Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Vinyl(chloromethyl)dimethylsilane, 97%
CAS: 16709-86-7 Molecular Formula: C5H11ClSi Molecular Weight (g/mol): 134.678 MDL Number: MFCD00040860 InChI Key: SZZZMXFBEKWPBU-UHFFFAOYSA-N Synonym: chloromethyl dimethylvinylsilane,silane, chloromethyl ethenyldimethyl,vinyl chloromethyl dimethylsilane,chloromethyl ethenyldimethylsilane,ccris 2448,chloromethyldimethylvinylsilane,silane, chloromethyl dimethylvinyl,chloromethyldimethylvinyl silane,chloromethyl dimethyl vinyl silane,chloromethyl ethenyl dimethylsilane PubChem CID: 85556 IUPAC Name: chloromethyl-ethenyl-dimethylsilane SMILES: C[Si](C)(CCl)C=C
| PubChem CID | 85556 |
|---|---|
| CAS | 16709-86-7 |
| Molecular Weight (g/mol) | 134.678 |
| MDL Number | MFCD00040860 |
| SMILES | C[Si](C)(CCl)C=C |
| Synonym | chloromethyl dimethylvinylsilane,silane, chloromethyl ethenyldimethyl,vinyl chloromethyl dimethylsilane,chloromethyl ethenyldimethylsilane,ccris 2448,chloromethyldimethylvinylsilane,silane, chloromethyl dimethylvinyl,chloromethyldimethylvinyl silane,chloromethyl dimethyl vinyl silane,chloromethyl ethenyl dimethylsilane |
| IUPAC Name | chloromethyl-ethenyl-dimethylsilane |
| InChI Key | SZZZMXFBEKWPBU-UHFFFAOYSA-N |
| Molecular Formula | C5H11ClSi |
1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane, 97%
CAS: 69304-37-6 Molecular Formula: C12H28Cl2OSi2 Molecular Weight (g/mol): 315.425 MDL Number: MFCD00009655 InChI Key: DDYAZDRFUVZBMM-UHFFFAOYSA-N Synonym: 1,3-dichloro-1,1,3,3-tetraisopropyldisiloxane,1,3-dichlorotetraisopropyldisiloxane,1,1,3,3-tetraisopropyl-1,3-dichlorodisiloxane,1,3-dichloro-1,1,3,3-tetraisopropyl-disiloxane,disiloxane, 1,3-dichloro-1,1,3,3-tetrakis 1-methylethyl,1,1,3,3-tetraisopropyl-1,3-dichlorosiloxane,chloro chlorodiisopropylsilyl oxy diisopropylsilane,chloro-chloro-di propan-2-yl silyl oxy-di propan-2-yl silane,tipdsicl2,tipdsi-cl2 PubChem CID: 172404 IUPAC Name: chloro-[chloro-di(propan-2-yl)silyl]oxy-di(propan-2-yl)silane SMILES: CC(C)[Si](C(C)C)(O[Si](C(C)C)(C(C)C)Cl)Cl
| PubChem CID | 172404 |
|---|---|
| CAS | 69304-37-6 |
| Molecular Weight (g/mol) | 315.425 |
| MDL Number | MFCD00009655 |
| SMILES | CC(C)[Si](C(C)C)(O[Si](C(C)C)(C(C)C)Cl)Cl |
| Synonym | 1,3-dichloro-1,1,3,3-tetraisopropyldisiloxane,1,3-dichlorotetraisopropyldisiloxane,1,1,3,3-tetraisopropyl-1,3-dichlorodisiloxane,1,3-dichloro-1,1,3,3-tetraisopropyl-disiloxane,disiloxane, 1,3-dichloro-1,1,3,3-tetrakis 1-methylethyl,1,1,3,3-tetraisopropyl-1,3-dichlorosiloxane,chloro chlorodiisopropylsilyl oxy diisopropylsilane,chloro-chloro-di propan-2-yl silyl oxy-di propan-2-yl silane,tipdsicl2,tipdsi-cl2 |
| IUPAC Name | chloro-[chloro-di(propan-2-yl)silyl]oxy-di(propan-2-yl)silane |
| InChI Key | DDYAZDRFUVZBMM-UHFFFAOYSA-N |
| Molecular Formula | C12H28Cl2OSi2 |
Dimethylsilyldiethylamine, 95%
CAS: 13686-66-3 Molecular Formula: C6H16NSi Molecular Weight (g/mol): 130.29 MDL Number: MFCD00048523 InChI Key: ADTGAVILDBXARD-UHFFFAOYSA-N Synonym: dimethylsilyldiethylamine,n,n-diethyl-1,1-dimethylsilylamine,diethylamino dimethylsilyl,silanamine, n,n-diethyl-1,1-dimethyl,silanamine,n,n-diethyl-1,1-dimethyl,diethylamino dimethyl silicon,diethylaminodimethylsilane,n,n-diethyl-1,1-dimethylsilanamine PubChem CID: 6335300 IUPAC Name: (diethylamino)dimethylsilyl SMILES: CCN(CC)[Si](C)C
| PubChem CID | 6335300 |
|---|---|
| CAS | 13686-66-3 |
| Molecular Weight (g/mol) | 130.29 |
| MDL Number | MFCD00048523 |
| SMILES | CCN(CC)[Si](C)C |
| Synonym | dimethylsilyldiethylamine,n,n-diethyl-1,1-dimethylsilylamine,diethylamino dimethylsilyl,silanamine, n,n-diethyl-1,1-dimethyl,silanamine,n,n-diethyl-1,1-dimethyl,diethylamino dimethyl silicon,diethylaminodimethylsilane,n,n-diethyl-1,1-dimethylsilanamine |
| IUPAC Name | (diethylamino)dimethylsilyl |
| InChI Key | ADTGAVILDBXARD-UHFFFAOYSA-N |
| Molecular Formula | C6H16NSi |
Chlorodimethyl(pentafluorophenyl)silane, 96%
CAS: 20082-71-7 Molecular Formula: C8H6ClF5Si Molecular Weight (g/mol): 260.66 MDL Number: MFCD00000500 InChI Key: PQRFRTCWNCVQHI-UHFFFAOYSA-N Synonym: pentafluorophenyldimethylchlorosilane,flophemesyl chloride,chlorodimethylpentafluorophenylsilane,chlorodimethyl perfluorophenyl silane,silane, chlorodimethyl pentafluorophenyl,chlorodimethyl pentafluorophenyl silane,benzene, 1-chlorodimethylsilyl-2,3,4,5,6-pentafluoro,chlorodimethyl 2,3,4,5,6-pentafluorophenyl silane,chloro dimethyl pentafluorophenyl silane,dimethylpentafluorophenylchlorosilane PubChem CID: 88361 IUPAC Name: chloro-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane SMILES: C[Si](C)(Cl)C1=C(F)C(F)=C(F)C(F)=C1F
| PubChem CID | 88361 |
|---|---|
| CAS | 20082-71-7 |
| Molecular Weight (g/mol) | 260.66 |
| MDL Number | MFCD00000500 |
| SMILES | C[Si](C)(Cl)C1=C(F)C(F)=C(F)C(F)=C1F |
| Synonym | pentafluorophenyldimethylchlorosilane,flophemesyl chloride,chlorodimethylpentafluorophenylsilane,chlorodimethyl perfluorophenyl silane,silane, chlorodimethyl pentafluorophenyl,chlorodimethyl pentafluorophenyl silane,benzene, 1-chlorodimethylsilyl-2,3,4,5,6-pentafluoro,chlorodimethyl 2,3,4,5,6-pentafluorophenyl silane,chloro dimethyl pentafluorophenyl silane,dimethylpentafluorophenylchlorosilane |
| IUPAC Name | chloro-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane |
| InChI Key | PQRFRTCWNCVQHI-UHFFFAOYSA-N |
| Molecular Formula | C8H6ClF5Si |
Silicon(IV) oxide, powder, 1.5 micron, 99.9%
CAS: 7631-86-9 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC Name: dioxosilane SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 7631-86-9 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| IUPAC Name | dioxosilane |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
n-Octyltriethoxysilane, 95%
CAS: 2943-75-1 Molecular Formula: C14H32O3Si Molecular Weight (g/mol): 276.49 MDL Number: MFCD00039883 InChI Key: MSRJTTSHWYDFIU-UHFFFAOYSA-N Synonym: n-octyltriethoxysilane,octyltriethoxysilane,triethoxy octyl silane,silane, triethoxyoctyl,dynasylan octeo,octyl triethoxy silane,prosil 9202,silquest a 137,prosil 9234,a 137 coupling agent PubChem CID: 76262 IUPAC Name: triethoxy(octyl)silane SMILES: CCCCCCCC[Si](OCC)(OCC)OCC
| PubChem CID | 76262 |
|---|---|
| CAS | 2943-75-1 |
| Molecular Weight (g/mol) | 276.49 |
| MDL Number | MFCD00039883 |
| SMILES | CCCCCCCC[Si](OCC)(OCC)OCC |
| Synonym | n-octyltriethoxysilane,octyltriethoxysilane,triethoxy octyl silane,silane, triethoxyoctyl,dynasylan octeo,octyl triethoxy silane,prosil 9202,silquest a 137,prosil 9234,a 137 coupling agent |
| IUPAC Name | triethoxy(octyl)silane |
| InChI Key | MSRJTTSHWYDFIU-UHFFFAOYSA-N |
| Molecular Formula | C14H32O3Si |
Indium powder, -100 mesh, 99.99% (metals basis)
CAS: 7440-74-6 Molecular Formula: In Molecular Weight (g/mol): 114.82 MDL Number: MFCD00134048 InChI Key: APFVFJFRJDLVQX-UHFFFAOYSA-N Synonym: indium, elemental,unii-045a6v3vfx,powder,shot,powder,-100 mesh,indio,shot, tear drop, 4mm 0.2in,ingot, polycrystalline, puratronic,shot, 5mm 0.2in & down, puratronic,wire, 0.5mm 0.02in dia, puratronic PubChem CID: 5359967 ChEBI: CHEBI:30430 IUPAC Name: indium SMILES: [In]
| PubChem CID | 5359967 |
|---|---|
| CAS | 7440-74-6 |
| Molecular Weight (g/mol) | 114.82 |
| ChEBI | CHEBI:30430 |
| MDL Number | MFCD00134048 |
| SMILES | [In] |
| Synonym | indium, elemental,unii-045a6v3vfx,powder,shot,powder,-100 mesh,indio,shot, tear drop, 4mm 0.2in,ingot, polycrystalline, puratronic,shot, 5mm 0.2in & down, puratronic,wire, 0.5mm 0.02in dia, puratronic |
| IUPAC Name | indium |
| InChI Key | APFVFJFRJDLVQX-UHFFFAOYSA-N |
| Molecular Formula | In |
Niobium ingot/button,≈25.4mm (1.0 in.) dia. x 11mm (0.45 in.) thick, 99.95% (metals basis)
CAS: 3-1-7440 Molecular Formula: Nb Molecular Weight (g/mol): 92.91 MDL Number: MFCD00011126 InChI Key: GUCVJGMIXFAOAE-UHFFFAOYSA-N Synonym: columbium,element,niobium-93,powder,foil,rod,vn 1,foil, 0.25mm 0.01in thick,columbio,niobio PubChem CID: 23936 ChEBI: CHEBI:33344 IUPAC Name: niobium SMILES: [Nb]
| PubChem CID | 23936 |
|---|---|
| CAS | 3-1-7440 |
| Molecular Weight (g/mol) | 92.91 |
| ChEBI | CHEBI:33344 |
| MDL Number | MFCD00011126 |
| SMILES | [Nb] |
| Synonym | columbium,element,niobium-93,powder,foil,rod,vn 1,foil, 0.25mm 0.01in thick,columbio,niobio |
| IUPAC Name | niobium |
| InChI Key | GUCVJGMIXFAOAE-UHFFFAOYSA-N |
| Molecular Formula | Nb |
Sodium selenite, 44-46% Se, anhydrous
CAS: 10102-18-8 Molecular Formula: Na2O3Se Molecular Weight (g/mol): 172.94 MDL Number: MFCD00003489 InChI Key: BVTBRVFYZUCAKH-UHFFFAOYSA-L Synonym: sodium selenite,disodium selenite,natriumselenit,selenious acid, disodium salt,natriumselenit german,disodium selenium trioxide,unii-hiw548rq3w,selenious acid disodium salt,ccris 1260,hsdb 768 PubChem CID: 24934 ChEBI: CHEBI:48843 IUPAC Name: disodium;selenite SMILES: [O-][Se](=O)[O-].[Na+].[Na+]
| PubChem CID | 24934 |
|---|---|
| CAS | 10102-18-8 |
| Molecular Weight (g/mol) | 172.94 |
| ChEBI | CHEBI:48843 |
| MDL Number | MFCD00003489 |
| SMILES | [O-][Se](=O)[O-].[Na+].[Na+] |
| Synonym | sodium selenite,disodium selenite,natriumselenit,selenious acid, disodium salt,natriumselenit german,disodium selenium trioxide,unii-hiw548rq3w,selenious acid disodium salt,ccris 1260,hsdb 768 |
| IUPAC Name | disodium;selenite |
| InChI Key | BVTBRVFYZUCAKH-UHFFFAOYSA-L |
| Molecular Formula | Na2O3Se |
Boron nitride, 98%
CAS: 10043-11-5 Molecular Formula: BN Molecular Weight (g/mol): 24.82 MDL Number: MFCD00011317 InChI Key: LNLSXDSWJBUPHM-UHFFFAOYSA-N Synonym: boron nitride,elbor,borazon,elboron,kubonit,wurzin,denka boron nitride gp,geksanit r,hexanite r PubChem CID: 66227 ChEBI: CHEBI:50883 SMILES: B=N
| PubChem CID | 66227 |
|---|---|
| CAS | 10043-11-5 |
| Molecular Weight (g/mol) | 24.82 |
| ChEBI | CHEBI:50883 |
| MDL Number | MFCD00011317 |
| SMILES | B=N |
| Synonym | boron nitride,elbor,borazon,elboron,kubonit,wurzin,denka boron nitride gp,geksanit r,hexanite r |
| InChI Key | LNLSXDSWJBUPHM-UHFFFAOYSA-N |
| Molecular Formula | BN |
| PubChem CID | 313 |
|---|---|
| CAS | 7647-01-0 |
| Molecular Weight (g/mol) | 36.46 |
| ChEBI | CHEBI:17883 |
| MDL Number | MFCD00011324 MFCD00792839 |
| SMILES | Cl |
| Synonym | hydrochloric acid,hydrogen chloride,muriatic acid,chlorohydric acid,acide chlorhydrique,chlorwasserstoff,spirits of salt,hydrogen chloride hcl,anhydrous hydrochloric acid,chloorwaterstof |
| IUPAC Name | hydrogen chloride |
| InChI Key | VEXZGXHMUGYJMC-UHFFFAOYSA-N |
| Molecular Formula | ClH |
Iodine monobromide, 98% min
CAS: 7789-33-5 Molecular Formula: BrI Molecular Weight (g/mol): 206.81 MDL Number: MFCD00011353 InChI Key: CBEQRNSPHCCXSH-UHFFFAOYSA-N Synonym: iodine monobromide,iodine bromide,iodobromine,iodine bromide ibr,unii-g0k622rd9n,iodinemonobromide,iodobromane,bromoiodine,jodmonobromid,hanus solution PubChem CID: 82238 IUPAC Name: iodobromane SMILES: BrI
| PubChem CID | 82238 |
|---|---|
| CAS | 7789-33-5 |
| Molecular Weight (g/mol) | 206.81 |
| MDL Number | MFCD00011353 |
| SMILES | BrI |
| Synonym | iodine monobromide,iodine bromide,iodobromine,iodine bromide ibr,unii-g0k622rd9n,iodinemonobromide,iodobromane,bromoiodine,jodmonobromid,hanus solution |
| IUPAC Name | iodobromane |
| InChI Key | CBEQRNSPHCCXSH-UHFFFAOYSA-N |
| Molecular Formula | BrI |
Methylmagnesium bromide, 1M solution in CPME, AcroSeal™
CAS: 75-16-1 Molecular Formula: CH3BrMg Molecular Weight (g/mol): 119.24 MDL Number: MFCD00000041 InChI Key: AVFUHBJCUUTGCD-UHFFFAOYSA-M Synonym: methylmagnesium bromide,methyl magnesium bromide,magnesium, bromomethyl,bromo methyl magnesium,methylmagnesium bromide solution, 3.0 m in diethyl ether,unii-22cw9773df,memgbr,methymagnesiumbromide,ch3mgbr,methylmagnesiumbromide,grignard reagent PubChem CID: 6349 IUPAC Name: magnesium;carbanide;bromide SMILES: C[Mg]Br
| PubChem CID | 6349 |
|---|---|
| CAS | 75-16-1 |
| Molecular Weight (g/mol) | 119.24 |
| MDL Number | MFCD00000041 |
| SMILES | C[Mg]Br |
| Synonym | methylmagnesium bromide,methyl magnesium bromide,magnesium, bromomethyl,bromo methyl magnesium,methylmagnesium bromide solution, 3.0 m in diethyl ether,unii-22cw9773df,memgbr,methymagnesiumbromide,ch3mgbr,methylmagnesiumbromide,grignard reagent |
| IUPAC Name | magnesium;carbanide;bromide |
| InChI Key | AVFUHBJCUUTGCD-UHFFFAOYSA-M |
| Molecular Formula | CH3BrMg |
1-(Trimethylsiloxy)cyclohexene, 98%
CAS: 6651-36-1 Molecular Formula: C9H18OSi Molecular Weight (g/mol): 170.33 MDL Number: MFCD00001541 InChI Key: SBEMOANGDSSPJY-UHFFFAOYSA-N Synonym: 1-trimethylsilyloxy cyclohexene,cyclohex-1-en-1-yloxy trimethylsilane,1-trimethylsiloxy cyclohexene,silane, 1-cyclohexen-1-yloxy trimethyl,1-cyclohexenyloxytrimethylsilane,1-cyclohexen-1-yloxy trimethylsilane,cyclohexene, 1-trimethylsilyl oxy,cyclohexenyloxy trimethylsilane,1-trimethylsiloxycyclohexene,cyclohexenyloxytrimethylsilane PubChem CID: 81161 IUPAC Name: cyclohexen-1-yloxy(trimethyl)silane SMILES: C[Si](C)(C)OC1=CCCCC1
| PubChem CID | 81161 |
|---|---|
| CAS | 6651-36-1 |
| Molecular Weight (g/mol) | 170.33 |
| MDL Number | MFCD00001541 |
| SMILES | C[Si](C)(C)OC1=CCCCC1 |
| Synonym | 1-trimethylsilyloxy cyclohexene,cyclohex-1-en-1-yloxy trimethylsilane,1-trimethylsiloxy cyclohexene,silane, 1-cyclohexen-1-yloxy trimethyl,1-cyclohexenyloxytrimethylsilane,1-cyclohexen-1-yloxy trimethylsilane,cyclohexene, 1-trimethylsilyl oxy,cyclohexenyloxy trimethylsilane,1-trimethylsiloxycyclohexene,cyclohexenyloxytrimethylsilane |
| IUPAC Name | cyclohexen-1-yloxy(trimethyl)silane |
| InChI Key | SBEMOANGDSSPJY-UHFFFAOYSA-N |
| Molecular Formula | C9H18OSi |
Boron tribromide, 99+%
CAS: 10294-33-4 Molecular Formula: BBr3 Molecular Weight (g/mol): 250.52 MDL Number: MFCD00011312 InChI Key: ILAHWRKJUDSMFH-UHFFFAOYSA-N Synonym: boron tribromide,borane, tribromo,boron bromide,tribromoboron,hsdb 327,tribromoboran,boron tribrornide,boron tri bromide,boron tri-bromide PubChem CID: 25134 IUPAC Name: tribromoborane SMILES: BrB(Br)Br
| PubChem CID | 25134 |
|---|---|
| CAS | 10294-33-4 |
| Molecular Weight (g/mol) | 250.52 |
| MDL Number | MFCD00011312 |
| SMILES | BrB(Br)Br |
| Synonym | boron tribromide,borane, tribromo,boron bromide,tribromoboron,hsdb 327,tribromoboran,boron tribrornide,boron tri bromide,boron tri-bromide |
| IUPAC Name | tribromoborane |
| InChI Key | ILAHWRKJUDSMFH-UHFFFAOYSA-N |
| Molecular Formula | BBr3 |