Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Triisopropylsilyl Trifluoromethanesulfonate 98.0+%, TCI America™
CAS: 80522-42-5 Molecular Formula: C10H21F3O3SSi Molecular Weight (g/mol): 306.415 MDL Number: MFCD00009913 InChI Key: LHJCZOXMCGQVDQ-UHFFFAOYSA-N Synonym: triisopropylsilyl trifluoromethanesulfonate,triisopropylsilyl triflate,triisopropylsilyltrifluoromethanesulfonate,trifluoromethanesulfonic acid triisopropylsilyl ester,tips-otf,tips triflate,wacker silane ip3-triflate,triisopropylsilyl trifluoromethanesulphonate,triisopropylsilyl-trifluoromethanesulfonate,methanesulfonic acid, trifluoro-, tris 1-methylethyl silyl ester PubChem CID: 2724529 IUPAC Name: tri(propan-2-yl)silyl trifluoromethanesulfonate SMILES: CC(C)[Si](C(C)C)(C(C)C)OS(=O)(=O)C(F)(F)F
| PubChem CID | 2724529 |
|---|---|
| CAS | 80522-42-5 |
| Molecular Weight (g/mol) | 306.415 |
| MDL Number | MFCD00009913 |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)OS(=O)(=O)C(F)(F)F |
| Synonym | triisopropylsilyl trifluoromethanesulfonate,triisopropylsilyl triflate,triisopropylsilyltrifluoromethanesulfonate,trifluoromethanesulfonic acid triisopropylsilyl ester,tips-otf,tips triflate,wacker silane ip3-triflate,triisopropylsilyl trifluoromethanesulphonate,triisopropylsilyl-trifluoromethanesulfonate,methanesulfonic acid, trifluoro-, tris 1-methylethyl silyl ester |
| IUPAC Name | tri(propan-2-yl)silyl trifluoromethanesulfonate |
| InChI Key | LHJCZOXMCGQVDQ-UHFFFAOYSA-N |
| Molecular Formula | C10H21F3O3SSi |
Lithium acetylide ethylenediamine complex, tech. 85%, Thermo Scientific Chemicals
CAS: 6867-30-7 Molecular Formula: C4H9LiN2 Molecular Weight (g/mol): 92.07 MDL Number: MFCD00013183 InChI Key: QJQWXTYPTBEPGS-UHFFFAOYSA-N Synonym: lithium acetylide ethylenediamine complex,lithium acetylide, ethylenediamine complex,lithium; ethane-1,2-diamine; ethyne,1,2-ethanediamine compd. with lithium acetylide li c2h,lithium, 1,2-ethanediamine-kn1,kn2 ethynyl,1,2-ethanediamine, compd. with lithium acetylide li c2h 1:?,c2h8n2.c2hli,lithium acetylide, compd. with 1,2-ethanediamine,lithium acetylide, ethylene diamine complex 1:1,lithium acetylide, compound with ethane-1,2-diamine PubChem CID: 2724010 IUPAC Name: lithium;ethane-1,2-diamine;ethyne SMILES: [Li]C#C.NCCN
| PubChem CID | 2724010 |
|---|---|
| CAS | 6867-30-7 |
| Molecular Weight (g/mol) | 92.07 |
| MDL Number | MFCD00013183 |
| SMILES | [Li]C#C.NCCN |
| Synonym | lithium acetylide ethylenediamine complex,lithium acetylide, ethylenediamine complex,lithium; ethane-1,2-diamine; ethyne,1,2-ethanediamine compd. with lithium acetylide li c2h,lithium, 1,2-ethanediamine-kn1,kn2 ethynyl,1,2-ethanediamine, compd. with lithium acetylide li c2h 1:?,c2h8n2.c2hli,lithium acetylide, compd. with 1,2-ethanediamine,lithium acetylide, ethylene diamine complex 1:1,lithium acetylide, compound with ethane-1,2-diamine |
| IUPAC Name | lithium;ethane-1,2-diamine;ethyne |
| InChI Key | QJQWXTYPTBEPGS-UHFFFAOYSA-N |
| Molecular Formula | C4H9LiN2 |
(+/-)-2-Methyl-2,4-pentanediol, 98%
CAS: 107-41-5 Molecular Formula: C6H14O2 Molecular Weight (g/mol): 118.176 MDL Number: MFCD00004547 InChI Key: SVTBMSDMJJWYQN-UHFFFAOYSA-N Synonym: hexylene glycol,2-methyl-2,4-pentanediol,pinakon,2,4-dihydroxy-2-methylpentane,2,4-pentanediol, 2-methyl,diolane,isol,4-methyl-2,4-pentanediol,1,1,3-trimethyltrimethylenediol,2-methyl pentane-2,4-diol PubChem CID: 7870 ChEBI: CHEBI:62995 IUPAC Name: 2-methylpentane-2,4-diol SMILES: CC(CC(C)(C)O)O
| PubChem CID | 7870 |
|---|---|
| CAS | 107-41-5 |
| Molecular Weight (g/mol) | 118.176 |
| ChEBI | CHEBI:62995 |
| MDL Number | MFCD00004547 |
| SMILES | CC(CC(C)(C)O)O |
| Synonym | hexylene glycol,2-methyl-2,4-pentanediol,pinakon,2,4-dihydroxy-2-methylpentane,2,4-pentanediol, 2-methyl,diolane,isol,4-methyl-2,4-pentanediol,1,1,3-trimethyltrimethylenediol,2-methyl pentane-2,4-diol |
| IUPAC Name | 2-methylpentane-2,4-diol |
| InChI Key | SVTBMSDMJJWYQN-UHFFFAOYSA-N |
| Molecular Formula | C6H14O2 |
2,6-Dichloro-4-nitroaniline, 95%
CAS: 99-30-9 Molecular Formula: C6H4Cl2N2O2 Molecular Weight (g/mol): 207.01 MDL Number: MFCD00007677 InChI Key: BIXZHMJUSMUDOQ-UHFFFAOYSA-N Synonym: dichloran,dicloran,allisan,botran,dcna,ditranil,batran,bortran,resisan,dcna fungicide PubChem CID: 7430 ChEBI: CHEBI:27864 IUPAC Name: 2,6-dichloro-4-nitroaniline SMILES: C1=C(C=C(C(=C1Cl)N)Cl)[N+](=O)[O-]
| PubChem CID | 7430 |
|---|---|
| CAS | 99-30-9 |
| Molecular Weight (g/mol) | 207.01 |
| ChEBI | CHEBI:27864 |
| MDL Number | MFCD00007677 |
| SMILES | C1=C(C=C(C(=C1Cl)N)Cl)[N+](=O)[O-] |
| Synonym | dichloran,dicloran,allisan,botran,dcna,ditranil,batran,bortran,resisan,dcna fungicide |
| IUPAC Name | 2,6-dichloro-4-nitroaniline |
| InChI Key | BIXZHMJUSMUDOQ-UHFFFAOYSA-N |
| Molecular Formula | C6H4Cl2N2O2 |
N-Lauroylsarcosine, 98%, MP Biomedicals™
CAS: 137-16-6 Molecular Formula: C15H28NNaO3 Molecular Weight (g/mol): 293.38 MDL Number: MFCD00042728 InChI Key: KSAVQLQVUXSOCR-UHFFFAOYSA-M Synonym: sarkosyl nl,sodium lauroyl sarcosinate,n-lauroylsarcosine sodium salt,sodium n-lauroylsarcosinate,sodium lauroylsarcosinate,sarcosyl nl,maprosyl 30,compound 105,gardol,hamposyl l-30 PubChem CID: 23668817 IUPAC Name: sodium;2-[dodecanoyl(methyl)amino]acetate SMILES: [Na+].CCCCCCCCCCCC(=O)N(C)CC([O-])=O
| PubChem CID | 23668817 |
|---|---|
| CAS | 137-16-6 |
| Molecular Weight (g/mol) | 293.38 |
| MDL Number | MFCD00042728 |
| SMILES | [Na+].CCCCCCCCCCCC(=O)N(C)CC([O-])=O |
| Synonym | sarkosyl nl,sodium lauroyl sarcosinate,n-lauroylsarcosine sodium salt,sodium n-lauroylsarcosinate,sodium lauroylsarcosinate,sarcosyl nl,maprosyl 30,compound 105,gardol,hamposyl l-30 |
| IUPAC Name | sodium;2-[dodecanoyl(methyl)amino]acetate |
| InChI Key | KSAVQLQVUXSOCR-UHFFFAOYSA-M |
| Molecular Formula | C15H28NNaO3 |
Rubidium acetate, 99.8% (metals basis)
CAS: 563-67-7 Molecular Formula: C2H3O2Rb Molecular Weight (g/mol): 144.51 MDL Number: MFCD00013058 InChI Key: FOGKDYADEBOSPL-UHFFFAOYSA-M Synonym: rubidium acetate,acetic acid, rubidium salt,unii-86h795sz6d,acetic acid, rubidium salt 1:1,acetic acid rubidium,rubidio acetate,acmc-1aks3,rubidium 1+ acetate ion,rubidium 1+ ion acetate,c2h3o2.rb PubChem CID: 23673628 IUPAC Name: rubidium(1+);acetate SMILES: [Rb+].CC([O-])=O
| PubChem CID | 23673628 |
|---|---|
| CAS | 563-67-7 |
| Molecular Weight (g/mol) | 144.51 |
| MDL Number | MFCD00013058 |
| SMILES | [Rb+].CC([O-])=O |
| Synonym | rubidium acetate,acetic acid, rubidium salt,unii-86h795sz6d,acetic acid, rubidium salt 1:1,acetic acid rubidium,rubidio acetate,acmc-1aks3,rubidium 1+ acetate ion,rubidium 1+ ion acetate,c2h3o2.rb |
| IUPAC Name | rubidium(1+);acetate |
| InChI Key | FOGKDYADEBOSPL-UHFFFAOYSA-M |
| Molecular Formula | C2H3O2Rb |
alpha-Bisabolol, 96%
CAS: 515-69-5 Molecular Formula: C15H26O Molecular Weight (g/mol): 222.372 MDL Number: MFCD03846910 InChI Key: RGZSQWQPBWRIAQ-LSDHHAIUSA-N Synonym: bisabolol,alpha-bisabolol,+-alpha-bisabolol,d-alpha-bisabolol,.alpha.-bisabolol,+-1'r,2r-alpha-bisabolol,2r-6-methyl-2-1r-4-methylcyclohex-3-en-1-yl hept-5-en-2-ol,3-cyclohexene-1-methanol, .alpha.,4-dimethyl-.alpha.-4-methyl-3-pentenyl-, r*,r*,dsstox_cid_25964,dsstox_rid_81260 PubChem CID: 1549992 IUPAC Name: (2R)-6-methyl-2-[(1R)-4-methylcyclohex-3-en-1-yl]hept-5-en-2-ol SMILES: CC1=CCC(CC1)C(C)(CCC=C(C)C)O
| PubChem CID | 1549992 |
|---|---|
| CAS | 515-69-5 |
| Molecular Weight (g/mol) | 222.372 |
| MDL Number | MFCD03846910 |
| SMILES | CC1=CCC(CC1)C(C)(CCC=C(C)C)O |
| Synonym | bisabolol,alpha-bisabolol,+-alpha-bisabolol,d-alpha-bisabolol,.alpha.-bisabolol,+-1'r,2r-alpha-bisabolol,2r-6-methyl-2-1r-4-methylcyclohex-3-en-1-yl hept-5-en-2-ol,3-cyclohexene-1-methanol, .alpha.,4-dimethyl-.alpha.-4-methyl-3-pentenyl-, r*,r*,dsstox_cid_25964,dsstox_rid_81260 |
| IUPAC Name | (2R)-6-methyl-2-[(1R)-4-methylcyclohex-3-en-1-yl]hept-5-en-2-ol |
| InChI Key | RGZSQWQPBWRIAQ-LSDHHAIUSA-N |
| Molecular Formula | C15H26O |
2-Phenyl-2-imidazoline, 98+%, Thermo Scientific™
CAS: 936-49-2 Molecular Formula: C9H10N2 Molecular Weight (g/mol): 146.19 MDL Number: MFCD00005180 InChI Key: BKCCAYLNRIRKDJ-UHFFFAOYSA-N Synonym: 2-phenyl-2-imidazoline,2-phenylimidazoline,1h-imidazole, 4,5-dihydro-2-phenyl,2-imidazoline, 2-phenyl,4,5-dihydro-2-phenyl-1h-imidazole,2-phenyl imidazoline,2-phenyl-2-imidazolin,acmc-209rmt,labotest-bb lt00000058,5-23-06-00425 beilstein handbook reference PubChem CID: 13639 IUPAC Name: 2-phenyl-4,5-dihydro-1H-imidazole SMILES: C1CN=C(N1)C1=CC=CC=C1
| PubChem CID | 13639 |
|---|---|
| CAS | 936-49-2 |
| Molecular Weight (g/mol) | 146.19 |
| MDL Number | MFCD00005180 |
| SMILES | C1CN=C(N1)C1=CC=CC=C1 |
| Synonym | 2-phenyl-2-imidazoline,2-phenylimidazoline,1h-imidazole, 4,5-dihydro-2-phenyl,2-imidazoline, 2-phenyl,4,5-dihydro-2-phenyl-1h-imidazole,2-phenyl imidazoline,2-phenyl-2-imidazolin,acmc-209rmt,labotest-bb lt00000058,5-23-06-00425 beilstein handbook reference |
| IUPAC Name | 2-phenyl-4,5-dihydro-1H-imidazole |
| InChI Key | BKCCAYLNRIRKDJ-UHFFFAOYSA-N |
| Molecular Formula | C9H10N2 |
L-Glutathione, reduced, 97%
CAS: 70-18-8 Molecular Formula: C10H17N3O6S Molecular Weight (g/mol): 307.321 MDL Number: MFCD00065939 InChI Key: RWSXRVCMGQZWBV-WDSKDSINSA-N Synonym: glutathione,l-glutathione,glutathion,glutathione-sh,glutinal,isethion,tathion,reduced glutathione,deltathione,neuthion PubChem CID: 124886 ChEBI: CHEBI:16856 IUPAC Name: (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid SMILES: C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N
| PubChem CID | 124886 |
|---|---|
| CAS | 70-18-8 |
| Molecular Weight (g/mol) | 307.321 |
| ChEBI | CHEBI:16856 |
| MDL Number | MFCD00065939 |
| SMILES | C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N |
| Synonym | glutathione,l-glutathione,glutathion,glutathione-sh,glutinal,isethion,tathion,reduced glutathione,deltathione,neuthion |
| IUPAC Name | (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| InChI Key | RWSXRVCMGQZWBV-WDSKDSINSA-N |
| Molecular Formula | C10H17N3O6S |
Benzothiazole, 97%
CAS: 95-16-9 Molecular Formula: C7H5NS Molecular Weight (g/mol): 135.184 MDL Number: MFCD00005775 InChI Key: IOJUPLGTWVMSFF-UHFFFAOYSA-N Synonym: benzothiazole,benzo d thiazole,benzosulfonazole,1-thia-3-azaindene,vangard bt,benzothiazol,usaf ek-4812,benzthiazole,fema number 3256,unii-g5bw2593ep PubChem CID: 7222 ChEBI: CHEBI:45993 IUPAC Name: 1,3-benzothiazole SMILES: C1=CC=C2C(=C1)N=CS2
| PubChem CID | 7222 |
|---|---|
| CAS | 95-16-9 |
| Molecular Weight (g/mol) | 135.184 |
| ChEBI | CHEBI:45993 |
| MDL Number | MFCD00005775 |
| SMILES | C1=CC=C2C(=C1)N=CS2 |
| Synonym | benzothiazole,benzo d thiazole,benzosulfonazole,1-thia-3-azaindene,vangard bt,benzothiazol,usaf ek-4812,benzthiazole,fema number 3256,unii-g5bw2593ep |
| IUPAC Name | 1,3-benzothiazole |
| InChI Key | IOJUPLGTWVMSFF-UHFFFAOYSA-N |
| Molecular Formula | C7H5NS |
Sodium cyclamate, 99%
CAS: 139-05-9 Molecular Formula: C6H12NNaO3S Molecular Weight (g/mol): 201.22 MDL Number: MFCD00003827 InChI Key: UDIPTWFVPPPURJ-UHFFFAOYSA-M Synonym: sodium cyclamate,sodium cyclohexylsulfamate,sodium n-cyclohexylsulfamate,cyclamate sodium,cyclamic acid sodium salt,assugrin,ibiosuc,suessette,suestamin,sugarin PubChem CID: 23665706 ChEBI: CHEBI:82431 IUPAC Name: sodium;N-cyclohexylsulfamate SMILES: [Na+].[O-]S(=O)(=O)NC1CCCCC1
| PubChem CID | 23665706 |
|---|---|
| CAS | 139-05-9 |
| Molecular Weight (g/mol) | 201.22 |
| ChEBI | CHEBI:82431 |
| MDL Number | MFCD00003827 |
| SMILES | [Na+].[O-]S(=O)(=O)NC1CCCCC1 |
| Synonym | sodium cyclamate,sodium cyclohexylsulfamate,sodium n-cyclohexylsulfamate,cyclamate sodium,cyclamic acid sodium salt,assugrin,ibiosuc,suessette,suestamin,sugarin |
| IUPAC Name | sodium;N-cyclohexylsulfamate |
| InChI Key | UDIPTWFVPPPURJ-UHFFFAOYSA-M |
| Molecular Formula | C6H12NNaO3S |
Dimethyl Sulfone 99.0+%, TCI America™
CAS: 67-71-0 Molecular Formula: C2H6O2S Molecular Weight (g/mol): 94.13 MDL Number: MFCD00007566 InChI Key: HHVIBTZHLRERCL-UHFFFAOYSA-N Synonym: dimethyl sulfone,methyl sulfone,sulfonylbismethane,dimethylsulfone,dimethyl sulphone,methane, sulfonylbis,sulphonylbismethane,methylsulfone,methanesulfonylmethane,sulfonyldimethane PubChem CID: 6213 ChEBI: CHEBI:9349 IUPAC Name: methanesulfonylmethane SMILES: CS(C)(=O)=O
| PubChem CID | 6213 |
|---|---|
| CAS | 67-71-0 |
| Molecular Weight (g/mol) | 94.13 |
| ChEBI | CHEBI:9349 |
| MDL Number | MFCD00007566 |
| SMILES | CS(C)(=O)=O |
| Synonym | dimethyl sulfone,methyl sulfone,sulfonylbismethane,dimethylsulfone,dimethyl sulphone,methane, sulfonylbis,sulphonylbismethane,methylsulfone,methanesulfonylmethane,sulfonyldimethane |
| IUPAC Name | methanesulfonylmethane |
| InChI Key | HHVIBTZHLRERCL-UHFFFAOYSA-N |
| Molecular Formula | C2H6O2S |
Isobutyl Acetate 99.0+%, TCI America™
CAS: 110-19-0 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00008932 InChI Key: GJRQTCIYDGXPES-UHFFFAOYSA-N Synonym: isobutyl acetate,isobutyl ethanoate,acetic acid, 2-methylpropyl ester,2-methyl-1-propyl acetate,2-methylpropyl ethanoate,acetic acid, isobutyl ester,acetic acid isobutyl ester,acetate d'isobutyle,iso-butyl acetate,beta-methylpropyl ethanoate PubChem CID: 8038 ChEBI: CHEBI:50569 IUPAC Name: 2-methylpropyl acetate SMILES: CC(C)COC(C)=O
| PubChem CID | 8038 |
|---|---|
| CAS | 110-19-0 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:50569 |
| MDL Number | MFCD00008932 |
| SMILES | CC(C)COC(C)=O |
| Synonym | isobutyl acetate,isobutyl ethanoate,acetic acid, 2-methylpropyl ester,2-methyl-1-propyl acetate,2-methylpropyl ethanoate,acetic acid, isobutyl ester,acetic acid isobutyl ester,acetate d'isobutyle,iso-butyl acetate,beta-methylpropyl ethanoate |
| IUPAC Name | 2-methylpropyl acetate |
| InChI Key | GJRQTCIYDGXPES-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
N-Ethylmaleimide 98.0+%, TCI America™
CAS: 128-53-0 Molecular Formula: C6H7NO2 Molecular Weight (g/mol): 125.127 MDL Number: MFCD00005509 InChI Key: HDFGOPSGAURCEO-UHFFFAOYSA-N Synonym: n-ethylmaleimide,ethylmaleimide,1-ethyl-1h-pyrrole-2,5-dione,maleimide, n-ethyl,1h-pyrrole-2,5-dione, 1-ethyl,maleic acid n-ethylimide,nem,usaf b-121,unii-o3c74acm9v,maleic acid-n-ethylimide PubChem CID: 4362 ChEBI: CHEBI:44485 IUPAC Name: 1-ethylpyrrole-2,5-dione SMILES: CCN1C(=O)C=CC1=O
| PubChem CID | 4362 |
|---|---|
| CAS | 128-53-0 |
| Molecular Weight (g/mol) | 125.127 |
| ChEBI | CHEBI:44485 |
| MDL Number | MFCD00005509 |
| SMILES | CCN1C(=O)C=CC1=O |
| Synonym | n-ethylmaleimide,ethylmaleimide,1-ethyl-1h-pyrrole-2,5-dione,maleimide, n-ethyl,1h-pyrrole-2,5-dione, 1-ethyl,maleic acid n-ethylimide,nem,usaf b-121,unii-o3c74acm9v,maleic acid-n-ethylimide |
| IUPAC Name | 1-ethylpyrrole-2,5-dione |
| InChI Key | HDFGOPSGAURCEO-UHFFFAOYSA-N |
| Molecular Formula | C6H7NO2 |
Tetrakis(triphenylphosphine)palladium(0), 99.9%, (trace metal basis)
CAS: 14221-01-3 Molecular Formula: C72H60P4Pd Molecular Weight (g/mol): 1155.59 MDL Number: MFCD00010012 InChI Key: NFHFRUOZVGFOOS-UHFFFAOYSA-N Synonym: tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 PubChem CID: 11979704 IUPAC Name: palladium;triphenylphosphane SMILES: [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11979704 |
|---|---|
| CAS | 14221-01-3 |
| Molecular Weight (g/mol) | 1155.59 |
| MDL Number | MFCD00010012 |
| SMILES | [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 |
| IUPAC Name | palladium;triphenylphosphane |
| InChI Key | NFHFRUOZVGFOOS-UHFFFAOYSA-N |
| Molecular Formula | C72H60P4Pd |