Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Azobenzene, 97+%
CAS: 103-33-3 Molecular Formula: C12H10N2 Molecular Weight (g/mol): 182.23 MDL Number: MFCD00003022 InChI Key: DMLAVOWQYNRWNQ-UHFFFAOYSA-N Synonym: azobenzene,diazene, diphenyl,diazobenzene,e-diphenyldiazene,azobisbenzene,azofume,1,2-diphenyldiazene,azodibenzeneazofume,diphenyldiimide,azobenzide PubChem CID: 2272 ChEBI: CHEBI:190358 IUPAC Name: diphenyldiazene SMILES: C1=CC=C(C=C1)N=NC1=CC=CC=C1
| PubChem CID | 2272 |
|---|---|
| CAS | 103-33-3 |
| Molecular Weight (g/mol) | 182.23 |
| ChEBI | CHEBI:190358 |
| MDL Number | MFCD00003022 |
| SMILES | C1=CC=C(C=C1)N=NC1=CC=CC=C1 |
| Synonym | azobenzene,diazene, diphenyl,diazobenzene,e-diphenyldiazene,azobisbenzene,azofume,1,2-diphenyldiazene,azodibenzeneazofume,diphenyldiimide,azobenzide |
| IUPAC Name | diphenyldiazene |
| InChI Key | DMLAVOWQYNRWNQ-UHFFFAOYSA-N |
| Molecular Formula | C12H10N2 |
Butylated hydroxyanisole, 96%
CAS: 25013-16-5 Molecular Formula: C11H16O2 Molecular Weight (g/mol): 180.24 MDL Number: MFCD01779059 InChI Key: MRBKEAMVRSLQPH-UHFFFAOYSA-N Synonym: 3-tert-butyl-4-hydroxyanisole,4-hydroxy-3-tert-butylanisole,2-tert-butyl-4-methoxyphenol,3-bha,4-methoxy-2-tert-butylphenol,3-t-butyl-4-hydroxyanisole,phenol, 2-1,1-dimethylethyl-4-methoxy,2-1,1-dimethylethyl-4-methoxyphenol,2-butyl-4-hydroxyanisole,phenol, 2-tert-butyl-4-methoxy PubChem CID: 8456 ChEBI: CHEBI:76358 IUPAC Name: 2-tert-butyl-4-methoxyphenol SMILES: CC(C)(C)C1=C(C=CC(=C1)OC)O
| PubChem CID | 8456 |
|---|---|
| CAS | 25013-16-5 |
| Molecular Weight (g/mol) | 180.24 |
| ChEBI | CHEBI:76358 |
| MDL Number | MFCD01779059 |
| SMILES | CC(C)(C)C1=C(C=CC(=C1)OC)O |
| Synonym | 3-tert-butyl-4-hydroxyanisole,4-hydroxy-3-tert-butylanisole,2-tert-butyl-4-methoxyphenol,3-bha,4-methoxy-2-tert-butylphenol,3-t-butyl-4-hydroxyanisole,phenol, 2-1,1-dimethylethyl-4-methoxy,2-1,1-dimethylethyl-4-methoxyphenol,2-butyl-4-hydroxyanisole,phenol, 2-tert-butyl-4-methoxy |
| IUPAC Name | 2-tert-butyl-4-methoxyphenol |
| InChI Key | MRBKEAMVRSLQPH-UHFFFAOYSA-N |
| Molecular Formula | C11H16O2 |
2,2,2-Trifluoroethyl Methacrylate (stabilized with MEHQ) 98.0+%, TCI America™
CAS: 352-87-4 Molecular Formula: C6H7F3O2 Molecular Weight (g/mol): 168.12 MDL Number: MFCD00013576,MFCD00274739 InChI Key: QTKPMCIBUROOGY-UHFFFAOYSA-N Synonym: 2,2,2-trifluoroethyl methacrylate,trifluoroethyl methacrylate,methacrylic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethylmethacrylate,2-propenoic acid, 2-methyl-, 2,2,2-trifluoroethyl ester,2-methyl-acrylic acid 2,2,2-trifluoro-ethyl ester,2-propenoic acid, 2-methyl-, trifluoroethyl ester,2-methyl-2-propenoic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethyl m,acmc-1af8z PubChem CID: 9608 IUPAC Name: 2,2,2-trifluoroethyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(F)(F)F
| PubChem CID | 9608 |
|---|---|
| CAS | 352-87-4 |
| Molecular Weight (g/mol) | 168.12 |
| MDL Number | MFCD00013576,MFCD00274739 |
| SMILES | CC(=C)C(=O)OCC(F)(F)F |
| Synonym | 2,2,2-trifluoroethyl methacrylate,trifluoroethyl methacrylate,methacrylic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethylmethacrylate,2-propenoic acid, 2-methyl-, 2,2,2-trifluoroethyl ester,2-methyl-acrylic acid 2,2,2-trifluoro-ethyl ester,2-propenoic acid, 2-methyl-, trifluoroethyl ester,2-methyl-2-propenoic acid 2,2,2-trifluoroethyl ester,2,2,2-trifluoroethyl m,acmc-1af8z |
| IUPAC Name | 2,2,2-trifluoroethyl 2-methylprop-2-enoate |
| InChI Key | QTKPMCIBUROOGY-UHFFFAOYSA-N |
| Molecular Formula | C6H7F3O2 |
9,10-Anthraquinone, 98+%, Thermo Scientific Chemicals
CAS: 84-65-1 Molecular Formula: C14H8O2 Molecular Weight (g/mol): 208.22 MDL Number: MFCD00001188 InChI Key: RZVHIXYEVGDQDX-UHFFFAOYSA-N Synonym: anthraquinone,9,10-anthraquinone,9,10-anthracenedione,anthradione,hoelite,9,10-dioxoanthracene,corbit,morkit,9,10-anthrachinon,anthra-9,10-quinone PubChem CID: 6780 ChEBI: CHEBI:40448 IUPAC Name: anthracene-9,10-dione SMILES: O=C1C2=CC=CC=C2C(=O)C2=CC=CC=C12
| PubChem CID | 6780 |
|---|---|
| CAS | 84-65-1 |
| Molecular Weight (g/mol) | 208.22 |
| ChEBI | CHEBI:40448 |
| MDL Number | MFCD00001188 |
| SMILES | O=C1C2=CC=CC=C2C(=O)C2=CC=CC=C12 |
| Synonym | anthraquinone,9,10-anthraquinone,9,10-anthracenedione,anthradione,hoelite,9,10-dioxoanthracene,corbit,morkit,9,10-anthrachinon,anthra-9,10-quinone |
| IUPAC Name | anthracene-9,10-dione |
| InChI Key | RZVHIXYEVGDQDX-UHFFFAOYSA-N |
| Molecular Formula | C14H8O2 |
4-Sulfophthalic Acid (contains 3-Sulfophthalic Acid) (ca. 50% in Water), TCI America™
CAS: 89-08-7 Molecular Formula: C8H6O7S Molecular Weight (g/mol): 246.189 MDL Number: MFCD00007494 InChI Key: WNKQDGLSQUASME-UHFFFAOYSA-N Synonym: 1,2-benzenedicarboxylic acid, 4-sulfo,phthalic acid, 4-sulfo,4-sulphophthalic acid,unii-t1sm5dom66,4-sulfobenzene-1,2-dicarboxylic acid,t1sm5dom66,4-sulfophthalic acid aq. soln.,5-sulfophthalic acid,acmc-209uex,1, 4-sulfo PubChem CID: 6962 IUPAC Name: 4-sulfophthalic acid SMILES: C1=CC(=C(C=C1S(=O)(=O)O)C(=O)O)C(=O)O
| PubChem CID | 6962 |
|---|---|
| CAS | 89-08-7 |
| Molecular Weight (g/mol) | 246.189 |
| MDL Number | MFCD00007494 |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)O)C(=O)O)C(=O)O |
| Synonym | 1,2-benzenedicarboxylic acid, 4-sulfo,phthalic acid, 4-sulfo,4-sulphophthalic acid,unii-t1sm5dom66,4-sulfobenzene-1,2-dicarboxylic acid,t1sm5dom66,4-sulfophthalic acid aq. soln.,5-sulfophthalic acid,acmc-209uex,1, 4-sulfo |
| IUPAC Name | 4-sulfophthalic acid |
| InChI Key | WNKQDGLSQUASME-UHFFFAOYSA-N |
| Molecular Formula | C8H6O7S |
Phthalic Anhydride 98.0+%, TCI America™
CAS: 85-44-9 Molecular Formula: C8H4O3 Molecular Weight (g/mol): 148.12 MDL Number: MFCD00005918 InChI Key: LGRFSURHDFAFJT-UHFFFAOYSA-N Synonym: phthalic anhydride,isobenzofuran-1,3-dione,1,3-isobenzofurandione,1,3-dioxophthalan,1,3-phthalandione,phthalsaeureanhydrid,phthalic acid anhydride,o-phthalic acid anhydride,phthalandione,retarder esen PubChem CID: 6811 ChEBI: CHEBI:36605 IUPAC Name: 1,3-dihydro-2-benzofuran-1,3-dione SMILES: O=C1OC(=O)C2=CC=CC=C12
| PubChem CID | 6811 |
|---|---|
| CAS | 85-44-9 |
| Molecular Weight (g/mol) | 148.12 |
| ChEBI | CHEBI:36605 |
| MDL Number | MFCD00005918 |
| SMILES | O=C1OC(=O)C2=CC=CC=C12 |
| Synonym | phthalic anhydride,isobenzofuran-1,3-dione,1,3-isobenzofurandione,1,3-dioxophthalan,1,3-phthalandione,phthalsaeureanhydrid,phthalic acid anhydride,o-phthalic acid anhydride,phthalandione,retarder esen |
| IUPAC Name | 1,3-dihydro-2-benzofuran-1,3-dione |
| InChI Key | LGRFSURHDFAFJT-UHFFFAOYSA-N |
| Molecular Formula | C8H4O3 |
Methylcyclohexane, 99%, extra pure
CAS: 108-87-2 Molecular Formula: C7H14 Molecular Weight (g/mol): 98.19 MDL Number: MFCD00001497 InChI Key: UAEPNZWRGJTJPN-UHFFFAOYSA-N Synonym: cyclohexane, methyl,hexahydrotoluene,cyclohexylmethane,toluene hexahydride,hexahydroxytoluene,sextone b,toluene, hexahydro,metylocykloheksan,methyl cyclohexane,methylcyclohexan PubChem CID: 7962 IUPAC Name: methylcyclohexane SMILES: CC1CCCCC1
| PubChem CID | 7962 |
|---|---|
| CAS | 108-87-2 |
| Molecular Weight (g/mol) | 98.19 |
| MDL Number | MFCD00001497 |
| SMILES | CC1CCCCC1 |
| Synonym | cyclohexane, methyl,hexahydrotoluene,cyclohexylmethane,toluene hexahydride,hexahydroxytoluene,sextone b,toluene, hexahydro,metylocykloheksan,methyl cyclohexane,methylcyclohexan |
| IUPAC Name | methylcyclohexane |
| InChI Key | UAEPNZWRGJTJPN-UHFFFAOYSA-N |
| Molecular Formula | C7H14 |
Tetraethylammonium Bromide 98.0+%, TCI America™
CAS: 71-91-0 Molecular Formula: C8H20BrN Molecular Weight (g/mol): 210.159 MDL Number: MFCD00011825 InChI Key: HWCKGOZZJDHMNC-UHFFFAOYSA-M Synonym: tetraethylammonium bromide,teab,tea bromide,tetrylammonium bromide,sympatektoman,tetranium,etylon,bromethyl,beparon,etambro PubChem CID: 6285 IUPAC Name: tetraethylazanium;bromide SMILES: CC[N+](CC)(CC)CC.[Br-]
| PubChem CID | 6285 |
|---|---|
| CAS | 71-91-0 |
| Molecular Weight (g/mol) | 210.159 |
| MDL Number | MFCD00011825 |
| SMILES | CC[N+](CC)(CC)CC.[Br-] |
| Synonym | tetraethylammonium bromide,teab,tea bromide,tetrylammonium bromide,sympatektoman,tetranium,etylon,bromethyl,beparon,etambro |
| IUPAC Name | tetraethylazanium;bromide |
| InChI Key | HWCKGOZZJDHMNC-UHFFFAOYSA-M |
| Molecular Formula | C8H20BrN |
Triphenylphosphine 95.0+%, TCI America™
CAS: 603-35-0 Molecular Formula: C18H15P Molecular Weight (g/mol): 262.29 MDL Number: MFCD00003043 MFCD20489348 InChI Key: RIOQSEWOXXDEQQ-UHFFFAOYSA-N Synonym: triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin PubChem CID: 11776 IUPAC Name: triphenylphosphane SMILES: C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11776 |
|---|---|
| CAS | 603-35-0 |
| Molecular Weight (g/mol) | 262.29 |
| MDL Number | MFCD00003043 MFCD20489348 |
| SMILES | C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin |
| IUPAC Name | triphenylphosphane |
| InChI Key | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
| Molecular Formula | C18H15P |
4-(Dimethylamino)phenethyl alcohol, 99%
CAS: 50438-75-0 InChI Key: CDTPAAZQBPSVGS-UHFFFAOYSA-N Synonym: 2-4-dimethylamino phenyl ethanol,4-dimethylamino phenethyl alcohol,ccris 987,4-dimethylamino benzeneethanol,2-4-dimetylaminophenyl ethanol,unii-84gfy3663n,2-4-dimethylaminophenyl ethanol,benzeneethanol, 4-dimethylamino,p-n,n-dimethylaminophenethanol PubChem CID: 93252 IUPAC Name: 2-[4-(dimethylamino)phenyl]ethanol SMILES: CN(C)C1=CC=C(C=C1)CCO
| PubChem CID | 93252 |
|---|---|
| CAS | 50438-75-0 |
| SMILES | CN(C)C1=CC=C(C=C1)CCO |
| Synonym | 2-4-dimethylamino phenyl ethanol,4-dimethylamino phenethyl alcohol,ccris 987,4-dimethylamino benzeneethanol,2-4-dimetylaminophenyl ethanol,unii-84gfy3663n,2-4-dimethylaminophenyl ethanol,benzeneethanol, 4-dimethylamino,p-n,n-dimethylaminophenethanol |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]ethanol |
| InChI Key | CDTPAAZQBPSVGS-UHFFFAOYSA-N |
Disuccinimidyl glutarate, 97%
CAS: 79642-50-5 Molecular Formula: C13H14N2O8 Molecular Weight (g/mol): 326.26 MDL Number: MFCD00153597 InChI Key: LNQHREYHFRFJAU-UHFFFAOYSA-N Synonym: disuccinimidyl glutarate,di n-succinimidyl glutarate,bis 2,5-dioxopyrrolidin-1-yl pentanedioate,pentanedioic acid,1,5-bis 2,5-dioxo-1-pyrrolidinyl ester,dsg crosslinker,glutaric acid disuccinimidyl ester,di n-hydroxysuccinimidyl glutarate,bis 2,5-dioxopyrrolidin-1-yl glutarate,di n-succinimidyl glutarate chn PubChem CID: 4432628 IUPAC Name: bis(2,5-dioxopyrrolidin-1-yl) pentanedioate SMILES: O=C(CCCC(=O)ON1C(=O)CCC1=O)ON1C(=O)CCC1=O
| PubChem CID | 4432628 |
|---|---|
| CAS | 79642-50-5 |
| Molecular Weight (g/mol) | 326.26 |
| MDL Number | MFCD00153597 |
| SMILES | O=C(CCCC(=O)ON1C(=O)CCC1=O)ON1C(=O)CCC1=O |
| Synonym | disuccinimidyl glutarate,di n-succinimidyl glutarate,bis 2,5-dioxopyrrolidin-1-yl pentanedioate,pentanedioic acid,1,5-bis 2,5-dioxo-1-pyrrolidinyl ester,dsg crosslinker,glutaric acid disuccinimidyl ester,di n-hydroxysuccinimidyl glutarate,bis 2,5-dioxopyrrolidin-1-yl glutarate,di n-succinimidyl glutarate chn |
| IUPAC Name | bis(2,5-dioxopyrrolidin-1-yl) pentanedioate |
| InChI Key | LNQHREYHFRFJAU-UHFFFAOYSA-N |
| Molecular Formula | C13H14N2O8 |
Lovastatin, 97%
CAS: 75330-75-5 Molecular Formula: C24H36O5 Molecular Weight (g/mol): 404.55 MDL Number: MFCD00072164 InChI Key: PCZOHLXUXFIOCF-BXMDZJJMSA-N Synonym: lovastatin,mevinolin,mevacor,monacolin k,lovalip,altoprev,lovalord,mevinacor,nergadan,6alpha-methylcompactin PubChem CID: 53232 ChEBI: CHEBI:40303 IUPAC Name: (1S,3R,7S,8S,8aR)-8-{2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl}-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl (2S)-2-methylbutanoate SMILES: CC[C@H](C)C(=O)O[C@H]1C[C@@H](C)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@@H]12
| PubChem CID | 53232 |
|---|---|
| CAS | 75330-75-5 |
| Molecular Weight (g/mol) | 404.55 |
| ChEBI | CHEBI:40303 |
| MDL Number | MFCD00072164 |
| SMILES | CC[C@H](C)C(=O)O[C@H]1C[C@@H](C)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@@H]12 |
| Synonym | lovastatin,mevinolin,mevacor,monacolin k,lovalip,altoprev,lovalord,mevinacor,nergadan,6alpha-methylcompactin |
| IUPAC Name | (1S,3R,7S,8S,8aR)-8-{2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl}-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl (2S)-2-methylbutanoate |
| InChI Key | PCZOHLXUXFIOCF-BXMDZJJMSA-N |
| Molecular Formula | C24H36O5 |
Ethylene carbonate, 99+%
CAS: 96-49-1 Molecular Formula: C3H4O3 Molecular Weight (g/mol): 88.06 MDL Number: MFCD00005382 InChI Key: KMTRUDSVKNLOMY-UHFFFAOYSA-N Synonym: ethylene carbonate,glycol carbonate,ethylene glycol carbonate,dioxolone-2,cyclic ethylene carbonate,ethylene carbonic acid,1,3-dioxacyclopentan-2-one,2-dioxolone,carbonic acid, cyclic ethylene ester,texacar ec PubChem CID: 7303 IUPAC Name: 1,3-dioxolan-2-one SMILES: C1COC(=O)O1
| PubChem CID | 7303 |
|---|---|
| CAS | 96-49-1 |
| Molecular Weight (g/mol) | 88.06 |
| MDL Number | MFCD00005382 |
| SMILES | C1COC(=O)O1 |
| Synonym | ethylene carbonate,glycol carbonate,ethylene glycol carbonate,dioxolone-2,cyclic ethylene carbonate,ethylene carbonic acid,1,3-dioxacyclopentan-2-one,2-dioxolone,carbonic acid, cyclic ethylene ester,texacar ec |
| IUPAC Name | 1,3-dioxolan-2-one |
| InChI Key | KMTRUDSVKNLOMY-UHFFFAOYSA-N |
| Molecular Formula | C3H4O3 |
Diacetone acrylamide, 99%
CAS: 2873-97-4 Molecular Formula: C9H15NO2 Molecular Weight (g/mol): 169.22 MDL Number: MFCD00008788 InChI Key: OMNKZBIFPJNNIO-UHFFFAOYSA-N Synonym: diacetone acrylamide,diacetoneacrylamide,n-1,1-dimethyl-3-oxobutyl acrylamide,2-propenamide, n-1,1-dimethyl-3-oxobutyl,n-2-methyl-4-oxopentan-2-yl acrylamide,n-2-2-methyl-4-oxopentyl acrylamide,acrylamide, n-1,1-dimethyl-3-oxobutyl,n-1,1-dimethyl-3-oxobutyl-2-propenamide,acrylamide, n,n-diacetonyl,ccris 5898 PubChem CID: 17888 IUPAC Name: N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide SMILES: CC(=O)CC(C)(C)NC(=O)C=C
| PubChem CID | 17888 |
|---|---|
| CAS | 2873-97-4 |
| Molecular Weight (g/mol) | 169.22 |
| MDL Number | MFCD00008788 |
| SMILES | CC(=O)CC(C)(C)NC(=O)C=C |
| Synonym | diacetone acrylamide,diacetoneacrylamide,n-1,1-dimethyl-3-oxobutyl acrylamide,2-propenamide, n-1,1-dimethyl-3-oxobutyl,n-2-methyl-4-oxopentan-2-yl acrylamide,n-2-2-methyl-4-oxopentyl acrylamide,acrylamide, n-1,1-dimethyl-3-oxobutyl,n-1,1-dimethyl-3-oxobutyl-2-propenamide,acrylamide, n,n-diacetonyl,ccris 5898 |
| IUPAC Name | N-(2-methyl-4-oxopentan-2-yl)prop-2-enamide |
| InChI Key | OMNKZBIFPJNNIO-UHFFFAOYSA-N |
| Molecular Formula | C9H15NO2 |
2-Picolinic acid, 99%
CAS: 98-98-6 Molecular Formula: C6H5NO2 Molecular Weight (g/mol): 123.111 MDL Number: MFCD00006293 InChI Key: SIOXPEMLGUPBBT-UHFFFAOYSA-N Synonym: picolinic acid,2-pyridinecarboxylic acid,2-picolinic acid,2-carboxypyridine,alpha-picolinic acid,o-pyridinecarboxylic acid,pyridinecarboxylic acid,alpha-pyridinecarboxylic acid,picolinate,acide picolique PubChem CID: 1018 ChEBI: CHEBI:28747 IUPAC Name: pyridine-2-carboxylic acid SMILES: C1=CC=NC(=C1)C(=O)O
| PubChem CID | 1018 |
|---|---|
| CAS | 98-98-6 |
| Molecular Weight (g/mol) | 123.111 |
| ChEBI | CHEBI:28747 |
| MDL Number | MFCD00006293 |
| SMILES | C1=CC=NC(=C1)C(=O)O |
| Synonym | picolinic acid,2-pyridinecarboxylic acid,2-picolinic acid,2-carboxypyridine,alpha-picolinic acid,o-pyridinecarboxylic acid,pyridinecarboxylic acid,alpha-pyridinecarboxylic acid,picolinate,acide picolique |
| IUPAC Name | pyridine-2-carboxylic acid |
| InChI Key | SIOXPEMLGUPBBT-UHFFFAOYSA-N |
| Molecular Formula | C6H5NO2 |