Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Anthranilamide, 99+%
CAS: 88-68-6 Molecular Formula: C7H8N2O Molecular Weight (g/mol): 136.15 MDL Number: MFCD00007981 InChI Key: PXBFMLJZNCDSMP-UHFFFAOYSA-N Synonym: anthranilamide,benzamide, 2-amino,o-aminobenzamide,2-carbamoylaniline,aminobenzamide,anthranilimidic acid,benzamide, o-amino,anthranilic acid amide,anthranilamide van,o-aminobenzamide van PubChem CID: 6942 IUPAC Name: 2-aminobenzamide SMILES: C1=CC=C(C(=C1)C(=O)N)N
| PubChem CID | 6942 |
|---|---|
| CAS | 88-68-6 |
| Molecular Weight (g/mol) | 136.15 |
| MDL Number | MFCD00007981 |
| SMILES | C1=CC=C(C(=C1)C(=O)N)N |
| Synonym | anthranilamide,benzamide, 2-amino,o-aminobenzamide,2-carbamoylaniline,aminobenzamide,anthranilimidic acid,benzamide, o-amino,anthranilic acid amide,anthranilamide van,o-aminobenzamide van |
| IUPAC Name | 2-aminobenzamide |
| InChI Key | PXBFMLJZNCDSMP-UHFFFAOYSA-N |
| Molecular Formula | C7H8N2O |
DL-Carnitine hydrochloride, 99%
CAS: 461-05-2 Molecular Formula: C7H15NO3·HCl Molecular Weight (g/mol): 197.66 MDL Number: MFCD00011904 InChI Key: JXXCENBLGFBQJM-UHFFFAOYSA-O Synonym: dl-carnitine hydrochloride,3-carboxy-2-hydroxypropyl-trimethylammonium hydrochloride,2,4-bis oxidanyl-4-oxidanylidene-butyl-trimethyl-azanium hydrochloride PubChem CID: 24206429 IUPAC Name: (3-carboxy-2-hydroxypropyl)-trimethylazanium;hydrochloride SMILES: C[N+](C)(C)CC(CC(=O)O)O.Cl
| PubChem CID | 24206429 |
|---|---|
| CAS | 461-05-2 |
| Molecular Weight (g/mol) | 197.66 |
| MDL Number | MFCD00011904 |
| SMILES | C[N+](C)(C)CC(CC(=O)O)O.Cl |
| Synonym | dl-carnitine hydrochloride,3-carboxy-2-hydroxypropyl-trimethylammonium hydrochloride,2,4-bis oxidanyl-4-oxidanylidene-butyl-trimethyl-azanium hydrochloride |
| IUPAC Name | (3-carboxy-2-hydroxypropyl)-trimethylazanium;hydrochloride |
| InChI Key | JXXCENBLGFBQJM-UHFFFAOYSA-O |
| Molecular Formula | C7H15NO3·HCl |
Calcium L-threonate, 98%
CAS: 70753-61-6 Molecular Formula: C8H14CaO10 Molecular Weight (g/mol): 310.27 MDL Number: MFCD00077882,MFCD00150824 InChI Key: ZJXGOFZGZFVRHK-UHFFFAOYNA-L Synonym: calcium l-threonate,l-threonic acid calcium salt,calcium 2r,3s-2,3,4-trihydroxybutanoate,calcium threonate,unii-hbb4ypo93u,hbb4ypo93u,calcium bis l-threonate,threonine, calcium salt,bis l-threonic acid calcium salt,butanoic acid, 2,3,4-trihydroxy-, calcium salt 2:1 , 2r,3s PubChem CID: 13388558 IUPAC Name: calcium;(2R,3S)-2,3,4-trihydroxybutanoate SMILES: [Ca++].OCC(O)C(O)C([O-])=O.OCC(O)C(O)C([O-])=O
| PubChem CID | 13388558 |
|---|---|
| CAS | 70753-61-6 |
| Molecular Weight (g/mol) | 310.27 |
| MDL Number | MFCD00077882,MFCD00150824 |
| SMILES | [Ca++].OCC(O)C(O)C([O-])=O.OCC(O)C(O)C([O-])=O |
| Synonym | calcium l-threonate,l-threonic acid calcium salt,calcium 2r,3s-2,3,4-trihydroxybutanoate,calcium threonate,unii-hbb4ypo93u,hbb4ypo93u,calcium bis l-threonate,threonine, calcium salt,bis l-threonic acid calcium salt,butanoic acid, 2,3,4-trihydroxy-, calcium salt 2:1 , 2r,3s |
| IUPAC Name | calcium;(2R,3S)-2,3,4-trihydroxybutanoate |
| InChI Key | ZJXGOFZGZFVRHK-UHFFFAOYNA-L |
| Molecular Formula | C8H14CaO10 |
Poly(vinyl alcohol), 88% hydrolyzed, average M.W. 20000-30000
CAS: 9002-89-5 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 44.05 MDL Number: MFCD00081922 InChI Key: IMROMDMJAWUWLK-UHFFFAOYSA-N Synonym: vinyl alcohol,polyvinyl alcohol,hydroxyethene,hydroxyethylene,ethenol, homopolymer,gohsenol,polyviol,elvanol,mowiol,poval PubChem CID: 11199 IUPAC Name: ethenol SMILES: OC(-*)C-*
| PubChem CID | 11199 |
|---|---|
| CAS | 9002-89-5 |
| Molecular Weight (g/mol) | 44.05 |
| MDL Number | MFCD00081922 |
| SMILES | OC(-*)C-* |
| Synonym | vinyl alcohol,polyvinyl alcohol,hydroxyethene,hydroxyethylene,ethenol, homopolymer,gohsenol,polyviol,elvanol,mowiol,poval |
| IUPAC Name | ethenol |
| InChI Key | IMROMDMJAWUWLK-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
3,4-Dichloroaniline, 98%
CAS: 95-76-1 MDL Number: MFCD00007768 InChI Key: SDYWXFYBZPNOFX-UHFFFAOYSA-N Synonym: 3,4-dichlorobenzenamine,3,4-dichloraniline,3,4-dichloranilin,4,5-dichloroaniline,benzenamine, 3,4-dichloro,1-amino-3,4-dichlorobenzene,3,4-dca,3,4-dichlorophenylamine,aniline, 3,4-dichloro,m,p-dichloroaniline PubChem CID: 7257 ChEBI: CHEBI:16767 IUPAC Name: 3,4-dichloroaniline SMILES: C1=CC(=C(C=C1N)Cl)Cl
| PubChem CID | 7257 |
|---|---|
| CAS | 95-76-1 |
| ChEBI | CHEBI:16767 |
| MDL Number | MFCD00007768 |
| SMILES | C1=CC(=C(C=C1N)Cl)Cl |
| Synonym | 3,4-dichlorobenzenamine,3,4-dichloraniline,3,4-dichloranilin,4,5-dichloroaniline,benzenamine, 3,4-dichloro,1-amino-3,4-dichlorobenzene,3,4-dca,3,4-dichlorophenylamine,aniline, 3,4-dichloro,m,p-dichloroaniline |
| IUPAC Name | 3,4-dichloroaniline |
| InChI Key | SDYWXFYBZPNOFX-UHFFFAOYSA-N |
Tributyl O-Acetylcitrate 97.0+%, TCI America™
CAS: 77-90-7 Molecular Formula: C20H34O8 Molecular Weight (g/mol): 402.48 MDL Number: MFCD00043554 InChI Key: QZCLKYGREBVARF-UHFFFAOYSA-N Synonym: O-Acetylcitric Acid Tributyl Ester PubChem CID: 6505 IUPAC Name: 1,2,3-tributyl 2-(acetyloxy)propane-1,2,3-tricarboxylate SMILES: CCCCOC(=O)CC(CC(=O)OCCCC)(OC(C)=O)C(=O)OCCCC
| PubChem CID | 6505 |
|---|---|
| CAS | 77-90-7 |
| Molecular Weight (g/mol) | 402.48 |
| MDL Number | MFCD00043554 |
| SMILES | CCCCOC(=O)CC(CC(=O)OCCCC)(OC(C)=O)C(=O)OCCCC |
| Synonym | O-Acetylcitric Acid Tributyl Ester |
| IUPAC Name | 1,2,3-tributyl 2-(acetyloxy)propane-1,2,3-tricarboxylate |
| InChI Key | QZCLKYGREBVARF-UHFFFAOYSA-N |
| Molecular Formula | C20H34O8 |
Trichloroethylene, 99.6%, ACS reagent, stabilized
CAS: 79-01-6 Molecular Formula: C2HCl3 Molecular Weight (g/mol): 131.39 MDL Number: MFCD00000838 InChI Key: XSTXAVWGXDQKEL-UHFFFAOYSA-N Synonym: trichloroethylene,trichloroethene,ethene, trichloro,trilene,trichlorethylene,ethinyl trichloride,ethylene trichloride,acetylene trichloride,chlorilen,narcogen PubChem CID: 6575 ChEBI: CHEBI:16602 IUPAC Name: 1,1,2-trichloroethene SMILES: C(=C(Cl)Cl)Cl
| PubChem CID | 6575 |
|---|---|
| CAS | 79-01-6 |
| Molecular Weight (g/mol) | 131.39 |
| ChEBI | CHEBI:16602 |
| MDL Number | MFCD00000838 |
| SMILES | C(=C(Cl)Cl)Cl |
| Synonym | trichloroethylene,trichloroethene,ethene, trichloro,trilene,trichlorethylene,ethinyl trichloride,ethylene trichloride,acetylene trichloride,chlorilen,narcogen |
| IUPAC Name | 1,1,2-trichloroethene |
| InChI Key | XSTXAVWGXDQKEL-UHFFFAOYSA-N |
| Molecular Formula | C2HCl3 |
Bromoacetic acid, 98+%
CAS: 79-08-3 Molecular Formula: C2H3BrO2 Molecular Weight (g/mol): 138.948 MDL Number: MFCD00002678 InChI Key: KDPAWGWELVVRCH-UHFFFAOYSA-N Synonym: bromoacetic acid,monobromoacetic acid,bromoethanoic acid,acetic acid, bromo,to ntu,bromoacetate ion,acide bromacetique,2-bromoacetyl group,2-bromoethanoic acid,acetic acid, 2-bromo PubChem CID: 6227 IUPAC Name: 2-bromoacetic acid SMILES: C(C(=O)O)Br
| PubChem CID | 6227 |
|---|---|
| CAS | 79-08-3 |
| Molecular Weight (g/mol) | 138.948 |
| MDL Number | MFCD00002678 |
| SMILES | C(C(=O)O)Br |
| Synonym | bromoacetic acid,monobromoacetic acid,bromoethanoic acid,acetic acid, bromo,to ntu,bromoacetate ion,acide bromacetique,2-bromoacetyl group,2-bromoethanoic acid,acetic acid, 2-bromo |
| IUPAC Name | 2-bromoacetic acid |
| InChI Key | KDPAWGWELVVRCH-UHFFFAOYSA-N |
| Molecular Formula | C2H3BrO2 |
3-Bromobenzoic acid, 99%
CAS: 585-76-2 Molecular Formula: C7H5BrO2 Molecular Weight (g/mol): 201.02 MDL Number: MFCD00002487 InChI Key: VOIZNVUXCQLQHS-UHFFFAOYSA-N Synonym: m-bromobenzoic acid,3-brombenzoic acid,benzoic acid, 3-bromo,3-bromo-benzoic acid,benzoic acid, m-bromo,unii-7dct3a73lx,7dct3a73lx,3-bromo benzene acid,3-bromobenzoicacid,4-fluorobenzoicacid PubChem CID: 11456 IUPAC Name: 3-bromobenzoic acid SMILES: C1=CC(=CC(=C1)Br)C(=O)O
| PubChem CID | 11456 |
|---|---|
| CAS | 585-76-2 |
| Molecular Weight (g/mol) | 201.02 |
| MDL Number | MFCD00002487 |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)O |
| Synonym | m-bromobenzoic acid,3-brombenzoic acid,benzoic acid, 3-bromo,3-bromo-benzoic acid,benzoic acid, m-bromo,unii-7dct3a73lx,7dct3a73lx,3-bromo benzene acid,3-bromobenzoicacid,4-fluorobenzoicacid |
| IUPAC Name | 3-bromobenzoic acid |
| InChI Key | VOIZNVUXCQLQHS-UHFFFAOYSA-N |
| Molecular Formula | C7H5BrO2 |
Dextran, MW ca 40,000
CAS: 9004-54-0 Molecular Formula: (C6H9O5)n(C6H10O5)m Molecular Weight (g/mol): 504.44 MDL Number: MFCD00130935 InChI Key: FZWBNHMXJMCXLU-UHFFFAOYNA-N Synonym: dextran,dextran, mw-86.000 aver.,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydro-2h-pyran-2-yl oxy methyl tetrahydro-2h-pyran-2-yl oxy hexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl oxan-2-yl oxymethyl oxan-2-yl oxyhexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydropyran-2-yl oxymethyl tetrahydropyran-2-yl oxy-hexanal PubChem CID: 4125253 IUPAC Name: Dextran SMILES: O[C@@H]1[C@@H](O)[C@@H](-*)O[C@H](CO[C@H]2O[C@H](CO-*)[C@@H](O)[C@H](O-*)[C@H]2O)[C@H]1O
| PubChem CID | 4125253 |
|---|---|
| CAS | 9004-54-0 |
| Molecular Weight (g/mol) | 504.44 |
| MDL Number | MFCD00130935 |
| SMILES | O[C@@H]1[C@@H](O)[C@@H](-*)O[C@H](CO[C@H]2O[C@H](CO-*)[C@@H](O)[C@H](O-*)[C@H]2O)[C@H]1O |
| Synonym | dextran,dextran, mw-86.000 aver.,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydro-2h-pyran-2-yl oxy methyl tetrahydro-2h-pyran-2-yl oxy hexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl oxan-2-yl oxymethyl oxan-2-yl oxyhexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydropyran-2-yl oxymethyl tetrahydropyran-2-yl oxy-hexanal |
| IUPAC Name | Dextran |
| InChI Key | FZWBNHMXJMCXLU-UHFFFAOYNA-N |
| Molecular Formula | (C6H9O5)n(C6H10O5)m |
2-Nitrodiphenylamine, MP Biomedicals
CAS: 119-75-5 Molecular Formula: C12H10N2O2 Molecular Weight (g/mol): 214.224 InChI Key: RUKISNQKOIKZGT-UHFFFAOYSA-N Synonym: 2-nitrodiphenylamine,o-nitrodiphenylamine,nitrodiphenylamine,benzenamine, 2-nitro-n-phenyl,sudan yellow 1339,n-phenyl-o-nitroaniline,o-nitro-n-phenylaniline,diphenylamine, 2-nitro,2-nitrophenyl phenylamine,2-nitrodophenylamine PubChem CID: 8407 IUPAC Name: 2-nitro-N-phenylaniline SMILES: C1=CC=C(C=C1)NC2=CC=CC=C2[N+](=O)[O-]
| PubChem CID | 8407 |
|---|---|
| CAS | 119-75-5 |
| Molecular Weight (g/mol) | 214.224 |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2[N+](=O)[O-] |
| Synonym | 2-nitrodiphenylamine,o-nitrodiphenylamine,nitrodiphenylamine,benzenamine, 2-nitro-n-phenyl,sudan yellow 1339,n-phenyl-o-nitroaniline,o-nitro-n-phenylaniline,diphenylamine, 2-nitro,2-nitrophenyl phenylamine,2-nitrodophenylamine |
| IUPAC Name | 2-nitro-N-phenylaniline |
| InChI Key | RUKISNQKOIKZGT-UHFFFAOYSA-N |
| Molecular Formula | C12H10N2O2 |
Ethyl hydrogen malonate, 96%
CAS: 1071-46-1 Molecular Formula: C5H8O4 Molecular Weight (g/mol): 132.115 MDL Number: MFCD00020490 InChI Key: HGINADPHJQTSKN-UHFFFAOYSA-N Synonym: ethyl hydrogen malonate,monoethyl malonate,monoethyl malonic acid,mono-ethyl malonate,monoethyl hydrogen malonate,malonic acid monoethyl ester,ethoxycarbonyl acetic acid,2-ethoxycarbonyl acetic acid,3-ethoxy-3-oxo-propanoic acid,ethylhydrogenmalonate PubChem CID: 70615 ChEBI: CHEBI:86907 IUPAC Name: 3-ethoxy-3-oxopropanoic acid SMILES: CCOC(=O)CC(=O)O
| PubChem CID | 70615 |
|---|---|
| CAS | 1071-46-1 |
| Molecular Weight (g/mol) | 132.115 |
| ChEBI | CHEBI:86907 |
| MDL Number | MFCD00020490 |
| SMILES | CCOC(=O)CC(=O)O |
| Synonym | ethyl hydrogen malonate,monoethyl malonate,monoethyl malonic acid,mono-ethyl malonate,monoethyl hydrogen malonate,malonic acid monoethyl ester,ethoxycarbonyl acetic acid,2-ethoxycarbonyl acetic acid,3-ethoxy-3-oxo-propanoic acid,ethylhydrogenmalonate |
| IUPAC Name | 3-ethoxy-3-oxopropanoic acid |
| InChI Key | HGINADPHJQTSKN-UHFFFAOYSA-N |
| Molecular Formula | C5H8O4 |
Methyl mercaptoacetate, 95%
CAS: 2365-48-2 Molecular Formula: C3H6O2S Molecular Weight (g/mol): 106.14 MDL Number: MFCD00004873 InChI Key: MKIJJIMOAABWGF-UHFFFAOYSA-N Synonym: methyl thioglycolate,methyl mercaptoacetate,methyl 2-mercaptoacetate,methylthioglycolate,thioglycolic acid methyl ester,acetic acid, mercapto-, methyl ester,methanethiol, methoxy,usaf ek-7119,thioglykolsaeure-methylester,unii-o1608la9el PubChem CID: 16907 IUPAC Name: methyl 2-sulfanylacetate SMILES: COC(=O)CS
| PubChem CID | 16907 |
|---|---|
| CAS | 2365-48-2 |
| Molecular Weight (g/mol) | 106.14 |
| MDL Number | MFCD00004873 |
| SMILES | COC(=O)CS |
| Synonym | methyl thioglycolate,methyl mercaptoacetate,methyl 2-mercaptoacetate,methylthioglycolate,thioglycolic acid methyl ester,acetic acid, mercapto-, methyl ester,methanethiol, methoxy,usaf ek-7119,thioglykolsaeure-methylester,unii-o1608la9el |
| IUPAC Name | methyl 2-sulfanylacetate |
| InChI Key | MKIJJIMOAABWGF-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2S |
2-Octanone, 98%
CAS: 111-13-7 Molecular Formula: C8H16O Molecular Weight (g/mol): 128.215 MDL Number: MFCD00009540 InChI Key: ZPVFWPFBNIEHGJ-UHFFFAOYSA-N Synonym: 2-octanone,n-hexyl methyl ketone,hexyl methyl ketone,methyl hexyl ketone,methyl n-hexyl ketone,octanone,2-oxooctane,2-octanone natural,fema number 2802,unii-j2g84h29af PubChem CID: 8093 ChEBI: CHEBI:87434 IUPAC Name: octan-2-one SMILES: CCCCCCC(=O)C
| PubChem CID | 8093 |
|---|---|
| CAS | 111-13-7 |
| Molecular Weight (g/mol) | 128.215 |
| ChEBI | CHEBI:87434 |
| MDL Number | MFCD00009540 |
| SMILES | CCCCCCC(=O)C |
| Synonym | 2-octanone,n-hexyl methyl ketone,hexyl methyl ketone,methyl hexyl ketone,methyl n-hexyl ketone,octanone,2-oxooctane,2-octanone natural,fema number 2802,unii-j2g84h29af |
| IUPAC Name | octan-2-one |
| InChI Key | ZPVFWPFBNIEHGJ-UHFFFAOYSA-N |
| Molecular Formula | C8H16O |
Ethyl trifluoroacetate, 99%
CAS: 383-63-1 Molecular Formula: C4H5F3O2 Molecular Weight (g/mol): 142.08 MDL Number: MFCD00000419 InChI Key: STSCVKRWJPWALQ-UHFFFAOYSA-N Synonym: ethyl trifluoroacetate,trifluoroacetic acid ethyl ester,ethyltrifluoroacetate,acetic acid, trifluoro-, ethyl ester,trifluoroacetic acid, ethyl ester,ethyl trifluoroethanoate,unii-a6tzk6x11x,acetic acid, 2,2,2-trifluoro-, ethyl ester,a6tzk6x11x,ethyl ester of trifluoroacetic acid PubChem CID: 9794 IUPAC Name: ethyl 2,2,2-trifluoroacetate SMILES: CCOC(=O)C(F)(F)F
| PubChem CID | 9794 |
|---|---|
| CAS | 383-63-1 |
| Molecular Weight (g/mol) | 142.08 |
| MDL Number | MFCD00000419 |
| SMILES | CCOC(=O)C(F)(F)F |
| Synonym | ethyl trifluoroacetate,trifluoroacetic acid ethyl ester,ethyltrifluoroacetate,acetic acid, trifluoro-, ethyl ester,trifluoroacetic acid, ethyl ester,ethyl trifluoroethanoate,unii-a6tzk6x11x,acetic acid, 2,2,2-trifluoro-, ethyl ester,a6tzk6x11x,ethyl ester of trifluoroacetic acid |
| IUPAC Name | ethyl 2,2,2-trifluoroacetate |
| InChI Key | STSCVKRWJPWALQ-UHFFFAOYSA-N |
| Molecular Formula | C4H5F3O2 |