Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Thermo Scientific Chemicals Carboxymethyl cellulose, sodium salt, average M.W. 700000 (DS=0.9)
CAS: 9004-32-4 Molecular Formula: (C12 H14 O9 R6)n Molecular Weight (g/mol): 263.20 MDL Number: MFCD00081472 InChI Key: DPXJVFZANSGRMM-UHFFFAOYNA-N Synonym: carboxymethylcellulose sodium usp,celluvisc tn,carmellose sodium jp17,sodium dextrose acetate,c.m.c. tn PubChem CID: 23706213 IUPAC Name: sodium;2,3,4,5,6-pentahydroxyhexanal;acetate SMILES: [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O
| PubChem CID | 23706213 |
|---|---|
| CAS | 9004-32-4 |
| Molecular Weight (g/mol) | 263.20 |
| MDL Number | MFCD00081472 |
| SMILES | [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O |
| Synonym | carboxymethylcellulose sodium usp,celluvisc tn,carmellose sodium jp17,sodium dextrose acetate,c.m.c. tn |
| IUPAC Name | sodium;2,3,4,5,6-pentahydroxyhexanal;acetate |
| InChI Key | DPXJVFZANSGRMM-UHFFFAOYNA-N |
| Molecular Formula | (C12 H14 O9 R6)n |
L-Ascorbic Acid 2-Phosphate Sesquimagnesium Salt Hydrate 98.0+%, TCI America™
CAS: 113170-55-1 Molecular Formula: C12H18Mg3O18P2 Molecular Weight (g/mol): 585.12 MDL Number: MFCD08063372 InChI Key: IRBRZNUQJUHOBT-UHFFFAOYNA-N PubChem CID: 129894323 IUPAC Name: bis({[5-(1,2-dihydroxyethyl)-4-hydroxy-2-oxo-2,5-dihydrofuran-3-yl]oxy}phosphonic acid) trimagnesium SMILES: [Mg].[Mg].[Mg].OCC(O)C1OC(=O)C(OP(O)(O)=O)=C1O.OCC(O)C1OC(=O)C(OP(O)(O)=O)=C1O
| PubChem CID | 129894323 |
|---|---|
| CAS | 113170-55-1 |
| Molecular Weight (g/mol) | 585.12 |
| MDL Number | MFCD08063372 |
| SMILES | [Mg].[Mg].[Mg].OCC(O)C1OC(=O)C(OP(O)(O)=O)=C1O.OCC(O)C1OC(=O)C(OP(O)(O)=O)=C1O |
| IUPAC Name | bis({[5-(1,2-dihydroxyethyl)-4-hydroxy-2-oxo-2,5-dihydrofuran-3-yl]oxy}phosphonic acid) trimagnesium |
| InChI Key | IRBRZNUQJUHOBT-UHFFFAOYNA-N |
| Molecular Formula | C12H18Mg3O18P2 |
Indole-3-Butyric Acid Potassium Salt, MP Biomedicals™
Molecular Formula: C12H12KNO2 Molecular Weight (g/mol): 241.331 MDL Number: MFCD00058442 InChI Key: KTWDHJYSJOSTSJ-UHFFFAOYSA-M Synonym: potassium 4-1h-indol-3-yl butanoate,indole-3-butyric acid potassium salt,indole-3-butyric acid potassium,4-indol-3-ylbutanoic acid, potassium salt,potassium indolebutyrate,pubchem22140,cambridge id 5119461,potassium ion indole-3 butyrate,indole-3-butyric acid-potassium salt,3-indole butyric acid, potassium salt PubChem CID: 23664348 IUPAC Name: potassium;4-(1H-indol-3-yl)butanoate SMILES: C1=CC=C2C(=C1)C(=CN2)CCCC(=O)[O-].[K+]
| PubChem CID | 23664348 |
|---|---|
| Molecular Weight (g/mol) | 241.331 |
| MDL Number | MFCD00058442 |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCCC(=O)[O-].[K+] |
| Synonym | potassium 4-1h-indol-3-yl butanoate,indole-3-butyric acid potassium salt,indole-3-butyric acid potassium,4-indol-3-ylbutanoic acid, potassium salt,potassium indolebutyrate,pubchem22140,cambridge id 5119461,potassium ion indole-3 butyrate,indole-3-butyric acid-potassium salt,3-indole butyric acid, potassium salt |
| IUPAC Name | potassium;4-(1H-indol-3-yl)butanoate |
| InChI Key | KTWDHJYSJOSTSJ-UHFFFAOYSA-M |
| Molecular Formula | C12H12KNO2 |
Diethylene glycol monoethyl ether acetate, 99%
CAS: 112-15-2 Molecular Formula: C8H16O4 Molecular Weight (g/mol): 176.21 MDL Number: MFCD00041928 InChI Key: FPZWZCWUIYYYBU-UHFFFAOYSA-N Synonym: carbitol acetate,2-2-ethoxyethoxy ethyl acetate,diethylene glycol monoethyl ether acetate,ektasolve de acetate,karbitolacetat,ethoxydiglycol acetate,glycol ether de acetate,diglycol monoethyl ether acetate,ethanol, 2-2-ethoxyethoxy-, acetate,ethyldiglycol acetate PubChem CID: 8165 IUPAC Name: 2-(2-ethoxyethoxy)ethyl acetate SMILES: CCOCCOCCOC(C)=O
| PubChem CID | 8165 |
|---|---|
| CAS | 112-15-2 |
| Molecular Weight (g/mol) | 176.21 |
| MDL Number | MFCD00041928 |
| SMILES | CCOCCOCCOC(C)=O |
| Synonym | carbitol acetate,2-2-ethoxyethoxy ethyl acetate,diethylene glycol monoethyl ether acetate,ektasolve de acetate,karbitolacetat,ethoxydiglycol acetate,glycol ether de acetate,diglycol monoethyl ether acetate,ethanol, 2-2-ethoxyethoxy-, acetate,ethyldiglycol acetate |
| IUPAC Name | 2-(2-ethoxyethoxy)ethyl acetate |
| InChI Key | FPZWZCWUIYYYBU-UHFFFAOYSA-N |
| Molecular Formula | C8H16O4 |
Pinacolone, 97%, Thermo Scientific Chemicals
CAS: 75-97-8 Molecular Formula: C6H12O Molecular Weight (g/mol): 100.161 MDL Number: MFCD00008846 InChI Key: PJGSXYOJTGTZAV-UHFFFAOYSA-N Synonym: pinacolone,3,3-dimethyl-2-butanone,tert-butyl methyl ketone,pinacolin,2-butanone, 3,3-dimethyl,pinacoline,t-butyl methyl ketone,methyl tert-butyl ketone,pinakolin,2,2-dimethylbutanone PubChem CID: 6416 IUPAC Name: 3,3-dimethylbutan-2-one SMILES: CC(=O)C(C)(C)C
| PubChem CID | 6416 |
|---|---|
| CAS | 75-97-8 |
| Molecular Weight (g/mol) | 100.161 |
| MDL Number | MFCD00008846 |
| SMILES | CC(=O)C(C)(C)C |
| Synonym | pinacolone,3,3-dimethyl-2-butanone,tert-butyl methyl ketone,pinacolin,2-butanone, 3,3-dimethyl,pinacoline,t-butyl methyl ketone,methyl tert-butyl ketone,pinakolin,2,2-dimethylbutanone |
| IUPAC Name | 3,3-dimethylbutan-2-one |
| InChI Key | PJGSXYOJTGTZAV-UHFFFAOYSA-N |
| Molecular Formula | C6H12O |
Cyclopentyl methyl ether, stab., 99.9+%
CAS: 5614-37-9 Molecular Formula: C6H12O Molecular Weight (g/mol): 100.16 MDL Number: MFCD08276401 InChI Key: SKTCDJAMAYNROS-UHFFFAOYSA-N Synonym: cyclopentyl methyl ether,cyclopentane, methoxy,cpme,cyclopentane,methoxy,unii-4067e5gbkb,cyclopentylmethylether,cylopentylmethylether,methoxycyclopentane,2-methoxycyclopentyl,cylopentyl-methylether PubChem CID: 138539 IUPAC Name: methoxycyclopentane SMILES: COC1CCCC1
| PubChem CID | 138539 |
|---|---|
| CAS | 5614-37-9 |
| Molecular Weight (g/mol) | 100.16 |
| MDL Number | MFCD08276401 |
| SMILES | COC1CCCC1 |
| Synonym | cyclopentyl methyl ether,cyclopentane, methoxy,cpme,cyclopentane,methoxy,unii-4067e5gbkb,cyclopentylmethylether,cylopentylmethylether,methoxycyclopentane,2-methoxycyclopentyl,cylopentyl-methylether |
| IUPAC Name | methoxycyclopentane |
| InChI Key | SKTCDJAMAYNROS-UHFFFAOYSA-N |
| Molecular Formula | C6H12O |
Benzoin, 99%
CAS: 119-53-9 Molecular Formula: C14H12O2 Molecular Weight (g/mol): 212.25 MDL Number: MFCD00004496 InChI Key: ISAOCJYIOMOJEB-UHFFFAOYNA-N Synonym: benzoin,2-hydroxy-2-phenylacetophenone,benzoylphenylcarbinol,benzoin tincture,+--benzoin,ethanone, 2-hydroxy-1,2-diphenyl,bitter almond oil camphor,phenylbenzoyl carbinol,2-hydroxy-1,2-diphenylethan-1-one,alpha-hydroxybenzyl phenyl ketone PubChem CID: 8400 ChEBI: CHEBI:17682 IUPAC Name: 2-hydroxy-1,2-diphenylethanone SMILES: OC(C(=O)C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 8400 |
|---|---|
| CAS | 119-53-9 |
| Molecular Weight (g/mol) | 212.25 |
| ChEBI | CHEBI:17682 |
| MDL Number | MFCD00004496 |
| SMILES | OC(C(=O)C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | benzoin,2-hydroxy-2-phenylacetophenone,benzoylphenylcarbinol,benzoin tincture,+--benzoin,ethanone, 2-hydroxy-1,2-diphenyl,bitter almond oil camphor,phenylbenzoyl carbinol,2-hydroxy-1,2-diphenylethan-1-one,alpha-hydroxybenzyl phenyl ketone |
| IUPAC Name | 2-hydroxy-1,2-diphenylethanone |
| InChI Key | ISAOCJYIOMOJEB-UHFFFAOYNA-N |
| Molecular Formula | C14H12O2 |
Orcinol Monohydrate, 99%
CAS: 6153-39-5 Molecular Formula: C7H8O2·H2O Molecular Weight (g/mol): 142.15 MDL Number: MFCD00149092 InChI Key: NBKPNAMTHBIMLA-UHFFFAOYSA-N Synonym: 5-methylbenzene-1,3-diol hydrate,orcinol monohydrate,5-methylresorcinol monohydrate,3,5-dihydroxytoluene monohydrate,orcinol hydrate,resorcinol, 5-methyl-, monohydrate,1,3-benzenediol, 5-methyl-, monohydrate,1,3-dihydroxy-5-methylbenzene monohydrate,acmc-209mtl,5-methylresorcinol hydrate PubChem CID: 3083941 IUPAC Name: 5-methylbenzene-1,3-diol;hydrate SMILES: CC1=CC(=CC(=C1)O)O.O
| PubChem CID | 3083941 |
|---|---|
| CAS | 6153-39-5 |
| Molecular Weight (g/mol) | 142.15 |
| MDL Number | MFCD00149092 |
| SMILES | CC1=CC(=CC(=C1)O)O.O |
| Synonym | 5-methylbenzene-1,3-diol hydrate,orcinol monohydrate,5-methylresorcinol monohydrate,3,5-dihydroxytoluene monohydrate,orcinol hydrate,resorcinol, 5-methyl-, monohydrate,1,3-benzenediol, 5-methyl-, monohydrate,1,3-dihydroxy-5-methylbenzene monohydrate,acmc-209mtl,5-methylresorcinol hydrate |
| IUPAC Name | 5-methylbenzene-1,3-diol;hydrate |
| InChI Key | NBKPNAMTHBIMLA-UHFFFAOYSA-N |
| Molecular Formula | C7H8O2·H2O |
Thermo Scientific Chemicals Cellulose acetate, average M.W. 100,000
CAS: 9004-35-7 Molecular Formula: (C6H7O5)nC2H3O MDL Number: MFCD00081496
| CAS | 9004-35-7 |
|---|---|
| MDL Number | MFCD00081496 |
| Molecular Formula | (C6H7O5)nC2H3O |
Terephthalaldehyde, 98%
CAS: 623-27-8 Molecular Formula: C8H6O2 Molecular Weight (g/mol): 134.134 MDL Number: MFCD00006949 InChI Key: KUCOHFSKRZZVRO-UHFFFAOYSA-N Synonym: 1,4-benzenedicarboxaldehyde,p-phthalaldehyde,terephthaldehyde,terephthaldialdehyde,terephthaladehyde,terephthaldicarboxaldehyde,terephthalic aldehyde,1,4-phthalaldehyde,p-formylbenzaldehyde,terephtaldehyde PubChem CID: 12173 IUPAC Name: terephthalaldehyde SMILES: C1=CC(=CC=C1C=O)C=O
| PubChem CID | 12173 |
|---|---|
| CAS | 623-27-8 |
| Molecular Weight (g/mol) | 134.134 |
| MDL Number | MFCD00006949 |
| SMILES | C1=CC(=CC=C1C=O)C=O |
| Synonym | 1,4-benzenedicarboxaldehyde,p-phthalaldehyde,terephthaldehyde,terephthaldialdehyde,terephthaladehyde,terephthaldicarboxaldehyde,terephthalic aldehyde,1,4-phthalaldehyde,p-formylbenzaldehyde,terephtaldehyde |
| IUPAC Name | terephthalaldehyde |
| InChI Key | KUCOHFSKRZZVRO-UHFFFAOYSA-N |
| Molecular Formula | C8H6O2 |
3,4-Methylenedioxyacetophenone, 98%
CAS: 3162-29-6 Molecular Formula: C9H8O3 Molecular Weight (g/mol): 164.16 MDL Number: MFCD00005831 InChI Key: BMHMKWXYXFBWMI-UHFFFAOYSA-N Synonym: 3',4'-methylenedioxy acetophenone,1-benzo d 1,3 dioxol-5-yl ethanone,5-acetyl-1,3-benzodioxole,3,4-methylenedioxyacetophenone,3,4-methylenedioxy acetophenone,3',4'-methylenedioxyacetophenone,1-1,3-benzodioxol-5-yl ethanone,acetopiperone,1-1,3-benzodioxol-5-yl ethan-1-one,ethanone, 1-1,3-benzodioxol-5-yl PubChem CID: 76622 IUPAC Name: 1-(1,3-benzodioxol-5-yl)ethanone SMILES: CC(=O)C1=CC2=C(C=C1)OCO2
| PubChem CID | 76622 |
|---|---|
| CAS | 3162-29-6 |
| Molecular Weight (g/mol) | 164.16 |
| MDL Number | MFCD00005831 |
| SMILES | CC(=O)C1=CC2=C(C=C1)OCO2 |
| Synonym | 3',4'-methylenedioxy acetophenone,1-benzo d 1,3 dioxol-5-yl ethanone,5-acetyl-1,3-benzodioxole,3,4-methylenedioxyacetophenone,3,4-methylenedioxy acetophenone,3',4'-methylenedioxyacetophenone,1-1,3-benzodioxol-5-yl ethanone,acetopiperone,1-1,3-benzodioxol-5-yl ethan-1-one,ethanone, 1-1,3-benzodioxol-5-yl |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)ethanone |
| InChI Key | BMHMKWXYXFBWMI-UHFFFAOYSA-N |
| Molecular Formula | C9H8O3 |
Thioacetamide, 98%
CAS: 62-55-5 Molecular Formula: C2H5NS Molecular Weight (g/mol): 75.13 MDL Number: MFCD00008070 InChI Key: YUKQRDCYNOVPGJ-UHFFFAOYSA-N Synonym: thioacetamide,acetothioamide,thiacetamide,acetamide, thio,thioacetimidic acid,acetimidic acid, thio,usaf cb-21,usaf ek-1719,rcra waste number u218,acetic acid, thiono-, amide PubChem CID: 2723949 ChEBI: CHEBI:32497 IUPAC Name: ethanethioamide SMILES: CC(N)=S
| PubChem CID | 2723949 |
|---|---|
| CAS | 62-55-5 |
| Molecular Weight (g/mol) | 75.13 |
| ChEBI | CHEBI:32497 |
| MDL Number | MFCD00008070 |
| SMILES | CC(N)=S |
| Synonym | thioacetamide,acetothioamide,thiacetamide,acetamide, thio,thioacetimidic acid,acetimidic acid, thio,usaf cb-21,usaf ek-1719,rcra waste number u218,acetic acid, thiono-, amide |
| IUPAC Name | ethanethioamide |
| InChI Key | YUKQRDCYNOVPGJ-UHFFFAOYSA-N |
| Molecular Formula | C2H5NS |
4-Chlorobenzaldehyde, 98%
CAS: 104-88-1 Molecular Formula: C7H5ClO Molecular Weight (g/mol): 140.57 InChI Key: AVPYQKSLYISFPO-UHFFFAOYSA-N Synonym: p-chlorobenzaldehyde,benzaldehyde, 4-chloro,benzaldehyde, p-chloro,p-chlorobenzenecarboxaldehyde,4-chloro-benzaldehyde,4-chlorobenzenaldehyde,4-chloro benzaldehyde,ccris 857,para-chlorobenzaldehyde,unii-e67727up9z PubChem CID: 7726 ChEBI: CHEBI:28105 IUPAC Name: 4-chlorobenzaldehyde SMILES: C1=CC(=CC=C1C=O)Cl
| PubChem CID | 7726 |
|---|---|
| CAS | 104-88-1 |
| Molecular Weight (g/mol) | 140.57 |
| ChEBI | CHEBI:28105 |
| SMILES | C1=CC(=CC=C1C=O)Cl |
| Synonym | p-chlorobenzaldehyde,benzaldehyde, 4-chloro,benzaldehyde, p-chloro,p-chlorobenzenecarboxaldehyde,4-chloro-benzaldehyde,4-chlorobenzenaldehyde,4-chloro benzaldehyde,ccris 857,para-chlorobenzaldehyde,unii-e67727up9z |
| IUPAC Name | 4-chlorobenzaldehyde |
| InChI Key | AVPYQKSLYISFPO-UHFFFAOYSA-N |
| Molecular Formula | C7H5ClO |
2-Amino-2-methyl-1-propanol, 95%, may cont. ca 5% water
CAS: 124-68-5 Molecular Formula: C4H11NO Molecular Weight (g/mol): 89.14 MDL Number: MFCD00008051 InChI Key: CBTVGIZVANVGBH-UHFFFAOYSA-N Synonym: 2-amino-2-methyl-1-propanol,isobutanol-2-amine,1-propanol, 2-amino-2-methyl,amp regular,2-aminoisobutanol,aminomethylpropanol,2-amino-2-methylpropanol,2-methyl-2-aminopropanol,2-aminodimethylethanol,hydroxy-tert-butylamine PubChem CID: 11807 IUPAC Name: 2-amino-2-methylpropan-1-ol SMILES: CC(C)(N)CO
| PubChem CID | 11807 |
|---|---|
| CAS | 124-68-5 |
| Molecular Weight (g/mol) | 89.14 |
| MDL Number | MFCD00008051 |
| SMILES | CC(C)(N)CO |
| Synonym | 2-amino-2-methyl-1-propanol,isobutanol-2-amine,1-propanol, 2-amino-2-methyl,amp regular,2-aminoisobutanol,aminomethylpropanol,2-amino-2-methylpropanol,2-methyl-2-aminopropanol,2-aminodimethylethanol,hydroxy-tert-butylamine |
| IUPAC Name | 2-amino-2-methylpropan-1-ol |
| InChI Key | CBTVGIZVANVGBH-UHFFFAOYSA-N |
| Molecular Formula | C4H11NO |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, 0.5M aq. soln, pH 8.0
CAS: 60-00-4 Molecular Formula: C10H16N2O8 Molecular Weight (g/mol): 292.24 MDL Number: MFCD00003541 InChI Key: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC Name: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid SMILES: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| PubChem CID | 6049 |
|---|---|
| CAS | 60-00-4 |
| Molecular Weight (g/mol) | 292.24 |
| ChEBI | CHEBI:42191 |
| MDL Number | MFCD00003541 |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O8 |