Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Sodium Hydride (60%, dispersion in Paraffin Liquid), TCI America™
CAS: 7646-69-7 Molecular Formula: HNa Molecular Weight (g/mol): 23.998 MDL Number: MFCD00003471 InChI Key: BZKBCQXYZZXSCO-UHFFFAOYSA-N Synonym: sodium hydride,sodiumhydride,sodium hydride nah,sodium hydride oil dispersion,sodium monohydride,sodium hydride nad,sodiumhydrid,natrium hydride,sodium hydrid PubChem CID: 24758 IUPAC Name: sodium;hydride SMILES: [H-].[Na+]
| PubChem CID | 24758 |
|---|---|
| CAS | 7646-69-7 |
| Molecular Weight (g/mol) | 23.998 |
| MDL Number | MFCD00003471 |
| SMILES | [H-].[Na+] |
| Synonym | sodium hydride,sodiumhydride,sodium hydride nah,sodium hydride oil dispersion,sodium monohydride,sodium hydride nad,sodiumhydrid,natrium hydride,sodium hydrid |
| IUPAC Name | sodium;hydride |
| InChI Key | BZKBCQXYZZXSCO-UHFFFAOYSA-N |
| Molecular Formula | HNa |
Manganese(II) sulfate monohydrate, 99%
CAS: 10034-96-5 Molecular Formula: H2MnO5S Molecular Weight (g/mol): 169.01 MDL Number: MFCD00149159 InChI Key: ISPYRSDWRDQNSW-UHFFFAOYSA-L Synonym: manganese sulfate monohydrate,manganese ii sulfate monohydrate,manganese sulfate hydrate,manganese ii sulfate hydrate,mnso4.h2o,manganous sulfate monohydrate,unii-w00lys4t26,manganese 2+ sulfate monohydrate,manganese sulfate usp,manganese 2+ sulfate hydrate PubChem CID: 177577 ChEBI: CHEBI:86364 IUPAC Name: manganese(2+);sulfate;hydrate SMILES: O.[Mn++].[O-]S([O-])(=O)=O
| PubChem CID | 177577 |
|---|---|
| CAS | 10034-96-5 |
| Molecular Weight (g/mol) | 169.01 |
| ChEBI | CHEBI:86364 |
| MDL Number | MFCD00149159 |
| SMILES | O.[Mn++].[O-]S([O-])(=O)=O |
| Synonym | manganese sulfate monohydrate,manganese ii sulfate monohydrate,manganese sulfate hydrate,manganese ii sulfate hydrate,mnso4.h2o,manganous sulfate monohydrate,unii-w00lys4t26,manganese 2+ sulfate monohydrate,manganese sulfate usp,manganese 2+ sulfate hydrate |
| IUPAC Name | manganese(2+);sulfate;hydrate |
| InChI Key | ISPYRSDWRDQNSW-UHFFFAOYSA-L |
| Molecular Formula | H2MnO5S |
Silver nitrate, ACS, 99.9+% (metals basis)
CAS: 7761-88-8 Molecular Formula: AgNO3 Molecular Weight (g/mol): 169.87 MDL Number: MFCD00003414 InChI Key: SQGYOTSLMSWVJD-UHFFFAOYSA-N Synonym: silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol PubChem CID: 24470 ChEBI: CHEBI:32130 IUPAC Name: silver(1+) nitrate SMILES: [Ag+].[O-][N+]([O-])=O
| PubChem CID | 24470 |
|---|---|
| CAS | 7761-88-8 |
| Molecular Weight (g/mol) | 169.87 |
| ChEBI | CHEBI:32130 |
| MDL Number | MFCD00003414 |
| SMILES | [Ag+].[O-][N+]([O-])=O |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
| IUPAC Name | silver(1+) nitrate |
| InChI Key | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| Molecular Formula | AgNO3 |
Ricca Chemical Company Lead Acetate Cotton, Ricca Chemical
CAS: 6080-56-4 Molecular Formula: C4H12O7Pb Molecular Weight (g/mol): 379.30 MDL Number: MFCD00150023 InChI Key: MCEUZMYFCCOOQO-UHFFFAOYSA-L Synonym: lead acetate trihydrate,lead diacetate trihydrate,bleiazetat german,bis acetato trihydroxytrilead,unii-rx077p88ry,ccris 9031,lead acetate ii , trihydrate,lead acetate jan,acetic acid, lead +2 salt trihydrate,acetic acid, lead 2+ salt, trihydrate PubChem CID: 22456 ChEBI: CHEBI:33112 IUPAC Name: λ2-lead(2+) diacetate trihydrate SMILES: O.O.O.[Pb++].CC([O-])=O.CC([O-])=O
| PubChem CID | 22456 |
|---|---|
| CAS | 6080-56-4 |
| Molecular Weight (g/mol) | 379.30 |
| ChEBI | CHEBI:33112 |
| MDL Number | MFCD00150023 |
| SMILES | O.O.O.[Pb++].CC([O-])=O.CC([O-])=O |
| Synonym | lead acetate trihydrate,lead diacetate trihydrate,bleiazetat german,bis acetato trihydroxytrilead,unii-rx077p88ry,ccris 9031,lead acetate ii , trihydrate,lead acetate jan,acetic acid, lead +2 salt trihydrate,acetic acid, lead 2+ salt, trihydrate |
| IUPAC Name | λ2-lead(2+) diacetate trihydrate |
| InChI Key | MCEUZMYFCCOOQO-UHFFFAOYSA-L |
| Molecular Formula | C4H12O7Pb |
LabChem, Inc. Potassium Iodide, ACS Grade, ≥ 99.0%, LabChem™
CAS: 7681-11-0 Molecular Formula: IK Molecular Weight (g/mol): 166.003 InChI Key: NLKNQRATVPKPDG-UHFFFAOYSA-M Synonym: potassium iodide,potassium iodide ki,pima,kali iodide,thyro-block,knollide,kisol,asmofug e,potassium diiodide,potassium monoiodide PubChem CID: 4875 ChEBI: CHEBI:8346 IUPAC Name: potassium;iodide SMILES: [K+].[I-]
| PubChem CID | 4875 |
|---|---|
| CAS | 7681-11-0 |
| Molecular Weight (g/mol) | 166.003 |
| ChEBI | CHEBI:8346 |
| SMILES | [K+].[I-] |
| Synonym | potassium iodide,potassium iodide ki,pima,kali iodide,thyro-block,knollide,kisol,asmofug e,potassium diiodide,potassium monoiodide |
| IUPAC Name | potassium;iodide |
| InChI Key | NLKNQRATVPKPDG-UHFFFAOYSA-M |
| Molecular Formula | IK |
Magnesium chloride, 1M aq. soln.
CAS: 7786-30-3 Molecular Formula: Cl2Mg Molecular Weight (g/mol): 95.21 MDL Number: MFCD00011106 InChI Key: TWRXJAOTZQYOKJ-UHFFFAOYSA-L Synonym: magnesium chloride,magnesium chloride anhydrous,mgcl2,magnesium chloride, anhydrous,magnesium 2+ ion dichloride,chloromagnesite,magnesiumchlorid,magnesium ii chloride PubChem CID: 5360315 ChEBI: CHEBI:6636 SMILES: [Mg++].[Cl-].[Cl-]
| PubChem CID | 5360315 |
|---|---|
| CAS | 7786-30-3 |
| Molecular Weight (g/mol) | 95.21 |
| ChEBI | CHEBI:6636 |
| MDL Number | MFCD00011106 |
| SMILES | [Mg++].[Cl-].[Cl-] |
| Synonym | magnesium chloride,magnesium chloride anhydrous,mgcl2,magnesium chloride, anhydrous,magnesium 2+ ion dichloride,chloromagnesite,magnesiumchlorid,magnesium ii chloride |
| InChI Key | TWRXJAOTZQYOKJ-UHFFFAOYSA-L |
| Molecular Formula | Cl2Mg |
Sodium Borohydride 95.0+%, TCI America™
CAS: 16940-66-2 Molecular Formula: BH4Na Molecular Weight (g/mol): 37.83 MDL Number: MFCD00003518 InChI Key: YOQDYZUWIQVZSF-UHFFFAOYSA-N Synonym: Sodium Tetrahydroborate, Sodium Tetrahydridoborate IUPAC Name: sodium boranuide SMILES: [BH4-].[Na+]
| CAS | 16940-66-2 |
|---|---|
| Molecular Weight (g/mol) | 37.83 |
| MDL Number | MFCD00003518 |
| SMILES | [BH4-].[Na+] |
| Synonym | Sodium Tetrahydroborate, Sodium Tetrahydridoborate |
| IUPAC Name | sodium boranuide |
| InChI Key | YOQDYZUWIQVZSF-UHFFFAOYSA-N |
| Molecular Formula | BH4Na |
1H,1H,2H,2H-Perfluorooctyltrichlorosilane, 97%
CAS: 78560-45-9 Molecular Formula: C8H4Cl3F13Si Molecular Weight (g/mol): 481.534 MDL Number: MFCD00042363 InChI Key: PISDRBMXQBSCIP-UHFFFAOYSA-N Synonym: trichloro 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl silane,1h,1h,2h,2h-perfluorooctyltrichlorosilane,silane, trichloro 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl,tridecafluoro-1,1,2,2-tetrahydrooctyl trichlorosilane,trichloro 1h,1h,2h,2h-perfluorooctyl silane,2-tridecafluorohexyl ethyltrichlorosilane,1h,1h,2h,2h-perfluorooctyl trichlorosilane,trichloro 1h,1h,2h,2h-perfluoro-n-octyl silane,trichloro 1h,1h,2h,2h-tridecafluoro-n-octyl silane PubChem CID: 123578 IUPAC Name: trichloro(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane SMILES: C(C[Si](Cl)(Cl)Cl)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
| PubChem CID | 123578 |
|---|---|
| CAS | 78560-45-9 |
| Molecular Weight (g/mol) | 481.534 |
| MDL Number | MFCD00042363 |
| SMILES | C(C[Si](Cl)(Cl)Cl)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| Synonym | trichloro 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl silane,1h,1h,2h,2h-perfluorooctyltrichlorosilane,silane, trichloro 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl,tridecafluoro-1,1,2,2-tetrahydrooctyl trichlorosilane,trichloro 1h,1h,2h,2h-perfluorooctyl silane,2-tridecafluorohexyl ethyltrichlorosilane,1h,1h,2h,2h-perfluorooctyl trichlorosilane,trichloro 1h,1h,2h,2h-perfluoro-n-octyl silane,trichloro 1h,1h,2h,2h-tridecafluoro-n-octyl silane |
| IUPAC Name | trichloro(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane |
| InChI Key | PISDRBMXQBSCIP-UHFFFAOYSA-N |
| Molecular Formula | C8H4Cl3F13Si |
Manganese(II) chloride, 1M aq. soln.
CAS: 7773-01-5 Molecular Formula: Cl2Mn Molecular Weight (g/mol): 125.84 MDL Number: MFCD00011114 InChI Key: GLFNIEUTAYBVOC-UHFFFAOYSA-L Synonym: manganese chloride,manganese ii chloride,manganese 2+ ion dichloride,manganesechloride,acmc-20akkt,manganous chloride,anhydrous,ksc171o6h,manganous chloride, anhydr,manganese ii chloride anhydrous crystalline PubChem CID: 10313134 ChEBI: CHEBI:63041 IUPAC Name: manganese(2+) dichloride SMILES: [Cl-].[Cl-].[Mn++]
| PubChem CID | 10313134 |
|---|---|
| CAS | 7773-01-5 |
| Molecular Weight (g/mol) | 125.84 |
| ChEBI | CHEBI:63041 |
| MDL Number | MFCD00011114 |
| SMILES | [Cl-].[Cl-].[Mn++] |
| Synonym | manganese chloride,manganese ii chloride,manganese 2+ ion dichloride,manganesechloride,acmc-20akkt,manganous chloride,anhydrous,ksc171o6h,manganous chloride, anhydr,manganese ii chloride anhydrous crystalline |
| IUPAC Name | manganese(2+) dichloride |
| InChI Key | GLFNIEUTAYBVOC-UHFFFAOYSA-L |
| Molecular Formula | Cl2Mn |
LabChem, Inc. Sodium Nitroprusside, Dihydrate, ACS Grade, 99.0 to 102.0%, LabChem™
CAS: 13755-38-9 Molecular Formula: C5H4FeN6Na2O3 Molecular Weight (g/mol): 297.95 MDL Number: MFCD00149192 InChI Key: JFPDVRGGFBUORC-UHFFFAOYSA-N Synonym: nitroprusside sodium,sodium pentacyanonitrosylferrate,sodium nitroferricyanide iii dihydrate,dsstox_cid_21126,dsstox_rid_79630,dsstox_gsid_41126,sodium pentacyanonitrosylferrate iii dihydrate,nitropress tn,sodium nitroprusside usp,c5fen6o.2na.2h2o PubChem CID: 11953895 IUPAC Name: disodium pentacyano(oxidaniumylidyneamino)ironbis(ylium) dihydrate SMILES: O.O.[Na+].[Na+].N#C[Fe++](C#N)(C#N)(C#N)(C#N)[N]#[O+]
| PubChem CID | 11953895 |
|---|---|
| CAS | 13755-38-9 |
| Molecular Weight (g/mol) | 297.95 |
| MDL Number | MFCD00149192 |
| SMILES | O.O.[Na+].[Na+].N#C[Fe++](C#N)(C#N)(C#N)(C#N)[N]#[O+] |
| Synonym | nitroprusside sodium,sodium pentacyanonitrosylferrate,sodium nitroferricyanide iii dihydrate,dsstox_cid_21126,dsstox_rid_79630,dsstox_gsid_41126,sodium pentacyanonitrosylferrate iii dihydrate,nitropress tn,sodium nitroprusside usp,c5fen6o.2na.2h2o |
| IUPAC Name | disodium pentacyano(oxidaniumylidyneamino)ironbis(ylium) dihydrate |
| InChI Key | JFPDVRGGFBUORC-UHFFFAOYSA-N |
| Molecular Formula | C5H4FeN6Na2O3 |
Sodium Bicarbonate (Powder/Certified ACS), Fisher Chemical™
CAS: 144-55-8 Molecular Formula: CHNaO3 Molecular Weight (g/mol): 84.01 MDL Number: MFCD00003528 InChI Key: UIIMBOGNXHQVGW-UHFFFAOYSA-M Synonym: sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut PubChem CID: 516892 ChEBI: CHEBI:32139 IUPAC Name: sodium hydrogen carbonate SMILES: [Na+].OC([O-])=O
| PubChem CID | 516892 |
|---|---|
| CAS | 144-55-8 |
| Molecular Weight (g/mol) | 84.01 |
| ChEBI | CHEBI:32139 |
| MDL Number | MFCD00003528 |
| SMILES | [Na+].OC([O-])=O |
| Synonym | sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut |
| IUPAC Name | sodium hydrogen carbonate |
| InChI Key | UIIMBOGNXHQVGW-UHFFFAOYSA-M |
| Molecular Formula | CHNaO3 |
Iodine, Certified, 0.1000N ±0.0005N (0.05M), LabChem™
CAS: 7553-56-2 Molecular Formula: I2 Molecular Weight (g/mol): 253.81 MDL Number: MFCD00011355 MFCD00164163 InChI Key: PNDPGZBMCMUPRI-UHFFFAOYSA-N IUPAC Name: diiodine SMILES: II
| CAS | 7553-56-2 |
|---|---|
| Molecular Weight (g/mol) | 253.81 |
| MDL Number | MFCD00011355 MFCD00164163 |
| SMILES | II |
| IUPAC Name | diiodine |
| InChI Key | PNDPGZBMCMUPRI-UHFFFAOYSA-N |
| Molecular Formula | I2 |
Ricca Chemical Company Sodium Citrate Dihydrate, ACS Reagent Grade, Ricca Chemical
CAS: 6132-04-3 Molecular Formula: C6H9Na3O9 Molecular Weight (g/mol): 294.10 InChI Key: NLJMYIDDQXHKNR-UHFFFAOYSA-K Synonym: trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate PubChem CID: 71474 ChEBI: CHEBI:32142 IUPAC Name: trisodium;2-hydroxypropane-1,2,3-tricarboxylate;dihydrate SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+]
| PubChem CID | 71474 |
|---|---|
| CAS | 6132-04-3 |
| Molecular Weight (g/mol) | 294.10 |
| ChEBI | CHEBI:32142 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+] |
| Synonym | trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate |
| IUPAC Name | trisodium;2-hydroxypropane-1,2,3-tricarboxylate;dihydrate |
| InChI Key | NLJMYIDDQXHKNR-UHFFFAOYSA-K |
| Molecular Formula | C6H9Na3O9 |
Sodium thiosulfate pentahydrate, 99+%
CAS: 10102-17-7 Molecular Formula: H10Na2O8S2 Molecular Weight (g/mol): 248.172 MDL Number: MFCD00149186 InChI Key: PODWXQQNRWNDGD-UHFFFAOYSA-L Synonym: sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate PubChem CID: 61475 ChEBI: CHEBI:32150 IUPAC Name: disodium;dioxido-oxo-sulfanylidene-$l^{6}-sulfane;pentahydrate SMILES: O.O.O.O.O.[O-]S(=O)(=S)[O-].[Na+].[Na+]
| PubChem CID | 61475 |
|---|---|
| CAS | 10102-17-7 |
| Molecular Weight (g/mol) | 248.172 |
| ChEBI | CHEBI:32150 |
| MDL Number | MFCD00149186 |
| SMILES | O.O.O.O.O.[O-]S(=O)(=S)[O-].[Na+].[Na+] |
| Synonym | sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate |
| IUPAC Name | disodium;dioxido-oxo-sulfanylidene-$l^{6}-sulfane;pentahydrate |
| InChI Key | PODWXQQNRWNDGD-UHFFFAOYSA-L |
| Molecular Formula | H10Na2O8S2 |
Sodium acetate, 3M aq. soln., pH 5.2, RNAse free
CAS: 127-09-3 Molecular Formula: C2H3NaO2 Molecular Weight (g/mol): 82.03 MDL Number: MFCD00012459 InChI Key: VMHLLURERBWHNL-UHFFFAOYSA-M Synonym: sodium acetate,acetic acid, sodium salt,sodium acetate anhydrous,sodium acetate, anhydrous,acetic acid sodium salt,anhydrous sodium acetate,sodii acetas,sodium ethanoate,natrium aceticum,octan sodny czech PubChem CID: 517045 ChEBI: CHEBI:32954 IUPAC Name: sodium acetate SMILES: [Na+].CC([O-])=O
| PubChem CID | 517045 |
|---|---|
| CAS | 127-09-3 |
| Molecular Weight (g/mol) | 82.03 |
| ChEBI | CHEBI:32954 |
| MDL Number | MFCD00012459 |
| SMILES | [Na+].CC([O-])=O |
| Synonym | sodium acetate,acetic acid, sodium salt,sodium acetate anhydrous,sodium acetate, anhydrous,acetic acid sodium salt,anhydrous sodium acetate,sodii acetas,sodium ethanoate,natrium aceticum,octan sodny czech |
| IUPAC Name | sodium acetate |
| InChI Key | VMHLLURERBWHNL-UHFFFAOYSA-M |
| Molecular Formula | C2H3NaO2 |