Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Tetrabutylammonium fluoride trihydrate, 99%
CAS: 87749-50-6 Molecular Formula: C16H36FN·3H2O Molecular Weight (g/mol): 315.51 MDL Number: MFCD00149981 InChI Key: VEPTXBCIDSFGBF-UHFFFAOYSA-M Synonym: tetrabutylammonium fluoride trihydrate,tetra-n-butylammonium fluoride trihydrate,tetrabutylazanium fluoride trihydrate,tetrabutylammonium trihydrate fluoride,1-butanaminium, n,n,n-tributyl-, fluoride, trihydrate,tetrabutylammonium ion trihydrate fluoride,tetra-n-butylammonium fluoride hydrate,bu4nf trihydrate,pubchem2275,pubchem4057 PubChem CID: 11726816 IUPAC Name: tetrabutylazanium;fluoride;trihydrate SMILES: CCCC[N+](CCCC)(CCCC)CCCC.O.O.O.[F-]
| PubChem CID | 11726816 |
|---|---|
| CAS | 87749-50-6 |
| Molecular Weight (g/mol) | 315.51 |
| MDL Number | MFCD00149981 |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O.O.O.[F-] |
| Synonym | tetrabutylammonium fluoride trihydrate,tetra-n-butylammonium fluoride trihydrate,tetrabutylazanium fluoride trihydrate,tetrabutylammonium trihydrate fluoride,1-butanaminium, n,n,n-tributyl-, fluoride, trihydrate,tetrabutylammonium ion trihydrate fluoride,tetra-n-butylammonium fluoride hydrate,bu4nf trihydrate,pubchem2275,pubchem4057 |
| IUPAC Name | tetrabutylazanium;fluoride;trihydrate |
| InChI Key | VEPTXBCIDSFGBF-UHFFFAOYSA-M |
| Molecular Formula | C16H36FN·3H2O |
Sodium chloroacetate, 98%
CAS: 3926-62-3 Molecular Formula: C2H2ClNaO2 Molecular Weight (g/mol): 116.476 MDL Number: MFCD00002684 InChI Key: FDRCDNZGSXJAFP-UHFFFAOYSA-M Synonym: sodium chloroacetate,chloroacetic acid sodium salt,monoxone,acetic acid, chloro-, sodium salt,dow defoliant,sodium monochloroacetate,smca,sodium monochloracetate,caswell no. 755a,chloroctan sodny czech PubChem CID: 23665759 IUPAC Name: sodium;2-chloroacetate SMILES: C(C(=O)[O-])Cl.[Na+]
| PubChem CID | 23665759 |
|---|---|
| CAS | 3926-62-3 |
| Molecular Weight (g/mol) | 116.476 |
| MDL Number | MFCD00002684 |
| SMILES | C(C(=O)[O-])Cl.[Na+] |
| Synonym | sodium chloroacetate,chloroacetic acid sodium salt,monoxone,acetic acid, chloro-, sodium salt,dow defoliant,sodium monochloroacetate,smca,sodium monochloracetate,caswell no. 755a,chloroctan sodny czech |
| IUPAC Name | sodium;2-chloroacetate |
| InChI Key | FDRCDNZGSXJAFP-UHFFFAOYSA-M |
| Molecular Formula | C2H2ClNaO2 |
Dibenzoyl peroxide, 75%, remainder water
CAS: 94-36-0 Molecular Formula: C14H10O4 Molecular Weight (g/mol): 242.23 MDL Number: MFCD00003071 InChI Key: OMPJBNCRMGITSC-UHFFFAOYSA-N Synonym: benzoyl peroxide,dibenzoyl peroxide,peroxide, dibenzoyl,benzoperoxide,benzoyl superoxide,acetoxyl,lucidol,benoxyl,panoxyl,benzol peroxide PubChem CID: 7187 ChEBI: CHEBI:82405 IUPAC Name: benzoyl benzenecarboperoxoate SMILES: C1=CC=C(C=C1)C(=O)OOC(=O)C2=CC=CC=C2
| PubChem CID | 7187 |
|---|---|
| CAS | 94-36-0 |
| Molecular Weight (g/mol) | 242.23 |
| ChEBI | CHEBI:82405 |
| MDL Number | MFCD00003071 |
| SMILES | C1=CC=C(C=C1)C(=O)OOC(=O)C2=CC=CC=C2 |
| Synonym | benzoyl peroxide,dibenzoyl peroxide,peroxide, dibenzoyl,benzoperoxide,benzoyl superoxide,acetoxyl,lucidol,benoxyl,panoxyl,benzol peroxide |
| IUPAC Name | benzoyl benzenecarboperoxoate |
| InChI Key | OMPJBNCRMGITSC-UHFFFAOYSA-N |
| Molecular Formula | C14H10O4 |
Polysulfone Resin, Pellets
CAS: 25135-51-7 Molecular Formula: (C27H22O4S)n Molecular Weight (g/mol): NaN MDL Number: MFCD00134387 InChI Key: ZUZZUJNBGCVPLQ-UHFFFAOYSA-N PubChem CID: 16211415 SMILES: CC(C)(C1=CC=C(O-*)C=C1)C1=CC=C(OC2=CC=C(C=C2)S(=O)(=O)C2=CC=C(-*)C=C2)C=C1
| PubChem CID | 16211415 |
|---|---|
| CAS | 25135-51-7 |
| Molecular Weight (g/mol) | NaN |
| MDL Number | MFCD00134387 |
| SMILES | CC(C)(C1=CC=C(O-*)C=C1)C1=CC=C(OC2=CC=C(C=C2)S(=O)(=O)C2=CC=C(-*)C=C2)C=C1 |
| InChI Key | ZUZZUJNBGCVPLQ-UHFFFAOYSA-N |
| Molecular Formula | (C27H22O4S)n |
Triethyl phosphite, 98%, Thermo Scientific Chemicals
CAS: 122-52-1 Molecular Weight (g/mol): 166.16 MDL Number: MFCD00009084 InChI Key: BDZBKCUKTQZUTL-UHFFFAOYSA-N Synonym: phosphorous acid, triethyl ester,triethoxyphosphine,ethyl phosphite, eto 3p,triethylphosphite,phosphorous acid triethyl ester,fosforyn trojetylowy czech,unii-6b2r04s55g,hsdb 895,p oet 3,c2h5o 3p PubChem CID: 31215 IUPAC Name: triethyl phosphite SMILES: CCOP(OCC)OCC
| PubChem CID | 31215 |
|---|---|
| CAS | 122-52-1 |
| Molecular Weight (g/mol) | 166.16 |
| MDL Number | MFCD00009084 |
| SMILES | CCOP(OCC)OCC |
| Synonym | phosphorous acid, triethyl ester,triethoxyphosphine,ethyl phosphite, eto 3p,triethylphosphite,phosphorous acid triethyl ester,fosforyn trojetylowy czech,unii-6b2r04s55g,hsdb 895,p oet 3,c2h5o 3p |
| IUPAC Name | triethyl phosphite |
| InChI Key | BDZBKCUKTQZUTL-UHFFFAOYSA-N |
3-Methyl-1-butanol, 99%, for biochemistry, AcroSeal™
CAS: 123-51-3 Molecular Formula: C5H12O Molecular Weight (g/mol): 88.15 InChI Key: PHTQWCKDNZKARW-UHFFFAOYSA-N Synonym: 3-methyl-1-butanol,isoamyl alcohol,isopentyl alcohol,isopentanol,3-methylbutanol,1-butanol, 3-methyl,isoamylol,isobutylcarbinol,iso-amylalkohol,isobutyl carbinol PubChem CID: 31260 ChEBI: CHEBI:15837 IUPAC Name: 3-methylbutan-1-ol SMILES: CC(C)CCO
| PubChem CID | 31260 |
|---|---|
| CAS | 123-51-3 |
| Molecular Weight (g/mol) | 88.15 |
| ChEBI | CHEBI:15837 |
| SMILES | CC(C)CCO |
| Synonym | 3-methyl-1-butanol,isoamyl alcohol,isopentyl alcohol,isopentanol,3-methylbutanol,1-butanol, 3-methyl,isoamylol,isobutylcarbinol,iso-amylalkohol,isobutyl carbinol |
| IUPAC Name | 3-methylbutan-1-ol |
| InChI Key | PHTQWCKDNZKARW-UHFFFAOYSA-N |
| Molecular Formula | C5H12O |
3-Hexanone, 98%
CAS: 589-38-8 Molecular Formula: C6H12O Molecular Weight (g/mol): 100.16 MDL Number: MFCD00009402 InChI Key: PFCHFHIRKBAQGU-UHFFFAOYSA-N Synonym: 3-hexanone,ethyl propyl ketone,3-oxohexane,aethylpropylketon,ethyl n-propyl ketone,3-hexanone natural,aethylpropylketon german,fema no. 3290,3-hexanone, analytical standard,pentanone, methyl PubChem CID: 11509 IUPAC Name: hexan-3-one SMILES: CCCC(=O)CC
| PubChem CID | 11509 |
|---|---|
| CAS | 589-38-8 |
| Molecular Weight (g/mol) | 100.16 |
| MDL Number | MFCD00009402 |
| SMILES | CCCC(=O)CC |
| Synonym | 3-hexanone,ethyl propyl ketone,3-oxohexane,aethylpropylketon,ethyl n-propyl ketone,3-hexanone natural,aethylpropylketon german,fema no. 3290,3-hexanone, analytical standard,pentanone, methyl |
| IUPAC Name | hexan-3-one |
| InChI Key | PFCHFHIRKBAQGU-UHFFFAOYSA-N |
| Molecular Formula | C6H12O |
Thermo Scientific Chemicals Tamoxifen citrate, 98%
CAS: 54965-24-1 Molecular Formula: C32H37NO8 Molecular Weight (g/mol): 563.65 MDL Number: MFCD00058321 InChI Key: FQZYTYWMLGAPFJ-OQKDUQJOSA-N Synonym: tamoxifen citrate,istubal,zitazonium,unii-7frv7310n6,i.c.i. 46474 citrate,tamoxifen citrate salt,farmifeno,ginarsan,jenoxifen PubChem CID: 2733525 ChEBI: CHEBI:9397 IUPAC Name: 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid SMILES: OC(=O)CC(O)(CC(O)=O)C(O)=O.CC\C(=C(/C1=CC=CC=C1)C1=CC=C(OCCN(C)C)C=C1)C1=CC=CC=C1
| PubChem CID | 2733525 |
|---|---|
| CAS | 54965-24-1 |
| Molecular Weight (g/mol) | 563.65 |
| ChEBI | CHEBI:9397 |
| MDL Number | MFCD00058321 |
| SMILES | OC(=O)CC(O)(CC(O)=O)C(O)=O.CC\C(=C(/C1=CC=CC=C1)C1=CC=C(OCCN(C)C)C=C1)C1=CC=CC=C1 |
| Synonym | tamoxifen citrate,istubal,zitazonium,unii-7frv7310n6,i.c.i. 46474 citrate,tamoxifen citrate salt,farmifeno,ginarsan,jenoxifen |
| IUPAC Name | 2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChI Key | FQZYTYWMLGAPFJ-OQKDUQJOSA-N |
| Molecular Formula | C32H37NO8 |
Indole-3-butyric acid, 98%
CAS: 133-32-4 Molecular Formula: C12H13NO2 Molecular Weight (g/mol): 203.241 MDL Number: MFCD00005664 InChI Key: JTEDVYBZBROSJT-UHFFFAOYSA-N Synonym: indole-3-butyric acid,3-indolebutyric acid,4-1h-indol-3-yl butanoic acid,indolebutyric acid,hormodin,1h-indole-3-butanoic acid,seradix,indole-3-butanoic acid,jiffy grow,4-indol-3-yl butyric acid PubChem CID: 8617 ChEBI: CHEBI:33070 IUPAC Name: 4-(1H-indol-3-yl)butanoic acid SMILES: C1=CC=C2C(=C1)C(=CN2)CCCC(=O)O
| PubChem CID | 8617 |
|---|---|
| CAS | 133-32-4 |
| Molecular Weight (g/mol) | 203.241 |
| ChEBI | CHEBI:33070 |
| MDL Number | MFCD00005664 |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCCC(=O)O |
| Synonym | indole-3-butyric acid,3-indolebutyric acid,4-1h-indol-3-yl butanoic acid,indolebutyric acid,hormodin,1h-indole-3-butanoic acid,seradix,indole-3-butanoic acid,jiffy grow,4-indol-3-yl butyric acid |
| IUPAC Name | 4-(1H-indol-3-yl)butanoic acid |
| InChI Key | JTEDVYBZBROSJT-UHFFFAOYSA-N |
| Molecular Formula | C12H13NO2 |
Dimethyl carbonate, 99+%, Extra Dry, AcroSeal™
CAS: 616-38-6 Molecular Formula: C3H6O3 Molecular Weight (g/mol): 90.08 MDL Number: MFCD00008420 InChI Key: IEJIGPNLZYLLBP-UHFFFAOYSA-N Synonym: methyl carbonate,carbonic acid, dimethyl ester,carbonic acid dimethyl ester,methyl carbonate meo 2co,unii-ke9j097spn,dimethylcarbonate,ch3ocooch3,ke9j097spn,dimethyl ester of carbonic acid,dsstox_cid_9192 PubChem CID: 12021 ChEBI: CHEBI:36596 IUPAC Name: dimethyl carbonate SMILES: COC(=O)OC
| PubChem CID | 12021 |
|---|---|
| CAS | 616-38-6 |
| Molecular Weight (g/mol) | 90.08 |
| ChEBI | CHEBI:36596 |
| MDL Number | MFCD00008420 |
| SMILES | COC(=O)OC |
| Synonym | methyl carbonate,carbonic acid, dimethyl ester,carbonic acid dimethyl ester,methyl carbonate meo 2co,unii-ke9j097spn,dimethylcarbonate,ch3ocooch3,ke9j097spn,dimethyl ester of carbonic acid,dsstox_cid_9192 |
| IUPAC Name | dimethyl carbonate |
| InChI Key | IEJIGPNLZYLLBP-UHFFFAOYSA-N |
| Molecular Formula | C3H6O3 |
Decamethylcyclopentasiloxane, 97%
CAS: 541-02-6 Molecular Formula: C10H30O5Si5 Molecular Weight (g/mol): 370.77 MDL Number: MFCD00046966 InChI Key: XMSXQFUHVRWGNA-UHFFFAOYSA-N Synonym: decamethylcyclopentasiloxane,cyclopentasiloxane, decamethyl,cyclomethicone 5,dimethylsiloxane pentamer,dow corning 345 fluid,nuc silicone vs 7158,dow corning 345,silicon sf 1202,cyclic dimethylsiloxane pentamer,dekamethylcyklopentasiloxan PubChem CID: 10913 IUPAC Name: 2,2,4,4,6,6,8,8,10,10-decamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane SMILES: C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C
| PubChem CID | 10913 |
|---|---|
| CAS | 541-02-6 |
| Molecular Weight (g/mol) | 370.77 |
| MDL Number | MFCD00046966 |
| SMILES | C[Si]1(O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)C |
| Synonym | decamethylcyclopentasiloxane,cyclopentasiloxane, decamethyl,cyclomethicone 5,dimethylsiloxane pentamer,dow corning 345 fluid,nuc silicone vs 7158,dow corning 345,silicon sf 1202,cyclic dimethylsiloxane pentamer,dekamethylcyklopentasiloxan |
| IUPAC Name | 2,2,4,4,6,6,8,8,10,10-decamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| InChI Key | XMSXQFUHVRWGNA-UHFFFAOYSA-N |
| Molecular Formula | C10H30O5Si5 |
Creatinine, 98%
CAS: 60-27-5 Molecular Formula: C4H7N3O Molecular Weight (g/mol): 113.12 InChI Key: DDRJAANPRJIHGJ-UHFFFAOYSA-N Synonym: creatinine,2-imino-1-methylimidazolidin-4-one,1-methylglycocyamidine,1-methylhydantoin-2-imide,creatinine,heated,4h-imidazol-4-one, 2-amino-1,5-dihydro-1-methyl,2-amino-1-methylimidazolin-4-one,creatinina,kreatinin,unii-ayi8ex34eu PubChem CID: 588 ChEBI: CHEBI:16737 IUPAC Name: 2-amino-3-methyl-4H-imidazol-5-one SMILES: CN1CC(=O)N=C1N
| PubChem CID | 588 |
|---|---|
| CAS | 60-27-5 |
| Molecular Weight (g/mol) | 113.12 |
| ChEBI | CHEBI:16737 |
| SMILES | CN1CC(=O)N=C1N |
| Synonym | creatinine,2-imino-1-methylimidazolidin-4-one,1-methylglycocyamidine,1-methylhydantoin-2-imide,creatinine,heated,4h-imidazol-4-one, 2-amino-1,5-dihydro-1-methyl,2-amino-1-methylimidazolin-4-one,creatinina,kreatinin,unii-ayi8ex34eu |
| IUPAC Name | 2-amino-3-methyl-4H-imidazol-5-one |
| InChI Key | DDRJAANPRJIHGJ-UHFFFAOYSA-N |
| Molecular Formula | C4H7N3O |
Dipropylene glycol, mixture of isomers, 99%
CAS: 25265-71-8 Molecular Weight (g/mol): 134.18 InChI Key: AZUXKVXMJOIAOF-UHFFFAOYNA-N PubChem CID: 8087 IUPAC Name: 1-(2-hydroxypropoxy)propan-2-ol SMILES: CC(O)COCC(C)O
| PubChem CID | 8087 |
|---|---|
| CAS | 25265-71-8 |
| Molecular Weight (g/mol) | 134.18 |
| SMILES | CC(O)COCC(C)O |
| IUPAC Name | 1-(2-hydroxypropoxy)propan-2-ol |
| InChI Key | AZUXKVXMJOIAOF-UHFFFAOYNA-N |
m-Toluic acid, 99%
CAS: 99-04-7 Molecular Formula: C8H8O2 Molecular Weight (g/mol): 136.15 MDL Number: MFCD00002523 InChI Key: GPSDUZXPYCFOSQ-UHFFFAOYSA-N Synonym: m-toluic acid,m-toluylic acid,3-toluic acid,benzoic acid, 3-methyl,meta-toluic acid,m-methylbenzoic acid,beta-methylbenzoic acid,3-methyl-benzoic acid,beta-bethylbenzoic acid,unii-1ua7k8eext PubChem CID: 7418 ChEBI: CHEBI:10589 IUPAC Name: 3-methylbenzoic acid SMILES: CC1=CC=CC(=C1)C(O)=O
| PubChem CID | 7418 |
|---|---|
| CAS | 99-04-7 |
| Molecular Weight (g/mol) | 136.15 |
| ChEBI | CHEBI:10589 |
| MDL Number | MFCD00002523 |
| SMILES | CC1=CC=CC(=C1)C(O)=O |
| Synonym | m-toluic acid,m-toluylic acid,3-toluic acid,benzoic acid, 3-methyl,meta-toluic acid,m-methylbenzoic acid,beta-methylbenzoic acid,3-methyl-benzoic acid,beta-bethylbenzoic acid,unii-1ua7k8eext |
| IUPAC Name | 3-methylbenzoic acid |
| InChI Key | GPSDUZXPYCFOSQ-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2 |
| Viscosity | 3.13 mPa.s (19°C) |
|---|---|
| Linear Formula | (CH3)4NOH |
| Molecular Weight (g/mol) | 91.15 |
| InChI Key | WGTYBPLFGIVFAS-UHFFFAOYSA-M |
| Density | 1.0140g/mL |
| PubChem CID | 60966 |
| Name Note | 25% in Water |
| Percent Purity | 23 to 27% |
| Fieser | 11,514 |
| RTECS Number | PA0875000 |
| Formula Weight | 91.15 |
| Melting Point | -25.0°C |
| Boiling Point | 102.0°C |
| Color | Colorless to Yellow |
| Physical Form | Solution |
| Chemical Name or Material | Tetramethylammonium hydroxide |
| SMILES | C[N+](C)(C)C.[OH-] |
| Merck Index | 15,9371 |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Rinse mouth. IF IN EYES: Rinse cautiously with water for several minutes. Remove con |
| MDL Number | MFCD00008280 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Toxic if swallowed. Fatal in contact with skin. Causes damage to organs. Causes damage to organs through prolonged or repeated exposure. Toxic to aquatic life w |
| Solubility Information | Solubility in water: soluble. |
| Packaging | Plastic bottle |
| Flash Point | >95°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Refractive Index | 1.3780 to 1.3840 (20°C, 589nm) |
| Synonym | tetramethylammonium hydroxide,tmah,hydroxyde de tetramethylammonium,nmw-w,nmd 3,tetramethyl ammonium hydroxide,unii-5gkp7317q2,ammonium, tetramethyl-, hydroxide,methanaminium, n,n,n-trimethyl-, hydroxide,tetramethylammoniumhydroxide |
| TSCA | TSCA |
| IUPAC Name | tetramethylazanium;hydroxide |
| Beilstein | 04,5 |
| Molecular Formula | C4H13NO |
| EINECS Number | 200-882-9 |
| Specific Gravity | 1.014 |