Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Potassium fluoride, 99%, extra pure, anhydrous, Thermo Scientific Chemicals
CAS: 7789-23-3 Molecular Formula: FK Molecular Weight (g/mol): 58.10 MDL Number: MFCD00011398 InChI Key: NROKBHXJSPEDAR-UHFFFAOYSA-M Synonym: potassium fluoride,potassiumfluoride,potassium fluoride kf,potassium fluorure,fluorure de potassium,potassium fluorure french,potassium fluoride on calcium fluoride,potassium fluoride, anhydrous,unii-9082wg1g3f,ccris 1568 PubChem CID: 522689 ChEBI: CHEBI:66872 SMILES: [F-].[K+]
| PubChem CID | 522689 |
|---|---|
| CAS | 7789-23-3 |
| Molecular Weight (g/mol) | 58.10 |
| ChEBI | CHEBI:66872 |
| MDL Number | MFCD00011398 |
| SMILES | [F-].[K+] |
| Synonym | potassium fluoride,potassiumfluoride,potassium fluoride kf,potassium fluorure,fluorure de potassium,potassium fluorure french,potassium fluoride on calcium fluoride,potassium fluoride, anhydrous,unii-9082wg1g3f,ccris 1568 |
| InChI Key | NROKBHXJSPEDAR-UHFFFAOYSA-M |
| Molecular Formula | FK |
Sodium hexacyanoferrate(II) decahydrate, 99%
CAS: 14434-22-1 Molecular Formula: C6H20FeN6Na4O10 Molecular Weight (g/mol): 484.06 MDL Number: MFCD00149274 InChI Key: JFSUDVTVQZUDOP-UHFFFAOYSA-N Synonym: Sodium ferrocyanide decahydrate SMILES: O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[Na+].[Na+].[Fe++].[C-]#N.[C-]#N.[C-]#N.[C-]#N.[C-]#N.[C-]#N
| CAS | 14434-22-1 |
|---|---|
| Molecular Weight (g/mol) | 484.06 |
| MDL Number | MFCD00149274 |
| SMILES | O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[Na+].[Na+].[Fe++].[C-]#N.[C-]#N.[C-]#N.[C-]#N.[C-]#N.[C-]#N |
| Synonym | Sodium ferrocyanide decahydrate |
| InChI Key | JFSUDVTVQZUDOP-UHFFFAOYSA-N |
| Molecular Formula | C6H20FeN6Na4O10 |
Sodium Azide, ≥99%
CAS: 26628-22-8 Molecular Formula: N3Na Molecular Weight (g/mol): 65.011 MDL Number: MFCD00003536 InChI Key: PXIPVTKHYLBLMZ-UHFFFAOYSA-N Synonym: sodium azide,azide, sodium,natriumazid,nemazyd,smite,kazoe,azoture de sodium,sodium azide na n3,hydrazoic acid, sodium salt,natriumazid german PubChem CID: 33557 ChEBI: CHEBI:278547 IUPAC Name: sodium;azide SMILES: [N-]=[N+]=[N-].[Na+]
| PubChem CID | 33557 |
|---|---|
| CAS | 26628-22-8 |
| Molecular Weight (g/mol) | 65.011 |
| ChEBI | CHEBI:278547 |
| MDL Number | MFCD00003536 |
| SMILES | [N-]=[N+]=[N-].[Na+] |
| Synonym | sodium azide,azide, sodium,natriumazid,nemazyd,smite,kazoe,azoture de sodium,sodium azide na n3,hydrazoic acid, sodium salt,natriumazid german |
| IUPAC Name | sodium;azide |
| InChI Key | PXIPVTKHYLBLMZ-UHFFFAOYSA-N |
| Molecular Formula | N3Na |
Praseodymium rod, 12.7mm (0.5in) dia, 99.5% (metals basis excluding Ta)
CAS: 7440-10-0 Molecular Formula: Pr Molecular Weight (g/mol): 140.91 MDL Number: MFCD00011174 InChI Key: PUDIUYLPXJFUGB-UHFFFAOYSA-N Synonym: unii-nkn7eza750,nkn7eza750,ingot,praseodimio,praseodyme,praseodym,atom,chips,powder,acmc-1bktg PubChem CID: 23942 ChEBI: CHEBI:49828 IUPAC Name: praseodymium SMILES: [Pr]
| PubChem CID | 23942 |
|---|---|
| CAS | 7440-10-0 |
| Molecular Weight (g/mol) | 140.91 |
| ChEBI | CHEBI:49828 |
| MDL Number | MFCD00011174 |
| SMILES | [Pr] |
| Synonym | unii-nkn7eza750,nkn7eza750,ingot,praseodimio,praseodyme,praseodym,atom,chips,powder,acmc-1bktg |
| IUPAC Name | praseodymium |
| InChI Key | PUDIUYLPXJFUGB-UHFFFAOYSA-N |
| Molecular Formula | Pr |
Sodium, dispersion, 40% in oil
CAS: 7440-23-5 Molecular Formula: Na Molecular Weight (g/mol): 22.99 MDL Number: MFCD00085307 InChI Key: KEAYESYHFKHZAL-UHFFFAOYSA-N Synonym: natrium,sodium-23,sodio,metal,sodio spanish,liquid alloy,unii-9nez333n27,hsdb 687,unii-23j3bhr95o,ingot PubChem CID: 5360545 ChEBI: CHEBI:26708 IUPAC Name: sodium SMILES: [Na]
| PubChem CID | 5360545 |
|---|---|
| CAS | 7440-23-5 |
| Molecular Weight (g/mol) | 22.99 |
| ChEBI | CHEBI:26708 |
| MDL Number | MFCD00085307 |
| SMILES | [Na] |
| Synonym | natrium,sodium-23,sodio,metal,sodio spanish,liquid alloy,unii-9nez333n27,hsdb 687,unii-23j3bhr95o,ingot |
| IUPAC Name | sodium |
| InChI Key | KEAYESYHFKHZAL-UHFFFAOYSA-N |
| Molecular Formula | Na |
Sodium hexanitritocobaltate(III)
CAS: 14649-73-1 Molecular Formula: CoN6Na3O12 Molecular Weight (g/mol): 403.933 MDL Number: MFCD00003512 InChI Key: ZEBNDJQGEZXBCR-UHFFFAOYSA-H Synonym: cobaltic trisodium hexanitrite,trisodium cobalt 3+ hexanitrite,sodium hexanitritocobaltate 3-,cobalt 3+ sodium nitrite 1:3:6,cobaltate 3-, hexanitrito-, trisodium,cobaltate 3-, hexakis nitrito-o-, trisodium, oc-6-11,na3 co no2 6,cobaltate 3-, hexakis nitrito-kappao-, sodium 1:3 , oc-6-11 PubChem CID: 159748 IUPAC Name: trisodium;cobalt(3+);hexanitrite SMILES: N(=O)[O-].N(=O)[O-].N(=O)[O-].N(=O)[O-].N(=O)[O-].N(=O)[O-].[Na+].[Na+].[Na+].[Co+3]
| PubChem CID | 159748 |
|---|---|
| CAS | 14649-73-1 |
| Molecular Weight (g/mol) | 403.933 |
| MDL Number | MFCD00003512 |
| SMILES | N(=O)[O-].N(=O)[O-].N(=O)[O-].N(=O)[O-].N(=O)[O-].N(=O)[O-].[Na+].[Na+].[Na+].[Co+3] |
| Synonym | cobaltic trisodium hexanitrite,trisodium cobalt 3+ hexanitrite,sodium hexanitritocobaltate 3-,cobalt 3+ sodium nitrite 1:3:6,cobaltate 3-, hexanitrito-, trisodium,cobaltate 3-, hexakis nitrito-o-, trisodium, oc-6-11,na3 co no2 6,cobaltate 3-, hexakis nitrito-kappao-, sodium 1:3 , oc-6-11 |
| IUPAC Name | trisodium;cobalt(3+);hexanitrite |
| InChI Key | ZEBNDJQGEZXBCR-UHFFFAOYSA-H |
| Molecular Formula | CoN6Na3O12 |
Tetrabutylammonium Hydroxide Solution, MP Biomedical
CAS: 2052-49-5 Molecular Formula: C16H37NO Molecular Weight (g/mol): 259.48 MDL Number: MFCD00009425 InChI Key: VDZOOKBUILJEDG-UHFFFAOYSA-M Synonym: tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1,tetrabutylammonium hydroxide solution in water PubChem CID: 2723671 IUPAC Name: tetrabutylazanium hydroxide SMILES: [OH-].CCCC[N+](CCCC)(CCCC)CCCC
| PubChem CID | 2723671 |
|---|---|
| CAS | 2052-49-5 |
| Molecular Weight (g/mol) | 259.48 |
| MDL Number | MFCD00009425 |
| SMILES | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| Synonym | tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1,tetrabutylammonium hydroxide solution in water |
| IUPAC Name | tetrabutylazanium hydroxide |
| InChI Key | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| Molecular Formula | C16H37NO |
Lead wire, 0.75mm (0.03in) dia, 99.995% (metals basis)
CAS: 7439-92-1 Molecular Formula: Pb Molecular Weight (g/mol): 207.20 MDL Number: MFCD00134050 InChI Key: WABPQHHGFIMREM-UHFFFAOYSA-N Synonym: plumbum,metal,blei,lead, elemental,rough bullion,plomo,glover,element,flake,omaha & grant PubChem CID: 5352425 ChEBI: CHEBI:27889 IUPAC Name: lead SMILES: [Pb]
| PubChem CID | 5352425 |
|---|---|
| CAS | 7439-92-1 |
| Molecular Weight (g/mol) | 207.20 |
| ChEBI | CHEBI:27889 |
| MDL Number | MFCD00134050 |
| SMILES | [Pb] |
| Synonym | plumbum,metal,blei,lead, elemental,rough bullion,plomo,glover,element,flake,omaha & grant |
| IUPAC Name | lead |
| InChI Key | WABPQHHGFIMREM-UHFFFAOYSA-N |
| Molecular Formula | Pb |
Copper wire, 2.0mm (0.08in) dia, Puratronic™, 99.999% (metals basis)
CAS: 7440-50-8 Molecular Formula: Cu Molecular Weight (g/mol): 63.55 MDL Number: MFCD00010965 InChI Key: RYGMFSIKBFXOCR-UHFFFAOYSA-N Synonym: cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer PubChem CID: 23978 ChEBI: CHEBI:30052 IUPAC Name: copper SMILES: [Cu]
| PubChem CID | 23978 |
|---|---|
| CAS | 7440-50-8 |
| Molecular Weight (g/mol) | 63.55 |
| ChEBI | CHEBI:30052 |
| MDL Number | MFCD00010965 |
| SMILES | [Cu] |
| Synonym | cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer |
| IUPAC Name | copper |
| InChI Key | RYGMFSIKBFXOCR-UHFFFAOYSA-N |
| Molecular Formula | Cu |
Gallium(III) oxide, 99.99+%, (trace metal basis)
CAS: 12024-21-4 Molecular Formula: Ga2O3 Molecular Weight (g/mol): 187.44 MDL Number: MFCD00011020 InChI Key: AJNVQOSZGJRYEI-UHFFFAOYSA-N IUPAC Name: digallium(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Ga+3].[Ga+3]
| CAS | 12024-21-4 |
|---|---|
| Molecular Weight (g/mol) | 187.44 |
| MDL Number | MFCD00011020 |
| SMILES | [O--].[O--].[O--].[Ga+3].[Ga+3] |
| IUPAC Name | digallium(3+) trioxidandiide |
| InChI Key | AJNVQOSZGJRYEI-UHFFFAOYSA-N |
| Molecular Formula | Ga2O3 |
Sodium, 99.8%, oiled sticks, wrapped in aluminum foil
CAS: 7440-23-5 Molecular Formula: Na Molecular Weight (g/mol): 22.99 MDL Number: MFCD00085307 InChI Key: KEAYESYHFKHZAL-UHFFFAOYSA-N Synonym: natrium,sodium-23,sodio,metal,sodio spanish,liquid alloy,unii-9nez333n27,hsdb 687,unii-23j3bhr95o,ingot PubChem CID: 5360545 ChEBI: CHEBI:26708 IUPAC Name: sodium SMILES: [Na]
| PubChem CID | 5360545 |
|---|---|
| CAS | 7440-23-5 |
| Molecular Weight (g/mol) | 22.99 |
| ChEBI | CHEBI:26708 |
| MDL Number | MFCD00085307 |
| SMILES | [Na] |
| Synonym | natrium,sodium-23,sodio,metal,sodio spanish,liquid alloy,unii-9nez333n27,hsdb 687,unii-23j3bhr95o,ingot |
| IUPAC Name | sodium |
| InChI Key | KEAYESYHFKHZAL-UHFFFAOYSA-N |
| Molecular Formula | Na |
Potassium carbonate, ACS, 99.0% min
CAS: 584-08-7 Molecular Formula: CK2O3 Molecular Weight (g/mol): 138.21 MDL Number: MFCD00011382 InChI Key: BWHMMNNQKKPAPP-UHFFFAOYSA-L Synonym: potassium carbonate,dipotassium carbonate,potash,potassium carbonate, anhydrous,carbonic acid, dipotassium salt,carbonate of potash,pearl ash,salt of tartar,kaliumcarbonat,potassiumcarbonate PubChem CID: 11430 SMILES: [K+].[K+].[O-]C([O-])=O
| PubChem CID | 11430 |
|---|---|
| CAS | 584-08-7 |
| Molecular Weight (g/mol) | 138.21 |
| MDL Number | MFCD00011382 |
| SMILES | [K+].[K+].[O-]C([O-])=O |
| Synonym | potassium carbonate,dipotassium carbonate,potash,potassium carbonate, anhydrous,carbonic acid, dipotassium salt,carbonate of potash,pearl ash,salt of tartar,kaliumcarbonat,potassiumcarbonate |
| InChI Key | BWHMMNNQKKPAPP-UHFFFAOYSA-L |
| Molecular Formula | CK2O3 |
Sodium 1-Octanesulfonate 98.0+%, TCI America™
CAS: 5324-84-5 Molecular Formula: C8H17NaO3S Molecular Weight (g/mol): 216.27 MDL Number: MFCD00007544 InChI Key: HRQDCDQDOPSGBR-UHFFFAOYSA-M Synonym: sodium 1-octanesulfonate,sodium octane-1-sulfonate,1-octanesulfonic acid sodium salt,sodium octanesulfonate,1-octanesulfonic acid, sodium salt,1-octanesulfonate, sodium,sodium octylsulfonate,unii-j46ez5jyb3,octyl sodium sulfonate,ipc-alks-8 PubChem CID: 23669624 IUPAC Name: sodium octane-1-sulfonate SMILES: [Na+].CCCCCCCCS([O-])(=O)=O
| PubChem CID | 23669624 |
|---|---|
| CAS | 5324-84-5 |
| Molecular Weight (g/mol) | 216.27 |
| MDL Number | MFCD00007544 |
| SMILES | [Na+].CCCCCCCCS([O-])(=O)=O |
| Synonym | sodium 1-octanesulfonate,sodium octane-1-sulfonate,1-octanesulfonic acid sodium salt,sodium octanesulfonate,1-octanesulfonic acid, sodium salt,1-octanesulfonate, sodium,sodium octylsulfonate,unii-j46ez5jyb3,octyl sodium sulfonate,ipc-alks-8 |
| IUPAC Name | sodium octane-1-sulfonate |
| InChI Key | HRQDCDQDOPSGBR-UHFFFAOYSA-M |
| Molecular Formula | C8H17NaO3S |
Sodium sulfite, ACS, 98.0% min
CAS: 7757-83-7 Molecular Formula: Na2O3S Molecular Weight (g/mol): 126.037 MDL Number: MFCD00003503 InChI Key: GEHJYWRUCIMESM-UHFFFAOYSA-L Synonym: sodium sulfite,disodium sulfite,sodium sulphite,sodium sulfite anhydrous,sulfurous acid, disodium salt,sulftech,natrium sulfurosum,sodiumsulfite,natriumsulfid,natriumsulfit PubChem CID: 24437 ChEBI: CHEBI:86477 IUPAC Name: disodium;sulfite SMILES: [O-]S(=O)[O-].[Na+].[Na+]
| PubChem CID | 24437 |
|---|---|
| CAS | 7757-83-7 |
| Molecular Weight (g/mol) | 126.037 |
| ChEBI | CHEBI:86477 |
| MDL Number | MFCD00003503 |
| SMILES | [O-]S(=O)[O-].[Na+].[Na+] |
| Synonym | sodium sulfite,disodium sulfite,sodium sulphite,sodium sulfite anhydrous,sulfurous acid, disodium salt,sulftech,natrium sulfurosum,sodiumsulfite,natriumsulfid,natriumsulfit |
| IUPAC Name | disodium;sulfite |
| InChI Key | GEHJYWRUCIMESM-UHFFFAOYSA-L |
| Molecular Formula | Na2O3S |
Lithium iodide, ultra dry, 99.999% (metals basis)
CAS: 10377-51-2 Molecular Formula: ILi Molecular Weight (g/mol): 133.84 MDL Number: MFCD00011092 InChI Key: HSZCZNFXUDYRKD-UHFFFAOYSA-M Synonym: lithium iodide,lithium iodide, anhydrous,unii-s6k2xet783,lithium iodide 6lii,lithium 1+ ion iodide,lithium iodide, ultra dry,lithium iodide 7lii,lithiumiodide,lithium monoiodide PubChem CID: 66321 SMILES: [Li+].[I-]
| PubChem CID | 66321 |
|---|---|
| CAS | 10377-51-2 |
| Molecular Weight (g/mol) | 133.84 |
| MDL Number | MFCD00011092 |
| SMILES | [Li+].[I-] |
| Synonym | lithium iodide,lithium iodide, anhydrous,unii-s6k2xet783,lithium iodide 6lii,lithium 1+ ion iodide,lithium iodide, ultra dry,lithium iodide 7lii,lithiumiodide,lithium monoiodide |
| InChI Key | HSZCZNFXUDYRKD-UHFFFAOYSA-M |
| Molecular Formula | ILi |