Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Suramin hexasodium salt, 98%, Thermo Scientific Chemicals
CAS: 129-46-4 Molecular Formula: C51H34N6Na6O23S6 Molecular Weight (g/mol): 1429.15 MDL Number: MFCD00210217 InChI Key: VAPNKLKDKUDFHK-UHFFFAOYSA-H Synonym: suramin sodium,suramin hexasodium,suramin hexasodium salt,suramin sodium salt,antrypol,moranyl,naganinum,naphuride sodium,fourneau 309,suramine sodium salt PubChem CID: 8514 IUPAC Name: hexasodium;8-[[4-methyl-3-[[3-[[3-[[2-methyl-5-[(4,6,8-trisulfonatonaphthalen-1-yl)carbamoyl]phenyl]carbamoyl]phenyl]carbamoylamino]benzoyl]amino]benzoyl]amino]naphthalene-1,3,5-trisulfonate SMILES: [Na+].[Na+].[Na+].[Na+].[Na+].[Na+].CC1=CC=C(C=C1NC(=O)C1=CC(NC(=O)NC2=CC(=CC=C2)C(=O)NC2=CC(=CC=C2C)C(=O)NC2=C3C(C=C(C=C3S([O-])(=O)=O)S([O-])(=O)=O)=C(C=C2)S([O-])(=O)=O)=CC=C1)C(=O)NC1=C2C(C=C(C=C2S([O-])(=O)=O)S([O-])(=O)=O)=C(C=C1)S([O-])(=O)=O
| PubChem CID | 8514 |
|---|---|
| CAS | 129-46-4 |
| Molecular Weight (g/mol) | 1429.15 |
| MDL Number | MFCD00210217 |
| SMILES | [Na+].[Na+].[Na+].[Na+].[Na+].[Na+].CC1=CC=C(C=C1NC(=O)C1=CC(NC(=O)NC2=CC(=CC=C2)C(=O)NC2=CC(=CC=C2C)C(=O)NC2=C3C(C=C(C=C3S([O-])(=O)=O)S([O-])(=O)=O)=C(C=C2)S([O-])(=O)=O)=CC=C1)C(=O)NC1=C2C(C=C(C=C2S([O-])(=O)=O)S([O-])(=O)=O)=C(C=C1)S([O-])(=O)=O |
| Synonym | suramin sodium,suramin hexasodium,suramin hexasodium salt,suramin sodium salt,antrypol,moranyl,naganinum,naphuride sodium,fourneau 309,suramine sodium salt |
| IUPAC Name | hexasodium;8-[[4-methyl-3-[[3-[[3-[[2-methyl-5-[(4,6,8-trisulfonatonaphthalen-1-yl)carbamoyl]phenyl]carbamoyl]phenyl]carbamoylamino]benzoyl]amino]benzoyl]amino]naphthalene-1,3,5-trisulfonate |
| InChI Key | VAPNKLKDKUDFHK-UHFFFAOYSA-H |
| Molecular Formula | C51H34N6Na6O23S6 |
Naphthalene, 99%
CAS: 91-20-3 Molecular Formula: C10H8 Molecular Weight (g/mol): 128.17 MDL Number: MFCD00001742 InChI Key: UFWIBTONFRDIAS-UHFFFAOYSA-N Synonym: naphthalin,naphthene,camphor tar,tar camphor,white tar,albocarbon,naphthaline,moth flakes,moth balls,naphtalene PubChem CID: 931 ChEBI: CHEBI:16482 IUPAC Name: naphthalene SMILES: C1=CC2=CC=CC=C2C=C1
| PubChem CID | 931 |
|---|---|
| CAS | 91-20-3 |
| Molecular Weight (g/mol) | 128.17 |
| ChEBI | CHEBI:16482 |
| MDL Number | MFCD00001742 |
| SMILES | C1=CC2=CC=CC=C2C=C1 |
| Synonym | naphthalin,naphthene,camphor tar,tar camphor,white tar,albocarbon,naphthaline,moth flakes,moth balls,naphtalene |
| IUPAC Name | naphthalene |
| InChI Key | UFWIBTONFRDIAS-UHFFFAOYSA-N |
| Molecular Formula | C10H8 |
n-Octane, 97%, pure
CAS: 111-65-9 Molecular Formula: C8H18 Molecular Weight (g/mol): 114.23 MDL Number: MFCD00009556 InChI Key: TVMXDCGIABBOFY-UHFFFAOYSA-N Synonym: n-octane,oktan,oktanen,ottani,oktanen dutch,heptane, methyl,oktan polish,ottani italian,octane, all isomers,unii-x1rv0b2fjv PubChem CID: 356 ChEBI: CHEBI:17590 IUPAC Name: octane SMILES: CCCCCCCC
| PubChem CID | 356 |
|---|---|
| CAS | 111-65-9 |
| Molecular Weight (g/mol) | 114.23 |
| ChEBI | CHEBI:17590 |
| MDL Number | MFCD00009556 |
| SMILES | CCCCCCCC |
| Synonym | n-octane,oktan,oktanen,ottani,oktanen dutch,heptane, methyl,oktan polish,ottani italian,octane, all isomers,unii-x1rv0b2fjv |
| IUPAC Name | octane |
| InChI Key | TVMXDCGIABBOFY-UHFFFAOYSA-N |
| Molecular Formula | C8H18 |
Trifluoroacetic anhydride, 99+%
CAS: 407-25-0 Molecular Formula: C4F6O3 Molecular Weight (g/mol): 210.03 MDL Number: MFCD00000416 InChI Key: QAEDZJGFFMLHHQ-UHFFFAOYSA-N Synonym: trifluoroacetic anhydride,trifluoroacetic acid anhydride,2,2,2-trifluoroacetic anhydride,bis trifluoroacetic anhydride,acetic acid, trifluoro-, anhydride,perfluoroacetic anhydride,trifluoroacetyl anhydride,tfaa,hexafluoroacetic anhydride,anhydrid kyseliny trifluoroctove PubChem CID: 9845 IUPAC Name: (2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate SMILES: FC(F)(F)C(=O)OC(=O)C(F)(F)F
| PubChem CID | 9845 |
|---|---|
| CAS | 407-25-0 |
| Molecular Weight (g/mol) | 210.03 |
| MDL Number | MFCD00000416 |
| SMILES | FC(F)(F)C(=O)OC(=O)C(F)(F)F |
| Synonym | trifluoroacetic anhydride,trifluoroacetic acid anhydride,2,2,2-trifluoroacetic anhydride,bis trifluoroacetic anhydride,acetic acid, trifluoro-, anhydride,perfluoroacetic anhydride,trifluoroacetyl anhydride,tfaa,hexafluoroacetic anhydride,anhydrid kyseliny trifluoroctove |
| IUPAC Name | (2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
| InChI Key | QAEDZJGFFMLHHQ-UHFFFAOYSA-N |
| Molecular Formula | C4F6O3 |
Polyethyleneimine, branched, M.W. 70,000, 30% w/v aq. soln.
CAS: 9002-98-6 Molecular Formula: ((C2H5N)zC2H4N)y(C2H5N)x Molecular Weight (g/mol): 43.07 MDL Number: MFCD00084427 InChI Key: NOWKCMXCCJGMRR-UHFFFAOYSA-N Synonym: ethyleneimine,ethylenimine,azacyclopropane,dimethyleneimine,ethylene imine,polyethyleneimine,dihydroazirene,everamine,aziran,polymin PubChem CID: 9033 ChEBI: CHEBI:30969 IUPAC Name: aziridine SMILES: *-CCNCCN(-*)CCN-*
| PubChem CID | 9033 |
|---|---|
| CAS | 9002-98-6 |
| Molecular Weight (g/mol) | 43.07 |
| ChEBI | CHEBI:30969 |
| MDL Number | MFCD00084427 |
| SMILES | *-CCNCCN(-*)CCN-* |
| Synonym | ethyleneimine,ethylenimine,azacyclopropane,dimethyleneimine,ethylene imine,polyethyleneimine,dihydroazirene,everamine,aziran,polymin |
| IUPAC Name | aziridine |
| InChI Key | NOWKCMXCCJGMRR-UHFFFAOYSA-N |
| Molecular Formula | ((C2H5N)zC2H4N)y(C2H5N)x |
Maleimide, 98%
CAS: 541-59-3 Molecular Formula: C8H4AgKN2O4 Molecular Weight (g/mol): 339.10 MDL Number: MFCD00005494 InChI Key: KWLWLQRUFFGWNG-UHFFFAOYSA-L Synonym: maleimide,1h-pyrrole-2,5-dione,2,5-pyrroledione,maleinimide,maleic imide,3-pyrroline-2,5-dione,2,5-dihydro-1h-pyrrole-2,5-dione,unii-2519r1ugp8,ccris 3408,5-hydroxy-2h-pyrrol-2-one PubChem CID: 10935 ChEBI: CHEBI:16072 SMILES: [K+].[Ag+].O=C1[N-]C(=O)C=C1.O=C1[N-]C(=O)C=C1
| PubChem CID | 10935 |
|---|---|
| CAS | 541-59-3 |
| Molecular Weight (g/mol) | 339.10 |
| ChEBI | CHEBI:16072 |
| MDL Number | MFCD00005494 |
| SMILES | [K+].[Ag+].O=C1[N-]C(=O)C=C1.O=C1[N-]C(=O)C=C1 |
| Synonym | maleimide,1h-pyrrole-2,5-dione,2,5-pyrroledione,maleinimide,maleic imide,3-pyrroline-2,5-dione,2,5-dihydro-1h-pyrrole-2,5-dione,unii-2519r1ugp8,ccris 3408,5-hydroxy-2h-pyrrol-2-one |
| InChI Key | KWLWLQRUFFGWNG-UHFFFAOYSA-L |
| Molecular Formula | C8H4AgKN2O4 |
Succinic acid, disodium salt, 99%, anhydrous
CAS: 150-90-3 Molecular Formula: C4H4Na2O4 Molecular Weight (g/mol): 162.052 MDL Number: MFCD00002790 InChI Key: ZDQYSKICYIVCPN-UHFFFAOYSA-L Synonym: disodium succinate,sodium succinate,disodium butanedioate,butanedioic acid, disodium salt,soduxin,succinic acid disodium salt,jantaran sodny czech,unii-v8zgc8isr3,succinic acid, disodium salt,fema no. 3277 PubChem CID: 9020 ChEBI: CHEBI:63675 IUPAC Name: disodium;butanedioate SMILES: C(CC(=O)[O-])C(=O)[O-].[Na+].[Na+]
| PubChem CID | 9020 |
|---|---|
| CAS | 150-90-3 |
| Molecular Weight (g/mol) | 162.052 |
| ChEBI | CHEBI:63675 |
| MDL Number | MFCD00002790 |
| SMILES | C(CC(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| Synonym | disodium succinate,sodium succinate,disodium butanedioate,butanedioic acid, disodium salt,soduxin,succinic acid disodium salt,jantaran sodny czech,unii-v8zgc8isr3,succinic acid, disodium salt,fema no. 3277 |
| IUPAC Name | disodium;butanedioate |
| InChI Key | ZDQYSKICYIVCPN-UHFFFAOYSA-L |
| Molecular Formula | C4H4Na2O4 |
3,5-Dimethylphenol, 99+%
CAS: 108-68-9 Molecular Formula: C8H10O Molecular Weight (g/mol): 122.17 MDL Number: MFCD00002307 InChI Key: TUAMRELNJMMDMT-UHFFFAOYSA-N Synonym: 3,5-xylenol,sym-m-xylenol,phenol, 3,5-dimethyl,1,3,5-xylenol,3,5-dmp,1-hydroxy-3,5-dimethylbenzene,3,5-dimethyl phenol,5-hydroxy-m-xylene,xylenol 200,unii-ona760g0wa PubChem CID: 7948 ChEBI: CHEBI:38572 IUPAC Name: 3,5-dimethylphenol SMILES: CC1=CC(O)=CC(C)=C1
| PubChem CID | 7948 |
|---|---|
| CAS | 108-68-9 |
| Molecular Weight (g/mol) | 122.17 |
| ChEBI | CHEBI:38572 |
| MDL Number | MFCD00002307 |
| SMILES | CC1=CC(O)=CC(C)=C1 |
| Synonym | 3,5-xylenol,sym-m-xylenol,phenol, 3,5-dimethyl,1,3,5-xylenol,3,5-dmp,1-hydroxy-3,5-dimethylbenzene,3,5-dimethyl phenol,5-hydroxy-m-xylene,xylenol 200,unii-ona760g0wa |
| IUPAC Name | 3,5-dimethylphenol |
| InChI Key | TUAMRELNJMMDMT-UHFFFAOYSA-N |
| Molecular Formula | C8H10O |
1,4-Diazabicyclo[2.2.2]octane, 98%
CAS: 280-57-9 Molecular Formula: C6H12N2 Molecular Weight (g/mol): 112.176 MDL Number: MFCD00006689 InChI Key: IMNIMPAHZVJRPE-UHFFFAOYSA-N Synonym: 1,4-diazabicyclo 2.2.2 octane,triethylenediamine,dabco,dabco 33lv,1,4-ethylenepiperazine,dabco crystal,teda,texacat td 100,dabco s-25 PubChem CID: 9237 IUPAC Name: 1,4-diazabicyclo[2.2.2]octane SMILES: C1CN2CCN1CC2
| PubChem CID | 9237 |
|---|---|
| CAS | 280-57-9 |
| Molecular Weight (g/mol) | 112.176 |
| MDL Number | MFCD00006689 |
| SMILES | C1CN2CCN1CC2 |
| Synonym | 1,4-diazabicyclo 2.2.2 octane,triethylenediamine,dabco,dabco 33lv,1,4-ethylenepiperazine,dabco crystal,teda,texacat td 100,dabco s-25 |
| IUPAC Name | 1,4-diazabicyclo[2.2.2]octane |
| InChI Key | IMNIMPAHZVJRPE-UHFFFAOYSA-N |
| Molecular Formula | C6H12N2 |
Tetrahydropyran, 99%
CAS: 142-68-7 MDL Number: MFCD00006585 InChI Key: DHXVGJBLRPWPCS-UHFFFAOYSA-N Synonym: tetrahydropyran,tetrahydro-2h-pyran,oxacyclohexane,pentamethylene oxide,2h-pyran, tetrahydro,tetrahydropyrane,unii-v06i3ilg6b,2h-tetrahydropyran,v06i3ilg6b,pye PubChem CID: 8894 ChEBI: CHEBI:46941 IUPAC Name: oxane SMILES: C1CCOCC1
| PubChem CID | 8894 |
|---|---|
| CAS | 142-68-7 |
| ChEBI | CHEBI:46941 |
| MDL Number | MFCD00006585 |
| SMILES | C1CCOCC1 |
| Synonym | tetrahydropyran,tetrahydro-2h-pyran,oxacyclohexane,pentamethylene oxide,2h-pyran, tetrahydro,tetrahydropyrane,unii-v06i3ilg6b,2h-tetrahydropyran,v06i3ilg6b,pye |
| IUPAC Name | oxane |
| InChI Key | DHXVGJBLRPWPCS-UHFFFAOYSA-N |
Trifluoromethanesulfonic acid, 98+%
CAS: 1493-13-6 Molecular Formula: CHF3O3S Molecular Weight (g/mol): 150.07 MDL Number: MFCD00007514 InChI Key: ITMCEJHCFYSIIV-UHFFFAOYSA-N Synonym: triflic acid,perfluoromethanesulfonic acid,trifluoromethanesulphonic acid,tfmsa,trifluoromethane sulfonic acid,tfoh,methanesulfonic acid, trifluoro,hotf,trifluoromethylsulfonic acid,trimsylate PubChem CID: 62406 ChEBI: CHEBI:48511 IUPAC Name: trifluoromethanesulfonic acid SMILES: OS(=O)(=O)C(F)(F)F
| PubChem CID | 62406 |
|---|---|
| CAS | 1493-13-6 |
| Molecular Weight (g/mol) | 150.07 |
| ChEBI | CHEBI:48511 |
| MDL Number | MFCD00007514 |
| SMILES | OS(=O)(=O)C(F)(F)F |
| Synonym | triflic acid,perfluoromethanesulfonic acid,trifluoromethanesulphonic acid,tfmsa,trifluoromethane sulfonic acid,tfoh,methanesulfonic acid, trifluoro,hotf,trifluoromethylsulfonic acid,trimsylate |
| IUPAC Name | trifluoromethanesulfonic acid |
| InChI Key | ITMCEJHCFYSIIV-UHFFFAOYSA-N |
| Molecular Formula | CHF3O3S |
Trichloroethylene, 98%
CAS: 79-01-6 Molecular Formula: C2HCl3 Molecular Weight (g/mol): 131.38 MDL Number: MFCD00000838 InChI Key: XSTXAVWGXDQKEL-UHFFFAOYSA-N Synonym: trichloroethylene,trichloroethene,ethene, trichloro,trilene,trichlorethylene,ethinyl trichloride,ethylene trichloride,acetylene trichloride,chlorilen,narcogen PubChem CID: 6575 ChEBI: CHEBI:16602 IUPAC Name: 1,1,2-trichloroethene SMILES: C(=C(Cl)Cl)Cl
| PubChem CID | 6575 |
|---|---|
| CAS | 79-01-6 |
| Molecular Weight (g/mol) | 131.38 |
| ChEBI | CHEBI:16602 |
| MDL Number | MFCD00000838 |
| SMILES | C(=C(Cl)Cl)Cl |
| Synonym | trichloroethylene,trichloroethene,ethene, trichloro,trilene,trichlorethylene,ethinyl trichloride,ethylene trichloride,acetylene trichloride,chlorilen,narcogen |
| IUPAC Name | 1,1,2-trichloroethene |
| InChI Key | XSTXAVWGXDQKEL-UHFFFAOYSA-N |
| Molecular Formula | C2HCl3 |
Thermo Scientific Chemicals Carboxymethyl cellulose, sodium salt, average M.W. 250000 (DS=0.9)
CAS: 9004-32-4 Molecular Formula: (C12 H14 O9 R6)n Molecular Weight (g/mol): 263.20 MDL Number: MFCD00081472 InChI Key: DPXJVFZANSGRMM-UHFFFAOYNA-N Synonym: carboxymethylcellulose sodium usp,celluvisc tn,carmellose sodium jp17,sodium dextrose acetate,c.m.c. tn PubChem CID: 23706213 IUPAC Name: 2,3,4,5,6-pentahydroxyhexanal acetic acid sodium SMILES: [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O
| PubChem CID | 23706213 |
|---|---|
| CAS | 9004-32-4 |
| Molecular Weight (g/mol) | 263.20 |
| MDL Number | MFCD00081472 |
| SMILES | [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O |
| Synonym | carboxymethylcellulose sodium usp,celluvisc tn,carmellose sodium jp17,sodium dextrose acetate,c.m.c. tn |
| IUPAC Name | 2,3,4,5,6-pentahydroxyhexanal acetic acid sodium |
| InChI Key | DPXJVFZANSGRMM-UHFFFAOYNA-N |
| Molecular Formula | (C12 H14 O9 R6)n |
Phenosafranin
CAS: 81-93-6 Molecular Formula: C18H15ClN4 Molecular Weight (g/mol): 322.80 MDL Number: MFCD00036335 InChI Key: SOUHUMACVWVDME-UHFFFAOYSA-N Synonym: phenosafranin,phenosafranine,phenosafranine, chloride,phenosafrinine,phenosofranine,phenosofrinine,safranin b extra,safrinin b extra,3,7-diamino-5-phenylphenazinium chloride,schultz no. 958 PubChem CID: 65732 ChEBI: CHEBI:33601 IUPAC Name: 10-phenylphenazin-10-ium-2,8-diamine;chloride SMILES: [Cl-].NC1=CC2=[N+](C3=CC=CC=C3)C3=CC(N)=CC=C3N=C2C=C1
| PubChem CID | 65732 |
|---|---|
| CAS | 81-93-6 |
| Molecular Weight (g/mol) | 322.80 |
| ChEBI | CHEBI:33601 |
| MDL Number | MFCD00036335 |
| SMILES | [Cl-].NC1=CC2=[N+](C3=CC=CC=C3)C3=CC(N)=CC=C3N=C2C=C1 |
| Synonym | phenosafranin,phenosafranine,phenosafranine, chloride,phenosafrinine,phenosofranine,phenosofrinine,safranin b extra,safrinin b extra,3,7-diamino-5-phenylphenazinium chloride,schultz no. 958 |
| IUPAC Name | 10-phenylphenazin-10-ium-2,8-diamine;chloride |
| InChI Key | SOUHUMACVWVDME-UHFFFAOYSA-N |
| Molecular Formula | C18H15ClN4 |
Methyl chloroformate, 99%
CAS: 79-22-1 Molecular Formula: C2H3ClO2 Molecular Weight (g/mol): 94.49 MDL Number: MFCD00000639 InChI Key: XMJHPCRAQCTCFT-UHFFFAOYSA-N Synonym: methyl chloroformate,methyl chlorocarbonate,chloroformic acid methyl ester,methoxycarbonyl chloride,carbonochloridic acid, methyl ester,methyl chloridocarbonate,chloro methoxy methanone,metilcloroformiato,k-stoff,methylchloorformiaat PubChem CID: 6586 IUPAC Name: methyl carbonochloridate SMILES: COC(Cl)=O
| PubChem CID | 6586 |
|---|---|
| CAS | 79-22-1 |
| Molecular Weight (g/mol) | 94.49 |
| MDL Number | MFCD00000639 |
| SMILES | COC(Cl)=O |
| Synonym | methyl chloroformate,methyl chlorocarbonate,chloroformic acid methyl ester,methoxycarbonyl chloride,carbonochloridic acid, methyl ester,methyl chloridocarbonate,chloro methoxy methanone,metilcloroformiato,k-stoff,methylchloorformiaat |
| IUPAC Name | methyl carbonochloridate |
| InChI Key | XMJHPCRAQCTCFT-UHFFFAOYSA-N |
| Molecular Formula | C2H3ClO2 |