Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
3'-Fluoro-4'-methoxyacetophenone, 99%
CAS: 455-91-4 Molecular Formula: C9H9FO2 Molecular Weight (g/mol): 168.167 MDL Number: MFCD00026219 InChI Key: LQASUDVYVOFKNK-UHFFFAOYSA-N Synonym: 3'-fluoro-4'-methoxyacetophenone,3-fluoro-4-methoxyacetophenone,1-3-fluoro-4-methoxyphenyl ethanone,1-3-fluoro-4-methoxyphenyl ethan-1-one,ethanone, 1-3-fluoro-4-methoxyphenyl,3'-fluoro-4-methoxyacetophenone,acetophenone, 3'-fluoro-4'-methoxy,1-3-fluoro-4-methoxy-phenyl-ethanone,1-3-fluoro-4-methoxyphenyl-1-ethanone,1-3-fluoro-4-methoxy-phenyl ethanone PubChem CID: 96828 IUPAC Name: 1-(3-fluoro-4-methoxyphenyl)ethanone SMILES: CC(=O)C1=CC(=C(C=C1)OC)F
| PubChem CID | 96828 |
|---|---|
| CAS | 455-91-4 |
| Molecular Weight (g/mol) | 168.167 |
| MDL Number | MFCD00026219 |
| SMILES | CC(=O)C1=CC(=C(C=C1)OC)F |
| Synonym | 3'-fluoro-4'-methoxyacetophenone,3-fluoro-4-methoxyacetophenone,1-3-fluoro-4-methoxyphenyl ethanone,1-3-fluoro-4-methoxyphenyl ethan-1-one,ethanone, 1-3-fluoro-4-methoxyphenyl,3'-fluoro-4-methoxyacetophenone,acetophenone, 3'-fluoro-4'-methoxy,1-3-fluoro-4-methoxy-phenyl-ethanone,1-3-fluoro-4-methoxyphenyl-1-ethanone,1-3-fluoro-4-methoxy-phenyl ethanone |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)ethanone |
| InChI Key | LQASUDVYVOFKNK-UHFFFAOYSA-N |
| Molecular Formula | C9H9FO2 |
Salbutamol hemisulfate, 98+%
CAS: 51022-70-9 Molecular Formula: C13H23NO7S Molecular Weight (g/mol): 337.387 MDL Number: MFCD00055200 InChI Key: OVICLFZZVQVVFT-UHFFFAOYSA-N Synonym: salbutamol sulfate,albuterol sulfate,ventolin,ventorlin,4-2-tert-butylamino-1-hydroxyethyl-2-hydroxymethyl phenol sulfate,asthavent,albuterol sulfate 1:x,salbutamol; sulfuric acid,asmaven sulfate,2-tert-butylamino-1-4-hydroxy-3-hydroxymethylphenyl ethanol hemisulfate PubChem CID: 9884233 IUPAC Name: 4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol;sulfuric acid SMILES: CC(C)(C)NCC(C1=CC(=C(C=C1)O)CO)O.OS(=O)(=O)O
| PubChem CID | 9884233 |
|---|---|
| CAS | 51022-70-9 |
| Molecular Weight (g/mol) | 337.387 |
| MDL Number | MFCD00055200 |
| SMILES | CC(C)(C)NCC(C1=CC(=C(C=C1)O)CO)O.OS(=O)(=O)O |
| Synonym | salbutamol sulfate,albuterol sulfate,ventolin,ventorlin,4-2-tert-butylamino-1-hydroxyethyl-2-hydroxymethyl phenol sulfate,asthavent,albuterol sulfate 1:x,salbutamol; sulfuric acid,asmaven sulfate,2-tert-butylamino-1-4-hydroxy-3-hydroxymethylphenyl ethanol hemisulfate |
| IUPAC Name | 4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol;sulfuric acid |
| InChI Key | OVICLFZZVQVVFT-UHFFFAOYSA-N |
| Molecular Formula | C13H23NO7S |
3,5-Bis(trifluoromethyl)phenylacetonitrile, 97%
CAS: 85068-32-2 Molecular Formula: C10H5F6N Molecular Weight (g/mol): 253.15 MDL Number: MFCD00009904 InChI Key: YXGWYBUKRTYHJM-UHFFFAOYSA-N Synonym: 3,5-bis trifluoromethyl phenylacetonitrile,2-3,5-bis trifluoromethyl phenyl acetonitrile,3,5-bis trifluoromethyl benzyl cyanide,3,5-di trifluoromethyl benzyl cyanide,3,5-bis trifluoromethyl-phenylacetonitrile,3,5-bis trifluoromethyl phenyl acetonitrile,benzeneacetonitrile, 3,5-bis trifluoromethyl,3,5-bis trifluoromethyl benzylcyanide PubChem CID: 603657 IUPAC Name: 2-[3,5-bis(trifluoromethyl)phenyl]acetonitrile SMILES: FC(F)(F)C1=CC(=CC(CC#N)=C1)C(F)(F)F
| PubChem CID | 603657 |
|---|---|
| CAS | 85068-32-2 |
| Molecular Weight (g/mol) | 253.15 |
| MDL Number | MFCD00009904 |
| SMILES | FC(F)(F)C1=CC(=CC(CC#N)=C1)C(F)(F)F |
| Synonym | 3,5-bis trifluoromethyl phenylacetonitrile,2-3,5-bis trifluoromethyl phenyl acetonitrile,3,5-bis trifluoromethyl benzyl cyanide,3,5-di trifluoromethyl benzyl cyanide,3,5-bis trifluoromethyl-phenylacetonitrile,3,5-bis trifluoromethyl phenyl acetonitrile,benzeneacetonitrile, 3,5-bis trifluoromethyl,3,5-bis trifluoromethyl benzylcyanide |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]acetonitrile |
| InChI Key | YXGWYBUKRTYHJM-UHFFFAOYSA-N |
| Molecular Formula | C10H5F6N |
Tragacanth powder
CAS: 9000-65-1 MDL Number: MFCD00131255 Synonym: Gum tragacanth
| CAS | 9000-65-1 |
|---|---|
| MDL Number | MFCD00131255 |
| Synonym | Gum tragacanth |
3-(2-Furyl)acrolein, 99%
CAS: 623-30-3 Molecular Formula: C7H6O2 Molecular Weight (g/mol): 122.123 MDL Number: MFCD00003256 InChI Key: VZIRCHXYMBFNFD-HNQUOIGGSA-N Synonym: 3-2-furyl acrolein,2-furanacrolein,e-3-furan-2-yl acrylaldehyde,3-furan-2-yl acrylaldehyde,2-propenal, 3-2-furanyl,trans-3-2-furyl acrolein,beta-2-furylacrolein,3-2-furyl acrylaldehyde,unii-ssq86u3drp,furyl acrolein PubChem CID: 1549521 IUPAC Name: (E)-3-(furan-2-yl)prop-2-enal SMILES: C1=COC(=C1)C=CC=O
| PubChem CID | 1549521 |
|---|---|
| CAS | 623-30-3 |
| Molecular Weight (g/mol) | 122.123 |
| MDL Number | MFCD00003256 |
| SMILES | C1=COC(=C1)C=CC=O |
| Synonym | 3-2-furyl acrolein,2-furanacrolein,e-3-furan-2-yl acrylaldehyde,3-furan-2-yl acrylaldehyde,2-propenal, 3-2-furanyl,trans-3-2-furyl acrolein,beta-2-furylacrolein,3-2-furyl acrylaldehyde,unii-ssq86u3drp,furyl acrolein |
| IUPAC Name | (E)-3-(furan-2-yl)prop-2-enal |
| InChI Key | VZIRCHXYMBFNFD-HNQUOIGGSA-N |
| Molecular Formula | C7H6O2 |
2',4'-Dimethylacetophenone, 95%
CAS: 89-74-7 Molecular Formula: C10H12O Molecular Weight (g/mol): 148.205 MDL Number: MFCD00003571 InChI Key: HSDSKVWQTONQBJ-UHFFFAOYSA-N Synonym: 2',4'-dimethylacetophenone,1-2,4-dimethylphenyl ethanone,2,4-dimethylacetophenone,4-acetyl-m-xylene,ethanone, 1-2,4-dimethylphenyl,acetyl-m-xylene,1-2,4-dimethylphenyl ethan-1-one,acetophenone, 2',4'-dimethyl,unii-8k29me27ya,methyl 2,4-dimethylphenyl ketone PubChem CID: 6985 IUPAC Name: 1-(2,4-dimethylphenyl)ethanone SMILES: CC1=CC(=C(C=C1)C(=O)C)C
| PubChem CID | 6985 |
|---|---|
| CAS | 89-74-7 |
| Molecular Weight (g/mol) | 148.205 |
| MDL Number | MFCD00003571 |
| SMILES | CC1=CC(=C(C=C1)C(=O)C)C |
| Synonym | 2',4'-dimethylacetophenone,1-2,4-dimethylphenyl ethanone,2,4-dimethylacetophenone,4-acetyl-m-xylene,ethanone, 1-2,4-dimethylphenyl,acetyl-m-xylene,1-2,4-dimethylphenyl ethan-1-one,acetophenone, 2',4'-dimethyl,unii-8k29me27ya,methyl 2,4-dimethylphenyl ketone |
| IUPAC Name | 1-(2,4-dimethylphenyl)ethanone |
| InChI Key | HSDSKVWQTONQBJ-UHFFFAOYSA-N |
| Molecular Formula | C10H12O |
3-Chloropropiophenone, 96%
CAS: 936-59-4 Molecular Formula: C9H9ClO Molecular Weight (g/mol): 168.62 MDL Number: MFCD00000990 InChI Key: KTJRGPZVSKWRTJ-UHFFFAOYSA-N Synonym: 3-chloropropiophenone,1-propanone, 3-chloro-1-phenyl,beta-chloropropiophenone,2-chloroethyl phenyl ketone,3-chloropropanophenone,3-chloro-1-phenyl-1-propanone,propiophenone, 3-chloro,3-chloro-1-phenyl-propan-1-one,.beta.-chloropropiophenone,.omega.-chloropropiophenone PubChem CID: 70295 IUPAC Name: 3-chloro-1-phenylpropan-1-one SMILES: C1=CC=C(C=C1)C(=O)CCCl
| PubChem CID | 70295 |
|---|---|
| CAS | 936-59-4 |
| Molecular Weight (g/mol) | 168.62 |
| MDL Number | MFCD00000990 |
| SMILES | C1=CC=C(C=C1)C(=O)CCCl |
| Synonym | 3-chloropropiophenone,1-propanone, 3-chloro-1-phenyl,beta-chloropropiophenone,2-chloroethyl phenyl ketone,3-chloropropanophenone,3-chloro-1-phenyl-1-propanone,propiophenone, 3-chloro,3-chloro-1-phenyl-propan-1-one,.beta.-chloropropiophenone,.omega.-chloropropiophenone |
| IUPAC Name | 3-chloro-1-phenylpropan-1-one |
| InChI Key | KTJRGPZVSKWRTJ-UHFFFAOYSA-N |
| Molecular Formula | C9H9ClO |
delta-Valerolactam, 98%
CAS: 675-20-7 Molecular Formula: C5H9NO Molecular Weight (g/mol): 99.13 MDL Number: MFCD00006037 InChI Key: XUWHAWMETYGRKB-UHFFFAOYSA-N Synonym: 2-piperidone,2-piperidinone,delta-valerolactam,valerolactim,5-pentanolactam,piperidinone,piperidon,piperidone,alpha-piperidone,piperidone-2 PubChem CID: 12665 ChEBI: CHEBI:77761 IUPAC Name: piperidin-2-one SMILES: O=C1CCCCN1
| PubChem CID | 12665 |
|---|---|
| CAS | 675-20-7 |
| Molecular Weight (g/mol) | 99.13 |
| ChEBI | CHEBI:77761 |
| MDL Number | MFCD00006037 |
| SMILES | O=C1CCCCN1 |
| Synonym | 2-piperidone,2-piperidinone,delta-valerolactam,valerolactim,5-pentanolactam,piperidinone,piperidon,piperidone,alpha-piperidone,piperidone-2 |
| IUPAC Name | piperidin-2-one |
| InChI Key | XUWHAWMETYGRKB-UHFFFAOYSA-N |
| Molecular Formula | C5H9NO |
2-(1-Piperidinyl)aniline, 98%
CAS: 39643-31-7 Molecular Formula: C11H16N2 Molecular Weight (g/mol): 176.26 MDL Number: MFCD00047467 InChI Key: OYECAJPUPWFCSL-UHFFFAOYSA-N Synonym: 2-piperidinoaniline,2-piperidin-1-yl aniline,2-piperidin-1-yl-phenylamine,benzenamine, 2-1-piperidinyl,n-2-aminophenyl piperidine,2-1-piperidinyl aniline,2-1-piperidino aniline,1-2-aminophenyl piperidine,2-piperidylphenylamine,2-piperdinoaniline PubChem CID: 458795 IUPAC Name: 2-piperidin-1-ylaniline SMILES: NC1=CC=CC=C1N1CCCCC1
| PubChem CID | 458795 |
|---|---|
| CAS | 39643-31-7 |
| Molecular Weight (g/mol) | 176.26 |
| MDL Number | MFCD00047467 |
| SMILES | NC1=CC=CC=C1N1CCCCC1 |
| Synonym | 2-piperidinoaniline,2-piperidin-1-yl aniline,2-piperidin-1-yl-phenylamine,benzenamine, 2-1-piperidinyl,n-2-aminophenyl piperidine,2-1-piperidinyl aniline,2-1-piperidino aniline,1-2-aminophenyl piperidine,2-piperidylphenylamine,2-piperdinoaniline |
| IUPAC Name | 2-piperidin-1-ylaniline |
| InChI Key | OYECAJPUPWFCSL-UHFFFAOYSA-N |
| Molecular Formula | C11H16N2 |
Ethyl methanesulfonate, 99%
CAS: 62-50-0 Molecular Formula: C3H8O3S Molecular Weight (g/mol): 124.154 MDL Number: MFCD00007559 InChI Key: PLUBXMRUUVWRLT-UHFFFAOYSA-N Synonym: ethyl mesylate,ethyl methanesulphonate,half-myleran,methanesulfonic acid, ethyl ester,methanesulfonic acid ethyl ester,methylsulfonic acid, ethyl ester,rcra waste number u119,ethyl methansulphonate,ethyl ester of methylsulfonic acid,ethyl ester of methanesulfonic acid PubChem CID: 6113 ChEBI: CHEBI:23994 IUPAC Name: ethyl methanesulfonate SMILES: CCOS(=O)(=O)C
| PubChem CID | 6113 |
|---|---|
| CAS | 62-50-0 |
| Molecular Weight (g/mol) | 124.154 |
| ChEBI | CHEBI:23994 |
| MDL Number | MFCD00007559 |
| SMILES | CCOS(=O)(=O)C |
| Synonym | ethyl mesylate,ethyl methanesulphonate,half-myleran,methanesulfonic acid, ethyl ester,methanesulfonic acid ethyl ester,methylsulfonic acid, ethyl ester,rcra waste number u119,ethyl methansulphonate,ethyl ester of methylsulfonic acid,ethyl ester of methanesulfonic acid |
| IUPAC Name | ethyl methanesulfonate |
| InChI Key | PLUBXMRUUVWRLT-UHFFFAOYSA-N |
| Molecular Formula | C3H8O3S |
9,10-Anthraquinone, 98+%, Thermo Scientific Chemicals
CAS: 84-65-1 Molecular Formula: C14H8O2 Molecular Weight (g/mol): 208.22 MDL Number: MFCD00001188 InChI Key: RZVHIXYEVGDQDX-UHFFFAOYSA-N Synonym: anthraquinone,9,10-anthraquinone,9,10-anthracenedione,anthradione,hoelite,9,10-dioxoanthracene,corbit,morkit,9,10-anthrachinon,anthra-9,10-quinone PubChem CID: 6780 ChEBI: CHEBI:40448 IUPAC Name: anthracene-9,10-dione SMILES: O=C1C2=CC=CC=C2C(=O)C2=CC=CC=C12
| PubChem CID | 6780 |
|---|---|
| CAS | 84-65-1 |
| Molecular Weight (g/mol) | 208.22 |
| ChEBI | CHEBI:40448 |
| MDL Number | MFCD00001188 |
| SMILES | O=C1C2=CC=CC=C2C(=O)C2=CC=CC=C12 |
| Synonym | anthraquinone,9,10-anthraquinone,9,10-anthracenedione,anthradione,hoelite,9,10-dioxoanthracene,corbit,morkit,9,10-anthrachinon,anthra-9,10-quinone |
| IUPAC Name | anthracene-9,10-dione |
| InChI Key | RZVHIXYEVGDQDX-UHFFFAOYSA-N |
| Molecular Formula | C14H8O2 |
Ethyl levulinate, 98%
CAS: 539-88-8 Molecular Formula: C7H12O3 Molecular Weight (g/mol): 144.17 MDL Number: MFCD00009209 InChI Key: GMEONFUTDYJSNV-UHFFFAOYSA-N Synonym: ethyl levulinate,ethyl levulate,ethyl laevulinate,levulinic acid, ethyl ester,ethyl 4-ketovalerate,ethyl 3-acetylpropionate,ethyl 4-oxovalerate,pentanoic acid, 4-oxo-, ethyl ester,ethyl ketovalerate,ethyl acetylpropanoate PubChem CID: 10883 IUPAC Name: ethyl 4-oxopentanoate SMILES: CCOC(=O)CCC(C)=O
| PubChem CID | 10883 |
|---|---|
| CAS | 539-88-8 |
| Molecular Weight (g/mol) | 144.17 |
| MDL Number | MFCD00009209 |
| SMILES | CCOC(=O)CCC(C)=O |
| Synonym | ethyl levulinate,ethyl levulate,ethyl laevulinate,levulinic acid, ethyl ester,ethyl 4-ketovalerate,ethyl 3-acetylpropionate,ethyl 4-oxovalerate,pentanoic acid, 4-oxo-, ethyl ester,ethyl ketovalerate,ethyl acetylpropanoate |
| IUPAC Name | ethyl 4-oxopentanoate |
| InChI Key | GMEONFUTDYJSNV-UHFFFAOYSA-N |
| Molecular Formula | C7H12O3 |
Ethyl valerate, 99%
CAS: 539-82-2 Molecular Formula: C7H14O2 Molecular Weight (g/mol): 130.19 MDL Number: MFCD00009479 InChI Key: ICMAFTSLXCXHRK-UHFFFAOYSA-N Synonym: ethyl valerate,ethyl n-valerate,pentanoic acid, ethyl ester,valeric acid, ethyl ester,ethylvalerate,ethyl valerianate,pentanoic acid ethyl ester,n-valeric acid ethyl ester,valeric acid, ethyl ester 8ci,fema no. 2462 PubChem CID: 10882 IUPAC Name: ethyl pentanoate SMILES: CCCCC(=O)OCC
| PubChem CID | 10882 |
|---|---|
| CAS | 539-82-2 |
| Molecular Weight (g/mol) | 130.19 |
| MDL Number | MFCD00009479 |
| SMILES | CCCCC(=O)OCC |
| Synonym | ethyl valerate,ethyl n-valerate,pentanoic acid, ethyl ester,valeric acid, ethyl ester,ethylvalerate,ethyl valerianate,pentanoic acid ethyl ester,n-valeric acid ethyl ester,valeric acid, ethyl ester 8ci,fema no. 2462 |
| IUPAC Name | ethyl pentanoate |
| InChI Key | ICMAFTSLXCXHRK-UHFFFAOYSA-N |
| Molecular Formula | C7H14O2 |
Diethylenetriaminepentaacetic Acid, Pentasodium Salt, 41% Solution in Water, Spectrum™ Chemical
CAS: 140-01-2 Molecular Formula: C14H18N3Na5O10 Molecular Weight (g/mol): 503.26 MDL Number: MFCD00051016 InChI Key: LQPLDXQVILYOOL-UHFFFAOYSA-I IUPAC Name: pentasodium 2-[bis({2-[bis(carboxylatomethyl)amino]ethyl})amino]acetate SMILES: [Na+].[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O
| CAS | 140-01-2 |
|---|---|
| Molecular Weight (g/mol) | 503.26 |
| MDL Number | MFCD00051016 |
| SMILES | [Na+].[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O |
| IUPAC Name | pentasodium 2-[bis({2-[bis(carboxylatomethyl)amino]ethyl})amino]acetate |
| InChI Key | LQPLDXQVILYOOL-UHFFFAOYSA-I |
| Molecular Formula | C14H18N3Na5O10 |
Thermo Scientific Chemicals o-Cresolphthalein complexone, indicator grade
CAS: 2411-89-4 Molecular Formula: C32H32N2O12 Molecular Weight (g/mol): 636.61 MDL Number: MFCD00005911 InChI Key: IYZPEGVSBUNMBE-UHFFFAOYSA-N Synonym: o-cresolphthalein complexone,phthalein purple,cresolphthalexon,o-cresolphthalexon,phthalein complexon,o-cresolphthalein complexon,cresolphthalein complexon,metal phthalein,cresolphthalein complexone,unii-a4p6737i7f PubChem CID: 75485 IUPAC Name: 2-[[5-[1-[3-[[bis(carboxymethyl)amino]methyl]-4-hydroxy-5-methylphenyl]-3-oxo-2-benzofuran-1-yl]-2-hydroxy-3-methylphenyl]methyl-(carboxymethyl)amino]acetic acid SMILES: CC1=CC(=CC(CN(CC(O)=O)CC(O)=O)=C1O)C1(OC(=O)C2=CC=CC=C12)C1=CC(C)=C(O)C(CN(CC(O)=O)CC(O)=O)=C1
| PubChem CID | 75485 |
|---|---|
| CAS | 2411-89-4 |
| Molecular Weight (g/mol) | 636.61 |
| MDL Number | MFCD00005911 |
| SMILES | CC1=CC(=CC(CN(CC(O)=O)CC(O)=O)=C1O)C1(OC(=O)C2=CC=CC=C12)C1=CC(C)=C(O)C(CN(CC(O)=O)CC(O)=O)=C1 |
| Synonym | o-cresolphthalein complexone,phthalein purple,cresolphthalexon,o-cresolphthalexon,phthalein complexon,o-cresolphthalein complexon,cresolphthalein complexon,metal phthalein,cresolphthalein complexone,unii-a4p6737i7f |
| IUPAC Name | 2-[[5-[1-[3-[[bis(carboxymethyl)amino]methyl]-4-hydroxy-5-methylphenyl]-3-oxo-2-benzofuran-1-yl]-2-hydroxy-3-methylphenyl]methyl-(carboxymethyl)amino]acetic acid |
| InChI Key | IYZPEGVSBUNMBE-UHFFFAOYSA-N |
| Molecular Formula | C32H32N2O12 |