytoine,dihydantoin,aleviatin,dilabid,diphantoin,diphenylan |
| IUPAC Name | 5,5-diphenylimidazolidine-2,4-dione |
| InChI Key | CXOFVDLJLONNDW-UHFFFAOYSA-N |
| Molecular Formula | C15H12N2O2 |
Isophorone diisocyanate, mixture of isomers, 98%
CAS: 4098-71-9 Molecular Formula: C12H18N2O2 Molecular Weight (g/mol): 222.29 MDL Number: MFCD00064956 InChI Key: NIMLQBUJDJZYEJ-UHFFFAOYNA-N Synonym: isophorone diisocyanate,ipdi,isophorone diamine diisocyanate,5-isocyanato-1-isocyanatomethyl-1,3,3-trimethylcyclohexane,3-isocyanatomethyl-3,5,5-trimethylcyclohexylisocyanate,cyclohexane, 5-isocyanato-1-isocyanatomethyl-1,3,3-trimethyl,3-isocyanatomethyl-3,5,5-trimethylcyclohexyl isocyanate,ccris 6252,isocyanic acid, methylene 3,5,5-trimethyl-3,1-cyclohexylene ester,isophorone diisocyanate diisocyanates PubChem CID: 169132 ChEBI: CHEBI:53214 IUPAC Name: 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane SMILES: CC1(C)CC(CC(C)(CN=C=O)C1)N=C=O
| PubChem CID | 169132 |
|---|---|
| CAS | 4098-71-9 |
| Molecular Weight (g/mol) | 222.29 |
| ChEBI | CHEBI:53214 |
| MDL Number | MFCD00064956 |
| SMILES | CC1(C)CC(CC(C)(CN=C=O)C1)N=C=O |
| Synonym | isophorone diisocyanate,ipdi,isophorone diamine diisocyanate,5-isocyanato-1-isocyanatomethyl-1,3,3-trimethylcyclohexane,3-isocyanatomethyl-3,5,5-trimethylcyclohexylisocyanate,cyclohexane, 5-isocyanato-1-isocyanatomethyl-1,3,3-trimethyl,3-isocyanatomethyl-3,5,5-trimethylcyclohexyl isocyanate,ccris 6252,isocyanic acid, methylene 3,5,5-trimethyl-3,1-cyclohexylene ester,isophorone diisocyanate diisocyanates |
| IUPAC Name | 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane |
| InChI Key | NIMLQBUJDJZYEJ-UHFFFAOYNA-N |
| Molecular Formula | C12H18N2O2 |
2,6-Dichloro-4-nitroaniline, 95%
CAS: 99-30-9 Molecular Formula: C6H4Cl2N2O2 Molecular Weight (g/mol): 207.01 MDL Number: MFCD00007677 InChI Key: BIXZHMJUSMUDOQ-UHFFFAOYSA-N Synonym: dichloran,dicloran,allisan,botran,dcna,ditranil,batran,bortran,resisan,dcna fungicide PubChem CID: 7430 ChEBI: CHEBI:27864 IUPAC Name: 2,6-dichloro-4-nitroaniline SMILES: C1=C(C=C(C(=C1Cl)N)Cl)[N+](=O)[O-]
| PubChem CID | 7430 |
|---|---|
| CAS | 99-30-9 |
| Molecular Weight (g/mol) | 207.01 |
| ChEBI | CHEBI:27864 |
| MDL Number | MFCD00007677 |
| SMILES | C1=C(C=C(C(=C1Cl)N)Cl)[N+](=O)[O-] |
| Synonym | dichloran,dicloran,allisan,botran,dcna,ditranil,batran,bortran,resisan,dcna fungicide |
| IUPAC Name | 2,6-dichloro-4-nitroaniline |
| InChI Key | BIXZHMJUSMUDOQ-UHFFFAOYSA-N |
| Molecular Formula | C6H4Cl2N2O2 |
Phenethyl alcohol, 99%
CAS: 60-12-8 Molecular Formula: C8H10O Molecular Weight (g/mol): 122.17 MDL Number: MFCD00002886 InChI Key: WRMNZCZEMHIOCP-UHFFFAOYSA-N Synonym: phenethyl alcohol,benzeneethanol,phenylethyl alcohol,benzyl carbinol,phenylethanol,phenethanol,2-phenylethyl alcohol,2-phenyl-ethanol,beta-phenylethanol,2-phenylethan-1-ol PubChem CID: 6054 ChEBI: CHEBI:49000 SMILES: OCCC1=CC=CC=C1
| PubChem CID | 6054 |
|---|---|
| CAS | 60-12-8 |
| Molecular Weight (g/mol) | 122.17 |
| ChEBI | CHEBI:49000 |
| MDL Number | MFCD00002886 |
| SMILES | OCCC1=CC=CC=C1 |
| Synonym | phenethyl alcohol,benzeneethanol,phenylethyl alcohol,benzyl carbinol,phenylethanol,phenethanol,2-phenylethyl alcohol,2-phenyl-ethanol,beta-phenylethanol,2-phenylethan-1-ol |
| InChI Key | WRMNZCZEMHIOCP-UHFFFAOYSA-N |
| Molecular Formula | C8H10O |
Sodium oxalate, 98.5%, extra pure
CAS: 62-76-0 Molecular Formula: C2Na2O4 Molecular Weight (g/mol): 134.00 MDL Number: MFCD00012465 InChI Key: ZNCPFRVNHGOPAG-UHFFFAOYSA-L Synonym: sodium oxalate,disodium oxalate,natriumoxalat,ethanedioic acid, disodium salt,oxalic acid, disodium salt,natriumoxalat german,stavelan sodny czech,oxalic acid disodium salt,unii-7u0v68lt9x,ethanedioic acid disodium salt PubChem CID: 6125 IUPAC Name: disodium;oxalate SMILES: [Na+].[Na+].[O-]C(=O)C([O-])=O
| PubChem CID | 6125 |
|---|---|
| CAS | 62-76-0 |
| Molecular Weight (g/mol) | 134.00 |
| MDL Number | MFCD00012465 |
| SMILES | [Na+].[Na+].[O-]C(=O)C([O-])=O |
| Synonym | sodium oxalate,disodium oxalate,natriumoxalat,ethanedioic acid, disodium salt,oxalic acid, disodium salt,natriumoxalat german,stavelan sodny czech,oxalic acid disodium salt,unii-7u0v68lt9x,ethanedioic acid disodium salt |
| IUPAC Name | disodium;oxalate |
| InChI Key | ZNCPFRVNHGOPAG-UHFFFAOYSA-L |
| Molecular Formula | C2Na2O4 |
alpha-Bisabolol, 96%
CAS: 515-69-5 Molecular Formula: C15H26O Molecular Weight (g/mol): 222.372 MDL Number: MFCD03846910 InChI Key: RGZSQWQPBWRIAQ-LSDHHAIUSA-N Synonym: bisabolol,alpha-bisabolol,+-alpha-bisabolol,d-alpha-bisabolol,.alpha.-bisabolol,+-1'r,2r-alpha-bisabolol,2r-6-methyl-2-1r-4-methylcyclohex-3-en-1-yl hept-5-en-2-ol,3-cyclohexene-1-methanol, .alpha.,4-dimethyl-.alpha.-4-methyl-3-pentenyl-, r*,r*,dsstox_cid_25964,dsstox_rid_81260 PubChem CID: 1549992 IUPAC Name: (2R)-6-methyl-2-[(1R)-4-methylcyclohex-3-en-1-yl]hept-5-en-2-ol SMILES: CC1=CCC(CC1)C(C)(CCC=C(C)C)O
| PubChem CID | 1549992 |
|---|---|
| CAS | 515-69-5 |
| Molecular Weight (g/mol) | 222.372 |
| MDL Number | MFCD03846910 |
| SMILES | CC1=CCC(CC1)C(C)(CCC=C(C)C)O |
| Synonym | bisabolol,alpha-bisabolol,+-alpha-bisabolol,d-alpha-bisabolol,.alpha.-bisabolol,+-1'r,2r-alpha-bisabolol,2r-6-methyl-2-1r-4-methylcyclohex-3-en-1-yl hept-5-en-2-ol,3-cyclohexene-1-methanol, .alpha.,4-dimethyl-.alpha.-4-methyl-3-pentenyl-, r*,r*,dsstox_cid_25964,dsstox_rid_81260 |
| IUPAC Name | (2R)-6-methyl-2-[(1R)-4-methylcyclohex-3-en-1-yl]hept-5-en-2-ol |
| InChI Key | RGZSQWQPBWRIAQ-LSDHHAIUSA-N |
| Molecular Formula | C15H26O |
trans-beta-Nitrostyrene, 97+%
CAS: 5153-67-3 Molecular Formula: C8H7NO2 Molecular Weight (g/mol): 149.15 MDL Number: MFCD00007402 InChI Key: PIAOLBVUVDXHHL-VOTSOKGWSA-N Synonym: trans-beta-nitrostyrene,2-nitrovinyl benzene,e-2-nitrovinyl benzene,beta-nitrostyrene,2-nitro-1-phenylethylene,e-beta-nitrostyrene,2-nitroethenyl benzene,1-phenyl-2-nitroethene,beta-nitrosytrene,benzene, 2-nitroethenyl PubChem CID: 5284459 IUPAC Name: [(E)-2-nitroethenyl]benzene SMILES: [O-][N+](=O)\C=C\C1=CC=CC=C1
| PubChem CID | 5284459 |
|---|---|
| CAS | 5153-67-3 |
| Molecular Weight (g/mol) | 149.15 |
| MDL Number | MFCD00007402 |
| SMILES | [O-][N+](=O)\C=C\C1=CC=CC=C1 |
| Synonym | trans-beta-nitrostyrene,2-nitrovinyl benzene,e-2-nitrovinyl benzene,beta-nitrostyrene,2-nitro-1-phenylethylene,e-beta-nitrostyrene,2-nitroethenyl benzene,1-phenyl-2-nitroethene,beta-nitrosytrene,benzene, 2-nitroethenyl |
| IUPAC Name | [(E)-2-nitroethenyl]benzene |
| InChI Key | PIAOLBVUVDXHHL-VOTSOKGWSA-N |
| Molecular Formula | C8H7NO2 |
2-Phenyl-2-imidazoline, 98+%, Thermo Scientific™
CAS: 936-49-2 Molecular Formula: C9H10N2 Molecular Weight (g/mol): 146.19 MDL Number: MFCD00005180 InChI Key: BKCCAYLNRIRKDJ-UHFFFAOYSA-N Synonym: 2-phenyl-2-imidazoline,2-phenylimidazoline,1h-imidazole, 4,5-dihydro-2-phenyl,2-imidazoline, 2-phenyl,4,5-dihydro-2-phenyl-1h-imidazole,2-phenyl imidazoline,2-phenyl-2-imidazolin,acmc-209rmt,labotest-bb lt00000058,5-23-06-00425 beilstein handbook reference PubChem CID: 13639 IUPAC Name: 2-phenyl-4,5-dihydro-1H-imidazole SMILES: C1CN=C(N1)C1=CC=CC=C1
| PubChem CID | 13639 |
|---|---|
| CAS | 936-49-2 |
| Molecular Weight (g/mol) | 146.19 |
| MDL Number | MFCD00005180 |
| SMILES | C1CN=C(N1)C1=CC=CC=C1 |
| Synonym | 2-phenyl-2-imidazoline,2-phenylimidazoline,1h-imidazole, 4,5-dihydro-2-phenyl,2-imidazoline, 2-phenyl,4,5-dihydro-2-phenyl-1h-imidazole,2-phenyl imidazoline,2-phenyl-2-imidazolin,acmc-209rmt,labotest-bb lt00000058,5-23-06-00425 beilstein handbook reference |
| IUPAC Name | 2-phenyl-4,5-dihydro-1H-imidazole |
| InChI Key | BKCCAYLNRIRKDJ-UHFFFAOYSA-N |
| Molecular Formula | C9H10N2 |
1,10-Phenanthroline iron(II) sulfate, 0.025M aq. soln.
CAS: 14634-91-4 Molecular Formula: C36H24FeN6O4S Molecular Weight (g/mol): 692.53 MDL Number: MFCD00036428 InChI Key: CIWXFRVOSDNDJZ-UHFFFAOYSA-L Synonym: ferroin,ferroin indicator solution,iron 2+ , tris 1,10-phenanthroline-.kappa.n1,.kappa.n10-, oc-6-11-, sulfate 1:1,ferroin sulfate,ferroin solution,1,10-phenanthroline ferrous sulfate,tris 1,10-phenanthroline-n1,n10 iron sulphate,ferrous 1,10-phenanthroline sulfate,ferroin indicator solution, 25 mmol/l,iron 2+ , tris 1,10-phenanthroline-kappan1,kappan10-, oc-6-11-, sulfate 1:1 PubChem CID: 84567 SMILES: [Fe++].[O-]S([O-])(=O)=O.C1=CN=C2C(C=CC3=CC=CN=C23)=C1.C1=CN=C2C(C=CC3=CC=CN=C23)=C1.C1=CN=C2C(C=CC3=CC=CN=C23)=C1
| PubChem CID | 84567 |
|---|---|
| CAS | 14634-91-4 |
| Molecular Weight (g/mol) | 692.53 |
| MDL Number | MFCD00036428 |
| SMILES | [Fe++].[O-]S([O-])(=O)=O.C1=CN=C2C(C=CC3=CC=CN=C23)=C1.C1=CN=C2C(C=CC3=CC=CN=C23)=C1.C1=CN=C2C(C=CC3=CC=CN=C23)=C1 |
| Synonym | ferroin,ferroin indicator solution,iron 2+ , tris 1,10-phenanthroline-.kappa.n1,.kappa.n10-, oc-6-11-, sulfate 1:1,ferroin sulfate,ferroin solution,1,10-phenanthroline ferrous sulfate,tris 1,10-phenanthroline-n1,n10 iron sulphate,ferrous 1,10-phenanthroline sulfate,ferroin indicator solution, 25 mmol/l,iron 2+ , tris 1,10-phenanthroline-kappan1,kappan10-, oc-6-11-, sulfate 1:1 |
| InChI Key | CIWXFRVOSDNDJZ-UHFFFAOYSA-L |
| Molecular Formula | C36H24FeN6O4S |
4-Methylbenzenesulfonhydrazide, 97%
CAS: 1576-35-8 Molecular Formula: C7H10N2O2S Molecular Weight (g/mol): 186.23 MDL Number: MFCD00007588 InChI Key: ICGLPKIVTVWCFT-UHFFFAOYSA-N Synonym: 4-methylbenzenesulfonhydrazide,p-toluenesulfonhydrazide,tosylhydrazine,p-toluenesulfonyl hydrazide,tosylhydrazide,p-tosylhydrazine,p-toluenesulfonylhydrazine,celogen tsh,ptsh,4-toluenesulfonyl hydrazide PubChem CID: 15303 SMILES: CC1=CC=C(C=C1)S(=O)(=O)NN
| PubChem CID | 15303 |
|---|---|
| CAS | 1576-35-8 |
| Molecular Weight (g/mol) | 186.23 |
| MDL Number | MFCD00007588 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NN |
| Synonym | 4-methylbenzenesulfonhydrazide,p-toluenesulfonhydrazide,tosylhydrazine,p-toluenesulfonyl hydrazide,tosylhydrazide,p-tosylhydrazine,p-toluenesulfonylhydrazine,celogen tsh,ptsh,4-toluenesulfonyl hydrazide |
| InChI Key | ICGLPKIVTVWCFT-UHFFFAOYSA-N |
| Molecular Formula | C7H10N2O2S |
Activated charcoal, NORIT™ GAC 1240, 12-40 mesh
CAS: 7440-44-0 Molecular Formula: C Molecular Weight (g/mol): 12 MDL Number: MFCD00133992 InChI Key: OKTJSMMVPCPJKN-UHFFFAOYSA-N Synonym: graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve PubChem CID: 5462310 ChEBI: CHEBI:27594 IUPAC Name: carbon SMILES: [C]
| PubChem CID | 5462310 |
|---|---|
| CAS | 7440-44-0 |
| Molecular Weight (g/mol) | 12 |
| ChEBI | CHEBI:27594 |
| MDL Number | MFCD00133992 |
| SMILES | [C] |
| Synonym | graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve |
| IUPAC Name | carbon |
| InChI Key | OKTJSMMVPCPJKN-UHFFFAOYSA-N |
| Molecular Formula | C |
Poly(methylhydrosiloxane), trimethylsilyl terminated
CAS: 63148-57-2 Molecular Formula: (CH4OSi)n MDL Number: MFCD00084478 InChI Key: QNWOFLWXQGHSRH-UHFFFAOYSA-N SMILES: C[SiH](O[Si](C)(C)C)O[Si](C)(C)C
| CAS | 63148-57-2 |
|---|---|
| MDL Number | MFCD00084478 |
| SMILES | C[SiH](O[Si](C)(C)C)O[Si](C)(C)C |
| InChI Key | QNWOFLWXQGHSRH-UHFFFAOYSA-N |
| Molecular Formula | (CH4OSi)n |
Thermo Scientific Chemicals Rosuvastatin, sodium salt, 97%
CAS: 147098-18-8 Molecular Formula: C22H27FN3NaO6S Molecular Weight (g/mol): 503.53 InChI Key: RGEBGDYYHAFODH-GBNZRNLASA-M Synonym: rosuvastatin sodium PubChem CID: 131632367 IUPAC Name: sodium;(3R,5S)-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-3,5-dihydroxyhept-6-enoate SMILES: CC(C)C1=NC(=NC(=C1C=CC(CC(CC(=O)[O-])O)O)C2=CC=C(C=C2)F)N(C)S(=O)(=O)C.[Na+]
| PubChem CID | 131632367 |
|---|---|
| CAS | 147098-18-8 |
| Molecular Weight (g/mol) | 503.53 |
| SMILES | CC(C)C1=NC(=NC(=C1C=CC(CC(CC(=O)[O-])O)O)C2=CC=C(C=C2)F)N(C)S(=O)(=O)C.[Na+] |
| Synonym | rosuvastatin sodium |
| IUPAC Name | sodium;(3R,5S)-7-[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]-3,5-dihydroxyhept-6-enoate |
| InChI Key | RGEBGDYYHAFODH-GBNZRNLASA-M |
| Molecular Formula | C22H27FN3NaO6S |