Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
2-Hydroxyethyl acrylate, 97%, stabilized
CAS: 818-61-1 Molecular Formula: C5H8O3 Molecular Weight (g/mol): 116.12 MDL Number: MFCD00002865 InChI Key: OMIGHNLMNHATMP-UHFFFAOYSA-N Synonym: 2-hydroxyethyl acrylate,hydroxyethyl acrylate,2-propenoic acid, 2-hydroxyethyl ester,ethylene glycol monoacrylate,bisomer 2hea,acrylic acid 2-hydroxyethyl ester,2-acryloyloxy ethanol,ethylene glycol, acrylate,acrylic acid, 2-hydroxyethyl ester,2-hydroxyethylacrylate PubChem CID: 13165 IUPAC Name: 2-hydroxyethyl prop-2-enoate SMILES: C=CC(=O)OCCO
| PubChem CID | 13165 |
|---|---|
| CAS | 818-61-1 |
| Molecular Weight (g/mol) | 116.12 |
| MDL Number | MFCD00002865 |
| SMILES | C=CC(=O)OCCO |
| Synonym | 2-hydroxyethyl acrylate,hydroxyethyl acrylate,2-propenoic acid, 2-hydroxyethyl ester,ethylene glycol monoacrylate,bisomer 2hea,acrylic acid 2-hydroxyethyl ester,2-acryloyloxy ethanol,ethylene glycol, acrylate,acrylic acid, 2-hydroxyethyl ester,2-hydroxyethylacrylate |
| IUPAC Name | 2-hydroxyethyl prop-2-enoate |
| InChI Key | OMIGHNLMNHATMP-UHFFFAOYSA-N |
| Molecular Formula | C5H8O3 |
Orcinol Monohydrate, 99%
CAS: 6153-39-5 Molecular Formula: C7H8O2·H2O Molecular Weight (g/mol): 142.15 MDL Number: MFCD00149092 InChI Key: NBKPNAMTHBIMLA-UHFFFAOYSA-N Synonym: 5-methylbenzene-1,3-diol hydrate,orcinol monohydrate,5-methylresorcinol monohydrate,3,5-dihydroxytoluene monohydrate,orcinol hydrate,resorcinol, 5-methyl-, monohydrate,1,3-benzenediol, 5-methyl-, monohydrate,1,3-dihydroxy-5-methylbenzene monohydrate,acmc-209mtl,5-methylresorcinol hydrate PubChem CID: 3083941 IUPAC Name: 5-methylbenzene-1,3-diol;hydrate SMILES: CC1=CC(=CC(=C1)O)O.O
| PubChem CID | 3083941 |
|---|---|
| CAS | 6153-39-5 |
| Molecular Weight (g/mol) | 142.15 |
| MDL Number | MFCD00149092 |
| SMILES | CC1=CC(=CC(=C1)O)O.O |
| Synonym | 5-methylbenzene-1,3-diol hydrate,orcinol monohydrate,5-methylresorcinol monohydrate,3,5-dihydroxytoluene monohydrate,orcinol hydrate,resorcinol, 5-methyl-, monohydrate,1,3-benzenediol, 5-methyl-, monohydrate,1,3-dihydroxy-5-methylbenzene monohydrate,acmc-209mtl,5-methylresorcinol hydrate |
| IUPAC Name | 5-methylbenzene-1,3-diol;hydrate |
| InChI Key | NBKPNAMTHBIMLA-UHFFFAOYSA-N |
| Molecular Formula | C7H8O2·H2O |
2-Methyl-2-pentenal, 97%
CAS: 623-36-9 Molecular Formula: C6H10O Molecular Weight (g/mol): 98.15 MDL Number: MFCD00006978 InChI Key: IDEYZABHVQLHAF-GQCTYLIASA-N Synonym: 2-methyl-2-pentenal,2-pentenal, 2-methyl,e-2-methyl-2-pentenal,2-methyl-3-ethylacrolein,2-methyl-2-penten-1-al,2-methyl-2-pentene-1-al,2,4-dimethylcrotonaldehyde,trans-2-methyl-2-pentenal,e-2-methylpent-2-enal,unii-98qag1u530 PubChem CID: 5319754 IUPAC Name: (E)-2-methylpent-2-enal SMILES: CCC=C(C)C=O
| PubChem CID | 5319754 |
|---|---|
| CAS | 623-36-9 |
| Molecular Weight (g/mol) | 98.15 |
| MDL Number | MFCD00006978 |
| SMILES | CCC=C(C)C=O |
| Synonym | 2-methyl-2-pentenal,2-pentenal, 2-methyl,e-2-methyl-2-pentenal,2-methyl-3-ethylacrolein,2-methyl-2-penten-1-al,2-methyl-2-pentene-1-al,2,4-dimethylcrotonaldehyde,trans-2-methyl-2-pentenal,e-2-methylpent-2-enal,unii-98qag1u530 |
| IUPAC Name | (E)-2-methylpent-2-enal |
| InChI Key | IDEYZABHVQLHAF-GQCTYLIASA-N |
| Molecular Formula | C6H10O |
Potassium hydrogen L-tartrate, 98+%
CAS: 868-14-4 Molecular Formula: C4H5KO6 Molecular Weight (g/mol): 188.18 MDL Number: MFCD00065392,MFCD00071626,MFCD00064206 InChI Key: KYKNRZGSIGMXFH-ZVGUSBNCSA-M Synonym: potassium bitartrate,l +-potassium hydrogen tartrate,potassium 3-carboxy-2,3-dihydroxypropanoate,monopotassium tartrate,potassium acid tartrate,kaliumtartrat,potassium hydrogentartrate,1-potassium hydrogentartrate,ksc657e1t,butanedioic acid, 2,3-dihydroxy-2r,3r-, potassium salt 1:1 IUPAC Name: 2,3-dihydroxybutanedioic acid;potassium SMILES: [K+].O[C@H]([C@@H](O)C([O-])=O)C(O)=O
| CAS | 868-14-4 |
|---|---|
| Molecular Weight (g/mol) | 188.18 |
| MDL Number | MFCD00065392,MFCD00071626,MFCD00064206 |
| SMILES | [K+].O[C@H]([C@@H](O)C([O-])=O)C(O)=O |
| Synonym | potassium bitartrate,l +-potassium hydrogen tartrate,potassium 3-carboxy-2,3-dihydroxypropanoate,monopotassium tartrate,potassium acid tartrate,kaliumtartrat,potassium hydrogentartrate,1-potassium hydrogentartrate,ksc657e1t,butanedioic acid, 2,3-dihydroxy-2r,3r-, potassium salt 1:1 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;potassium |
| InChI Key | KYKNRZGSIGMXFH-ZVGUSBNCSA-M |
| Molecular Formula | C4H5KO6 |
2-Methylimidazole, 99%
CAS: 693-98-1 Molecular Formula: C4H6N2 Molecular Weight (g/mol): 82.11 MDL Number: MFCD00005190 InChI Key: LXBGSDVWAMZHDD-UHFFFAOYSA-N Synonym: 2-methylimidazole,1h-imidazole, 2-methyl,imidazole, 2-methyl,2-methyl imidazole,2-methylglyoxaline,unii-t0049z45lz,ccris 2459,dsstox_cid_2107,dsstox_rid_76489,dsstox_gsid_22107 PubChem CID: 12749 IUPAC Name: 2-methyl-1H-imidazole SMILES: CC1=NC=CN1
| PubChem CID | 12749 |
|---|---|
| CAS | 693-98-1 |
| Molecular Weight (g/mol) | 82.11 |
| MDL Number | MFCD00005190 |
| SMILES | CC1=NC=CN1 |
| Synonym | 2-methylimidazole,1h-imidazole, 2-methyl,imidazole, 2-methyl,2-methyl imidazole,2-methylglyoxaline,unii-t0049z45lz,ccris 2459,dsstox_cid_2107,dsstox_rid_76489,dsstox_gsid_22107 |
| IUPAC Name | 2-methyl-1H-imidazole |
| InChI Key | LXBGSDVWAMZHDD-UHFFFAOYSA-N |
| Molecular Formula | C4H6N2 |
4-Nitrophenyl phosphate, 97%
CAS: 330-13-2 Molecular Formula: C6H6NO6P Molecular Weight (g/mol): 219.09 InChI Key: XZKIHKMTEMTJQX-UHFFFAOYSA-N Synonym: 4-nitrophenyl phosphate,4-nitrophenyl dihydrogen phosphate,nitrophenylphosphate,phosphoric acid, mono 4-nitrophenyl ester,p-nitrophenyl phosphate,p-nitrophenyl dihydrogen phosphate,p-nitrophenol phosphate,p-nitrophenylphosphate,pnpp PubChem CID: 378 ChEBI: CHEBI:17440 SMILES: C1=CC(=CC=C1[N+](=O)[O-])OP(=O)(O)O
| PubChem CID | 378 |
|---|---|
| CAS | 330-13-2 |
| Molecular Weight (g/mol) | 219.09 |
| ChEBI | CHEBI:17440 |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OP(=O)(O)O |
| Synonym | 4-nitrophenyl phosphate,4-nitrophenyl dihydrogen phosphate,nitrophenylphosphate,phosphoric acid, mono 4-nitrophenyl ester,p-nitrophenyl phosphate,p-nitrophenyl dihydrogen phosphate,p-nitrophenol phosphate,p-nitrophenylphosphate,pnpp |
| InChI Key | XZKIHKMTEMTJQX-UHFFFAOYSA-N |
| Molecular Formula | C6H6NO6P |
Urea, 99.5%, for analysis
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.06 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.06 |
| ChEBI | CHEBI:48376 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Ethylenediaminetetraacetic acid, iron(III) monosodium salt
CAS: 15708-41-5 Molecular Formula: C10H12FeN2NaO8 Molecular Weight (g/mol): 367.047 MDL Number: MFCD00078215 InChI Key: MKWYFZFMAMBPQK-UHFFFAOYSA-J Synonym: sodium feredetate,edta ferric sodium salt,calmosine,sodium ironedetate,edta iron iii sodium salt,ferisan,sytron,sequestrene nafe,sodium iron edta,ferric sodium edta PubChem CID: 27461 ChEBI: CHEBI:78292 IUPAC Name: sodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;iron(3+) SMILES: C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Na+].[Fe+3]
| PubChem CID | 27461 |
|---|---|
| CAS | 15708-41-5 |
| Molecular Weight (g/mol) | 367.047 |
| ChEBI | CHEBI:78292 |
| MDL Number | MFCD00078215 |
| SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Na+].[Fe+3] |
| Synonym | sodium feredetate,edta ferric sodium salt,calmosine,sodium ironedetate,edta iron iii sodium salt,ferisan,sytron,sequestrene nafe,sodium iron edta,ferric sodium edta |
| IUPAC Name | sodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;iron(3+) |
| InChI Key | MKWYFZFMAMBPQK-UHFFFAOYSA-J |
| Molecular Formula | C10H12FeN2NaO8 |
| CAS | 9010-66-6 |
|---|---|
| MDL Number | MFCD00062414 |
Nicotinic acid, 99%
CAS: 59-67-6 Molecular Formula: C6H5NO2 Molecular Weight (g/mol): 123.11 MDL Number: MFCD00006391 InChI Key: PVNIIMVLHYAWGP-UHFFFAOYSA-N Synonym: nicotinic acid,niacin,3-pyridinecarboxylic acid,3-carboxypyridine,wampocap,acidum nicotinicum,apelagrin,pellagrin,akotin,daskil PubChem CID: 938 ChEBI: CHEBI:15940 IUPAC Name: pyridine-3-carboxylic acid SMILES: OC(=O)C1=CC=CN=C1
| PubChem CID | 938 |
|---|---|
| CAS | 59-67-6 |
| Molecular Weight (g/mol) | 123.11 |
| ChEBI | CHEBI:15940 |
| MDL Number | MFCD00006391 |
| SMILES | OC(=O)C1=CC=CN=C1 |
| Synonym | nicotinic acid,niacin,3-pyridinecarboxylic acid,3-carboxypyridine,wampocap,acidum nicotinicum,apelagrin,pellagrin,akotin,daskil |
| IUPAC Name | pyridine-3-carboxylic acid |
| InChI Key | PVNIIMVLHYAWGP-UHFFFAOYSA-N |
| Molecular Formula | C6H5NO2 |
Hydrazine sulfate, 99+%
CAS: 10034-93-2 Molecular Formula: H4N2·H2SO4 Molecular Weight (g/mol): 130.12 MDL Number: MFCD00044873 InChI Key: ZGCHATBSUIJLRL-UHFFFAOYSA-N Synonym: hydrazine sulfate,hydrazine monosulfate,hydrazine, sulfate,hydrazine sulphate,hydrazinium sulfate,hydrazonium sulfate,hydrazine sulfate 1:1,segidrin,sehydrin,diamine sulfate PubChem CID: 24842 IUPAC Name: hydrazine;sulfuric acid SMILES: NN.OS(=O)(=O)O
| PubChem CID | 24842 |
|---|---|
| CAS | 10034-93-2 |
| Molecular Weight (g/mol) | 130.12 |
| MDL Number | MFCD00044873 |
| SMILES | NN.OS(=O)(=O)O |
| Synonym | hydrazine sulfate,hydrazine monosulfate,hydrazine, sulfate,hydrazine sulphate,hydrazinium sulfate,hydrazonium sulfate,hydrazine sulfate 1:1,segidrin,sehydrin,diamine sulfate |
| IUPAC Name | hydrazine;sulfuric acid |
| InChI Key | ZGCHATBSUIJLRL-UHFFFAOYSA-N |
| Molecular Formula | H4N2·H2SO4 |
Sebacoyl chloride, 95%
CAS: 111-19-3 Molecular Formula: C10H16Cl2O2 Molecular Weight (g/mol): 239.136 MDL Number: MFCD00000770 InChI Key: WMPOZLHMGVKUEJ-UHFFFAOYSA-N Synonym: sebacoyl chloride,sebacyl chloride,sebacoyl dichloride,sebacic acid dichloride,decanedioyl chloride,sebacoylchloride,octane-1,8-dicarbonyl chloride,sebacoyl chloride, cp,acmc-1byrk,decanedioic acid chloride PubChem CID: 66072 IUPAC Name: decanedioyl dichloride SMILES: C(CCCCC(=O)Cl)CCCC(=O)Cl
| PubChem CID | 66072 |
|---|---|
| CAS | 111-19-3 |
| Molecular Weight (g/mol) | 239.136 |
| MDL Number | MFCD00000770 |
| SMILES | C(CCCCC(=O)Cl)CCCC(=O)Cl |
| Synonym | sebacoyl chloride,sebacyl chloride,sebacoyl dichloride,sebacic acid dichloride,decanedioyl chloride,sebacoylchloride,octane-1,8-dicarbonyl chloride,sebacoyl chloride, cp,acmc-1byrk,decanedioic acid chloride |
| IUPAC Name | decanedioyl dichloride |
| InChI Key | WMPOZLHMGVKUEJ-UHFFFAOYSA-N |
| Molecular Formula | C10H16Cl2O2 |
Thiourea, 99%, extra pure
CAS: 62-56-6 Molecular Formula: CH4N2S Molecular Weight (g/mol): 76.12 MDL Number: MFCD00008067 InChI Key: UMGDCJDMYOKAJW-UHFFFAOYSA-N Synonym: thiocarbamide,2-thiourea,pseudothiourea,isothiourea,sulourea,2-thiopseudourea,sulfourea,thiuronium,thiocarbonic acid diamide,urea, thio PubChem CID: 2723790 ChEBI: CHEBI:36946 IUPAC Name: thiourea SMILES: NC(N)=S
| PubChem CID | 2723790 |
|---|---|
| CAS | 62-56-6 |
| Molecular Weight (g/mol) | 76.12 |
| ChEBI | CHEBI:36946 |
| MDL Number | MFCD00008067 |
| SMILES | NC(N)=S |
| Synonym | thiocarbamide,2-thiourea,pseudothiourea,isothiourea,sulourea,2-thiopseudourea,sulfourea,thiuronium,thiocarbonic acid diamide,urea, thio |
| IUPAC Name | thiourea |
| InChI Key | UMGDCJDMYOKAJW-UHFFFAOYSA-N |
| Molecular Formula | CH4N2S |
Oxalyl chloride, 98%
CAS: 79-37-8 Molecular Formula: C2Cl2O2 Molecular Weight (g/mol): 126.92 MDL Number: MFCD00000704 InChI Key: CTSLXHKWHWQRSH-UHFFFAOYSA-N Synonym: oxalyl chloride,ethanedioyl dichloride,oxalic dichloride,oxaloyl chloride,oxalic acid dichloride,oxalic acid chloride,ethanedioyl chloride,oxalylchloride,unii-r4y96317dw,cocl 2 PubChem CID: 65578 IUPAC Name: oxalyl dichloride SMILES: C(=O)(C(=O)Cl)Cl
| PubChem CID | 65578 |
|---|---|
| CAS | 79-37-8 |
| Molecular Weight (g/mol) | 126.92 |
| MDL Number | MFCD00000704 |
| SMILES | C(=O)(C(=O)Cl)Cl |
| Synonym | oxalyl chloride,ethanedioyl dichloride,oxalic dichloride,oxaloyl chloride,oxalic acid dichloride,oxalic acid chloride,ethanedioyl chloride,oxalylchloride,unii-r4y96317dw,cocl 2 |
| IUPAC Name | oxalyl dichloride |
| InChI Key | CTSLXHKWHWQRSH-UHFFFAOYSA-N |
| Molecular Formula | C2Cl2O2 |
1-(3-Dimethylaminopropyl)-3-ethylcarbodiimide Hydrochloride 98.0+%, TCI America™
CAS: 25952-53-8 Molecular Formula: C8H18ClN3 Molecular Weight (g/mol): 191.70 MDL Number: MFCD00012503 InChI Key: FPQQSJJWHUJYPU-UHFFFAOYSA-N Synonym: 1-3-dimethylaminopropyl-3-ethylcarbodiimide hydrochloride,edc.hcl,edci,edc hydrochloride,wsc hcl,edac hydrochloride,edac, hydrochloride,1-ethyl-3-3-dimethylaminopropyl carbodiimide hydrochloride,edcl,edac hcl PubChem CID: 2723939 IUPAC Name: ({[3-(dimethylamino)propyl]imino}methylidene)(ethyl)amine hydrochloride SMILES: Cl.CCN=C=NCCCN(C)C
| PubChem CID | 2723939 |
|---|---|
| CAS | 25952-53-8 |
| Molecular Weight (g/mol) | 191.70 |
| MDL Number | MFCD00012503 |
| SMILES | Cl.CCN=C=NCCCN(C)C |
| Synonym | 1-3-dimethylaminopropyl-3-ethylcarbodiimide hydrochloride,edc.hcl,edci,edc hydrochloride,wsc hcl,edac hydrochloride,edac, hydrochloride,1-ethyl-3-3-dimethylaminopropyl carbodiimide hydrochloride,edcl,edac hcl |
| IUPAC Name | ({[3-(dimethylamino)propyl]imino}methylidene)(ethyl)amine hydrochloride |
| InChI Key | FPQQSJJWHUJYPU-UHFFFAOYSA-N |
| Molecular Formula | C8H18ClN3 |