Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
(+)-Biotin N-succinimidyl ester, 98%
CAS: 35013-72-0 Molecular Formula: C14H19N3O5S Molecular Weight (g/mol): 341.382 MDL Number: MFCD00078531 InChI Key: YMXHPSHLTSZXKH-RVBZMBCESA-N Synonym: +-biotin n-hydroxysuccinimide ester,biotin-nhs,biotin nhs,2,5-dioxopyrrolidin-1-yl 5-3as,4s,6ar-2-oxohexahydro-1h-thieno 3,4-d imidazol-4-yl pentanoate,n-hydroxysuccinimidobiotin,d-biotinyl-osu,biotin-osu,n-succinimidyl d-biotinate,bhse,biotin n-hydroxysuccinimide ester PubChem CID: 6710714 IUPAC Name: (2,5-dioxopyrrolidin-1-yl) 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate SMILES: C1CC(=O)N(C1=O)OC(=O)CCCCC2C3C(CS2)NC(=O)N3
| PubChem CID | 6710714 |
|---|---|
| CAS | 35013-72-0 |
| Molecular Weight (g/mol) | 341.382 |
| MDL Number | MFCD00078531 |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCCC2C3C(CS2)NC(=O)N3 |
| Synonym | +-biotin n-hydroxysuccinimide ester,biotin-nhs,biotin nhs,2,5-dioxopyrrolidin-1-yl 5-3as,4s,6ar-2-oxohexahydro-1h-thieno 3,4-d imidazol-4-yl pentanoate,n-hydroxysuccinimidobiotin,d-biotinyl-osu,biotin-osu,n-succinimidyl d-biotinate,bhse,biotin n-hydroxysuccinimide ester |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
| InChI Key | YMXHPSHLTSZXKH-RVBZMBCESA-N |
| Molecular Formula | C14H19N3O5S |
Allyl cyanide, 97%
CAS: 109-75-1 Molecular Formula: C4H5N Molecular Weight (g/mol): 67.091 MDL Number: MFCD00001962 InChI Key: SJNALLRHIVGIBI-UHFFFAOYSA-N Synonym: 3-butenenitrile,allyl cyanide,3-butenylnitrile,3-butenonitrile,allylnitrile,vinylacetonitrile,3-cyanopropene,3-cyano-1-propene,1-butene-4-nitrile,propene-3-nitrile PubChem CID: 8009 IUPAC Name: but-3-enenitrile SMILES: C=CCC#N
| PubChem CID | 8009 |
|---|---|
| CAS | 109-75-1 |
| Molecular Weight (g/mol) | 67.091 |
| MDL Number | MFCD00001962 |
| SMILES | C=CCC#N |
| Synonym | 3-butenenitrile,allyl cyanide,3-butenylnitrile,3-butenonitrile,allylnitrile,vinylacetonitrile,3-cyanopropene,3-cyano-1-propene,1-butene-4-nitrile,propene-3-nitrile |
| IUPAC Name | but-3-enenitrile |
| InChI Key | SJNALLRHIVGIBI-UHFFFAOYSA-N |
| Molecular Formula | C4H5N |
PTFE sheet, 3.18mm (0.125in) thick
CAS: 9002-84-0 Molecular Formula: (C2F4)n Molecular Weight (g/mol): NaN MDL Number: MFCD00084455 SMILES: FC(F)(-*)C(F)(F)-*
| CAS | 9002-84-0 |
|---|---|
| Molecular Weight (g/mol) | NaN |
| MDL Number | MFCD00084455 |
| SMILES | FC(F)(-*)C(F)(F)-* |
| Molecular Formula | (C2F4)n |
Polyethylene sheet, Low Density, 6.35mm (0.25 in.) thick, Thermo Scientific™
CAS: 9002-88-4 Molecular Formula: (C2H4)n Molecular Weight (g/mol): 28.05 MDL Number: MFCD00084423 InChI Key: VGGSQFUCUMXWEO-UHFFFAOYSA-N Synonym: ethylene,acetene,elayl,olefiant gas,athylen,etileno,liquid ethylene,polyethylene,bicarburretted hydrogen,plastipore PubChem CID: 6325 ChEBI: CHEBI:18153 IUPAC Name: ethene SMILES: *-CC-*
| PubChem CID | 6325 |
|---|---|
| CAS | 9002-88-4 |
| Molecular Weight (g/mol) | 28.05 |
| ChEBI | CHEBI:18153 |
| MDL Number | MFCD00084423 |
| SMILES | *-CC-* |
| Synonym | ethylene,acetene,elayl,olefiant gas,athylen,etileno,liquid ethylene,polyethylene,bicarburretted hydrogen,plastipore |
| IUPAC Name | ethene |
| InChI Key | VGGSQFUCUMXWEO-UHFFFAOYSA-N |
| Molecular Formula | (C2H4)n |
Invitrogen™ MERS S1 Ig Total Human ProcartaPlex™ Simplex Kit
Measures anti-MERS S1 antibodies in serum and plasma
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
Invitrogen™ CoV-229E Ig Total Human ProcartaPlex™ Simplex Kit
Measures anti-CoV-229E antibodies in serum and plasma
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
Bis(cyclopentadienyl)manganese, sublimed, Thermo Scientific Chemicals
CAS: 73138-26-8 Molecular Formula: C10H10Mn Molecular Weight (g/mol): 185.13 MDL Number: MFCD00045468 InChI Key: LCGVCXIFXLGLHG-UHFFFAOYSA-N Synonym: bis cyclopentadienyl manganese,acmc-20aln3,dicyclopentadienylmanganese,manganese,di-2,4-cyclopentadien-1-yl,bis cyclopenta-1,3-dien-1-yl manganese PubChem CID: 21960473 IUPAC Name: cyclopenta-1,3-diene;manganese(2+) SMILES: [Mn](c1cccc1)c1cccc1
| PubChem CID | 21960473 |
|---|---|
| CAS | 73138-26-8 |
| Molecular Weight (g/mol) | 185.13 |
| MDL Number | MFCD00045468 |
| SMILES | [Mn](c1cccc1)c1cccc1 |
| Synonym | bis cyclopentadienyl manganese,acmc-20aln3,dicyclopentadienylmanganese,manganese,di-2,4-cyclopentadien-1-yl,bis cyclopenta-1,3-dien-1-yl manganese |
| IUPAC Name | cyclopenta-1,3-diene;manganese(2+) |
| InChI Key | LCGVCXIFXLGLHG-UHFFFAOYSA-N |
| Molecular Formula | C10H10Mn |
Dichloro[bis(1,2-diphenylphosphino)ethane]nickel(II), 98%
CAS: 14647-23-5 Molecular Formula: C26H24Cl2NiP2 Molecular Weight (g/mol): 528.02 MDL Number: MFCD00013313 InChI Key: XXECWTBMGGXMKP-UHFFFAOYSA-L Synonym: 1,2-bis diphenylphosphino ethane nickel ii chloride PubChem CID: 131664338 IUPAC Name: nickel(2+) [2-(diphenylphosphaniumyl)ethyl]diphenylphosphanium dichloride SMILES: Cl[Ni]Cl.C(CP(C1=CC=CC=C1)C1=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 131664338 |
|---|---|
| CAS | 14647-23-5 |
| Molecular Weight (g/mol) | 528.02 |
| MDL Number | MFCD00013313 |
| SMILES | Cl[Ni]Cl.C(CP(C1=CC=CC=C1)C1=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 1,2-bis diphenylphosphino ethane nickel ii chloride |
| IUPAC Name | nickel(2+) [2-(diphenylphosphaniumyl)ethyl]diphenylphosphanium dichloride |
| InChI Key | XXECWTBMGGXMKP-UHFFFAOYSA-L |
| Molecular Formula | C26H24Cl2NiP2 |
p-Nitrophenyl Phosphate,, MilliporeSigma™
CAS: 330-13-2 Molecular Formula: C6H6NO6P Molecular Weight (g/mol): 219.09 InChI Key: XZKIHKMTEMTJQX-UHFFFAOYSA-N Synonym: 4-nitrophenyl phosphate,4-nitrophenyl dihydrogen phosphate,nitrophenylphosphate,phosphoric acid, mono 4-nitrophenyl ester,p-nitrophenyl phosphate,p-nitrophenyl dihydrogen phosphate,p-nitrophenol phosphate,p-nitrophenylphosphate,pnpp PubChem CID: 378 ChEBI: CHEBI:17440
| PubChem CID | 378 |
|---|---|
| CAS | 330-13-2 |
| Molecular Weight (g/mol) | 219.09 |
| ChEBI | CHEBI:17440 |
| Synonym | 4-nitrophenyl phosphate,4-nitrophenyl dihydrogen phosphate,nitrophenylphosphate,phosphoric acid, mono 4-nitrophenyl ester,p-nitrophenyl phosphate,p-nitrophenyl dihydrogen phosphate,p-nitrophenol phosphate,p-nitrophenylphosphate,pnpp |
| InChI Key | XZKIHKMTEMTJQX-UHFFFAOYSA-N |
| Molecular Formula | C6H6NO6P |
Di-n-butyltin dichloride, 96%
CAS: 683-18-1 Molecular Formula: C8H18Cl2Sn Molecular Weight (g/mol): 303.842 MDL Number: MFCD00000518 InChI Key: RJGHQTVXGKYATR-UHFFFAOYSA-L Synonym: dibutyltin dichloride,dibutyldichlorotin,di-n-butyltin dichloride,stannane, dibutyldichloro,dibutyltin chloride,dichlorodibutyltin,dibutyl dichloro stannane,dichlorodibutylstannane,dibutyltindichloride,dibutyl tin dichloride PubChem CID: 12688 IUPAC Name: dibutyl(dichloro)stannane SMILES: CCCC[Sn](CCCC)(Cl)Cl
| PubChem CID | 12688 |
|---|---|
| CAS | 683-18-1 |
| Molecular Weight (g/mol) | 303.842 |
| MDL Number | MFCD00000518 |
| SMILES | CCCC[Sn](CCCC)(Cl)Cl |
| Synonym | dibutyltin dichloride,dibutyldichlorotin,di-n-butyltin dichloride,stannane, dibutyldichloro,dibutyltin chloride,dichlorodibutyltin,dibutyl dichloro stannane,dichlorodibutylstannane,dibutyltindichloride,dibutyl tin dichloride |
| IUPAC Name | dibutyl(dichloro)stannane |
| InChI Key | RJGHQTVXGKYATR-UHFFFAOYSA-L |
| Molecular Formula | C8H18Cl2Sn |
(2S,4S)-(-)-2,4-Bis(diphenylphosphino)pentane, 99%, Thermo Scientific Chemicals
CAS: 77876-39-2 Molecular Formula: C29H30P2 Molecular Weight (g/mol): 440.51 MDL Number: MFCD00058923 InChI Key: CTYPJIUQROQJBG-ISIPKWIHNA-N Synonym: 2s,4s---2,4-bis diphenylphosphino pentane,s,s-bdpp,2s,4s-pentane-2,4-diylbis diphenylphosphine,phosphine, 1s,3s-1,3-dimethyl-1,3-propanediyl bis diphenyl,s,s-2,4-bis diphenylphosphino pentane,2s,4s-2,4-bis diphenylphosphino pentane,1s,3s-1,3-dimethyl-1,3-propanediyl bis diphenylphosphine,2s,4s-4-diphenylphosphanylpentan-2-yl-diphenylphosphane,2s,4s-4-diphenylphosphanyl pentan-2-yl diphenylphosphane PubChem CID: 2734567 SMILES: C[C@@H](C[C@H](C)P(C1=CC=CC=C1)C1=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 2734567 |
|---|---|
| CAS | 77876-39-2 |
| Molecular Weight (g/mol) | 440.51 |
| MDL Number | MFCD00058923 |
| SMILES | C[C@@H](C[C@H](C)P(C1=CC=CC=C1)C1=CC=CC=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 2s,4s---2,4-bis diphenylphosphino pentane,s,s-bdpp,2s,4s-pentane-2,4-diylbis diphenylphosphine,phosphine, 1s,3s-1,3-dimethyl-1,3-propanediyl bis diphenyl,s,s-2,4-bis diphenylphosphino pentane,2s,4s-2,4-bis diphenylphosphino pentane,1s,3s-1,3-dimethyl-1,3-propanediyl bis diphenylphosphine,2s,4s-4-diphenylphosphanylpentan-2-yl-diphenylphosphane,2s,4s-4-diphenylphosphanyl pentan-2-yl diphenylphosphane |
| InChI Key | CTYPJIUQROQJBG-ISIPKWIHNA-N |
| Molecular Formula | C29H30P2 |
Iron(III) meso-tetraphenylporphine-mu-oxo dimer
CAS: 12582-61-5 Molecular Formula: C88H58Fe2N8O Molecular Weight (g/mol): 1355.177 MDL Number: MFCD00058898 InChI Key: JTFKJCUSDKAMIA-UHFFFAOYSA-N Synonym: iron iii meso-tetraphenylporphine-mu-oxo dimer,iron,m-oxobis 5,10,15,20-tetraphenyl-21h,23h-porphinato 2--kn21,kn22,kn23,kn24 di PubChem CID: 11981848 IUPAC Name: iron(2+);5,10,15,20-tetraphenylporphyrin-22,24-diide;hydrate SMILES: C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C([N-]5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=CC=C8)C=C4)C9=CC=CC=C9)[N-]3.C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C([N-]5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=CC=C8)C=C4)C9=CC=CC=C9)[N-]3.O.[Fe+2].[Fe+2]
| PubChem CID | 11981848 |
|---|---|
| CAS | 12582-61-5 |
| Molecular Weight (g/mol) | 1355.177 |
| MDL Number | MFCD00058898 |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C([N-]5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=CC=C8)C=C4)C9=CC=CC=C9)[N-]3.C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C([N-]5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=CC=C8)C=C4)C9=CC=CC=C9)[N-]3.O.[Fe+2].[Fe+2] |
| Synonym | iron iii meso-tetraphenylporphine-mu-oxo dimer,iron,m-oxobis 5,10,15,20-tetraphenyl-21h,23h-porphinato 2--kn21,kn22,kn23,kn24 di |
| IUPAC Name | iron(2+);5,10,15,20-tetraphenylporphyrin-22,24-diide;hydrate |
| InChI Key | JTFKJCUSDKAMIA-UHFFFAOYSA-N |
| Molecular Formula | C88H58Fe2N8O |
Lithium tetraphenylborate tris(1,2-dimethoxyethane) adduct
CAS: 75965-35-4 Molecular Formula: C36H50BLiO6 Molecular Weight (g/mol): 596.54 MDL Number: MFCD00013311 InChI Key: ADYUZFWVPWDPFK-UHFFFAOYSA-N Synonym: lithium tetraphenylborate tris 1,2-dimethoxyethane,tetraphenylboron lithium tris 1,2-dimethoxyethane,lithium tetraphenylborate tris 1,2-dimethoxyethane adduct,lithium tetraphenylborate 1--1,2-dimethoxyethane 1/1/3,lithium 1+ tris 1,2-dimethoxyethane tetraphenylborate PubChem CID: 23681136 IUPAC Name: lithium;1,2-dimethoxyethane;tetraphenylboranuide SMILES: [Li+].[B-](C1=CC=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.COCCOC.COCCOC.COCCOC
| PubChem CID | 23681136 |
|---|---|
| CAS | 75965-35-4 |
| Molecular Weight (g/mol) | 596.54 |
| MDL Number | MFCD00013311 |
| SMILES | [Li+].[B-](C1=CC=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.COCCOC.COCCOC.COCCOC |
| Synonym | lithium tetraphenylborate tris 1,2-dimethoxyethane,tetraphenylboron lithium tris 1,2-dimethoxyethane,lithium tetraphenylborate tris 1,2-dimethoxyethane adduct,lithium tetraphenylborate 1--1,2-dimethoxyethane 1/1/3,lithium 1+ tris 1,2-dimethoxyethane tetraphenylborate |
| IUPAC Name | lithium;1,2-dimethoxyethane;tetraphenylboranuide |
| InChI Key | ADYUZFWVPWDPFK-UHFFFAOYSA-N |
| Molecular Formula | C36H50BLiO6 |
n-Heptadecane, 99%
CAS: 629-78-7 Molecular Formula: C17H36 Molecular Weight (g/mol): 240.475 MDL Number: MFCD00009002 InChI Key: NDJKXXJCMXVBJW-UHFFFAOYSA-N Synonym: n-heptadecane,heptadekan,unii-h7c0j39xum,hexadecane, methyl,h7c0j39xum,heptadecane, analytical standard,normal-heptadecane,heptadecane,dsstox_cid_27061,dsstox_rid_82078 PubChem CID: 12398 ChEBI: CHEBI:16148 IUPAC Name: heptadecane SMILES: CCCCCCCCCCCCCCCCC
| PubChem CID | 12398 |
|---|---|
| CAS | 629-78-7 |
| Molecular Weight (g/mol) | 240.475 |
| ChEBI | CHEBI:16148 |
| MDL Number | MFCD00009002 |
| SMILES | CCCCCCCCCCCCCCCCC |
| Synonym | n-heptadecane,heptadekan,unii-h7c0j39xum,hexadecane, methyl,h7c0j39xum,heptadecane, analytical standard,normal-heptadecane,heptadecane,dsstox_cid_27061,dsstox_rid_82078 |
| IUPAC Name | heptadecane |
| InChI Key | NDJKXXJCMXVBJW-UHFFFAOYSA-N |
| Molecular Formula | C17H36 |