Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
1,2-Dimethoxyethane, 99+%, stab. with BHT
CAS: 110-71-4 Molecular Formula: C4H10O2 Molecular Weight (g/mol): 90.122 MDL Number: MFCD00008502 InChI Key: XTHFKEDIFFGKHM-UHFFFAOYSA-N Synonym: monoglyme,ethylene glycol dimethyl ether,glyme,dimethyl cellosolve,egdme,ethane, 1,2-dimethoxy,dimethoxyethane,2,5-dioxahexane,glycol dimethyl ether,ethylene dimethyl ether PubChem CID: 8071 ChEBI: CHEBI:42263 IUPAC Name: 1,2-dimethoxyethane SMILES: COCCOC
| PubChem CID | 8071 |
|---|---|
| CAS | 110-71-4 |
| Molecular Weight (g/mol) | 90.122 |
| ChEBI | CHEBI:42263 |
| MDL Number | MFCD00008502 |
| SMILES | COCCOC |
| Synonym | monoglyme,ethylene glycol dimethyl ether,glyme,dimethyl cellosolve,egdme,ethane, 1,2-dimethoxy,dimethoxyethane,2,5-dioxahexane,glycol dimethyl ether,ethylene dimethyl ether |
| IUPAC Name | 1,2-dimethoxyethane |
| InChI Key | XTHFKEDIFFGKHM-UHFFFAOYSA-N |
| Molecular Formula | C4H10O2 |
beta-Nicotinamide adenine dinucleotide phosphate disodium salt, 97%
CAS: 24292-60-2 Molecular Formula: C21H26N7Na2O17P3 Molecular Weight (g/mol): 787.37 MDL Number: MFCD00065390 InChI Key: WSDDJLMGYRLUKR-MWLGWILCNA-L Synonym: nadp disodium salt,beta-nicotinamide adenine dinucleotide phosphate disodium salt PubChem CID: 131851653 IUPAC Name: [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate;sodium SMILES: [Na+].[Na+].NC(=O)C1=CC=C[N+](=C1)[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OC[C@H]2O[C@H]([C@H](OP(O)([O-])=O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O
| PubChem CID | 131851653 |
|---|---|
| CAS | 24292-60-2 |
| Molecular Weight (g/mol) | 787.37 |
| MDL Number | MFCD00065390 |
| SMILES | [Na+].[Na+].NC(=O)C1=CC=C[N+](=C1)[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OC[C@H]2O[C@H]([C@H](OP(O)([O-])=O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O |
| Synonym | nadp disodium salt,beta-nicotinamide adenine dinucleotide phosphate disodium salt |
| IUPAC Name | [[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-4-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R,5R)-5-(3-carbamoylpyridin-1-ium-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate;sodium |
| InChI Key | WSDDJLMGYRLUKR-MWLGWILCNA-L |
| Molecular Formula | C21H26N7Na2O17P3 |
Creatinine, 98%
CAS: 60-27-5 Molecular Formula: C4H7N3O Molecular Weight (g/mol): 113.12 MDL Number: MFCD00059730 InChI Key: DDRJAANPRJIHGJ-UHFFFAOYSA-N Synonym: creatinine,2-imino-1-methylimidazolidin-4-one,1-methylglycocyamidine,1-methylhydantoin-2-imide,creatinine,heated,4h-imidazol-4-one, 2-amino-1,5-dihydro-1-methyl,2-amino-1-methylimidazolin-4-one,creatinina,kreatinin,unii-ayi8ex34eu PubChem CID: 588 ChEBI: CHEBI:16737 IUPAC Name: 2-amino-3-methyl-4H-imidazol-5-one SMILES: CN1CC(=O)N=C1N
| PubChem CID | 588 |
|---|---|
| CAS | 60-27-5 |
| Molecular Weight (g/mol) | 113.12 |
| ChEBI | CHEBI:16737 |
| MDL Number | MFCD00059730 |
| SMILES | CN1CC(=O)N=C1N |
| Synonym | creatinine,2-imino-1-methylimidazolidin-4-one,1-methylglycocyamidine,1-methylhydantoin-2-imide,creatinine,heated,4h-imidazol-4-one, 2-amino-1,5-dihydro-1-methyl,2-amino-1-methylimidazolin-4-one,creatinina,kreatinin,unii-ayi8ex34eu |
| IUPAC Name | 2-amino-3-methyl-4H-imidazol-5-one |
| InChI Key | DDRJAANPRJIHGJ-UHFFFAOYSA-N |
| Molecular Formula | C4H7N3O |
Diethyl succinate, 98%
CAS: 123-25-1 Molecular Formula: C8H14O4 Molecular Weight (g/mol): 174.196 MDL Number: MFCD00009208 InChI Key: DKMROQRQHGEIOW-UHFFFAOYSA-N Synonym: diethyl succinate,ethyl succinate,butanedioic acid, diethyl ester,1,4-diethyl butanedioate,succinic acid, diethyl ester,succinic acid diethyl ester,diethyl ethanedicarboxylate,unii-elp55c13dr,diethylester kyseliny jantarove,fema no. 2377 PubChem CID: 31249 IUPAC Name: diethyl butanedioate SMILES: CCOC(=O)CCC(=O)OCC
| PubChem CID | 31249 |
|---|---|
| CAS | 123-25-1 |
| Molecular Weight (g/mol) | 174.196 |
| MDL Number | MFCD00009208 |
| SMILES | CCOC(=O)CCC(=O)OCC |
| Synonym | diethyl succinate,ethyl succinate,butanedioic acid, diethyl ester,1,4-diethyl butanedioate,succinic acid, diethyl ester,succinic acid diethyl ester,diethyl ethanedicarboxylate,unii-elp55c13dr,diethylester kyseliny jantarove,fema no. 2377 |
| IUPAC Name | diethyl butanedioate |
| InChI Key | DKMROQRQHGEIOW-UHFFFAOYSA-N |
| Molecular Formula | C8H14O4 |
Dodecane, mixture of isomers
CAS: 13475-82-6 Molecular Formula: C12H26 Molecular Weight (g/mol): 170.34 MDL Number: MFCD00008969 InChI Key: VKPSKYDESGTTFR-UHFFFAOYSA-N PubChem CID: 26058 ChEBI: CHEBI:77509 IUPAC Name: 2,2,4,6,6-pentamethylheptane SMILES: CC(CC(C)(C)C)CC(C)(C)C
| PubChem CID | 26058 |
|---|---|
| CAS | 13475-82-6 |
| Molecular Weight (g/mol) | 170.34 |
| ChEBI | CHEBI:77509 |
| MDL Number | MFCD00008969 |
| SMILES | CC(CC(C)(C)C)CC(C)(C)C |
| IUPAC Name | 2,2,4,6,6-pentamethylheptane |
| InChI Key | VKPSKYDESGTTFR-UHFFFAOYSA-N |
| Molecular Formula | C12H26 |
Ethanolamine, ACS reagent
CAS: 141-43-5 Molecular Formula: C2H7NO Molecular Weight (g/mol): 61.08 MDL Number: MFCD00008183 InChI Key: HZAXFHJVJLSVMW-UHFFFAOYSA-N Synonym: ethanolamine,monoethanolamine,aminoethanol,2-hydroxyethylamine,colamine,glycinol,olamine,2-amino-1-ethanol,ethanol, 2-amino,ethylolamine PubChem CID: 700 ChEBI: CHEBI:16000 SMILES: NCCO
| PubChem CID | 700 |
|---|---|
| CAS | 141-43-5 |
| Molecular Weight (g/mol) | 61.08 |
| ChEBI | CHEBI:16000 |
| MDL Number | MFCD00008183 |
| SMILES | NCCO |
| Synonym | ethanolamine,monoethanolamine,aminoethanol,2-hydroxyethylamine,colamine,glycinol,olamine,2-amino-1-ethanol,ethanol, 2-amino,ethylolamine |
| InChI Key | HZAXFHJVJLSVMW-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO |
9-Fluorenylmethyl chloroformate, 98+%
CAS: 28920-43-6 Molecular Formula: C15H11ClO2 Molecular Weight (g/mol): 258.701 MDL Number: MFCD00001138 InChI Key: IRXSLJNXXZKURP-UHFFFAOYSA-N Synonym: 9-fluorenylmethyl chloroformate,fmoc-cl,fmoc-chloride,fmoc chloride,9h-fluoren-9-ylmethyl chloroformate,carbonochloridic acid, 9h-fluoren-9-ylmethyl ester,9-fluorenylmethoxycarbonyl chloride,9-fluorenylmethylchloroformate,9h-fluoren-9-yl methyl carbonochloridate,9h-fluoren-9-ylmethoxy carbonyl chloride PubChem CID: 34367 IUPAC Name: 9H-fluoren-9-ylmethyl carbonochloridate SMILES: C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)Cl
| PubChem CID | 34367 |
|---|---|
| CAS | 28920-43-6 |
| Molecular Weight (g/mol) | 258.701 |
| MDL Number | MFCD00001138 |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)Cl |
| Synonym | 9-fluorenylmethyl chloroformate,fmoc-cl,fmoc-chloride,fmoc chloride,9h-fluoren-9-ylmethyl chloroformate,carbonochloridic acid, 9h-fluoren-9-ylmethyl ester,9-fluorenylmethoxycarbonyl chloride,9-fluorenylmethylchloroformate,9h-fluoren-9-yl methyl carbonochloridate,9h-fluoren-9-ylmethoxy carbonyl chloride |
| IUPAC Name | 9H-fluoren-9-ylmethyl carbonochloridate |
| InChI Key | IRXSLJNXXZKURP-UHFFFAOYSA-N |
| Molecular Formula | C15H11ClO2 |
Poly(acrylic acid), 25 wt% solution in water; approx. M.W. 240,000
CAS: 9003-01-4 Molecular Formula: (C3H4O2)n Molecular Weight (g/mol): 72.06 MDL Number: MFCD00084394 InChI Key: NNMHYFLPFNGQFZ-UHFFFAOYSA-M Synonym: acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer PubChem CID: 6581 ChEBI: CHEBI:18308 SMILES: OC(=O)C(-*)C-*
| PubChem CID | 6581 |
|---|---|
| CAS | 9003-01-4 |
| Molecular Weight (g/mol) | 72.06 |
| ChEBI | CHEBI:18308 |
| MDL Number | MFCD00084394 |
| SMILES | OC(=O)C(-*)C-* |
| Synonym | acrylic acid,2-propenoic acid,propenoic acid,vinylformic acid,acroleic acid,propene acid,ethylenecarboxylic acid,polyacrylate,propenoate,carbomer |
| InChI Key | NNMHYFLPFNGQFZ-UHFFFAOYSA-M |
| Molecular Formula | (C3H4O2)n |
Urea hydrogen peroxide adduct, 97%
CAS: 124-43-6 Molecular Formula: CH6N2O3 Molecular Weight (g/mol): 94.07 MDL Number: MFCD00013119 InChI Key: AQLJVWUFPCUVLO-UHFFFAOYSA-N Synonym: urea hydrogen peroxide,carbamide peroxide,percarbamide,urea peroxide,urea dioxide,hydrogen peroxide urea,urea hydroperoxide,hydroperit,hydroperite,percarbamid PubChem CID: 31294 ChEBI: CHEBI:75178 IUPAC Name: hydrogen peroxide;urea SMILES: C(=O)(N)N.OO
| PubChem CID | 31294 |
|---|---|
| CAS | 124-43-6 |
| Molecular Weight (g/mol) | 94.07 |
| ChEBI | CHEBI:75178 |
| MDL Number | MFCD00013119 |
| SMILES | C(=O)(N)N.OO |
| Synonym | urea hydrogen peroxide,carbamide peroxide,percarbamide,urea peroxide,urea dioxide,hydrogen peroxide urea,urea hydroperoxide,hydroperit,hydroperite,percarbamid |
| IUPAC Name | hydrogen peroxide;urea |
| InChI Key | AQLJVWUFPCUVLO-UHFFFAOYSA-N |
| Molecular Formula | CH6N2O3 |
Quinhydrone, 98%
CAS: 106-34-3 Molecular Formula: C12H10O4 Molecular Weight (g/mol): 218.21 MDL Number: MFCD00010310 InChI Key: BDJXVNRFAQSMAA-UHFFFAOYSA-N Synonym: quinhydrone,green hydroquinone,p-benzoquinhydrone,chinhydron,chinhydron czech,unii-p4a66lq3qj,hydroquinone, compd. with p-benzoquinone,p-benzoquinone, compd. with hydroquinone,2,5-cyclohexadiene-1,4-dione, compd. with 1,4-benzenediol 1:1,p-benzoquinone-hydroquinone compound 1:1 PubChem CID: 7801 ChEBI: CHEBI:26491 IUPAC Name: benzene-1,4-diol;cyclohexa-2,5-diene-1,4-dione SMILES: OC1=CC=C(O)C=C1.O=C1C=CC(=O)C=C1
| PubChem CID | 7801 |
|---|---|
| CAS | 106-34-3 |
| Molecular Weight (g/mol) | 218.21 |
| ChEBI | CHEBI:26491 |
| MDL Number | MFCD00010310 |
| SMILES | OC1=CC=C(O)C=C1.O=C1C=CC(=O)C=C1 |
| Synonym | quinhydrone,green hydroquinone,p-benzoquinhydrone,chinhydron,chinhydron czech,unii-p4a66lq3qj,hydroquinone, compd. with p-benzoquinone,p-benzoquinone, compd. with hydroquinone,2,5-cyclohexadiene-1,4-dione, compd. with 1,4-benzenediol 1:1,p-benzoquinone-hydroquinone compound 1:1 |
| IUPAC Name | benzene-1,4-diol;cyclohexa-2,5-diene-1,4-dione |
| InChI Key | BDJXVNRFAQSMAA-UHFFFAOYSA-N |
| Molecular Formula | C12H10O4 |
Phosphoenolpyruvic acid monopotassium salt, 99%
CAS: 4265-07-0 Molecular Formula: C3H4KO6P Molecular Weight (g/mol): 206.131 MDL Number: MFCD00044476 InChI Key: SOSDSEAIODNVPX-UHFFFAOYSA-M Synonym: potassium 1-carboxyvinyl hydrogenphosphate,potassium hydrogen 2-phosphonatooxy acrylate,2-propenoic acid, 2-phosphonooxy-, monopotassium salt,potassium 1-carboxyvinyl hydrogen phosphate,phospho enol pyruvic acid monopotassium salt,phosphoenolpyruvic acid monopotassium salt,2-propenoic acid, 2-phosphonooxy-, potassium salt 1:1,potassium 2-hydrogen phosphonooxy prop-2-enoic acid,phosphoenolpyruvate potassium salt,potassium 2-hydrogen phosphonatooxy prop-2-enoic acid PubChem CID: 23678879 IUPAC Name: potassium;1-carboxyethenyl hydrogen phosphate SMILES: C=C(C(=O)O)OP(=O)(O)[O-].[K+]
| PubChem CID | 23678879 |
|---|---|
| CAS | 4265-07-0 |
| Molecular Weight (g/mol) | 206.131 |
| MDL Number | MFCD00044476 |
| SMILES | C=C(C(=O)O)OP(=O)(O)[O-].[K+] |
| Synonym | potassium 1-carboxyvinyl hydrogenphosphate,potassium hydrogen 2-phosphonatooxy acrylate,2-propenoic acid, 2-phosphonooxy-, monopotassium salt,potassium 1-carboxyvinyl hydrogen phosphate,phospho enol pyruvic acid monopotassium salt,phosphoenolpyruvic acid monopotassium salt,2-propenoic acid, 2-phosphonooxy-, potassium salt 1:1,potassium 2-hydrogen phosphonooxy prop-2-enoic acid,phosphoenolpyruvate potassium salt,potassium 2-hydrogen phosphonatooxy prop-2-enoic acid |
| IUPAC Name | potassium;1-carboxyethenyl hydrogen phosphate |
| InChI Key | SOSDSEAIODNVPX-UHFFFAOYSA-M |
| Molecular Formula | C3H4KO6P |
p-Cresol, 99+%, pure
CAS: 106-44-5 Molecular Formula: C7H8O Molecular Weight (g/mol): 108.14 MDL Number: MFCD00002376 InChI Key: IWDCLRJOBJJRNH-UHFFFAOYSA-N Synonym: p-cresol,4-cresol,4-hydroxytoluene,p-methylphenol,phenol, 4-methyl,p-hydroxytoluene,p-tolyl alcohol,p-kresol,para-cresol,p-oxytoluene PubChem CID: 2879 ChEBI: CHEBI:17847 IUPAC Name: 4-methylphenol SMILES: CC1=CC=C(C=C1)O
| PubChem CID | 2879 |
|---|---|
| CAS | 106-44-5 |
| Molecular Weight (g/mol) | 108.14 |
| ChEBI | CHEBI:17847 |
| MDL Number | MFCD00002376 |
| SMILES | CC1=CC=C(C=C1)O |
| Synonym | p-cresol,4-cresol,4-hydroxytoluene,p-methylphenol,phenol, 4-methyl,p-hydroxytoluene,p-tolyl alcohol,p-kresol,para-cresol,p-oxytoluene |
| IUPAC Name | 4-methylphenol |
| InChI Key | IWDCLRJOBJJRNH-UHFFFAOYSA-N |
| Molecular Formula | C7H8O |
2-Hydroxy-4-(methacryloyloxy)benzophenone, 99%
CAS: 2035-72-5 Molecular Formula: C17H14O4 Molecular Weight (g/mol): 282.295 MDL Number: MFCD00080561 InChI Key: IMNBHNRXUAJVQE-UHFFFAOYSA-N Synonym: 4-benzoyl-3-hydroxyphenyl methacrylate,4-methacryloxy-2-hydroxybenzophenone,2-hydroxy-4-methacryloyloxy benzophenone,methacrylic acid 4-benzoyl-3-hydroxyphenyl ester,3-hydroxy-4-phenylcarbonyl phenyl 2-methylprop-2-enoate,2-propenoic acid, 2-methyl-, 4-benzoyl-3-hydroxyphenyl ester,acmc-20amfp,2-hydroxy-4-methacryloxybenzophenone,2-hydroxy-4-methacryloyloxybenzophenone PubChem CID: 74856 IUPAC Name: (4-benzoyl-3-hydroxyphenyl) 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OC1=CC(=C(C=C1)C(=O)C2=CC=CC=C2)O
| PubChem CID | 74856 |
|---|---|
| CAS | 2035-72-5 |
| Molecular Weight (g/mol) | 282.295 |
| MDL Number | MFCD00080561 |
| SMILES | CC(=C)C(=O)OC1=CC(=C(C=C1)C(=O)C2=CC=CC=C2)O |
| Synonym | 4-benzoyl-3-hydroxyphenyl methacrylate,4-methacryloxy-2-hydroxybenzophenone,2-hydroxy-4-methacryloyloxy benzophenone,methacrylic acid 4-benzoyl-3-hydroxyphenyl ester,3-hydroxy-4-phenylcarbonyl phenyl 2-methylprop-2-enoate,2-propenoic acid, 2-methyl-, 4-benzoyl-3-hydroxyphenyl ester,acmc-20amfp,2-hydroxy-4-methacryloxybenzophenone,2-hydroxy-4-methacryloyloxybenzophenone |
| IUPAC Name | (4-benzoyl-3-hydroxyphenyl) 2-methylprop-2-enoate |
| InChI Key | IMNBHNRXUAJVQE-UHFFFAOYSA-N |
| Molecular Formula | C17H14O4 |
Polyethylene oxide, M.W. 100,000
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Methyl 4-hydroxybenzoate, 99%
CAS: 99-76-3 Molecular Formula: C8H8O3 Molecular Weight (g/mol): 152.15 MDL Number: MFCD00002352 InChI Key: LXCFILQKKLGQFO-UHFFFAOYSA-N Synonym: methylparaben,methyl paraben,methyl p-hydroxybenzoate,nipagin,methyl parahydroxybenzoate,maseptol,p-hydroxybenzoic acid methyl ester,4-hydroxybenzoic acid methyl ester,p-carbomethoxyphenol,tegosept m PubChem CID: 7456 ChEBI: CHEBI:31835 IUPAC Name: methyl 4-hydroxybenzoate SMILES: COC(=O)C1=CC=C(C=C1)O
| PubChem CID | 7456 |
|---|---|
| CAS | 99-76-3 |
| Molecular Weight (g/mol) | 152.15 |
| ChEBI | CHEBI:31835 |
| MDL Number | MFCD00002352 |
| SMILES | COC(=O)C1=CC=C(C=C1)O |
| Synonym | methylparaben,methyl paraben,methyl p-hydroxybenzoate,nipagin,methyl parahydroxybenzoate,maseptol,p-hydroxybenzoic acid methyl ester,4-hydroxybenzoic acid methyl ester,p-carbomethoxyphenol,tegosept m |
| IUPAC Name | methyl 4-hydroxybenzoate |
| InChI Key | LXCFILQKKLGQFO-UHFFFAOYSA-N |
| Molecular Formula | C8H8O3 |