Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Styrene (stabilized with TBC) 99.0+%, TCI America™
CAS: 100-42-5 Molecular Formula: C8H8 Molecular Weight (g/mol): 104.15 MDL Number: MFCD00008612,MFCD00084450 InChI Key: PPBRXRYQALVLMV-UHFFFAOYSA-N Synonym: ethenylbenzene,phenylethylene,vinylbenzene,styrol,benzene, ethenyl,cinnamene,phenylethene,monomer,phenethylene,styrolene PubChem CID: 7501 ChEBI: CHEBI:27452 IUPAC Name: ethenylbenzene SMILES: C=CC1=CC=CC=C1
| PubChem CID | 7501 |
|---|---|
| CAS | 100-42-5 |
| Molecular Weight (g/mol) | 104.15 |
| ChEBI | CHEBI:27452 |
| MDL Number | MFCD00008612,MFCD00084450 |
| SMILES | C=CC1=CC=CC=C1 |
| Synonym | ethenylbenzene,phenylethylene,vinylbenzene,styrol,benzene, ethenyl,cinnamene,phenylethene,monomer,phenethylene,styrolene |
| IUPAC Name | ethenylbenzene |
| InChI Key | PPBRXRYQALVLMV-UHFFFAOYSA-N |
| Molecular Formula | C8H8 |
Methyl chloroformate, 99%, AcroSeal™
CAS: 79-22-1 Molecular Formula: C2H3ClO2 Molecular Weight (g/mol): 94.49 MDL Number: MFCD00000639 InChI Key: XMJHPCRAQCTCFT-UHFFFAOYSA-N Synonym: methyl chloroformate,methyl chlorocarbonate,chloroformic acid methyl ester,methoxycarbonyl chloride,carbonochloridic acid, methyl ester,methyl chloridocarbonate,chloro methoxy methanone,metilcloroformiato,k-stoff,methylchloorformiaat PubChem CID: 6586 IUPAC Name: methyl carbonochloridate SMILES: COC(Cl)=O
| PubChem CID | 6586 |
|---|---|
| CAS | 79-22-1 |
| Molecular Weight (g/mol) | 94.49 |
| MDL Number | MFCD00000639 |
| SMILES | COC(Cl)=O |
| Synonym | methyl chloroformate,methyl chlorocarbonate,chloroformic acid methyl ester,methoxycarbonyl chloride,carbonochloridic acid, methyl ester,methyl chloridocarbonate,chloro methoxy methanone,metilcloroformiato,k-stoff,methylchloorformiaat |
| IUPAC Name | methyl carbonochloridate |
| InChI Key | XMJHPCRAQCTCFT-UHFFFAOYSA-N |
| Molecular Formula | C2H3ClO2 |
Thiophenol, 99%, AcroSeal™
CAS: 108-98-5 Molecular Formula: C6H6S Molecular Weight (g/mol): 110.17 MDL Number: MFCD00004826 InChI Key: RMVRSNDYEFQCLF-UHFFFAOYSA-N Synonym: thiophenol,phenyl mercaptan,mercaptobenzene,phenylthiol,phenylmercaptan,thiofenol,phenol, thio,thiophenate,thiofenol czech,benzene, mercapto PubChem CID: 7969 ChEBI: CHEBI:48498 IUPAC Name: benzenethiol SMILES: C1=CC=C(C=C1)S
| PubChem CID | 7969 |
|---|---|
| CAS | 108-98-5 |
| Molecular Weight (g/mol) | 110.17 |
| ChEBI | CHEBI:48498 |
| MDL Number | MFCD00004826 |
| SMILES | C1=CC=C(C=C1)S |
| Synonym | thiophenol,phenyl mercaptan,mercaptobenzene,phenylthiol,phenylmercaptan,thiofenol,phenol, thio,thiophenate,thiofenol czech,benzene, mercapto |
| IUPAC Name | benzenethiol |
| InChI Key | RMVRSNDYEFQCLF-UHFFFAOYSA-N |
| Molecular Formula | C6H6S |
Isopropylamine, 99%
CAS: 75-31-0 Molecular Formula: C3H9N Molecular Weight (g/mol): 59.11 InChI Key: JJWLVOIRVHMVIS-UHFFFAOYSA-N Synonym: isopropylamine,2-propanamine,2-aminopropane,monoisopropylamine,2-propylamine,sec-propylamine,1-methylethylamine,isopropyl amine,isopropilamina,propane, 2-amino PubChem CID: 6363 ChEBI: CHEBI:15739 IUPAC Name: propan-2-amine SMILES: CC(C)N
| PubChem CID | 6363 |
|---|---|
| CAS | 75-31-0 |
| Molecular Weight (g/mol) | 59.11 |
| ChEBI | CHEBI:15739 |
| SMILES | CC(C)N |
| Synonym | isopropylamine,2-propanamine,2-aminopropane,monoisopropylamine,2-propylamine,sec-propylamine,1-methylethylamine,isopropyl amine,isopropilamina,propane, 2-amino |
| IUPAC Name | propan-2-amine |
| InChI Key | JJWLVOIRVHMVIS-UHFFFAOYSA-N |
| Molecular Formula | C3H9N |
Dextran, MW ca 6,000
CAS: 9004-54-0 Molecular Formula: (C6H9O5)n(C6H10O5)m Molecular Weight (g/mol): 504.44 MDL Number: MFCD00130935 InChI Key: FZWBNHMXJMCXLU-UHFFFAOYNA-N Synonym: dextran,dextran, mw-86.000 aver.,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydro-2h-pyran-2-yl oxy methyl tetrahydro-2h-pyran-2-yl oxy hexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl oxan-2-yl oxymethyl oxan-2-yl oxyhexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydropyran-2-yl oxymethyl tetrahydropyran-2-yl oxy-hexanal PubChem CID: 4125253 IUPAC Name: Dextran SMILES: O[C@@H]1[C@@H](O)[C@@H](-*)O[C@H](CO[C@H]2O[C@H](CO-*)[C@@H](O)[C@H](O-*)[C@H]2O)[C@H]1O
| PubChem CID | 4125253 |
|---|---|
| CAS | 9004-54-0 |
| Molecular Weight (g/mol) | 504.44 |
| MDL Number | MFCD00130935 |
| SMILES | O[C@@H]1[C@@H](O)[C@@H](-*)O[C@H](CO[C@H]2O[C@H](CO-*)[C@@H](O)[C@H](O-*)[C@H]2O)[C@H]1O |
| Synonym | dextran,dextran, mw-86.000 aver.,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydro-2h-pyran-2-yl oxy methyl tetrahydro-2h-pyran-2-yl oxy hexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl oxan-2-yl oxymethyl oxan-2-yl oxyhexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydropyran-2-yl oxymethyl tetrahydropyran-2-yl oxy-hexanal |
| IUPAC Name | Dextran |
| InChI Key | FZWBNHMXJMCXLU-UHFFFAOYNA-N |
| Molecular Formula | (C6H9O5)n(C6H10O5)m |
2-Bromoacetophenone, 98%
CAS: 70-11-1 Molecular Formula: C8H7BrO Molecular Weight (g/mol): 199.047 MDL Number: MFCD00000195 InChI Key: LIGACIXOYTUXAW-UHFFFAOYSA-N Synonym: 2-bromoacetophenone,phenacyl bromide,2-bromo-1-phenylethan-1-one,bromoacetophenone,ethanone, 2-bromo-1-phenyl,bromomethyl phenyl ketone,alpha-bromoacetophenone,stauffer 4644,omega-bromoacetophenone,acetophenone, 2-bromo PubChem CID: 6259 ChEBI: CHEBI:51846 IUPAC Name: 2-bromo-1-phenylethanone SMILES: C1=CC=C(C=C1)C(=O)CBr
| PubChem CID | 6259 |
|---|---|
| CAS | 70-11-1 |
| Molecular Weight (g/mol) | 199.047 |
| ChEBI | CHEBI:51846 |
| MDL Number | MFCD00000195 |
| SMILES | C1=CC=C(C=C1)C(=O)CBr |
| Synonym | 2-bromoacetophenone,phenacyl bromide,2-bromo-1-phenylethan-1-one,bromoacetophenone,ethanone, 2-bromo-1-phenyl,bromomethyl phenyl ketone,alpha-bromoacetophenone,stauffer 4644,omega-bromoacetophenone,acetophenone, 2-bromo |
| IUPAC Name | 2-bromo-1-phenylethanone |
| InChI Key | LIGACIXOYTUXAW-UHFFFAOYSA-N |
| Molecular Formula | C8H7BrO |
Diethylenetriamine, 98+%
CAS: 111-40-0 Molecular Formula: C4H13N3 Molecular Weight (g/mol): 103.17 MDL Number: MFCD00008171 InChI Key: RPNUMPOLZDHAAY-UHFFFAOYSA-N Synonym: diethylenetriamine,bis 2-aminoethyl amine,2,2'-diaminodiethylamine,diethylene triamine,barsamide 115,epicure t,ancamine deta,1,4,7-triazaheptane,2,2'-iminodiethylamine,n,n-bis 2-aminoethyl amine PubChem CID: 8111 ChEBI: CHEBI:30629 SMILES: NCCNCCN
| PubChem CID | 8111 |
|---|---|
| CAS | 111-40-0 |
| Molecular Weight (g/mol) | 103.17 |
| ChEBI | CHEBI:30629 |
| MDL Number | MFCD00008171 |
| SMILES | NCCNCCN |
| Synonym | diethylenetriamine,bis 2-aminoethyl amine,2,2'-diaminodiethylamine,diethylene triamine,barsamide 115,epicure t,ancamine deta,1,4,7-triazaheptane,2,2'-iminodiethylamine,n,n-bis 2-aminoethyl amine |
| InChI Key | RPNUMPOLZDHAAY-UHFFFAOYSA-N |
| Molecular Formula | C4H13N3 |
Thermo Scientific Chemicals Xylenol orange, sodium salt, ACS reagent
CAS: 3618-43-7 Molecular Formula: C31H28N2Na4O13S Molecular Weight (g/mol): 760.59
| CAS | 3618-43-7 |
|---|---|
| Molecular Weight (g/mol) | 760.59 |
| Molecular Formula | C31H28N2Na4O13S |
Propiophenone, 99%
CAS: 93-55-0 Molecular Formula: C9H10O Molecular Weight (g/mol): 134.18 InChI Key: KRIOVPPHQSLHCZ-UHFFFAOYSA-N Synonym: propiophenone,ethyl phenyl ketone,propionylbenzene,1-phenyl-1-propanone,1-propanone, 1-phenyl,phenyl ethyl ketone,ketone, ethyl phenyl,propionphenone,usaf ek-1235,1-phenyl-propan-1-one PubChem CID: 7148 ChEBI: CHEBI:425902 IUPAC Name: 1-phenylpropan-1-one SMILES: CCC(=O)C1=CC=CC=C1
| PubChem CID | 7148 |
|---|---|
| CAS | 93-55-0 |
| Molecular Weight (g/mol) | 134.18 |
| ChEBI | CHEBI:425902 |
| SMILES | CCC(=O)C1=CC=CC=C1 |
| Synonym | propiophenone,ethyl phenyl ketone,propionylbenzene,1-phenyl-1-propanone,1-propanone, 1-phenyl,phenyl ethyl ketone,ketone, ethyl phenyl,propionphenone,usaf ek-1235,1-phenyl-propan-1-one |
| IUPAC Name | 1-phenylpropan-1-one |
| InChI Key | KRIOVPPHQSLHCZ-UHFFFAOYSA-N |
| Molecular Formula | C9H10O |
Thermo Scientific Chemicals Cellulose acetate, average M.W. 100,000
CAS: 9004-35-7 Molecular Formula: (C6H7O5)nC2H3O MDL Number: MFCD00081496
| CAS | 9004-35-7 |
|---|---|
| MDL Number | MFCD00081496 |
| Molecular Formula | (C6H7O5)nC2H3O |
2-Mercaptoethanesulfonic acid sodium salt, 98%, analytical standard
CAS: 19767-45-4 Molecular Formula: C2H5NaO3S2 Molecular Weight (g/mol): 164.18 InChI Key: XOGTZOOQQBDUSI-UHFFFAOYSA-M Synonym: mesna,sodium 2-mercaptoethanesulfonate,mesnex,uromitexan,mitexan,2-mercaptoethanesulfonic acid sodium salt,mistabron,mesnum,mistabronco,mucofluid PubChem CID: 23662354 IUPAC Name: sodium;2-sulfanylethanesulfonate SMILES: C(CS(=O)(=O)[O-])S.[Na+]
| PubChem CID | 23662354 |
|---|---|
| CAS | 19767-45-4 |
| Molecular Weight (g/mol) | 164.18 |
| SMILES | C(CS(=O)(=O)[O-])S.[Na+] |
| Synonym | mesna,sodium 2-mercaptoethanesulfonate,mesnex,uromitexan,mitexan,2-mercaptoethanesulfonic acid sodium salt,mistabron,mesnum,mistabronco,mucofluid |
| IUPAC Name | sodium;2-sulfanylethanesulfonate |
| InChI Key | XOGTZOOQQBDUSI-UHFFFAOYSA-M |
| Molecular Formula | C2H5NaO3S2 |
Ethyl Benzoate, 99+%
CAS: 93-89-0 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00009109 InChI Key: MTZQAGJQAFMTAQ-UHFFFAOYSA-N Synonym: benzoic acid, ethyl ester,benzoic ether,ethyl benzenecarboxylate,ethylbenzoate,benzoyl ethyl ether,benzoic acid ethyl ester,ethylester kyseliny benzoove,natural,unii-j115brj15h,fema no. 2422 PubChem CID: 7165 IUPAC Name: ethyl benzoate SMILES: CCOC(=O)C1=CC=CC=C1
| PubChem CID | 7165 |
|---|---|
| CAS | 93-89-0 |
| Molecular Weight (g/mol) | 150.18 |
| MDL Number | MFCD00009109 |
| SMILES | CCOC(=O)C1=CC=CC=C1 |
| Synonym | benzoic acid, ethyl ester,benzoic ether,ethyl benzenecarboxylate,ethylbenzoate,benzoyl ethyl ether,benzoic acid ethyl ester,ethylester kyseliny benzoove,natural,unii-j115brj15h,fema no. 2422 |
| IUPAC Name | ethyl benzoate |
| InChI Key | MTZQAGJQAFMTAQ-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
Iodoacetic acid, sodium salt, 99%
CAS: 305-53-3 Molecular Formula: C2H2INaO2 Molecular Weight (g/mol): 207.93 MDL Number: MFCD00002686 InChI Key: AGDSCTQQXMDDCV-UHFFFAOYSA-M Synonym: sodium iodoacetate,iodoacetic acid sodium salt,acetic acid, iodo-, sodium salt,sodium 2-iodoacetate,sodium monoiodoacetate,iodoacetate, sodium salt,sodium iodacetate,iodoacetic acid, sodium salt,unii-07814f2qri,ccris 9232 PubChem CID: 5239 IUPAC Name: sodium;2-iodoacetate SMILES: C(C(=O)[O-])I.[Na+]
| PubChem CID | 5239 |
|---|---|
| CAS | 305-53-3 |
| Molecular Weight (g/mol) | 207.93 |
| MDL Number | MFCD00002686 |
| SMILES | C(C(=O)[O-])I.[Na+] |
| Synonym | sodium iodoacetate,iodoacetic acid sodium salt,acetic acid, iodo-, sodium salt,sodium 2-iodoacetate,sodium monoiodoacetate,iodoacetate, sodium salt,sodium iodacetate,iodoacetic acid, sodium salt,unii-07814f2qri,ccris 9232 |
| IUPAC Name | sodium;2-iodoacetate |
| InChI Key | AGDSCTQQXMDDCV-UHFFFAOYSA-M |
| Molecular Formula | C2H2INaO2 |
Sodium dihydrogen citrate, 99%
CAS: 18996-35-5 Molecular Formula: C6H10NaO7 Molecular Weight (g/mol): 217.129 MDL Number: MFCD00013067 InChI Key: SLWOXBQHKZPUNY-UHFFFAOYSA-N Synonym: bicitra,pneucid,1,2,3-propanetricarboxylic acid, 2-hydroxy-, sodium salt,sodium dihydrogen citrate anhydrous,citric acid, sodium salt,citric acid sodium,sodium 2-hydroxy-1,2,3-propanetricarboxylate,2-hydroxypropane-1,2,3-tricarboxylic acid; sodium,1,2,3-propanetricarboxylic acid, 2-hydroxy-, sodium salt 1:? PubChem CID: 131675399 IUPAC Name: 2-hydroxypropane-1,2,3-tricarboxylic acid;molecular hydrogen;sodium SMILES: [HH].C(C(=O)O)C(CC(=O)O)(C(=O)O)O.[Na]
| PubChem CID | 131675399 |
|---|---|
| CAS | 18996-35-5 |
| Molecular Weight (g/mol) | 217.129 |
| MDL Number | MFCD00013067 |
| SMILES | [HH].C(C(=O)O)C(CC(=O)O)(C(=O)O)O.[Na] |
| Synonym | bicitra,pneucid,1,2,3-propanetricarboxylic acid, 2-hydroxy-, sodium salt,sodium dihydrogen citrate anhydrous,citric acid, sodium salt,citric acid sodium,sodium 2-hydroxy-1,2,3-propanetricarboxylate,2-hydroxypropane-1,2,3-tricarboxylic acid; sodium,1,2,3-propanetricarboxylic acid, 2-hydroxy-, sodium salt 1:? |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;molecular hydrogen;sodium |
| InChI Key | SLWOXBQHKZPUNY-UHFFFAOYSA-N |
| Molecular Formula | C6H10NaO7 |
Thermo Scientific Chemicals Coconut oil, pure, refined
CAS: 8001-31-8 MDL Number: MFCD00130817
| CAS | 8001-31-8 |
|---|---|
| MDL Number | MFCD00130817 |