Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Risperidone, 99%
CAS: 106266-06-2 Molecular Formula: C23H27FN4O2 Molecular Weight (g/mol): 410.49 InChI Key: RAPZEAPATHNIPO-UHFFFAOYSA-N Synonym: risperidone,risperidal,risperdal,risperdal consta,rispolept,risperin,rispolin,sequinan,risperidona,risperidonum PubChem CID: 5073 ChEBI: CHEBI:8871 IUPAC Name: 3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one SMILES: CC1=C(C(=O)N2CCCCC2=N1)CCN3CCC(CC3)C4=NOC5=C4C=CC(=C5)F
| PubChem CID | 5073 |
|---|---|
| CAS | 106266-06-2 |
| Molecular Weight (g/mol) | 410.49 |
| ChEBI | CHEBI:8871 |
| SMILES | CC1=C(C(=O)N2CCCCC2=N1)CCN3CCC(CC3)C4=NOC5=C4C=CC(=C5)F |
| Synonym | risperidone,risperidal,risperdal,risperdal consta,rispolept,risperin,rispolin,sequinan,risperidona,risperidonum |
| IUPAC Name | 3-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
| InChI Key | RAPZEAPATHNIPO-UHFFFAOYSA-N |
| Molecular Formula | C23H27FN4O2 |
Phenyl phosphate disodium salt hydrate, 98%
CAS: 3279-54-7 Molecular Formula: C6H5Na2O4P Molecular Weight (g/mol): 218.06 MDL Number: MFCD00002133 InChI Key: TYJOJLOWRIQYQM-UHFFFAOYSA-L Synonym: disodium phenyl phosphate,phenyl phosphate disodium salt,disodium phenylphosphate,phenyldisodium phosphate,phosphoric acid, monophenyl ester, disodium salt,phenyl disodium orthophosphate,phenyl phosphate,phosphoric acid, monophenyl ester, sodium salt 1:2,disodium phenyl phosphate dihydrate,phenyl phosphate disodium salt dihydrate PubChem CID: 76771 IUPAC Name: disodium;phenyl phosphate SMILES: [Na+].[Na+].[O-]P([O-])(=O)OC1=CC=CC=C1
| PubChem CID | 76771 |
|---|---|
| CAS | 3279-54-7 |
| Molecular Weight (g/mol) | 218.06 |
| MDL Number | MFCD00002133 |
| SMILES | [Na+].[Na+].[O-]P([O-])(=O)OC1=CC=CC=C1 |
| Synonym | disodium phenyl phosphate,phenyl phosphate disodium salt,disodium phenylphosphate,phenyldisodium phosphate,phosphoric acid, monophenyl ester, disodium salt,phenyl disodium orthophosphate,phenyl phosphate,phosphoric acid, monophenyl ester, sodium salt 1:2,disodium phenyl phosphate dihydrate,phenyl phosphate disodium salt dihydrate |
| IUPAC Name | disodium;phenyl phosphate |
| InChI Key | TYJOJLOWRIQYQM-UHFFFAOYSA-L |
| Molecular Formula | C6H5Na2O4P |
2-Methylbenzyl alcohol, 98%
CAS: 89-95-2 Molecular Formula: C8H10O Molecular Weight (g/mol): 122.167 MDL Number: MFCD00004622 InChI Key: XPNGNIFUDRPBFJ-UHFFFAOYSA-N Synonym: 2-methylbenzyl alcohol,o-tolylmethanol,o-tolyl alcohol,2-methylphenyl methanol,o-methylbenzyl alcohol,benzenemethanol, 2-methyl,toluene-methanol,benzyl alcohol, o-methyl,unii-7l3m6y04nc,alpha-hydroxy-o-xylene PubChem CID: 6994 ChEBI: CHEBI:27724 IUPAC Name: (2-methylphenyl)methanol SMILES: CC1=CC=CC=C1CO
| PubChem CID | 6994 |
|---|---|
| CAS | 89-95-2 |
| Molecular Weight (g/mol) | 122.167 |
| ChEBI | CHEBI:27724 |
| MDL Number | MFCD00004622 |
| SMILES | CC1=CC=CC=C1CO |
| Synonym | 2-methylbenzyl alcohol,o-tolylmethanol,o-tolyl alcohol,2-methylphenyl methanol,o-methylbenzyl alcohol,benzenemethanol, 2-methyl,toluene-methanol,benzyl alcohol, o-methyl,unii-7l3m6y04nc,alpha-hydroxy-o-xylene |
| IUPAC Name | (2-methylphenyl)methanol |
| InChI Key | XPNGNIFUDRPBFJ-UHFFFAOYSA-N |
| Molecular Formula | C8H10O |
3,4,6-Tri-O-benzyl-D-glucal, 97%
CAS: 55628-54-1 Molecular Formula: C27H28O4 Molecular Weight (g/mol): 416.517 MDL Number: MFCD00061640 InChI Key: MXYLLYBWXIUMIT-PFBJBMPXSA-N Synonym: 3,4,6-tri-o-benzyl-d-glucal,tri-o-benzyl-d-glucal,2r,3s,4r-3,4-bis benzyloxy-2-benzyloxy methyl-3,4-dihydro-2h-pyran,pubchem10548,1,5-anhydro-3,4,6-tri-o-benzyl-2-deoxy-d-arabinohex-1-enitol,1,5-anhydro-2-deoxy-d-arabino-hex-1-enitol 3,4,6-tribenzyl ether PubChem CID: 11742644 IUPAC Name: (2R,3S,4R)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran SMILES: C1=CC=C(C=C1)COCC2C(C(C=CO2)OCC3=CC=CC=C3)OCC4=CC=CC=C4
| PubChem CID | 11742644 |
|---|---|
| CAS | 55628-54-1 |
| Molecular Weight (g/mol) | 416.517 |
| MDL Number | MFCD00061640 |
| SMILES | C1=CC=C(C=C1)COCC2C(C(C=CO2)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |
| Synonym | 3,4,6-tri-o-benzyl-d-glucal,tri-o-benzyl-d-glucal,2r,3s,4r-3,4-bis benzyloxy-2-benzyloxy methyl-3,4-dihydro-2h-pyran,pubchem10548,1,5-anhydro-3,4,6-tri-o-benzyl-2-deoxy-d-arabinohex-1-enitol,1,5-anhydro-2-deoxy-d-arabino-hex-1-enitol 3,4,6-tribenzyl ether |
| IUPAC Name | (2R,3S,4R)-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran |
| InChI Key | MXYLLYBWXIUMIT-PFBJBMPXSA-N |
| Molecular Formula | C27H28O4 |
Dimethyl fumarate, 99%
CAS: 624-49-7 Molecular Formula: C6H8O4 Molecular Weight (g/mol): 144.126 MDL Number: MFCD00064438 InChI Key: LDCRTTXIJACKKU-ONEGZZNKSA-N Synonym: dimethyl fumarate,tecfidera,e-dimethyl fumarate,fumaderm,dimethyl e-but-2-enedioate,fumaric acid, dimethyl ester,boletic acid dimethyl ester,fumaric acid dimethyl ester,methyl fumarate,dimethyl trans-ethylenedicarboxylate PubChem CID: 637568 ChEBI: CHEBI:76004 IUPAC Name: dimethyl (E)-but-2-enedioate SMILES: COC(=O)C=CC(=O)OC
| PubChem CID | 637568 |
|---|---|
| CAS | 624-49-7 |
| Molecular Weight (g/mol) | 144.126 |
| ChEBI | CHEBI:76004 |
| MDL Number | MFCD00064438 |
| SMILES | COC(=O)C=CC(=O)OC |
| Synonym | dimethyl fumarate,tecfidera,e-dimethyl fumarate,fumaderm,dimethyl e-but-2-enedioate,fumaric acid, dimethyl ester,boletic acid dimethyl ester,fumaric acid dimethyl ester,methyl fumarate,dimethyl trans-ethylenedicarboxylate |
| IUPAC Name | dimethyl (E)-but-2-enedioate |
| InChI Key | LDCRTTXIJACKKU-ONEGZZNKSA-N |
| Molecular Formula | C6H8O4 |
Ethyl 2-bromopropionate, 98+%
CAS: 535-11-5 Molecular Formula: C5H9BrO2 Molecular Weight (g/mol): 181.03 MDL Number: MFCD00000144 InChI Key: ARFLASKVLJTEJD-UHFFFAOYNA-N Synonym: ethyl 2-bromopropionate,ethyl alpha-bromopropionate,ethyl-2-bromopropionate,2-bromopropanoic acid ethyl ester,propanoic acid, 2-bromo-, ethyl ester,alpha-bromopropionic acid ethyl ester,ethyl a-bromopropionate,dl-ethyl 2-bromopropionate,2-bromopropionic acid ethyl ester,ethyl alpha-bromopropanoate PubChem CID: 79040 IUPAC Name: ethyl 2-bromopropanoate SMILES: CCOC(=O)C(C)Br
| PubChem CID | 79040 |
|---|---|
| CAS | 535-11-5 |
| Molecular Weight (g/mol) | 181.03 |
| MDL Number | MFCD00000144 |
| SMILES | CCOC(=O)C(C)Br |
| Synonym | ethyl 2-bromopropionate,ethyl alpha-bromopropionate,ethyl-2-bromopropionate,2-bromopropanoic acid ethyl ester,propanoic acid, 2-bromo-, ethyl ester,alpha-bromopropionic acid ethyl ester,ethyl a-bromopropionate,dl-ethyl 2-bromopropionate,2-bromopropionic acid ethyl ester,ethyl alpha-bromopropanoate |
| IUPAC Name | ethyl 2-bromopropanoate |
| InChI Key | ARFLASKVLJTEJD-UHFFFAOYNA-N |
| Molecular Formula | C5H9BrO2 |
Methyl crotonate, 96%, trans-isomer
CAS: 623-43-8 Molecular Formula: C5H8O2 Molecular Weight (g/mol): 100.12 MDL Number: MFCD00009287 InChI Key: MCVVUJPXSBQTRZ-ONEGZZNKSA-N Synonym: methyl crotonate,e-methyl but-2-enoate,trans-methyl crotonate,methyl e-crotonate,methyl 2-butenoate,methyl trans-crotonate,2-butenoic acid, methyl ester, 2e,trans-2-butenoic acid methyl ester,methyl trans-2-butenoate,e-crotonic acid methyl ester PubChem CID: 638132 IUPAC Name: methyl (E)-but-2-enoate SMILES: COC(=O)\C=C\C
| PubChem CID | 638132 |
|---|---|
| CAS | 623-43-8 |
| Molecular Weight (g/mol) | 100.12 |
| MDL Number | MFCD00009287 |
| SMILES | COC(=O)\C=C\C |
| Synonym | methyl crotonate,e-methyl but-2-enoate,trans-methyl crotonate,methyl e-crotonate,methyl 2-butenoate,methyl trans-crotonate,2-butenoic acid, methyl ester, 2e,trans-2-butenoic acid methyl ester,methyl trans-2-butenoate,e-crotonic acid methyl ester |
| IUPAC Name | methyl (E)-but-2-enoate |
| InChI Key | MCVVUJPXSBQTRZ-ONEGZZNKSA-N |
| Molecular Formula | C5H8O2 |
3-Amino-1,2,4-triazole, 96.1%, MP Biomedicals™
CAS: 61-82-5 Molecular Formula: C2H4N4 Molecular Weight (g/mol): 84.08 MDL Number: MFCD00005230,MFCD00053362 InChI Key: KLSJWNVTNUYHDU-UHFFFAOYSA-N Synonym: 3-amino-1,2,4-triazole,amitrole,aminotriazole,4h-1,2,4-triazol-3-amine,1h-1,2,4-triazol-3-amine,amitrol,amerol,amizol,emisol,vorox PubChem CID: 1639 ChEBI: CHEBI:40036 IUPAC Name: 1H-1,2,4-triazol-5-amine SMILES: NC1=NC=NN1
| PubChem CID | 1639 |
|---|---|
| CAS | 61-82-5 |
| Molecular Weight (g/mol) | 84.08 |
| ChEBI | CHEBI:40036 |
| MDL Number | MFCD00005230,MFCD00053362 |
| SMILES | NC1=NC=NN1 |
| Synonym | 3-amino-1,2,4-triazole,amitrole,aminotriazole,4h-1,2,4-triazol-3-amine,1h-1,2,4-triazol-3-amine,amitrol,amerol,amizol,emisol,vorox |
| IUPAC Name | 1H-1,2,4-triazol-5-amine |
| InChI Key | KLSJWNVTNUYHDU-UHFFFAOYSA-N |
| Molecular Formula | C2H4N4 |
5-Methoxyisatin, 97%
CAS: 39755-95-8 Molecular Formula: C9H7NO3 Molecular Weight (g/mol): 177.16 MDL Number: MFCD00169023 InChI Key: DMHGXMPXHPOXBF-UHFFFAOYSA-N Synonym: 5-methoxyisatin,5-methoxyindoline-2,3-dione,5-methoxy-2,3-indolinedione,1h-indole-2,3-dione, 5-methoxy,5-methoxy-indole-2,3-dione,5-methoxy isatin,5-methoxyindole-2,3-dione,5-methoxy-2,3-dihydro-1h-indole-2,3-dione,indole-2,3-dione, 5-methoxy,1h-indole-2,3-dione, 5-methoxy-9ci PubChem CID: 38333 IUPAC Name: 5-methoxy-1H-indole-2,3-dione SMILES: COC1=CC=C2NC(=O)C(=O)C2=C1
| PubChem CID | 38333 |
|---|---|
| CAS | 39755-95-8 |
| Molecular Weight (g/mol) | 177.16 |
| MDL Number | MFCD00169023 |
| SMILES | COC1=CC=C2NC(=O)C(=O)C2=C1 |
| Synonym | 5-methoxyisatin,5-methoxyindoline-2,3-dione,5-methoxy-2,3-indolinedione,1h-indole-2,3-dione, 5-methoxy,5-methoxy-indole-2,3-dione,5-methoxy isatin,5-methoxyindole-2,3-dione,5-methoxy-2,3-dihydro-1h-indole-2,3-dione,indole-2,3-dione, 5-methoxy,1h-indole-2,3-dione, 5-methoxy-9ci |
| IUPAC Name | 5-methoxy-1H-indole-2,3-dione |
| InChI Key | DMHGXMPXHPOXBF-UHFFFAOYSA-N |
| Molecular Formula | C9H7NO3 |
Thermo Scientific Chemicals L(+)-Histidine methyl ester dihydrochloride, 97%
CAS: 7389-87-9 Molecular Formula: C7H11ClN3O2 Molecular Weight (g/mol): 204.63 MDL Number: MFCD00012701 InChI Key: VXXIPPPPKNWFLK-UHFFFAOYNA-N Synonym: l-histidine methyl ester dihydrochloride,h-his-ome.2hcl,methyl l-histidinate dihydrochloride,l-histidine, methyl ester, dihydrochloride,s-methyl 2-amino-3-1h-imidazol-4-yl propanoate dihydrochloride,l-+-histidine methyl ester dihydrochloride,methyl 2s-2-amino-3-1h-imidazol-4-yl propanoate dihydrochloride,methyl 2s-2-amino-3-3h-imidazol-4-yl propanoate dihydrochloride,histidine methyl ester dihydrochloride,c7h11n3o2.2hcl PubChem CID: 2723645 IUPAC Name: methyl (2S)-2-amino-3-(1H-imidazol-5-yl)propanoate;dihydrochloride SMILES: [Cl].COC(=O)C(N)CC1=CN=CN1
| PubChem CID | 2723645 |
|---|---|
| CAS | 7389-87-9 |
| Molecular Weight (g/mol) | 204.63 |
| MDL Number | MFCD00012701 |
| SMILES | [Cl].COC(=O)C(N)CC1=CN=CN1 |
| Synonym | l-histidine methyl ester dihydrochloride,h-his-ome.2hcl,methyl l-histidinate dihydrochloride,l-histidine, methyl ester, dihydrochloride,s-methyl 2-amino-3-1h-imidazol-4-yl propanoate dihydrochloride,l-+-histidine methyl ester dihydrochloride,methyl 2s-2-amino-3-1h-imidazol-4-yl propanoate dihydrochloride,methyl 2s-2-amino-3-3h-imidazol-4-yl propanoate dihydrochloride,histidine methyl ester dihydrochloride,c7h11n3o2.2hcl |
| IUPAC Name | methyl (2S)-2-amino-3-(1H-imidazol-5-yl)propanoate;dihydrochloride |
| InChI Key | VXXIPPPPKNWFLK-UHFFFAOYNA-N |
| Molecular Formula | C7H11ClN3O2 |
Zinc acetate dihydrate, 97+%
CAS: 5970-45-6 Molecular Formula: C4H10O6Zn MDL Number: MFCD00066961 InChI Key: BEAZKUGSCHFXIQ-UHFFFAOYSA-L Synonym: zinc acetate dihydrate,zinc diacetate dihydrate,zinc ii acetate dihydrate,unii-fm5526k07a,acetic acid zinc salt,zinc acetate usp,acetic acid, zinc salt, dihydrate,zinc acetate, dihydrate,galzin tn PubChem CID: 2724192 IUPAC Name: zinc;diacetate;dihydrate
| PubChem CID | 2724192 |
|---|---|
| CAS | 5970-45-6 |
| MDL Number | MFCD00066961 |
| Synonym | zinc acetate dihydrate,zinc diacetate dihydrate,zinc ii acetate dihydrate,unii-fm5526k07a,acetic acid zinc salt,zinc acetate usp,acetic acid, zinc salt, dihydrate,zinc acetate, dihydrate,galzin tn |
| IUPAC Name | zinc;diacetate;dihydrate |
| InChI Key | BEAZKUGSCHFXIQ-UHFFFAOYSA-L |
| Molecular Formula | C4H10O6Zn |
Sodium hippurate, 96%
CAS: 532-94-5 Molecular Formula: C9H8NNaO3 Molecular Weight (g/mol): 201.157 MDL Number: MFCD00002693 InChI Key: ZBCAZEFVTIBZJS-UHFFFAOYSA-M Synonym: sodium hippurate,hippuric acid sodium salt,sodium 2-benzamidoacetate,n-benzoylglycine sodium salt,glycine, n-benzoyl-, monosodium salt,ccris 5812,hippuric acid, monosodium salt,glycine, n-benzoyl-, sodium salt 1:1,hippurate sodium,benzoylaminoacetic acid sodium salt PubChem CID: 516953 IUPAC Name: sodium;2-benzamidoacetate SMILES: C1=CC=C(C=C1)C(=O)NCC(=O)[O-].[Na+]
| PubChem CID | 516953 |
|---|---|
| CAS | 532-94-5 |
| Molecular Weight (g/mol) | 201.157 |
| MDL Number | MFCD00002693 |
| SMILES | C1=CC=C(C=C1)C(=O)NCC(=O)[O-].[Na+] |
| Synonym | sodium hippurate,hippuric acid sodium salt,sodium 2-benzamidoacetate,n-benzoylglycine sodium salt,glycine, n-benzoyl-, monosodium salt,ccris 5812,hippuric acid, monosodium salt,glycine, n-benzoyl-, sodium salt 1:1,hippurate sodium,benzoylaminoacetic acid sodium salt |
| IUPAC Name | sodium;2-benzamidoacetate |
| InChI Key | ZBCAZEFVTIBZJS-UHFFFAOYSA-M |
| Molecular Formula | C9H8NNaO3 |
2-Phenylphenol, 99%
CAS: 90-43-7 Molecular Formula: C12H10O Molecular Weight (g/mol): 170.21 MDL Number: MFCD00002208 InChI Key: LLEMOWNGBBNAJR-UHFFFAOYSA-N Synonym: 2-hydroxybiphenyl,o-phenylphenol,biphenyl-2-ol,2-biphenylol,o-hydroxybiphenyl,2-hydroxydiphenyl,o-hydroxydiphenyl,phenylphenol,biphenylol,1,1'-biphenyl-2-ol PubChem CID: 7017 ChEBI: CHEBI:17043 SMILES: OC1=CC=CC=C1C1=CC=CC=C1
| PubChem CID | 7017 |
|---|---|
| CAS | 90-43-7 |
| Molecular Weight (g/mol) | 170.21 |
| ChEBI | CHEBI:17043 |
| MDL Number | MFCD00002208 |
| SMILES | OC1=CC=CC=C1C1=CC=CC=C1 |
| Synonym | 2-hydroxybiphenyl,o-phenylphenol,biphenyl-2-ol,2-biphenylol,o-hydroxybiphenyl,2-hydroxydiphenyl,o-hydroxydiphenyl,phenylphenol,biphenylol,1,1'-biphenyl-2-ol |
| InChI Key | LLEMOWNGBBNAJR-UHFFFAOYSA-N |
| Molecular Formula | C12H10O |
Magnesium lactate trihydrate, 99%
CAS: 18917-96-9 Molecular Formula: C6H16MgO9 Molecular Weight (g/mol): 256.49 MDL Number: MFCD00156534 Synonym: magnesium lactate trihydrate,c6h10mgo6.3h2o,2-hydroxypropanoyl oxy magnesio 2-hydroxypropanoate trihydrate PubChem CID: 91668363 IUPAC Name: magnesium;2-hydroxypropanoate;trihydrate
| PubChem CID | 91668363 |
|---|---|
| CAS | 18917-96-9 |
| Molecular Weight (g/mol) | 256.49 |
| MDL Number | MFCD00156534 |
| Synonym | magnesium lactate trihydrate,c6h10mgo6.3h2o,2-hydroxypropanoyl oxy magnesio 2-hydroxypropanoate trihydrate |
| IUPAC Name | magnesium;2-hydroxypropanoate;trihydrate |
| Molecular Formula | C6H16MgO9 |
Isopropyl ether, for analysis, stabilized
CAS: 108-20-3 Molecular Formula: C6H14O Molecular Weight (g/mol): 102.18 MDL Number: MFCD00008880 InChI Key: ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Synonym: diisopropyl ether,isopropyl ether,propane, 2,2'-oxybis,2-isopropoxypropane,diisopropyl oxide,diisopropylether,ether, isopropyl,2,2'-oxydipropane,isopropylether,bis isopropyl ether PubChem CID: 7914 IUPAC Name: 2-propan-2-yloxypropane SMILES: CC(C)OC(C)C
| PubChem CID | 7914 |
|---|---|
| CAS | 108-20-3 |
| Molecular Weight (g/mol) | 102.18 |
| MDL Number | MFCD00008880 |
| SMILES | CC(C)OC(C)C |
| Synonym | diisopropyl ether,isopropyl ether,propane, 2,2'-oxybis,2-isopropoxypropane,diisopropyl oxide,diisopropylether,ether, isopropyl,2,2'-oxydipropane,isopropylether,bis isopropyl ether |
| IUPAC Name | 2-propan-2-yloxypropane |
| InChI Key | ZAFNJMIOTHYJRJ-UHFFFAOYSA-N |
| Molecular Formula | C6H14O |