Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
1,10-Phenanthroline monohydrate, ACS
CAS: 5144-89-8 Molecular Formula: C12H10N2O Molecular Weight (g/mol): 198.23 MDL Number: MFCD00149973 InChI Key: PPQJCISYYXZCAE-UHFFFAOYSA-N Synonym: 1,10-phenanthroline hydrate,1,10-phenanthroline monohydrate,o-phenanthroline monohydrate,unii-ksx215x00e,1,10-fenantrolina,4,5-phenanthroline monohydrate,1,10-phenanthroline, monohydrate,1,10-fenanthrolin,1,10-phenanthrolineo-phenanthroline,1, 10-phenanthroline monohydrate PubChem CID: 21226 IUPAC Name: 1,10-phenanthroline;hydrate SMILES: O.C1=CN=C2C(C=CC3=CC=CN=C23)=C1
| PubChem CID | 21226 |
|---|---|
| CAS | 5144-89-8 |
| Molecular Weight (g/mol) | 198.23 |
| MDL Number | MFCD00149973 |
| SMILES | O.C1=CN=C2C(C=CC3=CC=CN=C23)=C1 |
| Synonym | 1,10-phenanthroline hydrate,1,10-phenanthroline monohydrate,o-phenanthroline monohydrate,unii-ksx215x00e,1,10-fenantrolina,4,5-phenanthroline monohydrate,1,10-phenanthroline, monohydrate,1,10-fenanthrolin,1,10-phenanthrolineo-phenanthroline,1, 10-phenanthroline monohydrate |
| IUPAC Name | 1,10-phenanthroline;hydrate |
| InChI Key | PPQJCISYYXZCAE-UHFFFAOYSA-N |
| Molecular Formula | C12H10N2O |
2,3,5-Triphenyl-2H-tetrazolium chloride, 98%
CAS: 298-96-4 Molecular Formula: C19H15ClN4 Molecular Weight (g/mol): 334.81 MDL Number: MFCD00011963 InChI Key: PKDBCJSWQUOKDO-UHFFFAOYSA-M Synonym: 2,3,5-triphenyltetrazolium chloride,tetrazolium red,uroscreen,red tetrazolium,urocheck,vitastain,tetrazolium chloride,triphenyltetrazolium chloride,2,3,5-triphenyl-2h-tetrazolium chloride,tetrazolium chloride PubChem CID: 9283 ChEBI: CHEBI:78019 IUPAC Name: 2,3,5-triphenyltetrazol-2-ium;chloride SMILES: [Cl-].C1=CC=C(C=C1)N1N=C(N=[N+]1C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 9283 |
|---|---|
| CAS | 298-96-4 |
| Molecular Weight (g/mol) | 334.81 |
| ChEBI | CHEBI:78019 |
| MDL Number | MFCD00011963 |
| SMILES | [Cl-].C1=CC=C(C=C1)N1N=C(N=[N+]1C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 2,3,5-triphenyltetrazolium chloride,tetrazolium red,uroscreen,red tetrazolium,urocheck,vitastain,tetrazolium chloride,triphenyltetrazolium chloride,2,3,5-triphenyl-2h-tetrazolium chloride,tetrazolium chloride |
| IUPAC Name | 2,3,5-triphenyltetrazol-2-ium;chloride |
| InChI Key | PKDBCJSWQUOKDO-UHFFFAOYSA-M |
| Molecular Formula | C19H15ClN4 |
Iodoacetamide, 98%
CAS: 144-48-9 Molecular Formula: C2H4INO Molecular Weight (g/mol): 184.96 InChI Key: PGLTVOMIXTUURA-UHFFFAOYSA-N Synonym: iodoacetamide,monoiodoacetamide,surauto,acetamide, 2-iodo,2-iodo-acetamide,usaf d-1,alpha-iodoacetamide,ccris 7710,unii-zrh8m27s79,n-3-methoxy-4-butoxybenzyl thiobarbituric acid PubChem CID: 3727 IUPAC Name: 2-iodoacetamide SMILES: C(C(=O)N)I
| PubChem CID | 3727 |
|---|---|
| CAS | 144-48-9 |
| Molecular Weight (g/mol) | 184.96 |
| SMILES | C(C(=O)N)I |
| Synonym | iodoacetamide,monoiodoacetamide,surauto,acetamide, 2-iodo,2-iodo-acetamide,usaf d-1,alpha-iodoacetamide,ccris 7710,unii-zrh8m27s79,n-3-methoxy-4-butoxybenzyl thiobarbituric acid |
| IUPAC Name | 2-iodoacetamide |
| InChI Key | PGLTVOMIXTUURA-UHFFFAOYSA-N |
| Molecular Formula | C2H4INO |
Triethanolamine, 97%, Thermo Scientific Chemicals
CAS: 102-71-6 Molecular Formula: C6H15NO3 Molecular Weight (g/mol): 149.19 MDL Number: MFCD00002855 InChI Key: GSEJCLTVZPLZKY-UHFFFAOYSA-N Synonym: triethanolamine,trolamine,2,2',2-nitrilotriethanol,sterolamide,daltogen,tris 2-hydroxyethyl amine,triethylolamine,nitrilotriethanol,trihydroxytriethylamine,thiofaco t-35 PubChem CID: 7618 ChEBI: CHEBI:28621 IUPAC Name: 2-[bis(2-hydroxyethyl)amino]ethan-1-ol SMILES: OCCN(CCO)CCO
| PubChem CID | 7618 |
|---|---|
| CAS | 102-71-6 |
| Molecular Weight (g/mol) | 149.19 |
| ChEBI | CHEBI:28621 |
| MDL Number | MFCD00002855 |
| SMILES | OCCN(CCO)CCO |
| Synonym | triethanolamine,trolamine,2,2',2-nitrilotriethanol,sterolamide,daltogen,tris 2-hydroxyethyl amine,triethylolamine,nitrilotriethanol,trihydroxytriethylamine,thiofaco t-35 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethan-1-ol |
| InChI Key | GSEJCLTVZPLZKY-UHFFFAOYSA-N |
| Molecular Formula | C6H15NO3 |
n-Dodecane, 99%, pure
CAS: 112-40-3 Molecular Weight (g/mol): 170.34 MDL Number: MFCD00008969 InChI Key: SNRUBQQJIBEYMU-UHFFFAOYSA-N Synonym: n-dodecane,dihexyl,bihexyl,adakane 12,n-dodecan,n-dodecan german,duodecane,alkanes, c10-14,undecane, methyl,ccris 661 PubChem CID: 8182 ChEBI: CHEBI:28817 IUPAC Name: dodecane SMILES: CCCCCCCCCCCC
| PubChem CID | 8182 |
|---|---|
| CAS | 112-40-3 |
| Molecular Weight (g/mol) | 170.34 |
| ChEBI | CHEBI:28817 |
| MDL Number | MFCD00008969 |
| SMILES | CCCCCCCCCCCC |
| Synonym | n-dodecane,dihexyl,bihexyl,adakane 12,n-dodecan,n-dodecan german,duodecane,alkanes, c10-14,undecane, methyl,ccris 661 |
| IUPAC Name | dodecane |
| InChI Key | SNRUBQQJIBEYMU-UHFFFAOYSA-N |
1,5-Diphenylcarbazide, ACS
CAS: 140-22-7 Molecular Formula: C13H14N4O Molecular Weight (g/mol): 242.282 MDL Number: MFCD00003013 InChI Key: KSPIHGBHKVISFI-UHFFFAOYSA-N Synonym: 1,5-diphenylcarbazide,diphenylcarbazide,1,5-diphenylcarbohydrazide,carbonic dihydrazide, 2,2'-diphenyl,1,5-diphenylcarbonohydrazide,1,5-diphenylcabohydrazide,sym-diphenylcarbazide,n,n'-diphenylcarbazide,2,2'-diphenylcarbazide,carbohydrazide, 1,5-diphenyl PubChem CID: 8789 ChEBI: CHEBI:4641 IUPAC Name: 1,3-dianilinourea SMILES: C1=CC=C(C=C1)NNC(=O)NNC2=CC=CC=C2
| PubChem CID | 8789 |
|---|---|
| CAS | 140-22-7 |
| Molecular Weight (g/mol) | 242.282 |
| ChEBI | CHEBI:4641 |
| MDL Number | MFCD00003013 |
| SMILES | C1=CC=C(C=C1)NNC(=O)NNC2=CC=CC=C2 |
| Synonym | 1,5-diphenylcarbazide,diphenylcarbazide,1,5-diphenylcarbohydrazide,carbonic dihydrazide, 2,2'-diphenyl,1,5-diphenylcarbonohydrazide,1,5-diphenylcabohydrazide,sym-diphenylcarbazide,n,n'-diphenylcarbazide,2,2'-diphenylcarbazide,carbohydrazide, 1,5-diphenyl |
| IUPAC Name | 1,3-dianilinourea |
| InChI Key | KSPIHGBHKVISFI-UHFFFAOYSA-N |
| Molecular Formula | C13H14N4O |
Sodium pyruvate, 99%
CAS: 113-24-6 Molecular Formula: C3H3NaO3 Molecular Weight (g/mol): 110.044 MDL Number: MFCD00002586 InChI Key: DAEPDZWVDSPTHF-UHFFFAOYSA-M Synonym: sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 PubChem CID: 23662274 ChEBI: CHEBI:50144 IUPAC Name: sodium;2-oxopropanoate SMILES: CC(=O)C(=O)[O-].[Na+]
| PubChem CID | 23662274 |
|---|---|
| CAS | 113-24-6 |
| Molecular Weight (g/mol) | 110.044 |
| ChEBI | CHEBI:50144 |
| MDL Number | MFCD00002586 |
| SMILES | CC(=O)C(=O)[O-].[Na+] |
| Synonym | sodium pyruvate,pyruvic acid sodium salt,sodium 2-oxopropanoate,pyruvic acid, sodium salt,propanoic acid, 2-oxo-, sodium salt,sodium alpha-ketopropionate,pyruvate sodium,unii-pod38aif08,2-oxopropanoic acid sodium salt,pod38aif08 |
| IUPAC Name | sodium;2-oxopropanoate |
| InChI Key | DAEPDZWVDSPTHF-UHFFFAOYSA-M |
| Molecular Formula | C3H3NaO3 |
Sodium 1-Hexanesulfonate Monohydrate, 99%
CAS: 207300-91-2 Molecular Formula: C6H15NaO4S Molecular Weight (g/mol): 206.232 MDL Number: MFCD00149549 InChI Key: CLCGFJYKZGFGSQ-UHFFFAOYSA-M Synonym: 1-hexanesulfonic acid sodium salt monohydrate,sodium hexane-1-sulfonate hydrate,sodium 1-hexanesulfonate monohydrate,n-1-hexanesulfonic acid,sodium 1-hexanesulfonate hydrate,sodium n-hexanesulfonate monohydrate,potassium hexane-1-sulfonate hydrate,sodium hexane-1-sulphonate monohydrate,sodium hexane-1-sulfonate-water 1/1/1,1-hexanesulfonic acid,sodium salt, hydrate 1:1:1 PubChem CID: 23696962 IUPAC Name: sodium;hexane-1-sulfonate;hydrate SMILES: CCCCCCS(=O)(=O)[O-].O.[Na+]
| PubChem CID | 23696962 |
|---|---|
| CAS | 207300-91-2 |
| Molecular Weight (g/mol) | 206.232 |
| MDL Number | MFCD00149549 |
| SMILES | CCCCCCS(=O)(=O)[O-].O.[Na+] |
| Synonym | 1-hexanesulfonic acid sodium salt monohydrate,sodium hexane-1-sulfonate hydrate,sodium 1-hexanesulfonate monohydrate,n-1-hexanesulfonic acid,sodium 1-hexanesulfonate hydrate,sodium n-hexanesulfonate monohydrate,potassium hexane-1-sulfonate hydrate,sodium hexane-1-sulphonate monohydrate,sodium hexane-1-sulfonate-water 1/1/1,1-hexanesulfonic acid,sodium salt, hydrate 1:1:1 |
| IUPAC Name | sodium;hexane-1-sulfonate;hydrate |
| InChI Key | CLCGFJYKZGFGSQ-UHFFFAOYSA-M |
| Molecular Formula | C6H15NaO4S |
Imidazole, 99%
CAS: 288-32-4 Molecular Formula: C3H4N2 Molecular Weight (g/mol): 68.08 MDL Number: MFCD00005183 InChI Key: RAXXELZNTBOGNW-UHFFFAOYSA-N Synonym: imidazole,glyoxaline,imidazol,iminazole,miazole,1,3-diazole,glyoxalin,imutex,1,3-diaza-2,4-cyclopentadiene,pyrro b monazole PubChem CID: 795 ChEBI: CHEBI:16069 IUPAC Name: 1H-imidazole SMILES: N1C=CN=C1
| PubChem CID | 795 |
|---|---|
| CAS | 288-32-4 |
| Molecular Weight (g/mol) | 68.08 |
| ChEBI | CHEBI:16069 |
| MDL Number | MFCD00005183 |
| SMILES | N1C=CN=C1 |
| Synonym | imidazole,glyoxaline,imidazol,iminazole,miazole,1,3-diazole,glyoxalin,imutex,1,3-diaza-2,4-cyclopentadiene,pyrro b monazole |
| IUPAC Name | 1H-imidazole |
| InChI Key | RAXXELZNTBOGNW-UHFFFAOYSA-N |
| Molecular Formula | C3H4N2 |
Diethylene glycol, 99%, extra pure
CAS: 111-46-6 Molecular Formula: C4H10O3 Molecular Weight (g/mol): 106.12 MDL Number: MFCD00002882 InChI Key: MTHSVFCYNBDYFN-UHFFFAOYSA-N Synonym: diethylene glycol,2,2'-oxydiethanol,diglycol,diethylenglykol,2-hydroxyethyl ether,bis 2-hydroxyethyl ether,ethanol, 2,2'-oxybis,2,2'-oxybisethanol,2-2-hydroxyethoxy ethanol,digol PubChem CID: 8117 ChEBI: CHEBI:46807 SMILES: OCCOCCO
| PubChem CID | 8117 |
|---|---|
| CAS | 111-46-6 |
| Molecular Weight (g/mol) | 106.12 |
| ChEBI | CHEBI:46807 |
| MDL Number | MFCD00002882 |
| SMILES | OCCOCCO |
| Synonym | diethylene glycol,2,2'-oxydiethanol,diglycol,diethylenglykol,2-hydroxyethyl ether,bis 2-hydroxyethyl ether,ethanol, 2,2'-oxybis,2,2'-oxybisethanol,2-2-hydroxyethoxy ethanol,digol |
| InChI Key | MTHSVFCYNBDYFN-UHFFFAOYSA-N |
| Molecular Formula | C4H10O3 |
Tetramethylammonium hydroxide, 25% w/w aq. soln., Electronic Grade, 99.9999% (metals basis)
CAS: 75-59-2 Molecular Formula: C4H13NO Molecular Weight (g/mol): 91.154 MDL Number: MFCD00008280 InChI Key: WGTYBPLFGIVFAS-UHFFFAOYSA-M Synonym: tetramethylammonium hydroxide,tmah,hydroxyde de tetramethylammonium,nmw-w,nmd 3,tetramethyl ammonium hydroxide,unii-5gkp7317q2,ammonium, tetramethyl-, hydroxide,methanaminium, n,n,n-trimethyl-, hydroxide,tetramethylammoniumhydroxide PubChem CID: 60966 IUPAC Name: tetramethylazanium;hydroxide SMILES: C[N+](C)(C)C.[OH-]
| PubChem CID | 60966 |
|---|---|
| CAS | 75-59-2 |
| Molecular Weight (g/mol) | 91.154 |
| MDL Number | MFCD00008280 |
| SMILES | C[N+](C)(C)C.[OH-] |
| Synonym | tetramethylammonium hydroxide,tmah,hydroxyde de tetramethylammonium,nmw-w,nmd 3,tetramethyl ammonium hydroxide,unii-5gkp7317q2,ammonium, tetramethyl-, hydroxide,methanaminium, n,n,n-trimethyl-, hydroxide,tetramethylammoniumhydroxide |
| IUPAC Name | tetramethylazanium;hydroxide |
| InChI Key | WGTYBPLFGIVFAS-UHFFFAOYSA-M |
| Molecular Formula | C4H13NO |
Pepstatin A, Fisher BioReagents
CAS: 26305-03-3 Molecular Formula: C34H63N5O9 Molecular Weight (g/mol): 685.904 InChI Key: FAXGPCHRFPCXOO-WQILDUGRSA-N Synonym: pepstatin a PubChem CID: 131801262 IUPAC Name: (3R,4S)-3-hydroxy-4-[[(2R)-2-[[(3R,4S)-3-hydroxy-6-methyl-4-[[(2S)-3-methyl-2-[[(2S)-3-methyl-2-(3-methylbutanoylamino)butanoyl]amino]butanoyl]amino]heptanoyl]amino]propanoyl]amino]-6-methylheptanoic acid SMILES: CC(C)CC(C(CC(=O)O)O)NC(=O)C(C)NC(=O)CC(C(CC(C)C)NC(=O)C(C(C)C)NC(=O)C(C(C)C)NC(=O)CC(C)C)O
| PubChem CID | 131801262 |
|---|---|
| CAS | 26305-03-3 |
| Molecular Weight (g/mol) | 685.904 |
| SMILES | CC(C)CC(C(CC(=O)O)O)NC(=O)C(C)NC(=O)CC(C(CC(C)C)NC(=O)C(C(C)C)NC(=O)C(C(C)C)NC(=O)CC(C)C)O |
| Synonym | pepstatin a |
| IUPAC Name | (3R,4S)-3-hydroxy-4-[[(2R)-2-[[(3R,4S)-3-hydroxy-6-methyl-4-[[(2S)-3-methyl-2-[[(2S)-3-methyl-2-(3-methylbutanoylamino)butanoyl]amino]butanoyl]amino]heptanoyl]amino]propanoyl]amino]-6-methylheptanoic acid |
| InChI Key | FAXGPCHRFPCXOO-WQILDUGRSA-N |
| Molecular Formula | C34H63N5O9 |
1-Naphthol, 99%
CAS: 90-15-3 Molecular Formula: C10H8O Molecular Weight (g/mol): 144.173 MDL Number: MFCD00003930 InChI Key: KJCVRFUGPWSIIH-UHFFFAOYSA-N Synonym: 1-naphthol,1-naphthalenol,alpha-naphthol,1-hydroxynaphthalene,naphthol,fouramine ern,fourrine ern,tertral ern,furro er,basf ursol ern PubChem CID: 7005 ChEBI: CHEBI:10319 IUPAC Name: naphthalen-1-ol SMILES: C1=CC=C2C(=C1)C=CC=C2O
| PubChem CID | 7005 |
|---|---|
| CAS | 90-15-3 |
| Molecular Weight (g/mol) | 144.173 |
| ChEBI | CHEBI:10319 |
| MDL Number | MFCD00003930 |
| SMILES | C1=CC=C2C(=C1)C=CC=C2O |
| Synonym | 1-naphthol,1-naphthalenol,alpha-naphthol,1-hydroxynaphthalene,naphthol,fouramine ern,fourrine ern,tertral ern,furro er,basf ursol ern |
| IUPAC Name | naphthalen-1-ol |
| InChI Key | KJCVRFUGPWSIIH-UHFFFAOYSA-N |
| Molecular Formula | C10H8O |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, 99%, pure
CAS: 60-00-4 Molecular Formula: C10H16N2O8 Molecular Weight (g/mol): 292.24 MDL Number: MFCD00003541 InChI Key: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC Name: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid SMILES: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| PubChem CID | 6049 |
|---|---|
| CAS | 60-00-4 |
| Molecular Weight (g/mol) | 292.24 |
| ChEBI | CHEBI:42191 |
| MDL Number | MFCD00003541 |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O8 |
Thermo Scientific Chemicals Rose Bengal
CAS: 632-69-9 Molecular Formula: C20H4Cl4I4Na2O5 Molecular Weight (g/mol): 1019.644 MDL Number: MFCD00151169 InChI Key: DPBQSRZQYAYDGY-UHFFFAOYSA-N Synonym: rose bengal disodium salt,r105 sodium,rose bengal sodium,rose-bengal 131 i natrium,food red no. 105, sodium salt,food red color no. 105, sodium salt,rosa bengala sodica 131 i inn-spanish,rose bengale 131 i sodique inn-french,sel disodique de rose bengale iodee 131 i,roseum bengalense 131 i natricum inn-latin PubChem CID: 87244310 IUPAC Name: sodium;4,5,6,7-tetrachloro-3',6'-dihydroxy-2',4',5',7'-tetraiodospiro[2-benzofuran-3,9'-xanthene]-1-one SMILES: C1=C2C(=C(C(=C1I)O)I)OC3=C(C(=C(C=C3C24C5=C(C(=C(C(=C5Cl)Cl)Cl)Cl)C(=O)O4)I)O)I.[Na].[Na]
| PubChem CID | 87244310 |
|---|---|
| CAS | 632-69-9 |
| Molecular Weight (g/mol) | 1019.644 |
| MDL Number | MFCD00151169 |
| SMILES | C1=C2C(=C(C(=C1I)O)I)OC3=C(C(=C(C=C3C24C5=C(C(=C(C(=C5Cl)Cl)Cl)Cl)C(=O)O4)I)O)I.[Na].[Na] |
| Synonym | rose bengal disodium salt,r105 sodium,rose bengal sodium,rose-bengal 131 i natrium,food red no. 105, sodium salt,food red color no. 105, sodium salt,rosa bengala sodica 131 i inn-spanish,rose bengale 131 i sodique inn-french,sel disodique de rose bengale iodee 131 i,roseum bengalense 131 i natricum inn-latin |
| IUPAC Name | sodium;4,5,6,7-tetrachloro-3',6'-dihydroxy-2',4',5',7'-tetraiodospiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChI Key | DPBQSRZQYAYDGY-UHFFFAOYSA-N |
| Molecular Formula | C20H4Cl4I4Na2O5 |