Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
2-Mercaptopyridine-N-oxide, sodium salt, 40 w/w % aqueous solution
CAS: 3811-73-2 | C5H4NNaOS | 149.15 g/mol
| Molecular Weight (g/mol) | 149.15 |
|---|---|
| CAS Min % | 58.0 |
| InChI Key | XNRNJIIJLOFJEK-UHFFFAOYSA-N |
| Density | 1.2200g/mL |
| PubChem CID | 19658 |
| Name Note | 40 w/w% Aqueous Solution |
| Percent Purity | 40 to 42% |
| pH | 8.5 to 10.5 (10% soln. at 20°C) |
| Formula Weight | 149.15 |
| Melting Point | -30.0°C |
| CAS Max % | 60.0 |
| Boiling Point | 109.0°C |
| Physical Form | Solution |
| Chemical Name or Material | 2-Mercaptopyridine-N-oxide, sodium salt |
| SMILES | C1=CC(=S)N(C=C1)[O-].[Na+] |
| Merck Index | 10, 7892 |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Call a POISON CENTER or doctor/physician if you feel unwell. IF ON SKIN: Wash with plen |
| MDL Number | MFCD01941547 |
| Health Hazard 2 | GHS H Statement Harmful if swallowed. Harmful in contact with skin. Harmful if inhaled. Causes skin irritation. Causes serious eye irritation. Very toxic to aquatic life with long lasting effects. |
| Solubility Information | Solubility in water: soluble |
| Health Hazard 1 | GHS Signal Word: Warning |
| Synonym | sodium omadine,sodium pyrithione,sodium 2-pyridylthio-n-oxide,pyrithione sodium salt,thione reagent,2-pyridinethiol-1-oxide sodium salt,2-mercaptopyridine n-oxide sodium salt,omadine sodium,sodium-2-pyridinethiol-1-oxide,sodium omadine van |
| IUPAC Name | sodium;1-oxidopyridine-2-thione |
| Molecular Formula | C5H4NNaOS |
| EINECS Number | 223-296-5 |
| Specific Gravity | 1.22 |
Strontium 2-ethylhexanoate, 40% in 2-ethylhexanoic acid (8-12% Sr)
CAS: 2457-02-5 MDL Number: MFCD00070438
| CAS | 2457-02-5 |
|---|---|
| MDL Number | MFCD00070438 |
2-Mercaptopyridine N-oxide sodium salt, 40% aq. soln.
CAS: 3811-73-2 Molecular Formula: C5H4NNaOS Molecular Weight (g/mol): 149.143 MDL Number: MFCD01941547 InChI Key: XNRNJIIJLOFJEK-UHFFFAOYSA-N Synonym: sodium omadine,sodium pyrithione,sodium 2-pyridylthio-n-oxide,pyrithione sodium salt,thione reagent,2-pyridinethiol-1-oxide sodium salt,2-mercaptopyridine n-oxide sodium salt,omadine sodium,sodium-2-pyridinethiol-1-oxide,sodium omadine van PubChem CID: 19658 IUPAC Name: sodium;1-oxidopyridine-2-thione SMILES: C1=CC(=S)N(C=C1)[O-].[Na+]
| PubChem CID | 19658 |
|---|---|
| CAS | 3811-73-2 |
| Molecular Weight (g/mol) | 149.143 |
| MDL Number | MFCD01941547 |
| SMILES | C1=CC(=S)N(C=C1)[O-].[Na+] |
| Synonym | sodium omadine,sodium pyrithione,sodium 2-pyridylthio-n-oxide,pyrithione sodium salt,thione reagent,2-pyridinethiol-1-oxide sodium salt,2-mercaptopyridine n-oxide sodium salt,omadine sodium,sodium-2-pyridinethiol-1-oxide,sodium omadine van |
| IUPAC Name | sodium;1-oxidopyridine-2-thione |
| InChI Key | XNRNJIIJLOFJEK-UHFFFAOYSA-N |
| Molecular Formula | C5H4NNaOS |
2-Mercaptopyridine N-Oxide Sodium Salt (40% in Water, ca. 3.3mol/L), TCI America™
CAS: 3811-73-2 Molecular Formula: C5H4NNaOS Molecular Weight (g/mol): 149.143 MDL Number: MFCD01941547 InChI Key: XNRNJIIJLOFJEK-UHFFFAOYSA-N Synonym: sodium omadine,sodium pyrithione,sodium 2-pyridylthio-n-oxide,pyrithione sodium salt,thione reagent,2-pyridinethiol-1-oxide sodium salt,2-mercaptopyridine n-oxide sodium salt,omadine sodium,sodium-2-pyridinethiol-1-oxide,sodium omadine van PubChem CID: 19658 IUPAC Name: sodium;1-oxidopyridine-2-thione SMILES: C1=CC(=S)N(C=C1)[O-].[Na+]
| PubChem CID | 19658 |
|---|---|
| CAS | 3811-73-2 |
| Molecular Weight (g/mol) | 149.143 |
| MDL Number | MFCD01941547 |
| SMILES | C1=CC(=S)N(C=C1)[O-].[Na+] |
| Synonym | sodium omadine,sodium pyrithione,sodium 2-pyridylthio-n-oxide,pyrithione sodium salt,thione reagent,2-pyridinethiol-1-oxide sodium salt,2-mercaptopyridine n-oxide sodium salt,omadine sodium,sodium-2-pyridinethiol-1-oxide,sodium omadine van |
| IUPAC Name | sodium;1-oxidopyridine-2-thione |
| InChI Key | XNRNJIIJLOFJEK-UHFFFAOYSA-N |
| Molecular Formula | C5H4NNaOS |
N-[2-(N-Vinylbenzylamino)ethyl]-3-aminopropyltrimethoxysilane Hydrochloride (30-40% in Methanol), TCI America™
CAS: 34937-00-3 Molecular Formula: C17H30N2O3Si MDL Number: MFCD00060149 Synonym: Trimethoxy-N-[2-(N-vinylbenzylamino)ethyl]aminopropylsilane Hydrochloride
| CAS | 34937-00-3 |
|---|---|
| MDL Number | MFCD00060149 |
| Synonym | Trimethoxy-N-[2-(N-vinylbenzylamino)ethyl]aminopropylsilane Hydrochloride |
| Molecular Formula | C17H30N2O3Si |
2-Methyl-1,3-dithiolane, 99%
CAS: 5616-51-3 Molecular Formula: C4H8S2 Molecular Weight (g/mol): 120.23 MDL Number: MFCD01729666 InChI Key: CARJCVDELAMAEJ-UHFFFAOYSA-N Synonym: 1,3-dithiolane, 2-methyl,2-methyl-1,3-dithiacyclopentane,unii-4o81r0spr0,1,3-dithiolane,2-methyl,fema no. 3705,acmc-20anre,acetaldehdye ethylene thioacetal PubChem CID: 21828 IUPAC Name: 2-methyl-1,3-dithiolane SMILES: CC1SCCS1
| PubChem CID | 21828 |
|---|---|
| CAS | 5616-51-3 |
| Molecular Weight (g/mol) | 120.23 |
| MDL Number | MFCD01729666 |
| SMILES | CC1SCCS1 |
| Synonym | 1,3-dithiolane, 2-methyl,2-methyl-1,3-dithiacyclopentane,unii-4o81r0spr0,1,3-dithiolane,2-methyl,fema no. 3705,acmc-20anre,acetaldehdye ethylene thioacetal |
| IUPAC Name | 2-methyl-1,3-dithiolane |
| InChI Key | CARJCVDELAMAEJ-UHFFFAOYSA-N |
| Molecular Formula | C4H8S2 |
4-tert-Butylphenylacetylene, 90+%
CAS: 772-38-3 Molecular Formula: C12H14 Molecular Weight (g/mol): 158.244 MDL Number: MFCD00190197 InChI Key: ZSYQVVKVKBVHIL-UHFFFAOYSA-N Synonym: 1-tert-butyl-4-ethynylbenzene,4-tert-butyl phenylacetylene,4-tert-butylphenylacetylene,benzene, 1-1,1-dimethylethyl-4-ethynyl,acmc-20amtx,4-t-butylphenylacetylene,4-tert-butylphenyl ethyne,4-tert.butylphenylacetylen,4-tert-butyl phenylethyne,4-tert-butylphenyl acetylene PubChem CID: 2757302 IUPAC Name: 1-tert-butyl-4-ethynylbenzene SMILES: CC(C)(C)C1=CC=C(C=C1)C#C
| PubChem CID | 2757302 |
|---|---|
| CAS | 772-38-3 |
| Molecular Weight (g/mol) | 158.244 |
| MDL Number | MFCD00190197 |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C#C |
| Synonym | 1-tert-butyl-4-ethynylbenzene,4-tert-butyl phenylacetylene,4-tert-butylphenylacetylene,benzene, 1-1,1-dimethylethyl-4-ethynyl,acmc-20amtx,4-t-butylphenylacetylene,4-tert-butylphenyl ethyne,4-tert.butylphenylacetylen,4-tert-butyl phenylethyne,4-tert-butylphenyl acetylene |
| IUPAC Name | 1-tert-butyl-4-ethynylbenzene |
| InChI Key | ZSYQVVKVKBVHIL-UHFFFAOYSA-N |
| Molecular Formula | C12H14 |
Tri-O-acetyl-D-galactal 95.0+%, TCI America™
CAS: 4098-06-0 Molecular Formula: C12H16O7 Molecular Weight (g/mol): 272.25 MDL Number: MFCD00064092 InChI Key: LLPWGHLVUPBSLP-UHFFFAOYNA-N Synonym: 3,4,6-tri-o-acetyl-d-galactal,tri-o-acetyl-d-galactal,2r,3r,4r-2-acetoxymethyl-3,4-dihydro-2h-pyran-3,4-diyl diacetate,d-arabino-hex-5-enitol, 2,6-anhydro-5-deoxy-, triacetate,1,3,4-tri-o-acetyl-2,6-anhydro-5-deoxyhex-5-enitol,d-galactal triacetate,2,6-anhydro-5-deoxy-d-arabino-hex-5-enitol triacetate,2r,3r,4r-3,4-bis acetyloxy-3,4-dihydro-2h-pyran-2-yl methyl acetate,galactal triacetate,tri-o-acetylgalactal PubChem CID: 640125 IUPAC Name: [3,4-bis(acetyloxy)-3,4-dihydro-2H-pyran-2-yl]methyl acetate SMILES: CC(=O)OCC1OC=CC(OC(C)=O)C1OC(C)=O
| PubChem CID | 640125 |
|---|---|
| CAS | 4098-06-0 |
| Molecular Weight (g/mol) | 272.25 |
| MDL Number | MFCD00064092 |
| SMILES | CC(=O)OCC1OC=CC(OC(C)=O)C1OC(C)=O |
| Synonym | 3,4,6-tri-o-acetyl-d-galactal,tri-o-acetyl-d-galactal,2r,3r,4r-2-acetoxymethyl-3,4-dihydro-2h-pyran-3,4-diyl diacetate,d-arabino-hex-5-enitol, 2,6-anhydro-5-deoxy-, triacetate,1,3,4-tri-o-acetyl-2,6-anhydro-5-deoxyhex-5-enitol,d-galactal triacetate,2,6-anhydro-5-deoxy-d-arabino-hex-5-enitol triacetate,2r,3r,4r-3,4-bis acetyloxy-3,4-dihydro-2h-pyran-2-yl methyl acetate,galactal triacetate,tri-o-acetylgalactal |
| IUPAC Name | [3,4-bis(acetyloxy)-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
| InChI Key | LLPWGHLVUPBSLP-UHFFFAOYNA-N |
| Molecular Formula | C12H16O7 |
2-Fluorobenzenesulfonamide 98.0+%, TCI America™
CAS: 30058-40-3 Molecular Formula: C6H6FNO2S Molecular Weight (g/mol): 175.18 MDL Number: MFCD00042283 InChI Key: WFLBWYLZCQOPCA-UHFFFAOYSA-N Synonym: 2-fluorobenzene-1-sulfonamide,benzenesulfonamide, 2-fluoro,2-fbsa,2weg,pubchem11761,acmc-209hcr,2-fluorophenylsulfonamide,2-sulfamoyl fluorobenzene,2-fluorobenzenesulphonamide,2-flourobenzene sulfonamide PubChem CID: 193663 IUPAC Name: 2-fluorobenzene-1-sulfonamide SMILES: NS(=O)(=O)C1=CC=CC=C1F
| PubChem CID | 193663 |
|---|---|
| CAS | 30058-40-3 |
| Molecular Weight (g/mol) | 175.18 |
| MDL Number | MFCD00042283 |
| SMILES | NS(=O)(=O)C1=CC=CC=C1F |
| Synonym | 2-fluorobenzene-1-sulfonamide,benzenesulfonamide, 2-fluoro,2-fbsa,2weg,pubchem11761,acmc-209hcr,2-fluorophenylsulfonamide,2-sulfamoyl fluorobenzene,2-fluorobenzenesulphonamide,2-flourobenzene sulfonamide |
| IUPAC Name | 2-fluorobenzene-1-sulfonamide |
| InChI Key | WFLBWYLZCQOPCA-UHFFFAOYSA-N |
| Molecular Formula | C6H6FNO2S |
Pentafluoroanisole 98.0+%, TCI America™
CAS: 389-40-2 Molecular Formula: C7H3F5O Molecular Weight (g/mol): 198.092 MDL Number: MFCD00000289 InChI Key: ZRQUIRABLIQJRI-UHFFFAOYSA-N Synonym: 2,3,4,5,6-pentafluoroanisole,pentafluoroanisole,benzene, pentafluoromethoxy,pentafluorophenyl methyl ether,pentafluoromethoxybenzene,methyl pentafluorophenyl ether,benzene, 1,2,3,4,5-pentafluoro-6-methoxy,anisole, 2,3,4,5,6-pentafluoro,1,2,3,4,6-pentafluoro-5-methoxybenzene,methoxypentafluorobenzene PubChem CID: 67849 IUPAC Name: 1,2,3,4,5-pentafluoro-6-methoxybenzene SMILES: COC1=C(C(=C(C(=C1F)F)F)F)F
| PubChem CID | 67849 |
|---|---|
| CAS | 389-40-2 |
| Molecular Weight (g/mol) | 198.092 |
| MDL Number | MFCD00000289 |
| SMILES | COC1=C(C(=C(C(=C1F)F)F)F)F |
| Synonym | 2,3,4,5,6-pentafluoroanisole,pentafluoroanisole,benzene, pentafluoromethoxy,pentafluorophenyl methyl ether,pentafluoromethoxybenzene,methyl pentafluorophenyl ether,benzene, 1,2,3,4,5-pentafluoro-6-methoxy,anisole, 2,3,4,5,6-pentafluoro,1,2,3,4,6-pentafluoro-5-methoxybenzene,methoxypentafluorobenzene |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-methoxybenzene |
| InChI Key | ZRQUIRABLIQJRI-UHFFFAOYSA-N |
| Molecular Formula | C7H3F5O |
Bromopentamethylbenzene 97.0+%, TCI America™
CAS: 5153-40-2 Molecular Formula: C11H15Br Molecular Weight (g/mol): 227.15 MDL Number: MFCD00013523 InChI Key: XPDQRULPGCFCLX-UHFFFAOYSA-N Synonym: bromopentamethylbenzene,benzene, bromopentamethyl,pentamethylbromobenzene,1-bromopentamethylbenzene,1-bromo-2,3,4,5,6-pentamethyl-benzene,brompentamethylbenzol,maybridge1_002545,ksc273s6f,acmc-1b227,5-bromo-1,2,3,4,6-pentamethylbenzene PubChem CID: 78831 IUPAC Name: 1-bromo-2,3,4,5,6-pentamethylbenzene SMILES: CC1=C(C)C(C)=C(Br)C(C)=C1C
| PubChem CID | 78831 |
|---|---|
| CAS | 5153-40-2 |
| Molecular Weight (g/mol) | 227.15 |
| MDL Number | MFCD00013523 |
| SMILES | CC1=C(C)C(C)=C(Br)C(C)=C1C |
| Synonym | bromopentamethylbenzene,benzene, bromopentamethyl,pentamethylbromobenzene,1-bromopentamethylbenzene,1-bromo-2,3,4,5,6-pentamethyl-benzene,brompentamethylbenzol,maybridge1_002545,ksc273s6f,acmc-1b227,5-bromo-1,2,3,4,6-pentamethylbenzene |
| IUPAC Name | 1-bromo-2,3,4,5,6-pentamethylbenzene |
| InChI Key | XPDQRULPGCFCLX-UHFFFAOYSA-N |
| Molecular Formula | C11H15Br |
2,5-Furandicarboxylic Acid 98.0+%, TCI America™
CAS: 3238-40-2 Molecular Formula: C6H4O5 Molecular Weight (g/mol): 156.09 MDL Number: MFCD00016582 InChI Key: CHTHALBTIRVDBM-UHFFFAOYSA-N Synonym: 2,5-furandicarboxylic acid,dehydromucic acid,furan-2,5-dicarbonsaeure,2,5-furandicarboxylicacid,2,5-furandicarboxylate,furane-alpha,alpha'-dicarboxylic acid,furan 2,5-dicarboxylic acid,furan-2,5-dicarboxylate,furane-.alpha.,.alpha.'-dicarboxylic acid,2,5 furan dicarboxylic acid PubChem CID: 76720 ChEBI: CHEBI:84212 IUPAC Name: furan-2,5-dicarboxylic acid SMILES: OC(=O)C1=CC=C(O1)C(O)=O
| PubChem CID | 76720 |
|---|---|
| CAS | 3238-40-2 |
| Molecular Weight (g/mol) | 156.09 |
| ChEBI | CHEBI:84212 |
| MDL Number | MFCD00016582 |
| SMILES | OC(=O)C1=CC=C(O1)C(O)=O |
| Synonym | 2,5-furandicarboxylic acid,dehydromucic acid,furan-2,5-dicarbonsaeure,2,5-furandicarboxylicacid,2,5-furandicarboxylate,furane-alpha,alpha'-dicarboxylic acid,furan 2,5-dicarboxylic acid,furan-2,5-dicarboxylate,furane-.alpha.,.alpha.'-dicarboxylic acid,2,5 furan dicarboxylic acid |
| IUPAC Name | furan-2,5-dicarboxylic acid |
| InChI Key | CHTHALBTIRVDBM-UHFFFAOYSA-N |
| Molecular Formula | C6H4O5 |
2,4,4-Trimethyl-2-pentene 97.0+%, TCI America™
CAS: 107-40-4 Molecular Formula: C8H16 Molecular Weight (g/mol): 112.216 MDL Number: MFCD00008902 InChI Key: LAAVYEUJEMRIGF-UHFFFAOYSA-N Synonym: 2,4,4-trimethyl-2-pentene,2-pentene, 2,4,4-trimethyl,2,2,4-trimethyl-3-pentene,2,4,4-trimethylpentene-2,unii-548r0du21i,beta-diisobutylene,propene, 1-tert-butyl-2-methyl,acmc-1cujo,dsstox_cid_6766,dsstox_rid_78208 PubChem CID: 7869 IUPAC Name: 2,4,4-trimethylpent-2-ene SMILES: CC(=CC(C)(C)C)C
| PubChem CID | 7869 |
|---|---|
| CAS | 107-40-4 |
| Molecular Weight (g/mol) | 112.216 |
| MDL Number | MFCD00008902 |
| SMILES | CC(=CC(C)(C)C)C |
| Synonym | 2,4,4-trimethyl-2-pentene,2-pentene, 2,4,4-trimethyl,2,2,4-trimethyl-3-pentene,2,4,4-trimethylpentene-2,unii-548r0du21i,beta-diisobutylene,propene, 1-tert-butyl-2-methyl,acmc-1cujo,dsstox_cid_6766,dsstox_rid_78208 |
| IUPAC Name | 2,4,4-trimethylpent-2-ene |
| InChI Key | LAAVYEUJEMRIGF-UHFFFAOYSA-N |
| Molecular Formula | C8H16 |
2,6-Dichloropurine 97.0+%, TCI America™
CAS: 5451-40-1 Molecular Formula: C5H2Cl2N4 Molecular Weight (g/mol): 189.00 MDL Number: MFCD00077725 InChI Key: RMFWVOLULURGJI-UHFFFAOYSA-N Synonym: 2,6-dichloropurine,2,6-dichloro-9h-purine,2,6-dichloro-1h-purine,9h-purine, 2,6-dichloro,2,6-dichloro purine,2,6 dichloropurine,2,6-dichioropurine,purine,6-dichloro,zlchem 226,2,6-dichloro-purine PubChem CID: 5324412 IUPAC Name: 2,6-dichloro-7H-purine SMILES: ClC1=NC(Cl)=C2NC=NC2=N1
| PubChem CID | 5324412 |
|---|---|
| CAS | 5451-40-1 |
| Molecular Weight (g/mol) | 189.00 |
| MDL Number | MFCD00077725 |
| SMILES | ClC1=NC(Cl)=C2NC=NC2=N1 |
| Synonym | 2,6-dichloropurine,2,6-dichloro-9h-purine,2,6-dichloro-1h-purine,9h-purine, 2,6-dichloro,2,6-dichloro purine,2,6 dichloropurine,2,6-dichioropurine,purine,6-dichloro,zlchem 226,2,6-dichloro-purine |
| IUPAC Name | 2,6-dichloro-7H-purine |
| InChI Key | RMFWVOLULURGJI-UHFFFAOYSA-N |
| Molecular Formula | C5H2Cl2N4 |
2,3-Dimethylnaphthalene 98.0+%, TCI America™
CAS: 581-40-8 Molecular Formula: C12H12 Molecular Weight (g/mol): 156.228 MDL Number: MFCD00004119 InChI Key: WWGUMAYGTYQSGA-UHFFFAOYSA-N Synonym: guajen,naphthalene, 2,3-dimethyl,unii-35dj6se17o,2,3-dmn,2,3-dimethyl naphthalene,acmc-1ao3c,2,3-dimethylnaphthalene,naphthalene, 2,3-dimethyl-8ci 9ci PubChem CID: 11386 ChEBI: CHEBI:48615 IUPAC Name: 2,3-dimethylnaphthalene SMILES: CC1=CC2=CC=CC=C2C=C1C
| PubChem CID | 11386 |
|---|---|
| CAS | 581-40-8 |
| Molecular Weight (g/mol) | 156.228 |
| ChEBI | CHEBI:48615 |
| MDL Number | MFCD00004119 |
| SMILES | CC1=CC2=CC=CC=C2C=C1C |
| Synonym | guajen,naphthalene, 2,3-dimethyl,unii-35dj6se17o,2,3-dmn,2,3-dimethyl naphthalene,acmc-1ao3c,2,3-dimethylnaphthalene,naphthalene, 2,3-dimethyl-8ci 9ci |
| IUPAC Name | 2,3-dimethylnaphthalene |
| InChI Key | WWGUMAYGTYQSGA-UHFFFAOYSA-N |
| Molecular Formula | C12H12 |