Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Bis(2-ethylhexyl) phosphate, 95%
CAS: 298-07-7 Molecular Formula: C16H35O4P Molecular Weight (g/mol): 322.43 MDL Number: MFCD00009492 InChI Key: SEGLCEQVOFDUPX-UHFFFAOYNA-N Synonym: bis 2-ethylhexyl hydrogen phosphate,bis 2-ethylhexyl phosphate,hdehp,di 2-ethylhexyl phosphate,dehpa extractant,di 2-ethylhexyl phosphoric acid,escaid 100,d 2ehpa,bis 2-ethylhexyl phosphoric acid PubChem CID: 9275 IUPAC Name: bis(2-ethylhexyl) hydrogen phosphate SMILES: CCCCC(CC)COP(O)(=O)OCC(CC)CCCC
| PubChem CID | 9275 |
|---|---|
| CAS | 298-07-7 |
| Molecular Weight (g/mol) | 322.43 |
| MDL Number | MFCD00009492 |
| SMILES | CCCCC(CC)COP(O)(=O)OCC(CC)CCCC |
| Synonym | bis 2-ethylhexyl hydrogen phosphate,bis 2-ethylhexyl phosphate,hdehp,di 2-ethylhexyl phosphate,dehpa extractant,di 2-ethylhexyl phosphoric acid,escaid 100,d 2ehpa,bis 2-ethylhexyl phosphoric acid |
| IUPAC Name | bis(2-ethylhexyl) hydrogen phosphate |
| InChI Key | SEGLCEQVOFDUPX-UHFFFAOYNA-N |
| Molecular Formula | C16H35O4P |
Zirconium(IV) tert-butoxide, 99.99% (metals basis), Thermo Scientific Chemicals
CAS: 2081-12-1 Molecular Formula: C16H40O4Zr Molecular Weight (g/mol): 387.72 MDL Number: MFCD00075085 InChI Key: WRMYASGYMABHCC-UHFFFAOYSA-N Synonym: zirconium iv tert-butoxide,2-methylpropan-2-ol; zirconium PubChem CID: 25203936 IUPAC Name: 2-methylpropan-2-ol;zirconium SMILES: CC(C)(C)O.CC(C)(C)O.CC(C)(C)O.CC(C)(C)O.[Zr]
| PubChem CID | 25203936 |
|---|---|
| CAS | 2081-12-1 |
| Molecular Weight (g/mol) | 387.72 |
| MDL Number | MFCD00075085 |
| SMILES | CC(C)(C)O.CC(C)(C)O.CC(C)(C)O.CC(C)(C)O.[Zr] |
| Synonym | zirconium iv tert-butoxide,2-methylpropan-2-ol; zirconium |
| IUPAC Name | 2-methylpropan-2-ol;zirconium |
| InChI Key | WRMYASGYMABHCC-UHFFFAOYSA-N |
| Molecular Formula | C16H40O4Zr |
Methyl Acrylate (stabilized with MEHQ) 99.0+%, TCI America™
CAS: 96-33-3 Molecular Formula: C4H6O2 Molecular Weight (g/mol): 86.09 MDL Number: MFCD00008627 InChI Key: BAPJBEWLBFYGME-UHFFFAOYSA-N Synonym: methyl acrylate,methylacrylate,acrylic acid methyl ester,2-propenoic acid, methyl ester,methyl 2-propenoate,methyl propenoate,methylacrylaat,metilacrilato,methyl-acrylat,methoxycarbonylethylene PubChem CID: 7294 ChEBI: CHEBI:82482 IUPAC Name: methyl prop-2-enoate SMILES: COC(=O)C=C
| PubChem CID | 7294 |
|---|---|
| CAS | 96-33-3 |
| Molecular Weight (g/mol) | 86.09 |
| ChEBI | CHEBI:82482 |
| MDL Number | MFCD00008627 |
| SMILES | COC(=O)C=C |
| Synonym | methyl acrylate,methylacrylate,acrylic acid methyl ester,2-propenoic acid, methyl ester,methyl 2-propenoate,methyl propenoate,methylacrylaat,metilacrilato,methyl-acrylat,methoxycarbonylethylene |
| IUPAC Name | methyl prop-2-enoate |
| InChI Key | BAPJBEWLBFYGME-UHFFFAOYSA-N |
| Molecular Formula | C4H6O2 |
Thermo Scientific Chemicals D-(+)-Xylose, 98+%
CAS: 58-86-6 Molecular Formula: C5H10O5 MDL Number: MFCD00151475
| CAS | 58-86-6 |
|---|---|
| MDL Number | MFCD00151475 |
| Molecular Formula | C5H10O5 |
m-Phenylenediamine, 99+%
CAS: 108-45-2 Molecular Formula: C6H8N2 Molecular Weight (g/mol): 108.14 MDL Number: MFCD00007799 InChI Key: WZCQRUWWHSTZEM-UHFFFAOYSA-N Synonym: m-phenylenediamine,1,3-phenylenediamine,1,3-diaminobenzene,1,3-benzenediamine,m-diaminobenzene,3-aminoaniline,m-aminoaniline,meta-phenylenediamine,developer c,3-phenylenediamine PubChem CID: 7935 ChEBI: CHEBI:8092 IUPAC Name: benzene-1,3-diamine SMILES: C1=CC(=CC(=C1)N)N
| PubChem CID | 7935 |
|---|---|
| CAS | 108-45-2 |
| Molecular Weight (g/mol) | 108.14 |
| ChEBI | CHEBI:8092 |
| MDL Number | MFCD00007799 |
| SMILES | C1=CC(=CC(=C1)N)N |
| Synonym | m-phenylenediamine,1,3-phenylenediamine,1,3-diaminobenzene,1,3-benzenediamine,m-diaminobenzene,3-aminoaniline,m-aminoaniline,meta-phenylenediamine,developer c,3-phenylenediamine |
| IUPAC Name | benzene-1,3-diamine |
| InChI Key | WZCQRUWWHSTZEM-UHFFFAOYSA-N |
| Molecular Formula | C6H8N2 |
Tetra-n-hexylammonium perchlorate
CAS: 4656-81-9 Molecular Formula: C24H52ClNO4 Molecular Weight (g/mol): 454.13 MDL Number: MFCD00043185 InChI Key: RLCKPGXHGKSGOS-UHFFFAOYSA-M Synonym: tetra-n-hexylammonium perchlorate,tetrahexylammonium perchlorate,tetrahexylazanium perchlorate,1-hexanaminium, n,n,n-trihexyl-, perchlorate,n,n,n-trihexylhexan-1-aminiumperchlorate,1-hexanaminium, n,n,n-trihexyl-, perchlorate 1:1,tetra-n-hexyl ammonium perchlorate PubChem CID: 78388 SMILES: [O-][Cl](=O)(=O)=O.CCCCCC[N+](CCCCCC)(CCCCCC)CCCCCC
| PubChem CID | 78388 |
|---|---|
| CAS | 4656-81-9 |
| Molecular Weight (g/mol) | 454.13 |
| MDL Number | MFCD00043185 |
| SMILES | [O-][Cl](=O)(=O)=O.CCCCCC[N+](CCCCCC)(CCCCCC)CCCCCC |
| Synonym | tetra-n-hexylammonium perchlorate,tetrahexylammonium perchlorate,tetrahexylazanium perchlorate,1-hexanaminium, n,n,n-trihexyl-, perchlorate,n,n,n-trihexylhexan-1-aminiumperchlorate,1-hexanaminium, n,n,n-trihexyl-, perchlorate 1:1,tetra-n-hexyl ammonium perchlorate |
| InChI Key | RLCKPGXHGKSGOS-UHFFFAOYSA-M |
| Molecular Formula | C24H52ClNO4 |
Tetramethylammonium perchlorate
CAS: 2537-36-2 Molecular Formula: C4H12ClNO4 Molecular Weight (g/mol): 173.59 MDL Number: MFCD00043207 InChI Key: ZCWKIFAQRXNZCH-UHFFFAOYSA-M Synonym: tetramethylammonium perchlorate,methanaminium, n,n,n-trimethyl-, perchlorate,n,n,n-trimethylmethanaminium perchlorate,ammonium, tetramethyl-, perchlorate,methanaminium, n,n,n-trimethyl-, perchlorate 1:1,c4h12n.clo4,acmc-20ajj6,tetramethylazanium perchlorate,tetramethylammonium perchlorate 25g,wln: 2k2&2&2 &wgw PubChem CID: 17337 IUPAC Name: tetramethylazanium;perchlorate SMILES: C[N+](C)(C)C.[O-][Cl](=O)(=O)=O
| PubChem CID | 17337 |
|---|---|
| CAS | 2537-36-2 |
| Molecular Weight (g/mol) | 173.59 |
| MDL Number | MFCD00043207 |
| SMILES | C[N+](C)(C)C.[O-][Cl](=O)(=O)=O |
| Synonym | tetramethylammonium perchlorate,methanaminium, n,n,n-trimethyl-, perchlorate,n,n,n-trimethylmethanaminium perchlorate,ammonium, tetramethyl-, perchlorate,methanaminium, n,n,n-trimethyl-, perchlorate 1:1,c4h12n.clo4,acmc-20ajj6,tetramethylazanium perchlorate,tetramethylammonium perchlorate 25g,wln: 2k2&2&2 &wgw |
| IUPAC Name | tetramethylazanium;perchlorate |
| InChI Key | ZCWKIFAQRXNZCH-UHFFFAOYSA-M |
| Molecular Formula | C4H12ClNO4 |
Ethylenediaminetetraacetic Acid Disodium Salt Dihydrate, ≥99%, Molecular Biology Reagent Grade, MP Biomedicals™
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
D-(+)-Raffinose Pentahydrate 98.0+%, TCI America™
CAS: 17629-30-0 Molecular Formula: C18H42O21 Molecular Weight (g/mol): 594.513 MDL Number: MFCD00006630 InChI Key: BITMAWRCWSHCRW-ORBWWOJFSA-N Synonym: d-+-raffinosepentahydrate PubChem CID: 134129414 IUPAC Name: (3S,4S,5R,6R)-2-[[(2R,3S,4S,5S)-6-[(2S,3S,4R,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol;pentahydrate SMILES: C(C1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3(C(C(C(O3)CO)O)O)CO)O)O)O)O)O)O)O.O.O.O.O.O
| PubChem CID | 134129414 |
|---|---|
| CAS | 17629-30-0 |
| Molecular Weight (g/mol) | 594.513 |
| MDL Number | MFCD00006630 |
| SMILES | C(C1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3(C(C(C(O3)CO)O)O)CO)O)O)O)O)O)O)O.O.O.O.O.O |
| Synonym | d-+-raffinosepentahydrate |
| IUPAC Name | (3S,4S,5R,6R)-2-[[(2R,3S,4S,5S)-6-[(2S,3S,4R,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol;pentahydrate |
| InChI Key | BITMAWRCWSHCRW-ORBWWOJFSA-N |
| Molecular Formula | C18H42O21 |
Triphenylmethanol, 97%
CAS: 76-84-6 Molecular Formula: C19H16O Molecular Weight (g/mol): 260.34 MDL Number: MFCD00004445,MFCD10565638 InChI Key: LZTRCELOJRDYMQ-UHFFFAOYSA-N Synonym: triphenylcarbinol,trityl alcohol,tritanol,triphenylmethyl alcohol,triphenyl methanol,triphenyl carbinol,methanol, triphenyl,unii-u97q0ou9kb,triphenyl-methanol,benzenemethanol, .alpha.,.alpha.-diphenyl PubChem CID: 6457 IUPAC Name: triphenylmethanol SMILES: OC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 6457 |
|---|---|
| CAS | 76-84-6 |
| Molecular Weight (g/mol) | 260.34 |
| MDL Number | MFCD00004445,MFCD10565638 |
| SMILES | OC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenylcarbinol,trityl alcohol,tritanol,triphenylmethyl alcohol,triphenyl methanol,triphenyl carbinol,methanol, triphenyl,unii-u97q0ou9kb,triphenyl-methanol,benzenemethanol, .alpha.,.alpha.-diphenyl |
| IUPAC Name | triphenylmethanol |
| InChI Key | LZTRCELOJRDYMQ-UHFFFAOYSA-N |
| Molecular Formula | C19H16O |
Diethyl maleate, 97%
CAS: 141-05-9 Molecular Formula: C8H12O4 Molecular Weight (g/mol): 172.18 MDL Number: MFCD00009191 InChI Key: IEPRKVQEAMIZSS-WAYWQWQTSA-N Synonym: diethyl maleate,ethyl maleate,maleic acid, diethyl ester,diethylmaleate,maleic acid diethyl ester,2-butenedioic acid z-, diethyl ester,diethyl z-but-2-enedioate,diethyl 2z-but-2-enedioate,unii-g81wqb56ol,ccris 941 PubChem CID: 5271566 ChEBI: CHEBI:68508 IUPAC Name: diethyl (Z)-but-2-enedioate SMILES: CCOC(=O)C=CC(=O)OCC
| PubChem CID | 5271566 |
|---|---|
| CAS | 141-05-9 |
| Molecular Weight (g/mol) | 172.18 |
| ChEBI | CHEBI:68508 |
| MDL Number | MFCD00009191 |
| SMILES | CCOC(=O)C=CC(=O)OCC |
| Synonym | diethyl maleate,ethyl maleate,maleic acid, diethyl ester,diethylmaleate,maleic acid diethyl ester,2-butenedioic acid z-, diethyl ester,diethyl z-but-2-enedioate,diethyl 2z-but-2-enedioate,unii-g81wqb56ol,ccris 941 |
| IUPAC Name | diethyl (Z)-but-2-enedioate |
| InChI Key | IEPRKVQEAMIZSS-WAYWQWQTSA-N |
| Molecular Formula | C8H12O4 |
Ethylenediaminetetraacetic Acid Trisodium Salt Monohydrate, 99.32%, MP Biomedicals™
CAS: 10378-22-0 Molecular Formula: C10H18N2Na3O9 Molecular Weight (g/mol): 379.228 MDL Number: MFCD00149675 InChI Key: DFCJTQJARZUURB-UHFFFAOYSA-N Synonym: edta, trisodium salt trihydrate PubChem CID: 131865091 IUPAC Name: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;sodium;hydrate SMILES: C(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.O.[Na].[Na].[Na]
| PubChem CID | 131865091 |
|---|---|
| CAS | 10378-22-0 |
| Molecular Weight (g/mol) | 379.228 |
| MDL Number | MFCD00149675 |
| SMILES | C(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.O.[Na].[Na].[Na] |
| Synonym | edta, trisodium salt trihydrate |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;sodium;hydrate |
| InChI Key | DFCJTQJARZUURB-UHFFFAOYSA-N |
| Molecular Formula | C10H18N2Na3O9 |
1,3-Propanediol, 99%
CAS: 504-63-2 Molecular Formula: C3H8O2 Molecular Weight (g/mol): 76.10 MDL Number: MFCD00002949 InChI Key: YPFDHNVEDLHUCE-UHFFFAOYSA-N Synonym: 1,3-propanediol,trimethylene glycol,1,3-dihydroxypropane,2-deoxyglycerol,1,3-propylene glycol,1,3-propylenediol,1,3-propandiol,2-hydroxymethyl ethanol,omega-propanediol,beta-propylene glycol PubChem CID: 10442 ChEBI: CHEBI:16109 IUPAC Name: propane-1,3-diol SMILES: OCCCO
| PubChem CID | 10442 |
|---|---|
| CAS | 504-63-2 |
| Molecular Weight (g/mol) | 76.10 |
| ChEBI | CHEBI:16109 |
| MDL Number | MFCD00002949 |
| SMILES | OCCCO |
| Synonym | 1,3-propanediol,trimethylene glycol,1,3-dihydroxypropane,2-deoxyglycerol,1,3-propylene glycol,1,3-propylenediol,1,3-propandiol,2-hydroxymethyl ethanol,omega-propanediol,beta-propylene glycol |
| IUPAC Name | propane-1,3-diol |
| InChI Key | YPFDHNVEDLHUCE-UHFFFAOYSA-N |
| Molecular Formula | C3H8O2 |
n-Hexane, 97+%, for HPLC, ACS reagent, meets the requirm. of Reag. Ph.Eur.
Greener Choice
Offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More
Offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More
CAS: 110-54-3 Molecular Formula: C6H14 Molecular Weight (g/mol): 86.18 MDL Number: MFCD02179311 InChI Key: VLKZOEOYAKHREP-UHFFFAOYSA-N Synonym: n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes PubChem CID: 8058 ChEBI: CHEBI:29021 IUPAC Name: hexane SMILES: CCCCCC
| PubChem CID | 8058 |
|---|---|
| CAS | 110-54-3 |
| Molecular Weight (g/mol) | 86.18 |
| ChEBI | CHEBI:29021 |
| MDL Number | MFCD02179311 |
| SMILES | CCCCCC |
| Synonym | n-hexane,esani,skellysolve b,gettysolve-b,hexyl hydride,hexan,dipropyl,heksan,hexanen,hexanes |
| IUPAC Name | hexane |
| InChI Key | VLKZOEOYAKHREP-UHFFFAOYSA-N |
| Molecular Formula | C6H14 |
Benzylamine, 99.5+%, AcroSeal™
CAS: 100-46-9 Molecular Formula: C7H9N Molecular Weight (g/mol): 107.15 MDL Number: MFCD00008106 InChI Key: WGQKYBSKWIADBV-UHFFFAOYSA-N Synonym: benzylamine,benzenemethanamine,monobenzylamine,alpha-aminotoluene,phenylmethyl amine,aminomethyl benzene,1-phenylmethanamine,moringine,n-benzylamine,phenylmethylamine PubChem CID: 7504 ChEBI: CHEBI:40538 IUPAC Name: phenylmethanamine SMILES: C1=CC=C(C=C1)CN
| PubChem CID | 7504 |
|---|---|
| CAS | 100-46-9 |
| Molecular Weight (g/mol) | 107.15 |
| ChEBI | CHEBI:40538 |
| MDL Number | MFCD00008106 |
| SMILES | C1=CC=C(C=C1)CN |
| Synonym | benzylamine,benzenemethanamine,monobenzylamine,alpha-aminotoluene,phenylmethyl amine,aminomethyl benzene,1-phenylmethanamine,moringine,n-benzylamine,phenylmethylamine |
| IUPAC Name | phenylmethanamine |
| InChI Key | WGQKYBSKWIADBV-UHFFFAOYSA-N |
| Molecular Formula | C7H9N |