Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
3-Bromobenzylamine 98.0+%, TCI America™
CAS: 10269-01-9 Molecular Formula: C7H8BrN Molecular Weight (g/mol): 186.052 MDL Number: MFCD01026119 InChI Key: SUYJXERPRICYRX-UHFFFAOYSA-N Synonym: 3-bromobenzylamine,3-bromophenyl methanamine,benzenemethanamine, 3-bromo,3-bromophenyl methylamine,m-bromobenzylamine,1-3-bromophenyl methanamine,3-bromo-benzylamine,3-bromobenzenemethanamine,3-bromobenzyl amine,pubchem21109 PubChem CID: 457587 IUPAC Name: (3-bromophenyl)methanamine SMILES: C1=CC(=CC(=C1)Br)CN
| PubChem CID | 457587 |
|---|---|
| CAS | 10269-01-9 |
| Molecular Weight (g/mol) | 186.052 |
| MDL Number | MFCD01026119 |
| SMILES | C1=CC(=CC(=C1)Br)CN |
| Synonym | 3-bromobenzylamine,3-bromophenyl methanamine,benzenemethanamine, 3-bromo,3-bromophenyl methylamine,m-bromobenzylamine,1-3-bromophenyl methanamine,3-bromo-benzylamine,3-bromobenzenemethanamine,3-bromobenzyl amine,pubchem21109 |
| IUPAC Name | (3-bromophenyl)methanamine |
| InChI Key | SUYJXERPRICYRX-UHFFFAOYSA-N |
| Molecular Formula | C7H8BrN |
2-Bromoisobutyric Acid 98.0+%, TCI America™
CAS: 2052-01-9 Molecular Formula: C4H7BrO2 Molecular Weight (g/mol): 167.00 MDL Number: MFCD00004168 InChI Key: XXSPGBOGLXKMDU-UHFFFAOYSA-N Synonym: 2-bromoisobutyric acid,2-bromo-2-methylpropionic acid,isobromobutyric acid,propanoic acid, 2-bromo-2-methyl,alpha-bromoisobutyric acid,.alpha.-bromoisobutyric acid,2-bromo-2-methyl-propanoic acid,propionic acid, 2-bromo-2-methyl,unii-821p2r6b0a,ccris 9046 PubChem CID: 74924 IUPAC Name: 2-bromo-2-methylpropanoic acid SMILES: CC(C)(C(=O)O)Br
| PubChem CID | 74924 |
|---|---|
| CAS | 2052-01-9 |
| Molecular Weight (g/mol) | 167.00 |
| MDL Number | MFCD00004168 |
| SMILES | CC(C)(C(=O)O)Br |
| Synonym | 2-bromoisobutyric acid,2-bromo-2-methylpropionic acid,isobromobutyric acid,propanoic acid, 2-bromo-2-methyl,alpha-bromoisobutyric acid,.alpha.-bromoisobutyric acid,2-bromo-2-methyl-propanoic acid,propionic acid, 2-bromo-2-methyl,unii-821p2r6b0a,ccris 9046 |
| IUPAC Name | 2-bromo-2-methylpropanoic acid |
| InChI Key | XXSPGBOGLXKMDU-UHFFFAOYSA-N |
| Molecular Formula | C4H7BrO2 |
3-Bromo-5-iodopyridine 98.0+%, TCI America™
CAS: 233770-01-9 Molecular Formula: C5H3BrIN Molecular Weight (g/mol): 283.894 MDL Number: MFCD03086019 InChI Key: AOOZLVWDZUPEHT-UHFFFAOYSA-N PubChem CID: 820409 IUPAC Name: 3-bromo-5-iodopyridine SMILES: C1=C(C=NC=C1I)Br
| PubChem CID | 820409 |
|---|---|
| CAS | 233770-01-9 |
| Molecular Weight (g/mol) | 283.894 |
| MDL Number | MFCD03086019 |
| SMILES | C1=C(C=NC=C1I)Br |
| IUPAC Name | 3-bromo-5-iodopyridine |
| InChI Key | AOOZLVWDZUPEHT-UHFFFAOYSA-N |
| Molecular Formula | C5H3BrIN |
1,2,3-Triphenylguanidine 97.0+%, TCI America™
CAS: 101-01-9 Molecular Formula: C19H17N3 Molecular Weight (g/mol): 287.366 MDL Number: MFCD00020648 InChI Key: FUPAJKKAHDLPAZ-UHFFFAOYSA-N Synonym: n,n',n-triphenylguanidine,guanidine, n,n',n-triphenyl,sym-triphenylguanidine,guanidine, triphenyl,1,2,3-trifenylguanidin,unii-i64b170qfg,1,2,3-trifenylguanidin czech,guanidine, 1,2,3-triphenyl,phenyl 2-phenyl-1-phenylamino-2-azavinyl amine,triphenylguanidin PubChem CID: 7539 IUPAC Name: 1,2,3-triphenylguanidine SMILES: C1=CC=C(C=C1)NC(=NC2=CC=CC=C2)NC3=CC=CC=C3
| PubChem CID | 7539 |
|---|---|
| CAS | 101-01-9 |
| Molecular Weight (g/mol) | 287.366 |
| MDL Number | MFCD00020648 |
| SMILES | C1=CC=C(C=C1)NC(=NC2=CC=CC=C2)NC3=CC=CC=C3 |
| Synonym | n,n',n-triphenylguanidine,guanidine, n,n',n-triphenyl,sym-triphenylguanidine,guanidine, triphenyl,1,2,3-trifenylguanidin,unii-i64b170qfg,1,2,3-trifenylguanidin czech,guanidine, 1,2,3-triphenyl,phenyl 2-phenyl-1-phenylamino-2-azavinyl amine,triphenylguanidin |
| IUPAC Name | 1,2,3-triphenylguanidine |
| InChI Key | FUPAJKKAHDLPAZ-UHFFFAOYSA-N |
| Molecular Formula | C19H17N3 |
4-Bromo-2-chlorobenzonitrile 97.0+%, TCI America™
CAS: 154607-01-9 Molecular Formula: C7H3BrClN Molecular Weight (g/mol): 216.46 MDL Number: MFCD00040883 InChI Key: AYQBMZNSJPVADT-UHFFFAOYSA-N Synonym: 2-chloro-4-bromobenzonitrile,4-bromo-2-chloro-benzonitrile,benzonitrile, 4-bromo-2-chloro,4-bromo-2-chlorobenzenecarbonitrile,pubchem12801,intermediates-zcf02177,acmc-209db5,ksc497g8d PubChem CID: 7010420 IUPAC Name: 4-bromo-2-chlorobenzonitrile SMILES: ClC1=C(C=CC(Br)=C1)C#N
| PubChem CID | 7010420 |
|---|---|
| CAS | 154607-01-9 |
| Molecular Weight (g/mol) | 216.46 |
| MDL Number | MFCD00040883 |
| SMILES | ClC1=C(C=CC(Br)=C1)C#N |
| Synonym | 2-chloro-4-bromobenzonitrile,4-bromo-2-chloro-benzonitrile,benzonitrile, 4-bromo-2-chloro,4-bromo-2-chlorobenzenecarbonitrile,pubchem12801,intermediates-zcf02177,acmc-209db5,ksc497g8d |
| IUPAC Name | 4-bromo-2-chlorobenzonitrile |
| InChI Key | AYQBMZNSJPVADT-UHFFFAOYSA-N |
| Molecular Formula | C7H3BrClN |
Benzo[a]phenanthrene (purified by sublimation) 98.0+%, TCI America™
CAS: 218-01-9 Molecular Formula: C18H12 Molecular Weight (g/mol): 228.294 MDL Number: MFCD00003698 InChI Key: WDECIBYCCFPHNR-UHFFFAOYSA-N Synonym: benzo a phenanthrene,1,2-benzophenanthrene,1,2-benzphenanthrene,1,2,5,6-dibenzonaphthalene,benz a phenanthrene,chrysen,rcra waste number u050,rcra waste no. u050 PubChem CID: 9171 ChEBI: CHEBI:51687 IUPAC Name: chrysene SMILES: C1=CC=C2C(=C1)C=CC3=C2C=CC4=CC=CC=C43
| PubChem CID | 9171 |
|---|---|
| CAS | 218-01-9 |
| Molecular Weight (g/mol) | 228.294 |
| ChEBI | CHEBI:51687 |
| MDL Number | MFCD00003698 |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C=CC4=CC=CC=C43 |
| Synonym | benzo a phenanthrene,1,2-benzophenanthrene,1,2-benzphenanthrene,1,2,5,6-dibenzonaphthalene,benz a phenanthrene,chrysen,rcra waste number u050,rcra waste no. u050 |
| IUPAC Name | chrysene |
| InChI Key | WDECIBYCCFPHNR-UHFFFAOYSA-N |
| Molecular Formula | C18H12 |
3-tert-Butyl-5-ethyltoluene 98.0+%, TCI America™
CAS: 6630-01-9 Molecular Formula: C13H20 Molecular Weight (g/mol): 176.30 MDL Number: MFCD00026954 InChI Key: URDKTSKLGNWKDB-UHFFFAOYSA-N PubChem CID: 23114 IUPAC Name: 1-tert-butyl-3-ethyl-5-methylbenzene SMILES: CCC1=CC(=CC(=C1)C)C(C)(C)C
| PubChem CID | 23114 |
|---|---|
| CAS | 6630-01-9 |
| Molecular Weight (g/mol) | 176.30 |
| MDL Number | MFCD00026954 |
| SMILES | CCC1=CC(=CC(=C1)C)C(C)(C)C |
| IUPAC Name | 1-tert-butyl-3-ethyl-5-methylbenzene |
| InChI Key | URDKTSKLGNWKDB-UHFFFAOYSA-N |
| Molecular Formula | C13H20 |
DL-3,4-Dihydroxymandelic Acid 98.0+%, TCI America™
CAS: 775-01-9 Molecular Formula: C8H8O5 Molecular Weight (g/mol): 184.147 MDL Number: MFCD00004231 InChI Key: RGHMISIYKIHAJW-UHFFFAOYSA-N PubChem CID: 85782 ChEBI: CHEBI:27637 IUPAC Name: 2-(3,4-dihydroxyphenyl)-2-hydroxyacetic acid SMILES: C1=CC(=C(C=C1C(C(=O)O)O)O)O
| PubChem CID | 85782 |
|---|---|
| CAS | 775-01-9 |
| Molecular Weight (g/mol) | 184.147 |
| ChEBI | CHEBI:27637 |
| MDL Number | MFCD00004231 |
| SMILES | C1=CC(=C(C=C1C(C(=O)O)O)O)O |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-2-hydroxyacetic acid |
| InChI Key | RGHMISIYKIHAJW-UHFFFAOYSA-N |
| Molecular Formula | C8H8O5 |
2-(Trifluoromethyl)benzylamine 98.0+%, TCI America™
CAS: 3048-01-9 Molecular Formula: C8H8F3N Molecular Weight (g/mol): 175.15 MDL Number: MFCD00010297 InChI Key: ZSKQIFWUTUZAGF-UHFFFAOYSA-N Synonym: 2-trifluoromethyl benzylamine,2-trifluoromethylbenzylamine,2-trifluoromethyl phenyl methanamine,o-trifluoromethylbenzyl amine,o-trifluoromethylbenzylamine,2-trifluoromethyl-benzylamine,1-2-trifluoromethyl phenyl methanamine,benzenemethanamine, 2-trifluoromethyl,o-trifluoromethyl benzylamine PubChem CID: 76447 IUPAC Name: [2-(trifluoromethyl)phenyl]methanamine SMILES: C1=CC=C(C(=C1)CN)C(F)(F)F
| PubChem CID | 76447 |
|---|---|
| CAS | 3048-01-9 |
| Molecular Weight (g/mol) | 175.15 |
| MDL Number | MFCD00010297 |
| SMILES | C1=CC=C(C(=C1)CN)C(F)(F)F |
| Synonym | 2-trifluoromethyl benzylamine,2-trifluoromethylbenzylamine,2-trifluoromethyl phenyl methanamine,o-trifluoromethylbenzyl amine,o-trifluoromethylbenzylamine,2-trifluoromethyl-benzylamine,1-2-trifluoromethyl phenyl methanamine,benzenemethanamine, 2-trifluoromethyl,o-trifluoromethyl benzylamine |
| IUPAC Name | [2-(trifluoromethyl)phenyl]methanamine |
| InChI Key | ZSKQIFWUTUZAGF-UHFFFAOYSA-N |
| Molecular Formula | C8H8F3N |
1,3-Dibenzoyloxybenzene 98.0+%, TCI America™
CAS: 94-01-9 Molecular Formula: C20H14O4 Molecular Weight (g/mol): 318.33 MDL Number: MFCD00016576 InChI Key: SUQGLJRNDJRARS-UHFFFAOYSA-N Synonym: 1,3-dibenzoyloxybenzene,resorcinol dibenzoate,1,3-benzenediol, dibenzoate,1,3-phenylene dibenzoate,m-phenylene dibenzoate,resorcinol, dibenzoate,1,3-bis benzoyloxy benzene,3-benzoyloxy phenyl benzoate,1,3-benzenediol, 1,3-dibenzoate,1,3-phenylenedibenzoate PubChem CID: 66742 IUPAC Name: 3-(benzoyloxy)phenyl benzoate SMILES: O=C(OC1=CC(OC(=O)C2=CC=CC=C2)=CC=C1)C1=CC=CC=C1
| PubChem CID | 66742 |
|---|---|
| CAS | 94-01-9 |
| Molecular Weight (g/mol) | 318.33 |
| MDL Number | MFCD00016576 |
| SMILES | O=C(OC1=CC(OC(=O)C2=CC=CC=C2)=CC=C1)C1=CC=CC=C1 |
| Synonym | 1,3-dibenzoyloxybenzene,resorcinol dibenzoate,1,3-benzenediol, dibenzoate,1,3-phenylene dibenzoate,m-phenylene dibenzoate,resorcinol, dibenzoate,1,3-bis benzoyloxy benzene,3-benzoyloxy phenyl benzoate,1,3-benzenediol, 1,3-dibenzoate,1,3-phenylenedibenzoate |
| IUPAC Name | 3-(benzoyloxy)phenyl benzoate |
| InChI Key | SUQGLJRNDJRARS-UHFFFAOYSA-N |
| Molecular Formula | C20H14O4 |
Chloromethyl Isopropyl Carbonate 98.0+%, TCI America™
CAS: 35180-01-9 Molecular Formula: C5H9ClO3 Molecular Weight (g/mol): 152.57 MDL Number: MFCD07375443 InChI Key: JHYNXXBAHWPABC-UHFFFAOYSA-N Synonym: Carbonic Acid Chloromethyl Isopropyl Ester PubChem CID: 14787051 IUPAC Name: chloromethyl propan-2-yl carbonate SMILES: CC(C)OC(=O)OCCl
| PubChem CID | 14787051 |
|---|---|
| CAS | 35180-01-9 |
| Molecular Weight (g/mol) | 152.57 |
| MDL Number | MFCD07375443 |
| SMILES | CC(C)OC(=O)OCCl |
| Synonym | Carbonic Acid Chloromethyl Isopropyl Ester |
| IUPAC Name | chloromethyl propan-2-yl carbonate |
| InChI Key | JHYNXXBAHWPABC-UHFFFAOYSA-N |
| Molecular Formula | C5H9ClO3 |
1,4-Bis(dimethylsilyl)benzene 98.0+%, TCI America™
CAS: 2488-01-9 Molecular Formula: C10H16Si2 Molecular Weight (g/mol): 192.41 MDL Number: MFCD00039790 InChI Key: UHXCHUWSQRLZJS-UHFFFAOYSA-N Synonym: 1,4-bis dimethylsilyl benzene,benzene, 1,4-bis dimethylsilyl,p-phenylenebis dimethylsilane,1,4-phenylenebis dimethylsilane,p-bis dimethylsilyl benzene,silane, p-phenylenebis dimethyl,silane, 1,4-phenylenebis dimethyl,1,4 bis dimethylsilyl benzene PubChem CID: 6328729 IUPAC Name: (4-dimethylsilylidenecyclohexa-2,5-dien-1-ylidene)-dimethylsilane SMILES: C[Si](=C1C=CC(=[Si](C)C)C=C1)C
| PubChem CID | 6328729 |
|---|---|
| CAS | 2488-01-9 |
| Molecular Weight (g/mol) | 192.41 |
| MDL Number | MFCD00039790 |
| SMILES | C[Si](=C1C=CC(=[Si](C)C)C=C1)C |
| Synonym | 1,4-bis dimethylsilyl benzene,benzene, 1,4-bis dimethylsilyl,p-phenylenebis dimethylsilane,1,4-phenylenebis dimethylsilane,p-bis dimethylsilyl benzene,silane, p-phenylenebis dimethyl,silane, 1,4-phenylenebis dimethyl,1,4 bis dimethylsilyl benzene |
| IUPAC Name | (4-dimethylsilylidenecyclohexa-2,5-dien-1-ylidene)-dimethylsilane |
| InChI Key | UHXCHUWSQRLZJS-UHFFFAOYSA-N |
| Molecular Formula | C10H16Si2 |
3-Cyano-4-methylpyridine 98.0+%, TCI America™
CAS: 5444-01-9 Molecular Formula: C7H6N2 Molecular Weight (g/mol): 118.14 MDL Number: MFCD00234272 InChI Key: XLAPHZHNODDMDD-UHFFFAOYSA-N Synonym: 3-cyano-4-methylpyridine,4-methylnicotinonitrile,3-cyano-4-picoline,4-methyl-nicotinonitrile,3-pyridinecarbonitrile, 4-methyl,4-methyl-3-pyridinecarbonitrile,3-cyano-4-methylpyridine 3-cyano-4-picoline,pubchem6623,pubchem18426,4-methyl nicotinonitrile PubChem CID: 227806 IUPAC Name: 4-methylpyridine-3-carbonitrile SMILES: CC1=C(C=NC=C1)C#N
| PubChem CID | 227806 |
|---|---|
| CAS | 5444-01-9 |
| Molecular Weight (g/mol) | 118.14 |
| MDL Number | MFCD00234272 |
| SMILES | CC1=C(C=NC=C1)C#N |
| Synonym | 3-cyano-4-methylpyridine,4-methylnicotinonitrile,3-cyano-4-picoline,4-methyl-nicotinonitrile,3-pyridinecarbonitrile, 4-methyl,4-methyl-3-pyridinecarbonitrile,3-cyano-4-methylpyridine 3-cyano-4-picoline,pubchem6623,pubchem18426,4-methyl nicotinonitrile |
| IUPAC Name | 4-methylpyridine-3-carbonitrile |
| InChI Key | XLAPHZHNODDMDD-UHFFFAOYSA-N |
| Molecular Formula | C7H6N2 |
2,2,3,3,4,4,4-Heptafluoro-1-butanol 98.0+%, TCI America™
CAS: 375-01-9 Molecular Formula: C4H3F7O Molecular Weight (g/mol): 200.06 MDL Number: MFCD00004674 InChI Key: WXJFKAZDSQLPBX-UHFFFAOYSA-N Synonym: 2,2,3,3,4,4,4-heptafluoro-1-butanol,1-butanol, 2,2,3,3,4,4,4-heptafluoro,1h,1h-heptafluorobutanol-1,1h,1h-heptafluoro-1-butanol,1,1-dihydroperfluorobutyl alcohol,2,2,3,3,4,4,4-heptafluorobutanol,1,1-dihydroperfluorobutanol,1,1-h,h-heptafluorobutanol,perfluoro-1,1-dihydrobutanol,butanol, 2,2,3,3,4,4,4-heptafluoro PubChem CID: 9776 IUPAC Name: 2,2,3,3,4,4,4-heptafluorobutan-1-ol SMILES: OCC(F)(F)C(F)(F)C(F)(F)F
| PubChem CID | 9776 |
|---|---|
| CAS | 375-01-9 |
| Molecular Weight (g/mol) | 200.06 |
| MDL Number | MFCD00004674 |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)F |
| Synonym | 2,2,3,3,4,4,4-heptafluoro-1-butanol,1-butanol, 2,2,3,3,4,4,4-heptafluoro,1h,1h-heptafluorobutanol-1,1h,1h-heptafluoro-1-butanol,1,1-dihydroperfluorobutyl alcohol,2,2,3,3,4,4,4-heptafluorobutanol,1,1-dihydroperfluorobutanol,1,1-h,h-heptafluorobutanol,perfluoro-1,1-dihydrobutanol,butanol, 2,2,3,3,4,4,4-heptafluoro |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutan-1-ol |
| InChI Key | WXJFKAZDSQLPBX-UHFFFAOYSA-N |
| Molecular Formula | C4H3F7O |
1,5-Diphenyl-3-(2-thienyl)formazan 96.0+%, TCI America™
CAS: 135984-01-9 Molecular Formula: C17H14N4S Molecular Weight (g/mol): 306.387 MDL Number: MFCD00059744 InChI Key: YYNVZGCGVPELJN-GSPFKFNASA-N Synonym: STC Formazan PubChem CID: 66485618 IUPAC Name: N'-anilino-N-phenyliminothiophene-2-carboximidamide SMILES: C1=CC=C(C=C1)NN=C(C2=CC=CS2)N=NC3=CC=CC=C3
| PubChem CID | 66485618 |
|---|---|
| CAS | 135984-01-9 |
| Molecular Weight (g/mol) | 306.387 |
| MDL Number | MFCD00059744 |
| SMILES | C1=CC=C(C=C1)NN=C(C2=CC=CS2)N=NC3=CC=CC=C3 |
| Synonym | STC Formazan |
| IUPAC Name | N'-anilino-N-phenyliminothiophene-2-carboximidamide |
| InChI Key | YYNVZGCGVPELJN-GSPFKFNASA-N |
| Molecular Formula | C17H14N4S |