Organometallic Compounds
Filtered Search Results
Di-n-butylgermanium dichloride, 97%
CAS: 4593-81-1 Molecular Formula: C8H18Cl2Ge Molecular Weight (g/mol): 257.762 MDL Number: MFCD00013590 InChI Key: VKMPTHGEGBKPBQ-UHFFFAOYSA-N Synonym: di-n-butylgermanium dichloride,dibutylgermanium dichloride,dichlorodibutylgermane,germane, dibutyldichloro,di-n-butylgermanedichloride,di-n-butyldichlorogermane,dibutyl dichloro germane,wln: g-ge-g4&4 PubChem CID: 20723 IUPAC Name: dibutyl(dichloro)germane SMILES: CCCC[Ge](CCCC)(Cl)Cl
| PubChem CID | 20723 |
|---|---|
| CAS | 4593-81-1 |
| Molecular Weight (g/mol) | 257.762 |
| MDL Number | MFCD00013590 |
| SMILES | CCCC[Ge](CCCC)(Cl)Cl |
| Synonym | di-n-butylgermanium dichloride,dibutylgermanium dichloride,dichlorodibutylgermane,germane, dibutyldichloro,di-n-butylgermanedichloride,di-n-butyldichlorogermane,dibutyl dichloro germane,wln: g-ge-g4&4 |
| IUPAC Name | dibutyl(dichloro)germane |
| InChI Key | VKMPTHGEGBKPBQ-UHFFFAOYSA-N |
| Molecular Formula | C8H18Cl2Ge |
Germanium(IV) ethoxide, 99.995% (metals basis)
CAS: 14165-55-0 Molecular Formula: C8H20GeO4 MDL Number: MFCD00015121 Synonym: Germanium tetraethoxide; Tetraethoxygermane
| CAS | 14165-55-0 |
|---|---|
| MDL Number | MFCD00015121 |
| Synonym | Germanium tetraethoxide; Tetraethoxygermane |
| Molecular Formula | C8H20GeO4 |
1,2-Bis(trichlorosilyl)ethane 97.0+%, TCI America™
CAS: 2504-64-5 Molecular Formula: C2H4Cl6Si2 Molecular Weight (g/mol): 296.924 MDL Number: MFCD00013601 InChI Key: WDVUXWDZTPZIIE-UHFFFAOYSA-N PubChem CID: 75631 IUPAC Name: trichloro(2-trichlorosilylethyl)silane SMILES: C(C[Si](Cl)(Cl)Cl)[Si](Cl)(Cl)Cl
| PubChem CID | 75631 |
|---|---|
| CAS | 2504-64-5 |
| Molecular Weight (g/mol) | 296.924 |
| MDL Number | MFCD00013601 |
| SMILES | C(C[Si](Cl)(Cl)Cl)[Si](Cl)(Cl)Cl |
| IUPAC Name | trichloro(2-trichlorosilylethyl)silane |
| InChI Key | WDVUXWDZTPZIIE-UHFFFAOYSA-N |
| Molecular Formula | C2H4Cl6Si2 |
Chlorotriethylsilane 97.0+%, TCI America™
CAS: 994-30-9 Molecular Formula: C6H15ClSi Molecular Weight (g/mol): 150.72 MDL Number: MFCD00000507 InChI Key: DCFKHNIGBAHNSS-UHFFFAOYSA-N Synonym: triethylchlorosilane,silane, chlorotriethyl,triethylsilyl chloride,chloro triethyl silane,unii-q1a687m1py,triethyl silyl chloride,triethychlorosilane,chlorotrietylsilane,clsiet3,et3sicl PubChem CID: 13819 IUPAC Name: chlorotriethylsilane SMILES: CC[Si](Cl)(CC)CC
| PubChem CID | 13819 |
|---|---|
| CAS | 994-30-9 |
| Molecular Weight (g/mol) | 150.72 |
| MDL Number | MFCD00000507 |
| SMILES | CC[Si](Cl)(CC)CC |
| Synonym | triethylchlorosilane,silane, chlorotriethyl,triethylsilyl chloride,chloro triethyl silane,unii-q1a687m1py,triethyl silyl chloride,triethychlorosilane,chlorotrietylsilane,clsiet3,et3sicl |
| IUPAC Name | chlorotriethylsilane |
| InChI Key | DCFKHNIGBAHNSS-UHFFFAOYSA-N |
| Molecular Formula | C6H15ClSi |
Vinyltrimethoxysilane 98.0+%, TCI America™
CAS: 2-7-2768 Molecular Formula: C5H12O3Si Molecular Weight (g/mol): 148.23 MDL Number: MFCD00008605 InChI Key: NKSJNEHGWDZZQF-UHFFFAOYSA-N Synonym: vinyltrimethoxysilane,trimethoxyvinylsilane,silane, ethenyltrimethoxy,trimethoxy vinyl silane,trimethoxysilyl ethene,vinyl trimethoxy silane,silane, trimethoxyvinyl,trimethoxysilyl ethylene,vtmo,vts-m PubChem CID: 76004 IUPAC Name: ethenyl(trimethoxy)silane SMILES: CO[Si](C=C)(OC)OC
| PubChem CID | 76004 |
|---|---|
| CAS | 2-7-2768 |
| Molecular Weight (g/mol) | 148.23 |
| MDL Number | MFCD00008605 |
| SMILES | CO[Si](C=C)(OC)OC |
| Synonym | vinyltrimethoxysilane,trimethoxyvinylsilane,silane, ethenyltrimethoxy,trimethoxy vinyl silane,trimethoxysilyl ethene,vinyl trimethoxy silane,silane, trimethoxyvinyl,trimethoxysilyl ethylene,vtmo,vts-m |
| IUPAC Name | ethenyl(trimethoxy)silane |
| InChI Key | NKSJNEHGWDZZQF-UHFFFAOYSA-N |
| Molecular Formula | C5H12O3Si |
3-(Trimethoxysilyl)propyl Methacrylate (stabilized with BHT) 98.0+%, TCI America™
CAS: 2530-85-0 Molecular Formula: C10H20O5Si Molecular Weight (g/mol): 248.35 MDL Number: MFCD00008593 InChI Key: XDLMVUHYZWKMMD-UHFFFAOYSA-N Synonym: 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester PubChem CID: 17318 IUPAC Name: 3-trimethoxysilylpropyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCCC[Si](OC)(OC)OC
| PubChem CID | 17318 |
|---|---|
| CAS | 2530-85-0 |
| Molecular Weight (g/mol) | 248.35 |
| MDL Number | MFCD00008593 |
| SMILES | CC(=C)C(=O)OCCC[Si](OC)(OC)OC |
| Synonym | 3-trimethoxysilyl propyl methacrylate,3-methacryloxypropyltrimethoxysilane,methacryloxypropyltrimethoxysilane,dynasylan memo,silicone a-174,union carbide a-174,mops-m,silane a-174,nuca 174,2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester |
| IUPAC Name | 3-trimethoxysilylpropyl 2-methylprop-2-enoate |
| InChI Key | XDLMVUHYZWKMMD-UHFFFAOYSA-N |
| Molecular Formula | C10H20O5Si |
Trimethylsilyl Methacrylate (stabilized with BHT) 98.0+%, TCI America™
CAS: 13688-56-7 Molecular Formula: C7H14O2Si Molecular Weight (g/mol): 158.272 MDL Number: MFCD00053868 InChI Key: PGQNYIRJCLTTOJ-UHFFFAOYSA-N Synonym: trimethylsilyl methacrylate,2-propenoic acid, 2-methyl-, trimethylsilyl ester,methacryloxytrimethylsilane,trimethylsilyl 2-methylpropenoate,methacrylic acid trimethylsilyl ester,acmc-20ajd2,trimethylsilylmethacrylate,methacrylic acid, tms derivative PubChem CID: 2733839 IUPAC Name: trimethylsilyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)O[Si](C)(C)C
| PubChem CID | 2733839 |
|---|---|
| CAS | 13688-56-7 |
| Molecular Weight (g/mol) | 158.272 |
| MDL Number | MFCD00053868 |
| SMILES | CC(=C)C(=O)O[Si](C)(C)C |
| Synonym | trimethylsilyl methacrylate,2-propenoic acid, 2-methyl-, trimethylsilyl ester,methacryloxytrimethylsilane,trimethylsilyl 2-methylpropenoate,methacrylic acid trimethylsilyl ester,acmc-20ajd2,trimethylsilylmethacrylate,methacrylic acid, tms derivative |
| IUPAC Name | trimethylsilyl 2-methylprop-2-enoate |
| InChI Key | PGQNYIRJCLTTOJ-UHFFFAOYSA-N |
| Molecular Formula | C7H14O2Si |
Trimethoxyphenylsilane 98.0+%, TCI America™
CAS: 2996-92-1 Molecular Formula: C9H14O3Si Molecular Weight (g/mol): 198.29 MDL Number: MFCD00025689 InChI Key: ZNOCGWVLWPVKAO-UHFFFAOYSA-N Synonym: phenyltrimethoxysilane,trimethoxy phenyl silane,silane, trimethoxyphenyl,silane, phenyltrimethoxy,unii-21tqe746s9,trimethoxysilyl benzene,benzene, trimethoxysilyl,phenyl trimethoxysilane,phenyl trimethoxy silane,phenyltri methoxy silane PubChem CID: 18137 IUPAC Name: trimethoxy(phenyl)silane SMILES: CO[Si](OC)(OC)C1=CC=CC=C1
| PubChem CID | 18137 |
|---|---|
| CAS | 2996-92-1 |
| Molecular Weight (g/mol) | 198.29 |
| MDL Number | MFCD00025689 |
| SMILES | CO[Si](OC)(OC)C1=CC=CC=C1 |
| Synonym | phenyltrimethoxysilane,trimethoxy phenyl silane,silane, trimethoxyphenyl,silane, phenyltrimethoxy,unii-21tqe746s9,trimethoxysilyl benzene,benzene, trimethoxysilyl,phenyl trimethoxysilane,phenyl trimethoxy silane,phenyltri methoxy silane |
| IUPAC Name | trimethoxy(phenyl)silane |
| InChI Key | ZNOCGWVLWPVKAO-UHFFFAOYSA-N |
| Molecular Formula | C9H14O3Si |
Decyltrimethoxysilane 97.0+%, TCI America™
CAS: 5575-48-4 Molecular Formula: C13H30O3Si Molecular Weight (g/mol): 262.47 MDL Number: MFCD00069135 InChI Key: KQAHMVLQCSALSX-UHFFFAOYSA-N Synonym: n-decyltrimethoxysilane,decyltrimethoxysilan,trimethoxydecylsilane,decyl trimethoxy silane,silane,decyltrimethoxy,decyl-trimethoxysilane PubChem CID: 2758023 IUPAC Name: decyltrimethoxysilane SMILES: CCCCCCCCCC[Si](OC)(OC)OC
| PubChem CID | 2758023 |
|---|---|
| CAS | 5575-48-4 |
| Molecular Weight (g/mol) | 262.47 |
| MDL Number | MFCD00069135 |
| SMILES | CCCCCCCCCC[Si](OC)(OC)OC |
| Synonym | n-decyltrimethoxysilane,decyltrimethoxysilan,trimethoxydecylsilane,decyl trimethoxy silane,silane,decyltrimethoxy,decyl-trimethoxysilane |
| IUPAC Name | decyltrimethoxysilane |
| InChI Key | KQAHMVLQCSALSX-UHFFFAOYSA-N |
| Molecular Formula | C13H30O3Si |
Diacetoxydimethylsilane 97.0+%, TCI America™
CAS: 2182-66-3 Molecular Formula: C6H12O4Si Molecular Weight (g/mol): 176.243 MDL Number: MFCD00039832 InChI Key: RQVFGTYFBUVGOP-UHFFFAOYSA-N Synonym: dimethyldiacetoxysilane,diacetoxydimethylsilane,dimethylsilanediyl diacetate,silanediol, dimethyl-, diacetate,dimethylsilanediol, diacetate,silanediol, 1,1-dimethyl-, 1,1-diacetate,acetyloxy dimethylsilyl acetate,dimethyldiacetoxysilicane,dimethyl-silanediodiacetate,acmc-1ak12 PubChem CID: 75130 IUPAC Name: [acetyloxy(dimethyl)silyl] acetate SMILES: CC(=O)O[Si](C)(C)OC(=O)C
| PubChem CID | 75130 |
|---|---|
| CAS | 2182-66-3 |
| Molecular Weight (g/mol) | 176.243 |
| MDL Number | MFCD00039832 |
| SMILES | CC(=O)O[Si](C)(C)OC(=O)C |
| Synonym | dimethyldiacetoxysilane,diacetoxydimethylsilane,dimethylsilanediyl diacetate,silanediol, dimethyl-, diacetate,dimethylsilanediol, diacetate,silanediol, 1,1-dimethyl-, 1,1-diacetate,acetyloxy dimethylsilyl acetate,dimethyldiacetoxysilicane,dimethyl-silanediodiacetate,acmc-1ak12 |
| IUPAC Name | [acetyloxy(dimethyl)silyl] acetate |
| InChI Key | RQVFGTYFBUVGOP-UHFFFAOYSA-N |
| Molecular Formula | C6H12O4Si |
Hexamethyldisiloxane 98.0+%, TCI America™
CAS: 107-46-0 Molecular Formula: C6H18OSi2 Molecular Weight (g/mol): 162.379 MDL Number: MFCD00008265 InChI Key: UQEAIHBTYFGYIE-UHFFFAOYSA-N Synonym: hexamethyldisiloxane,disiloxane, hexamethyl,hexamethyl disiloxane,oxybis trimethylsilane,fluka ag,hmdso,bis trimethylsilyl ether,belsil dm 0.65,bis trimethylsilyl oxide PubChem CID: 24764 ChEBI: CHEBI:78002 IUPAC Name: trimethyl(trimethylsilyloxy)silane SMILES: C[Si](C)(C)O[Si](C)(C)C
| PubChem CID | 24764 |
|---|---|
| CAS | 107-46-0 |
| Molecular Weight (g/mol) | 162.379 |
| ChEBI | CHEBI:78002 |
| MDL Number | MFCD00008265 |
| SMILES | C[Si](C)(C)O[Si](C)(C)C |
| Synonym | hexamethyldisiloxane,disiloxane, hexamethyl,hexamethyl disiloxane,oxybis trimethylsilane,fluka ag,hmdso,bis trimethylsilyl ether,belsil dm 0.65,bis trimethylsilyl oxide |
| IUPAC Name | trimethyl(trimethylsilyloxy)silane |
| InChI Key | UQEAIHBTYFGYIE-UHFFFAOYSA-N |
| Molecular Formula | C6H18OSi2 |
Trichlorovinylsilane 98.0+%, TCI America™
CAS: 75-94-5 Molecular Formula: C2H3Cl3Si Molecular Weight (g/mol): 161.481 MDL Number: MFCD00000482 InChI Key: GQIUQDDJKHLHTB-UHFFFAOYSA-N Synonym: trichlorovinylsilane,vinyltrichlorosilane,trichloro vinyl silane,vtcs,silane, trichloroethenyl,silane, trichlorovinyl,trichlorovinylsilicon,vinyl trichlorosilane,trichlorovinyl silicane,vinylsilicon trichloride PubChem CID: 6413 IUPAC Name: trichloro(ethenyl)silane SMILES: C=C[Si](Cl)(Cl)Cl
| PubChem CID | 6413 |
|---|---|
| CAS | 75-94-5 |
| Molecular Weight (g/mol) | 161.481 |
| MDL Number | MFCD00000482 |
| SMILES | C=C[Si](Cl)(Cl)Cl |
| Synonym | trichlorovinylsilane,vinyltrichlorosilane,trichloro vinyl silane,vtcs,silane, trichloroethenyl,silane, trichlorovinyl,trichlorovinylsilicon,vinyl trichlorosilane,trichlorovinyl silicane,vinylsilicon trichloride |
| IUPAC Name | trichloro(ethenyl)silane |
| InChI Key | GQIUQDDJKHLHTB-UHFFFAOYSA-N |
| Molecular Formula | C2H3Cl3Si |
Phenyltrichlorosilane 98.0+%, TCI America™
CAS: 98-13-5 Molecular Formula: C6H5Cl3Si Molecular Weight (g/mol): 211.541 MDL Number: MFCD00000479 InChI Key: ORVMIVQULIKXCP-UHFFFAOYSA-N Synonym: trichloro phenyl silane,phenyltrichlorosilane,silane, trichlorophenyl,phenyl trichlorosilane,phenylsilicon trichloride,silane, phenyltrichloro,silicon phenyl trichloride,benzene, trichlorosilyl,unii-m7199jl06m,phenyl-trichloro-silane PubChem CID: 7372 IUPAC Name: trichloro(phenyl)silane SMILES: C1=CC=C(C=C1)[Si](Cl)(Cl)Cl
| PubChem CID | 7372 |
|---|---|
| CAS | 98-13-5 |
| Molecular Weight (g/mol) | 211.541 |
| MDL Number | MFCD00000479 |
| SMILES | C1=CC=C(C=C1)[Si](Cl)(Cl)Cl |
| Synonym | trichloro phenyl silane,phenyltrichlorosilane,silane, trichlorophenyl,phenyl trichlorosilane,phenylsilicon trichloride,silane, phenyltrichloro,silicon phenyl trichloride,benzene, trichlorosilyl,unii-m7199jl06m,phenyl-trichloro-silane |
| IUPAC Name | trichloro(phenyl)silane |
| InChI Key | ORVMIVQULIKXCP-UHFFFAOYSA-N |
| Molecular Formula | C6H5Cl3Si |
tert-Butyldiphenylchlorosilane 97.0+%, TCI America™
CAS: 58479-61-1 Molecular Formula: C16H19ClSi Molecular Weight (g/mol): 274.863 MDL Number: MFCD00000497 InChI Key: MHYGQXWCZAYSLJ-UHFFFAOYSA-N Synonym: tert-butylchlorodiphenylsilane,tert-butyldiphenylchlorosilane,t-butyldiphenylchlorosilane,silane, chloro 1,1-dimethylethyl diphenyl,tert-butyl chloro diphenylsilane,t-butylchlorodiphenylsilane,tbdpscl,t-butyldiphenylsilyl chloride,tert-butyldiphenyl chlorosilane,unii-3beu48ui4e PubChem CID: 94078 IUPAC Name: tert-butyl-chloro-diphenylsilane SMILES: CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)Cl
| PubChem CID | 94078 |
|---|---|
| CAS | 58479-61-1 |
| Molecular Weight (g/mol) | 274.863 |
| MDL Number | MFCD00000497 |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)Cl |
| Synonym | tert-butylchlorodiphenylsilane,tert-butyldiphenylchlorosilane,t-butyldiphenylchlorosilane,silane, chloro 1,1-dimethylethyl diphenyl,tert-butyl chloro diphenylsilane,t-butylchlorodiphenylsilane,tbdpscl,t-butyldiphenylsilyl chloride,tert-butyldiphenyl chlorosilane,unii-3beu48ui4e |
| IUPAC Name | tert-butyl-chloro-diphenylsilane |
| InChI Key | MHYGQXWCZAYSLJ-UHFFFAOYSA-N |
| Molecular Formula | C16H19ClSi |
Trimethylsilyl Methacrylate (stabilized with N-Nitrosodiisopropanolamine) 98.0+%, TCI America™
CAS: 13688-56-7 Molecular Formula: C7H14O2Si Molecular Weight (g/mol): 158.272 MDL Number: MFCD00053868 InChI Key: PGQNYIRJCLTTOJ-UHFFFAOYSA-N Synonym: trimethylsilyl methacrylate,2-propenoic acid, 2-methyl-, trimethylsilyl ester,methacryloxytrimethylsilane,trimethylsilyl 2-methylpropenoate,methacrylic acid trimethylsilyl ester,acmc-20ajd2,trimethylsilylmethacrylate,methacrylic acid, tms derivative PubChem CID: 2733839 IUPAC Name: trimethylsilyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)O[Si](C)(C)C
| PubChem CID | 2733839 |
|---|---|
| CAS | 13688-56-7 |
| Molecular Weight (g/mol) | 158.272 |
| MDL Number | MFCD00053868 |
| SMILES | CC(=C)C(=O)O[Si](C)(C)C |
| Synonym | trimethylsilyl methacrylate,2-propenoic acid, 2-methyl-, trimethylsilyl ester,methacryloxytrimethylsilane,trimethylsilyl 2-methylpropenoate,methacrylic acid trimethylsilyl ester,acmc-20ajd2,trimethylsilylmethacrylate,methacrylic acid, tms derivative |
| IUPAC Name | trimethylsilyl 2-methylprop-2-enoate |
| InChI Key | PGQNYIRJCLTTOJ-UHFFFAOYSA-N |
| Molecular Formula | C7H14O2Si |