Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Mercury(II) bromide, ACS reagent
CAS: 7789-47-1 Molecular Formula: Br2Hg Molecular Weight (g/mol): 360.4 InChI Key: NGYIMTKLQULBOO-UHFFFAOYSA-L Synonym: mercuric bromide,mercury dibromide,mercury ii bromide,hgbr2,mercury bromide hgbr2,mercuric dibromide,mercury ii bromide 1:2,hsdb 829,hg2,mercury 2 bromide PubChem CID: 24612 ChEBI: CHEBI:49639 IUPAC Name: dibromomercury SMILES: Br[Hg]Br
| PubChem CID | 24612 |
|---|---|
| CAS | 7789-47-1 |
| Molecular Weight (g/mol) | 360.4 |
| ChEBI | CHEBI:49639 |
| SMILES | Br[Hg]Br |
| Synonym | mercuric bromide,mercury dibromide,mercury ii bromide,hgbr2,mercury bromide hgbr2,mercuric dibromide,mercury ii bromide 1:2,hsdb 829,hg2,mercury 2 bromide |
| IUPAC Name | dibromomercury |
| InChI Key | NGYIMTKLQULBOO-UHFFFAOYSA-L |
| Molecular Formula | Br2Hg |
Nickel(II) tetrafluoroborate hexahydrate
CAS: 15684-36-3 Molecular Formula: B2F8H12NiO6 Molecular Weight (g/mol): 340.39 MDL Number: MFCD00150259 InChI Key: BFFWGFMAXHCLDV-UHFFFAOYSA-N Synonym: nickel ii tetrafluoroborate hexahydrate,nickel ii ditetrafluoroborate hexahydrate,nickel 2+ ditetrafluoroborate hexahydrate,borate 1-,tetrafluoro-, nickel 2+ 2:1 , hexahydrate 9ci,2bf4.ni.6h2o,nickel ii tetrafluoroboratehexahydrate,nickel ii tetrafluoroborate hexahydrate 100g,nickel 2+ hexahydrate ditetrafluoroborate,nickel 2+ ion hexahydrate ditetrafluoroborate PubChem CID: 177615 SMILES: O.O.O.O.O.O.[Ni++].F[B-](F)(F)F.F[B-](F)(F)F
| PubChem CID | 177615 |
|---|---|
| CAS | 15684-36-3 |
| Molecular Weight (g/mol) | 340.39 |
| MDL Number | MFCD00150259 |
| SMILES | O.O.O.O.O.O.[Ni++].F[B-](F)(F)F.F[B-](F)(F)F |
| Synonym | nickel ii tetrafluoroborate hexahydrate,nickel ii ditetrafluoroborate hexahydrate,nickel 2+ ditetrafluoroborate hexahydrate,borate 1-,tetrafluoro-, nickel 2+ 2:1 , hexahydrate 9ci,2bf4.ni.6h2o,nickel ii tetrafluoroboratehexahydrate,nickel ii tetrafluoroborate hexahydrate 100g,nickel 2+ hexahydrate ditetrafluoroborate,nickel 2+ ion hexahydrate ditetrafluoroborate |
| InChI Key | BFFWGFMAXHCLDV-UHFFFAOYSA-N |
| Molecular Formula | B2F8H12NiO6 |
Copper(I) chloride, 99% (metals basis)
CAS: 7758-89-6 Molecular Formula: ClCu Molecular Weight (g/mol): 98.996 MDL Number: MFCD00010971 InChI Key: OXBLHERUFWYNTN-UHFFFAOYSA-M Synonym: cuprous chloride,copper i chloride,copper chloride cucl,copper monochloride,dicopper dichloride,copper 1+ chloride,cucl,chlorid medny czech PubChem CID: 62652 ChEBI: CHEBI:53472 IUPAC Name: chlorocopper SMILES: Cl[Cu]
| PubChem CID | 62652 |
|---|---|
| CAS | 7758-89-6 |
| Molecular Weight (g/mol) | 98.996 |
| ChEBI | CHEBI:53472 |
| MDL Number | MFCD00010971 |
| SMILES | Cl[Cu] |
| Synonym | cuprous chloride,copper i chloride,copper chloride cucl,copper monochloride,dicopper dichloride,copper 1+ chloride,cucl,chlorid medny czech |
| IUPAC Name | chlorocopper |
| InChI Key | OXBLHERUFWYNTN-UHFFFAOYSA-M |
| Molecular Formula | ClCu |
| CAS | 7720-83-4 |
|---|---|
| MDL Number | MFCD00043077 |
Silver hexafluoroantimonate, 99%
CAS: 26042-64-8 Molecular Formula: AgF6Sb Molecular Weight (g/mol): 343.619 MDL Number: MFCD00003401 InChI Key: GSXFODUDOAXUBF-UHFFFAOYSA-H Synonym: silver hexafluoroantimonate,silver hexafluoroantimonate v,silver hexafluorostiboranuide,silver 1+ hexafluorostibanuide,ag.f6sb,silverhexafluoroantimonate,agsbf6,acmc-209tq8,ksc492g5j,silver i hexafluoroantimonate PubChem CID: 16687962 IUPAC Name: silver;hexafluoroantimony(1-) SMILES: F[Sb-](F)(F)(F)(F)F.[Ag+]
| PubChem CID | 16687962 |
|---|---|
| CAS | 26042-64-8 |
| Molecular Weight (g/mol) | 343.619 |
| MDL Number | MFCD00003401 |
| SMILES | F[Sb-](F)(F)(F)(F)F.[Ag+] |
| Synonym | silver hexafluoroantimonate,silver hexafluoroantimonate v,silver hexafluorostiboranuide,silver 1+ hexafluorostibanuide,ag.f6sb,silverhexafluoroantimonate,agsbf6,acmc-209tq8,ksc492g5j,silver i hexafluoroantimonate |
| IUPAC Name | silver;hexafluoroantimony(1-) |
| InChI Key | GSXFODUDOAXUBF-UHFFFAOYSA-H |
| Molecular Formula | AgF6Sb |
Palladium(II) sulfate dihydrate, Premion™, 99.995% (metals basis)
CAS: 13444-98-9 Molecular Formula: H4O6PdS Molecular Weight (g/mol): 238.51 MDL Number: MFCD00011173 InChI Key: TWIRRPLUAGEFNJ-UHFFFAOYSA-L Synonym: palladium ii sulfate dihydrate,palladium ii sulfate dihydrate, premion,palladium sulfate dihydrate,so4.pd.2h2o,palladium 2+ sulfate dihydrate,palladium 2+ dihydrate sulfate,palladium 2+ sulfate-water 1/1/2,palladium 2+ ion dihydrate sulfate,palladium ii sulfate dihydrate metals basis PubChem CID: 22042048 IUPAC Name: palladium(2+);sulfate;dihydrate SMILES: O.O.[Pd++].[O-]S([O-])(=O)=O
| PubChem CID | 22042048 |
|---|---|
| CAS | 13444-98-9 |
| Molecular Weight (g/mol) | 238.51 |
| MDL Number | MFCD00011173 |
| SMILES | O.O.[Pd++].[O-]S([O-])(=O)=O |
| Synonym | palladium ii sulfate dihydrate,palladium ii sulfate dihydrate, premion,palladium sulfate dihydrate,so4.pd.2h2o,palladium 2+ sulfate dihydrate,palladium 2+ dihydrate sulfate,palladium 2+ sulfate-water 1/1/2,palladium 2+ ion dihydrate sulfate,palladium ii sulfate dihydrate metals basis |
| IUPAC Name | palladium(2+);sulfate;dihydrate |
| InChI Key | TWIRRPLUAGEFNJ-UHFFFAOYSA-L |
| Molecular Formula | H4O6PdS |
Lanthanum(III) chloride, ultra dry, 99.9% (REO)
CAS: 10099-58-8 Molecular Formula: Cl3La Molecular Weight (g/mol): 245.26 MDL Number: MFCD00011068 InChI Key: ICAKDTKJOYSXGC-UHFFFAOYSA-K IUPAC Name: lanthanum(3+) trichloride SMILES: [Cl-].[Cl-].[Cl-].[La+3]
| CAS | 10099-58-8 |
|---|---|
| Molecular Weight (g/mol) | 245.26 |
| MDL Number | MFCD00011068 |
| SMILES | [Cl-].[Cl-].[Cl-].[La+3] |
| IUPAC Name | lanthanum(3+) trichloride |
| InChI Key | ICAKDTKJOYSXGC-UHFFFAOYSA-K |
| Molecular Formula | Cl3La |
Potassium Hexachloroplatinate(IV), 99%+, MilliporeSigma™
CAS: 16921-30-5 Molecular Formula: Cl6K2Pt Molecular Weight (g/mol): 485.98 MDL Number: MFCD00011389 InChI Key: DPAIVKJGTXERIM-UHFFFAOYSA-H Synonym: potassium hexachloroplatinate iv,potassium platinic chloride,potassium hexachloroplatinate,dipotassium platinum hexachloride,platinic potassium chloride,dipotassium hexachloroplatinate,potassium platinum chloride,dipotassium hexachloroplatinate 2-,ccris 7824,platinum potassium chloride PubChem CID: 61856 IUPAC Name: dipotassium hexachloroplatinumdiuide SMILES: [K+].[K+].Cl[Pt--](Cl)(Cl)(Cl)(Cl)Cl
| PubChem CID | 61856 |
|---|---|
| CAS | 16921-30-5 |
| Molecular Weight (g/mol) | 485.98 |
| MDL Number | MFCD00011389 |
| SMILES | [K+].[K+].Cl[Pt--](Cl)(Cl)(Cl)(Cl)Cl |
| Synonym | potassium hexachloroplatinate iv,potassium platinic chloride,potassium hexachloroplatinate,dipotassium platinum hexachloride,platinic potassium chloride,dipotassium hexachloroplatinate,potassium platinum chloride,dipotassium hexachloroplatinate 2-,ccris 7824,platinum potassium chloride |
| IUPAC Name | dipotassium hexachloroplatinumdiuide |
| InChI Key | DPAIVKJGTXERIM-UHFFFAOYSA-H |
| Molecular Formula | Cl6K2Pt |
Chromyl chloride, 99.99% (metals basis)
CAS: 14977-61-8 Molecular Formula: Cl2CrH4O2 Molecular Weight (g/mol): 158.926 MDL Number: MFCD00010951 InChI Key: HOCPFYCTFLRIAK-UHFFFAOYSA-L Synonym: chromyl chloride PubChem CID: 101943071 IUPAC Name: chromium(2+);dichloride;dihydrate SMILES: O.O.[Cl-].[Cl-].[Cr+2]
| PubChem CID | 101943071 |
|---|---|
| CAS | 14977-61-8 |
| Molecular Weight (g/mol) | 158.926 |
| MDL Number | MFCD00010951 |
| SMILES | O.O.[Cl-].[Cl-].[Cr+2] |
| Synonym | chromyl chloride |
| IUPAC Name | chromium(2+);dichloride;dihydrate |
| InChI Key | HOCPFYCTFLRIAK-UHFFFAOYSA-L |
| Molecular Formula | Cl2CrH4O2 |
Yttrium(III) fluoride, 98%
CAS: 13709-49-4 Molecular Formula: F3Y Molecular Weight (g/mol): 145.90 MDL Number: MFCD00049714 InChI Key: RBORBHYCVONNJH-UHFFFAOYSA-K IUPAC Name: yttrium(3+) trifluoride SMILES: [F-].[F-].[F-].[Y+3]
| CAS | 13709-49-4 |
|---|---|
| Molecular Weight (g/mol) | 145.90 |
| MDL Number | MFCD00049714 |
| SMILES | [F-].[F-].[F-].[Y+3] |
| IUPAC Name | yttrium(3+) trifluoride |
| InChI Key | RBORBHYCVONNJH-UHFFFAOYSA-K |
| Molecular Formula | F3Y |
Chromium carbide, 99.5% (metals basis)
CAS: 12105-81-6 Molecular Formula: Cr23C6 MDL Number: MFCD00678358 Synonym: bis methane trichromium
| CAS | 12105-81-6 |
|---|---|
| MDL Number | MFCD00678358 |
| Synonym | bis methane trichromium |
| Molecular Formula | Cr23C6 |
Nickel(II) hydroxide, for analysis
CAS: 12054-48-7 Molecular Formula: H2NiO2 Molecular Weight (g/mol): 92.71 MDL Number: MFCD00011140 InChI Key: BFDHFSHZJLFAMC-UHFFFAOYSA-L IUPAC Name: nickel(2+) dihydroxide SMILES: [OH-].[OH-].[Ni++]
| CAS | 12054-48-7 |
|---|---|
| Molecular Weight (g/mol) | 92.71 |
| MDL Number | MFCD00011140 |
| SMILES | [OH-].[OH-].[Ni++] |
| IUPAC Name | nickel(2+) dihydroxide |
| InChI Key | BFDHFSHZJLFAMC-UHFFFAOYSA-L |
| Molecular Formula | H2NiO2 |
Copper(II) oxide, 99.7% (metals basis)
CAS: 1317-38-0 Molecular Formula: CuO Molecular Weight (g/mol): 79.55 MDL Number: MFCD00010979 InChI Key: KKCXRELNMOYFLS-UHFFFAOYSA-N Synonym: cupric oxide,copper ii oxide,copper oxide,copper monoxide,banacobru ol,chrome brown,copper brown,copper monooxide,black copper oxide PubChem CID: 14829 IUPAC Name: copper(2+) oxidandiide SMILES: [O--].[Cu++]
| PubChem CID | 14829 |
|---|---|
| CAS | 1317-38-0 |
| Molecular Weight (g/mol) | 79.55 |
| MDL Number | MFCD00010979 |
| SMILES | [O--].[Cu++] |
| Synonym | cupric oxide,copper ii oxide,copper oxide,copper monoxide,banacobru ol,chrome brown,copper brown,copper monooxide,black copper oxide |
| IUPAC Name | copper(2+) oxidandiide |
| InChI Key | KKCXRELNMOYFLS-UHFFFAOYSA-N |
| Molecular Formula | CuO |
Iron(III) chloride, MilliporeSigma™
CAS: 7705-08-0 Molecular Formula: Cl3Fe Molecular Weight (g/mol): 162.20 MDL Number: MFCD00011005 InChI Key: RBTARNINKXHZNM-UHFFFAOYSA-K Synonym: Ferric chloride; Iron trichloride IUPAC Name: iron(3+) trichloride SMILES: [Cl-].[Cl-].[Cl-].[Fe+3]
| CAS | 7705-08-0 |
|---|---|
| Molecular Weight (g/mol) | 162.20 |
| MDL Number | MFCD00011005 |
| SMILES | [Cl-].[Cl-].[Cl-].[Fe+3] |
| Synonym | Ferric chloride; Iron trichloride |
| IUPAC Name | iron(3+) trichloride |
| InChI Key | RBTARNINKXHZNM-UHFFFAOYSA-K |
| Molecular Formula | Cl3Fe |
Copper(II) tetrafluoroborate, 45% aq. soln.
CAS: 38465-60-0 Molecular Formula: B2CuF8 Molecular Weight (g/mol): 237.15 MDL Number: MFCD00016054 InChI Key: HMUNZEYTSRPVBE-UHFFFAOYSA-N Synonym: copper fluoroborate,copper fluoborate,copper ii tetrafluoroborate,copper ditetrafluoroborate,cupric tetrafluoroborate hydrate,copper ii tetrafluoroborate in h2o,cupric fluoborate,copper ii fluoborate,copper 2+ ditetrafluoroborate,copper 2+ tetrafluoroborate 1- PubChem CID: 170058 IUPAC Name: copper;ditetrafluoroborate SMILES: [Cu++].F[B-](F)(F)F.F[B-](F)(F)F
| PubChem CID | 170058 |
|---|---|
| CAS | 38465-60-0 |
| Molecular Weight (g/mol) | 237.15 |
| MDL Number | MFCD00016054 |
| SMILES | [Cu++].F[B-](F)(F)F.F[B-](F)(F)F |
| Synonym | copper fluoroborate,copper fluoborate,copper ii tetrafluoroborate,copper ditetrafluoroborate,cupric tetrafluoroborate hydrate,copper ii tetrafluoroborate in h2o,cupric fluoborate,copper ii fluoborate,copper 2+ ditetrafluoroborate,copper 2+ tetrafluoroborate 1- |
| IUPAC Name | copper;ditetrafluoroborate |
| InChI Key | HMUNZEYTSRPVBE-UHFFFAOYSA-N |
| Molecular Formula | B2CuF8 |