Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
tert-Butylhydroquinone, 97%
CAS: 1948-33-0 Molecular Formula: C10H14O2 Molecular Weight (g/mol): 166.22 MDL Number: MFCD00002344 InChI Key: BGNXCDMCOKJUMV-UHFFFAOYSA-N Synonym: tert-butylhydroquinone,tbhq,2-tert-butylhydroquinone,t-butylhydroquinone,mtbhq,t-butyl hydroquinone,2-tert-butyl-1,4-benzenediol,2-t-butylhydroquinone,mono-tert-butylhydroquinone,sustane PubChem CID: 16043 ChEBI: CHEBI:78886 IUPAC Name: 2-tert-butylbenzene-1,4-diol SMILES: CC(C)(C)C1=C(C=CC(=C1)O)O
| PubChem CID | 16043 |
|---|---|
| CAS | 1948-33-0 |
| Molecular Weight (g/mol) | 166.22 |
| ChEBI | CHEBI:78886 |
| MDL Number | MFCD00002344 |
| SMILES | CC(C)(C)C1=C(C=CC(=C1)O)O |
| Synonym | tert-butylhydroquinone,tbhq,2-tert-butylhydroquinone,t-butylhydroquinone,mtbhq,t-butyl hydroquinone,2-tert-butyl-1,4-benzenediol,2-t-butylhydroquinone,mono-tert-butylhydroquinone,sustane |
| IUPAC Name | 2-tert-butylbenzene-1,4-diol |
| InChI Key | BGNXCDMCOKJUMV-UHFFFAOYSA-N |
| Molecular Formula | C10H14O2 |
Cinnamyl chloride, 95% trans
CAS: 2687-12-9 Molecular Formula: C9H9Cl Molecular Weight (g/mol): 152.62 MDL Number: MFCD00000986 InChI Key: IWTYTFSSTWXZFU-QPJJXVBHSA-N Synonym: cinnamyl chloride,3-chloroprop-1-en-1-yl benzene,3-chloro-1-phenyl-1-propene,trans-cinnamyl chloride,1e-3-chloroprop-1-en-1-yl benzene,benzene, 3-chloropropenyl,e-3-chloroprop-1-enyl benzene,unii-2i1adl56tx,2i1adl56tx,cinnamylchloride PubChem CID: 639658 IUPAC Name: [(E)-3-chloroprop-1-enyl]benzene SMILES: C1=CC=C(C=C1)C=CCCl
| PubChem CID | 639658 |
|---|---|
| CAS | 2687-12-9 |
| Molecular Weight (g/mol) | 152.62 |
| MDL Number | MFCD00000986 |
| SMILES | C1=CC=C(C=C1)C=CCCl |
| Synonym | cinnamyl chloride,3-chloroprop-1-en-1-yl benzene,3-chloro-1-phenyl-1-propene,trans-cinnamyl chloride,1e-3-chloroprop-1-en-1-yl benzene,benzene, 3-chloropropenyl,e-3-chloroprop-1-enyl benzene,unii-2i1adl56tx,2i1adl56tx,cinnamylchloride |
| IUPAC Name | [(E)-3-chloroprop-1-enyl]benzene |
| InChI Key | IWTYTFSSTWXZFU-QPJJXVBHSA-N |
| Molecular Formula | C9H9Cl |
| CAS | 66905-23-5 |
|---|---|
| MDL Number | MFCD00064209 |
Tris(hydroxymethyl)aminomethane Acetate 99.0+%, TCI America™
CAS: 6850-28-8 Molecular Formula: C6H15NO5 Molecular Weight (g/mol): 181.188 MDL Number: MFCD00038951 InChI Key: PIEPQKCYPFFYMG-UHFFFAOYSA-N Synonym: tris hydroxymethyl aminomethane acetate,tris acetate,tris acetate salt,2-amino-2-hydroxymethyl propane-1,3-diol acetate salt,trizma acetate,tris hydroxymethyl aminomethane acetate salt,2-hydroxy-1,1-bis hydroxymethyl ethyl ammonium acetate,1,3-dihydroxy-2-hydroxymethyl propan-2-aminium acetate,acetic acid; tris buffer,tris-acetate PubChem CID: 16218782 ChEBI: CHEBI:66869 IUPAC Name: acetic acid;2-amino-2-(hydroxymethyl)propane-1,3-diol SMILES: CC(=O)O.C(C(CO)(CO)N)O
| PubChem CID | 16218782 |
|---|---|
| CAS | 6850-28-8 |
| Molecular Weight (g/mol) | 181.188 |
| ChEBI | CHEBI:66869 |
| MDL Number | MFCD00038951 |
| SMILES | CC(=O)O.C(C(CO)(CO)N)O |
| Synonym | tris hydroxymethyl aminomethane acetate,tris acetate,tris acetate salt,2-amino-2-hydroxymethyl propane-1,3-diol acetate salt,trizma acetate,tris hydroxymethyl aminomethane acetate salt,2-hydroxy-1,1-bis hydroxymethyl ethyl ammonium acetate,1,3-dihydroxy-2-hydroxymethyl propan-2-aminium acetate,acetic acid; tris buffer,tris-acetate |
| IUPAC Name | acetic acid;2-amino-2-(hydroxymethyl)propane-1,3-diol |
| InChI Key | PIEPQKCYPFFYMG-UHFFFAOYSA-N |
| Molecular Formula | C6H15NO5 |
| CAS | 64742-48-9 |
|---|
4-Vinylpyridine, 96%, low polymer, stab. with 100ppm hydroquinone
CAS: 100-43-6 Molecular Formula: C7H7N Molecular Weight (g/mol): 105.14 MDL Number: MFCD00006447 InChI Key: KFDVPJUYSDEJTH-UHFFFAOYSA-N Synonym: 4-vinylpyridine,pyridine, 4-ethenyl,pyridine, 4-vinyl,gamma-vinylpyridine,unii-i56g67xm8d,ccris 5240,4vp,4-pyridylethylene,4-vinyl-pyridine,4-vinyl pyridine PubChem CID: 7502 IUPAC Name: 4-ethenylpyridine SMILES: C=CC1=CC=NC=C1
| PubChem CID | 7502 |
|---|---|
| CAS | 100-43-6 |
| Molecular Weight (g/mol) | 105.14 |
| MDL Number | MFCD00006447 |
| SMILES | C=CC1=CC=NC=C1 |
| Synonym | 4-vinylpyridine,pyridine, 4-ethenyl,pyridine, 4-vinyl,gamma-vinylpyridine,unii-i56g67xm8d,ccris 5240,4vp,4-pyridylethylene,4-vinyl-pyridine,4-vinyl pyridine |
| IUPAC Name | 4-ethenylpyridine |
| InChI Key | KFDVPJUYSDEJTH-UHFFFAOYSA-N |
| Molecular Formula | C7H7N |
Polydimethylsiloxane, trimethylsiloxy terminated, M.W. 770
CAS: 9016-00-6 Molecular Formula: (C2H6OSi)n Molecular Weight (g/mol): 74.15 MDL Number: MFCD00084411 InChI Key: SEUDSDUUJXTXSV-UHFFFAOYSA-N IUPAC Name: dimethylsilanone SMILES: C[Si](C)(-*)O-*
| CAS | 9016-00-6 |
|---|---|
| Molecular Weight (g/mol) | 74.15 |
| MDL Number | MFCD00084411 |
| SMILES | C[Si](C)(-*)O-* |
| IUPAC Name | dimethylsilanone |
| InChI Key | SEUDSDUUJXTXSV-UHFFFAOYSA-N |
| Molecular Formula | (C2H6OSi)n |
2-Mercaptoethanol, 98+%
CAS: 60-24-2 Molecular Formula: C2H6OS Molecular Weight (g/mol): 78.13 MDL Number: MFCD00004890 InChI Key: DGVVWUTYPXICAM-UHFFFAOYSA-N Synonym: 2-mercaptoethanol,mercaptoethanol,thioglycol,beta-mercaptoethanol,ethanol, 2-mercapto,2-thioethanol,2-hydroxy-1-ethanethiol,thioethylene glycol,2-hydroxyethanethiol,2-hydroxyethyl mercaptan PubChem CID: 1567 ChEBI: CHEBI:41218 SMILES: OCCS
| PubChem CID | 1567 |
|---|---|
| CAS | 60-24-2 |
| Molecular Weight (g/mol) | 78.13 |
| ChEBI | CHEBI:41218 |
| MDL Number | MFCD00004890 |
| SMILES | OCCS |
| Synonym | 2-mercaptoethanol,mercaptoethanol,thioglycol,beta-mercaptoethanol,ethanol, 2-mercapto,2-thioethanol,2-hydroxy-1-ethanethiol,thioethylene glycol,2-hydroxyethanethiol,2-hydroxyethyl mercaptan |
| InChI Key | DGVVWUTYPXICAM-UHFFFAOYSA-N |
| Molecular Formula | C2H6OS |
3-Phenylphenol, 90%
CAS: 580-51-8 Molecular Formula: C12H10O Molecular Weight (g/mol): 170.21 MDL Number: MFCD00002294 InChI Key: UBXYXCRCOKCZIT-UHFFFAOYSA-N Synonym: 3-hydroxybiphenyl,1,1'-biphenyl-3-ol,biphenyl-3-ol,m-phenylphenol,m-hydroxydiphenyl,3-biphenylol,m-hydroxybiphenyl,3-hydroxydiphenyl,3-phenyl phenol,unii-zu11x47h4o PubChem CID: 11381 ChEBI: CHEBI:34338 IUPAC Name: 3-phenylphenol SMILES: OC1=CC=CC(=C1)C1=CC=CC=C1
| PubChem CID | 11381 |
|---|---|
| CAS | 580-51-8 |
| Molecular Weight (g/mol) | 170.21 |
| ChEBI | CHEBI:34338 |
| MDL Number | MFCD00002294 |
| SMILES | OC1=CC=CC(=C1)C1=CC=CC=C1 |
| Synonym | 3-hydroxybiphenyl,1,1'-biphenyl-3-ol,biphenyl-3-ol,m-phenylphenol,m-hydroxydiphenyl,3-biphenylol,m-hydroxybiphenyl,3-hydroxydiphenyl,3-phenyl phenol,unii-zu11x47h4o |
| IUPAC Name | 3-phenylphenol |
| InChI Key | UBXYXCRCOKCZIT-UHFFFAOYSA-N |
| Molecular Formula | C12H10O |
2-Methylbutane, 99+%, for spectroscopy
CAS: 78-78-4 Molecular Formula: C5H12 Molecular Weight (g/mol): 72.15 MDL Number: MFCD00009338 InChI Key: QWTDNUCVQCZILF-UHFFFAOYSA-N Synonym: isopentane,isoamylhydride,butane, 2-methyl,dimethylethylmethane,ethyldimethylmethane,1,1,2-trimethylethane,iso-pentane,1,1-dimethylpropane,butanes,iso-c5h12 PubChem CID: 6556 ChEBI: CHEBI:30362 IUPAC Name: 2-methylbutane SMILES: CCC(C)C
| PubChem CID | 6556 |
|---|---|
| CAS | 78-78-4 |
| Molecular Weight (g/mol) | 72.15 |
| ChEBI | CHEBI:30362 |
| MDL Number | MFCD00009338 |
| SMILES | CCC(C)C |
| Synonym | isopentane,isoamylhydride,butane, 2-methyl,dimethylethylmethane,ethyldimethylmethane,1,1,2-trimethylethane,iso-pentane,1,1-dimethylpropane,butanes,iso-c5h12 |
| IUPAC Name | 2-methylbutane |
| InChI Key | QWTDNUCVQCZILF-UHFFFAOYSA-N |
| Molecular Formula | C5H12 |
Chloroquine diphosphate salt, 98%
CAS: 50-63-5 Molecular Formula: C18H32ClN3O8P2 Molecular Weight (g/mol): 515.86 MDL Number: MFCD00069852 InChI Key: QKICWELGRMTQCR-UHFFFAOYNA-N Synonym: chloroquine diphosphate,chloroquine phosphate,aralen phosphate,chingamin phosphate,chloroquine bis phosphate,chingaminum,alermine,h-stadur,aralen diphosphate,miniquine PubChem CID: 64927 SMILES: OP(O)(O)=O.OP(O)(O)=O.CCN(CC)CCCC(C)NC1=C2C=CC(Cl)=CC2=NC=C1
| PubChem CID | 64927 |
|---|---|
| CAS | 50-63-5 |
| Molecular Weight (g/mol) | 515.86 |
| MDL Number | MFCD00069852 |
| SMILES | OP(O)(O)=O.OP(O)(O)=O.CCN(CC)CCCC(C)NC1=C2C=CC(Cl)=CC2=NC=C1 |
| Synonym | chloroquine diphosphate,chloroquine phosphate,aralen phosphate,chingamin phosphate,chloroquine bis phosphate,chingaminum,alermine,h-stadur,aralen diphosphate,miniquine |
| InChI Key | QKICWELGRMTQCR-UHFFFAOYNA-N |
| Molecular Formula | C18H32ClN3O8P2 |
Methyl 4-(aminomethyl)benzoate hydrochloride, 97%
CAS: 6232-11-7 Molecular Formula: C9H11NO2·ClH Molecular Weight (g/mol): 201.65 MDL Number: MFCD00182671 InChI Key: GIZCKBSSWNIUMZ-UHFFFAOYSA-N Synonym: methyl 4-aminomethyl benzoate hydrochloride,methyl 4-aminomethylbenzoate hydrochloride,methyl-4-aminomethyl benzoate hydrochloride,methyl 4-aminomethylbenzoate hcl,methyl 4-aminomethyl benzoate, hcl,4-aminomethyl benzoic acid methyl ester hydrochloride,methyl4-aminomethyl benzoatehydrochloride,methyl 4-aminomethyl-benzoate hydrochloride,4-aminomethyl benzoic acid methyl ester hcl,4-aminomethylbenzoic acid methyl ester hydrochloride PubChem CID: 2729253 IUPAC Name: methyl 4-(aminomethyl)benzoate;hydrochloride SMILES: COC(=O)C1=CC=C(C=C1)CN.Cl
| PubChem CID | 2729253 |
|---|---|
| CAS | 6232-11-7 |
| Molecular Weight (g/mol) | 201.65 |
| MDL Number | MFCD00182671 |
| SMILES | COC(=O)C1=CC=C(C=C1)CN.Cl |
| Synonym | methyl 4-aminomethyl benzoate hydrochloride,methyl 4-aminomethylbenzoate hydrochloride,methyl-4-aminomethyl benzoate hydrochloride,methyl 4-aminomethylbenzoate hcl,methyl 4-aminomethyl benzoate, hcl,4-aminomethyl benzoic acid methyl ester hydrochloride,methyl4-aminomethyl benzoatehydrochloride,methyl 4-aminomethyl-benzoate hydrochloride,4-aminomethyl benzoic acid methyl ester hcl,4-aminomethylbenzoic acid methyl ester hydrochloride |
| IUPAC Name | methyl 4-(aminomethyl)benzoate;hydrochloride |
| InChI Key | GIZCKBSSWNIUMZ-UHFFFAOYSA-N |
| Molecular Formula | C9H11NO2·ClH |
Copper(II) Trifluoromethanesulfonate 98.0+%, TCI America™
CAS: 34946-82-2 Molecular Formula: CHCuF3O3S Molecular Weight (g/mol): 213.617 MDL Number: MFCD00077492 InChI Key: GZWXEFRPSWBAGC-UHFFFAOYSA-N Synonym: copper; trifluoromethanesulfonic acid PubChem CID: 45051791 IUPAC Name: copper;trifluoromethanesulfonic acid SMILES: C(F)(F)(F)S(=O)(=O)O.[Cu]
| PubChem CID | 45051791 |
|---|---|
| CAS | 34946-82-2 |
| Molecular Weight (g/mol) | 213.617 |
| MDL Number | MFCD00077492 |
| SMILES | C(F)(F)(F)S(=O)(=O)O.[Cu] |
| Synonym | copper; trifluoromethanesulfonic acid |
| IUPAC Name | copper;trifluoromethanesulfonic acid |
| InChI Key | GZWXEFRPSWBAGC-UHFFFAOYSA-N |
| Molecular Formula | CHCuF3O3S |
3-Hydroxyphenylacetic acid, 99%
CAS: 621-37-4 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.15 MDL Number: MFCD00004337 InChI Key: FVMDYYGIDFPZAX-UHFFFAOYSA-N Synonym: 3-hydroxyphenylacetic acid,2-3-hydroxyphenyl acetic acid,3-hydroxyphenyl acetic acid,3-hydroxybenzeneacetic acid,3-hydroxyphenylacetate,m-hydroxyphenylacetic acid,m-hydroxyphenyl acetic acid,benzeneacetic acid, 3-hydroxy,metahydroxy phenylacetic acid,acetic acid, m-hydroxyphenyl PubChem CID: 12122 ChEBI: CHEBI:17445 IUPAC Name: 2-(3-hydroxyphenyl)acetic acid SMILES: OC(=O)CC1=CC=CC(O)=C1
| PubChem CID | 12122 |
|---|---|
| CAS | 621-37-4 |
| Molecular Weight (g/mol) | 152.15 |
| ChEBI | CHEBI:17445 |
| MDL Number | MFCD00004337 |
| SMILES | OC(=O)CC1=CC=CC(O)=C1 |
| Synonym | 3-hydroxyphenylacetic acid,2-3-hydroxyphenyl acetic acid,3-hydroxyphenyl acetic acid,3-hydroxybenzeneacetic acid,3-hydroxyphenylacetate,m-hydroxyphenylacetic acid,m-hydroxyphenyl acetic acid,benzeneacetic acid, 3-hydroxy,metahydroxy phenylacetic acid,acetic acid, m-hydroxyphenyl |
| IUPAC Name | 2-(3-hydroxyphenyl)acetic acid |
| InChI Key | FVMDYYGIDFPZAX-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |
Hydrogen fluoride pyridine complex, ca 70% HF, Thermo Scientific Chemicals
CAS: 62778-11-4 Molecular Formula: C5H6FN Molecular Weight (g/mol): 99.108 MDL Number: MFCD00012436 InChI Key: GRJJQCWNZGRKAU-UHFFFAOYSA-N Synonym: pyridine hydrofluoride,hydrogen fluoride-pyridine,olah's reagent,pyridinium fluoride,hydrogen fluoride pyridine complex,hydrogen fluoride pyridine,hf-pyridine,pyridine, hydrofluoride 1:1,pyridinium poly hydrogen fluoride,hydrogen fluoride/pyridine PubChem CID: 64774 IUPAC Name: pyridine;hydrofluoride SMILES: C1=CC=NC=C1.F
| PubChem CID | 64774 |
|---|---|
| CAS | 62778-11-4 |
| Molecular Weight (g/mol) | 99.108 |
| MDL Number | MFCD00012436 |
| SMILES | C1=CC=NC=C1.F |
| Synonym | pyridine hydrofluoride,hydrogen fluoride-pyridine,olah's reagent,pyridinium fluoride,hydrogen fluoride pyridine complex,hydrogen fluoride pyridine,hf-pyridine,pyridine, hydrofluoride 1:1,pyridinium poly hydrogen fluoride,hydrogen fluoride/pyridine |
| IUPAC Name | pyridine;hydrofluoride |
| InChI Key | GRJJQCWNZGRKAU-UHFFFAOYSA-N |
| Molecular Formula | C5H6FN |